%!PS-Adobe-2.0
%%Creator: dvips(k) 5.86 Copyright 1999 Radical Eye Software
%%Title: p24-EL-Sayed.dvi
%%Pages: 4
%%PageOrder: Ascend
%%BoundingBox: 0 0 612 792
%%DocumentFonts: Helvetica-Bold Helvetica Times-Roman Times-Bold
%%+ Times-Italic Courier Symbol
%%EndComments
%DVIPSWebPage: (www.radicaleye.com)
%DVIPSCommandLine: dvips -t letter -o p24-EL-Sayed.ps p24-EL-Sayed.dvi
%DVIPSParameters: dpi=600, compressed
%DVIPSSource: TeX output 2002.09.21:1329
%%BeginProcSet: texc.pro
%!
/TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S
N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72
mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0
0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{
landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize
mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[
matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round
exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{
statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0]
N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin
/FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array
/BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2
array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N
df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A
definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get
}B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub}
B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr
1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3
1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx
0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx
sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{
rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp
gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B
/chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{
/cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{
A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy
get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse}
ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp
fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17
{2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add
chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{
1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop}
forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn
/BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put
}if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{
bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A
mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{
SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{
userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X
1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4
index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N
/p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{
/Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT)
(LaserWriter 16/600)]{A length product length le{A length product exch 0
exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse
end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask
grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot}
imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round
exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto
fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p
delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M}
B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{
p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S
rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end
%%EndProcSet
%%BeginProcSet: 8r.enc
% @@psencodingfile@{
% author = "S. Rahtz, P. MacKay, Alan Jeffrey, B. Horn, K. Berry",
% version = "0.6",
% date = "1 July 1998",
% filename = "8r.enc",
% email = "tex-fonts@@tug.org",
% docstring = "Encoding for TrueType or Type 1 fonts
% to be used with TeX."
% @}
%
% Idea is to have all the characters normally included in Type 1 fonts
% available for typesetting. This is effectively the characters in Adobe
% Standard Encoding + ISO Latin 1 + extra characters from Lucida.
%
% Character code assignments were made as follows:
%
% (1) the Windows ANSI characters are almost all in their Windows ANSI
% positions, because some Windows users cannot easily reencode the
% fonts, and it makes no difference on other systems. The only Windows
% ANSI characters not available are those that make no sense for
% typesetting -- rubout (127 decimal), nobreakspace (160), softhyphen
% (173). quotesingle and grave are moved just because it's such an
% irritation not having them in TeX positions.
%
% (2) Remaining characters are assigned arbitrarily to the lower part
% of the range, avoiding 0, 10 and 13 in case we meet dumb software.
%
% (3) Y&Y Lucida Bright includes some extra text characters; in the
% hopes that other PostScript fonts, perhaps created for public
% consumption, will include them, they are included starting at 0x12.
%
% (4) Remaining positions left undefined are for use in (hopefully)
% upward-compatible revisions, if someday more characters are generally
% available.
%
% (5) hyphen appears twice for compatibility with both
% ASCII and Windows.
%
/TeXBase1Encoding [
% 0x00 (encoded characters from Adobe Standard not in Windows 3.1)
/.notdef /dotaccent /fi /fl
/fraction /hungarumlaut /Lslash /lslash
/ogonek /ring /.notdef
/breve /minus /.notdef
% These are the only two remaining unencoded characters, so may as
% well include them.
/Zcaron /zcaron
% 0x10
/caron /dotlessi
% (unusual TeX characters available in, e.g., Lucida Bright)
/dotlessj /ff /ffi /ffl
/.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef
% very contentious; it's so painful not having quoteleft and quoteright
% at 96 and 145 that we move the things normally found there to here.
/grave /quotesingle
% 0x20 (ASCII begins)
/space /exclam /quotedbl /numbersign
/dollar /percent /ampersand /quoteright
/parenleft /parenright /asterisk /plus /comma /hyphen /period /slash
% 0x30
/zero /one /two /three /four /five /six /seven
/eight /nine /colon /semicolon /less /equal /greater /question
% 0x40
/at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O
% 0x50
/P /Q /R /S /T /U /V /W
/X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore
% 0x60
/quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o
% 0x70
/p /q /r /s /t /u /v /w
/x /y /z /braceleft /bar /braceright /asciitilde
/.notdef % rubout; ASCII ends
% 0x80
/.notdef /.notdef /quotesinglbase /florin
/quotedblbase /ellipsis /dagger /daggerdbl
/circumflex /perthousand /Scaron /guilsinglleft
/OE /.notdef /.notdef /.notdef
% 0x90
/.notdef /.notdef /.notdef /quotedblleft
/quotedblright /bullet /endash /emdash
/tilde /trademark /scaron /guilsinglright
/oe /.notdef /.notdef /Ydieresis
% 0xA0
/.notdef % nobreakspace
/exclamdown /cent /sterling
/currency /yen /brokenbar /section
/dieresis /copyright /ordfeminine /guillemotleft
/logicalnot
/hyphen % Y&Y (also at 45); Windows' softhyphen
/registered
/macron
% 0xD0
/degree /plusminus /twosuperior /threesuperior
/acute /mu /paragraph /periodcentered
/cedilla /onesuperior /ordmasculine /guillemotright
/onequarter /onehalf /threequarters /questiondown
% 0xC0
/Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla
/Egrave /Eacute /Ecircumflex /Edieresis
/Igrave /Iacute /Icircumflex /Idieresis
% 0xD0
/Eth /Ntilde /Ograve /Oacute
/Ocircumflex /Otilde /Odieresis /multiply
/Oslash /Ugrave /Uacute /Ucircumflex
/Udieresis /Yacute /Thorn /germandbls
% 0xE0
/agrave /aacute /acircumflex /atilde
/adieresis /aring /ae /ccedilla
/egrave /eacute /ecircumflex /edieresis
/igrave /iacute /icircumflex /idieresis
% 0xF0
/eth /ntilde /ograve /oacute
/ocircumflex /otilde /odieresis /divide
/oslash /ugrave /uacute /ucircumflex
/udieresis /yacute /thorn /ydieresis
] def
%%EndProcSet
%%BeginProcSet: texps.pro
%!
TeXDict begin/rf{findfont dup length 1 add dict begin{1 index/FID ne 2
index/UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll
exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]/Metrics
exch def dict begin Encoding{exch dup type/integertype ne{pop pop 1 sub
dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get div def}
ifelse}forall Metrics/Metrics currentdict end def[2 index currentdict
end definefont 3 -1 roll makefont/setfont cvx]cvx def}def/ObliqueSlant{
dup sin S cos div neg}B/SlantFont{4 index mul add}def/ExtendFont{3 -1
roll mul exch}def/ReEncodeFont{CharStrings rcheck{/Encoding false def
dup[exch{dup CharStrings exch known not{pop/.notdef/Encoding true def}
if}forall Encoding{]exch pop}{cleartomark}ifelse}if/Encoding exch def}
def end
%%EndProcSet
%%BeginProcSet: special.pro
%!
TeXDict begin/SDict 200 dict N SDict begin/@SpecialDefaults{/hs 612 N
/vs 792 N/ho 0 N/vo 0 N/hsc 1 N/vsc 1 N/ang 0 N/CLIP 0 N/rwiSeen false N
/rhiSeen false N/letter{}N/note{}N/a4{}N/legal{}N}B/@scaleunit 100 N
/@hscale{@scaleunit div/hsc X}B/@vscale{@scaleunit div/vsc X}B/@hsize{
/hs X/CLIP 1 N}B/@vsize{/vs X/CLIP 1 N}B/@clip{/CLIP 2 N}B/@hoffset{/ho
X}B/@voffset{/vo X}B/@angle{/ang X}B/@rwi{10 div/rwi X/rwiSeen true N}B
/@rhi{10 div/rhi X/rhiSeen true N}B/@llx{/llx X}B/@lly{/lly X}B/@urx{
/urx X}B/@ury{/ury X}B/magscale true def end/@MacSetUp{userdict/md known
{userdict/md get type/dicttype eq{userdict begin md length 10 add md
maxlength ge{/md md dup length 20 add dict copy def}if end md begin
/letter{}N/note{}N/legal{}N/od{txpose 1 0 mtx defaultmatrix dtransform S
atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{
itransform lineto}}{6 -2 roll transform 6 -2 roll transform 6 -2 roll
transform{itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll
curveto}}{{closepath}}pathforall newpath counttomark array astore/gc xdf
pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack}
if}N/txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1
-1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3
get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip
yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub
neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{
noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop
90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get
neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr
1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr
2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4
-1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S
TR}if}N/cp{pop pop showpage pm restore}N end}if}if}N/normalscale{
Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale
}if 0 setgray}N/psfts{S 65781.76 div N}N/startTexFig{/psf$SavedState
save N userdict maxlength dict begin/magscale true def normalscale
currentpoint TR/psf$ury psfts/psf$urx psfts/psf$lly psfts/psf$llx psfts
/psf$y psfts/psf$x psfts currentpoint/psf$cy X/psf$cx X/psf$sx psf$x
psf$urx psf$llx sub div N/psf$sy psf$y psf$ury psf$lly sub div N psf$sx
psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub
TR/showpage{}N/erasepage{}N/copypage{}N/p 3 def @MacSetUp}N/doclip{
psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2
roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath
moveto}N/endTexFig{end psf$SavedState restore}N/@beginspecial{SDict
begin/SpecialSave save N gsave normalscale currentpoint TR
@SpecialDefaults count/ocount X/dcount countdictstack N}N/@setspecial{
CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto
closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx
sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR
}{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse
CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury
lineto closepath clip}if/showpage{}N/erasepage{}N/copypage{}N newpath}N
/@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{end}
repeat grestore SpecialSave restore end}N/@defspecial{SDict begin}N
/@fedspecial{end}B/li{lineto}B/rl{rlineto}B/rc{rcurveto}B/np{/SaveX
currentpoint/SaveY X N 1 setlinecap newpath}N/st{stroke SaveX SaveY
moveto}N/fil{fill SaveX SaveY moveto}N/ellipse{/endangle X/startangle X
/yrad X/xrad X/savematrix matrix currentmatrix N TR xrad yrad scale 0 0
1 startangle endangle arc savematrix setmatrix}N end
%%EndProcSet
TeXDict begin 40258431 52099146 1000 600 600 (p24-EL-Sayed.dvi)
@start /Fa 219[37 36[{.167 SlantFont TeXBase1Encoding ReEncodeFont}1
74.7198 /Times-Roman rf /Fb 206[25 49[{TeXBase1Encoding ReEncodeFont}1
49.8132 /Times-Roman rf
%DVIPSBitmapFont: Fc cmmi6 6 26
/Fc 26 121 df<127812FCA4127806067A8513>58 D<127812FCA212FEA2127E1206A312
0CA2121C121812301260124007107A8513>I<16C01503150FED3F0015FCEC03F0EC0FC0
023FC7FC14FCEB03F0EB0FC0013FC8FC13FCEA03F0EA0FC0003FC9FC12FC12F012FC123F
EA0FC0EA03F0EA00FC133FEB0FC0EB03F0EB00FC143FEC0FC0EC03F0EC00FC153FED0FC0
1503150022237A9D30>I<140C141CA21438A21470A314E0A2EB01C0A2EB0380A3EB0700
A2130EA35BA25BA25BA35BA2485AA3485AA248C7FCA3120EA25AA25AA35AA25AA25A1631
7CA420>I<12C012F012FC123FEA0FC0EA03F0EA00FC133FEB0FC0EB03F0EB00FC143FEC
0FC0EC03F0EC00FC153FED0FC01503150FED3F0015FCEC03F0EC0FC0023FC7FC14FCEB03
F0EB0FC0013FC8FC13FCEA03F0EA0FC0003FC9FC12FC12F012C022237A9D30>I<90B6FC
16E0903907C001F0ED00F84948137C163C163EA249C7123C167CA216F8013EEB01F0ED03
E0ED0F8090393FFFFE005B90397C001F80ED07C0ED03E049EB01F0A2150016F8484814F0
1501A2ED03E04848EB07C0ED0F80ED3F00000714FEB612F815C027227CA12E>66
D<90B512FCEDFF80903907C007C0ED01F090380F800016F8A349C7FCA3ED01F0013E14E0
ED03C0ED0F80ED7E0090387FFFF85D90387C00FC153E5B81A34848133EA448485B1606A2
0007EC3C0CD8FFFEEB3E18ED1FF0C8EA07E027237CA12E>82 D<131FEBFF8C3801E0DE38
03807E3807007C48133C121E123E003C5B127CA3485BA215401560903801E0C012781303
393807E180391C1CF300380FF87F3807E03C1B177E9522>97 DII101
D<13F8EA0FF0A21200A2485AA4485AA4380787E0EB9FF8EBB83CEBE01C380FC01E1380A2
1300001E5BA35C5AA2ECF0201530481460EB01E015C0A239F000E380ECFF000060133C1C
247CA224>104 D<1338137CA2137813701300A7EA0780EA1FC0EA38E01230EA60F0EAC1
E0A3EA03C0A3EA0780A2EA0F0013041306EA1E0CA21318121CEA1E70EA0FE0EA07800F23
7DA116>I<1418143C147CA214381400A7EB0780EB1FE01338EB60F013C0A2EA0180A238
0001E0A4EB03C0A4EB0780A4EB0F00A4131EA21238EA783CEAF8381378EA70F0EA7FC000
1FC7FC162D81A119>I<13F8EA0FF0A21200A2485AA4485AA43807801E147FEB81C3EB83
87380F060F495A1318EB700E4848C7FCA213FCEA1E7EEA3C0F80EB0781158039780F0300
A21402EB070600F0138CEB03F8386000F019247CA221>II<000F017E13FC3A1F81FF83FF3B31C383C707803A61EE03CC039026EC01F8
13C0D8C1F813F013F001E013E00003903903C0078013C0A2EE0F003907800780A2EE1E04
1706270F000F00130C163C1718A2001E011EEB1C70EE1FE0000C010CEB07802F177D9536
>I111
D<3801E01F3903F07FC0390639C1E0390C3F80F0EB3E00001814F8013C137815F8C65AA4
9038F001F0A3EC03E0D801E013C0EBF00715809038F80F003803DC3CEBCFF8EBC7E001C0
C7FC485AA448C8FCA2EA7FF012FF1D20809520>I<380F01F0381FC7F83831CE1CEA61F8
EBF03C00C1137C13E014383803C000A4485AA448C7FCA4121EA2120C16177D951D>114
DI<133013785BA4485AA4485AB51280A23803C000485AA448C7FCA4121EA25B
1480383C03001306A25BEA1C38EA0FF0EA07C011217D9F18>II<3807800E380FE01FEA
38F012300060130F12C01407EAC1E000011306EA03C0A33807800CA214081418A2143014
6014C0EA03C13801FF00EA007E18177D951F>II<3801F0
1E3907FC7F80390E1CE1C038180F8100301383007013071260EC0380D8001EC7FCA45BA2
1580003014C0397878018012F8EC030038F0FC0638E19C1C387F0FF8381E03E01A177D95
23>I E
%EndDVIPSBitmapFont
%DVIPSBitmapFont: Fd cmr6 6 5
/Fd 5 56 df<133013FE3807FF80380F31E0381C307000381338007013180060130C00E0
133C147CA300F0133800F81300127C127FEA3FF0EA1FFE380FFF806C13C0000113E03800
3FF0EB31F8EB3078143C12200070131C12F8A212F000C0131800601338A2003013700038
13E0381E33C03807FF00EA01FCEA0030A216287CA41E>36 D<13E01201120712FF12F912
01B3A7487EB512C0A212217AA01E>49 DI<13
FF000313C0380F03E0381C00F014F8003E13FC147CA2001E13FC120CC712F8A2EB01F0EB
03E0EB0FC03801FF00A2380003E0EB00F01478147C143E143F1230127812FCA2143E4813
7E0060137C003813F8381E03F0380FFFC00001130018227DA01E>I<1230123C003FB5FC
A24813FE14FC386000181430A248136014C038000180EB0300A213065BA2131C5BA31378
137013F0A41201A76C5A18237CA11E>55 D E
%EndDVIPSBitmapFont
%DVIPSBitmapFont: Fe cmr9 9 3
/Fe 3 62 df<14C01301EB03005B130E5B5B137813705B12015B1203485AA248C7FCA312
1EA3123E123CA2127CA4127812F8B01278127CA4123CA2123E121EA37EA36C7EA26C7E12
017F12001370137813387F7F7F7FEB01C01300124A79B71E>40 D<7E7E126012707E7E7E
120F7E6C7E7F12017F6C7EA21378A37FA3133E131EA2131FA47F1480B014005BA4131EA2
133E133CA35BA35BA2485A5B12035B48C7FC5A120E5A5A5A12605A5A114A7BB71E>I<00
7FB812C0B912E0A26C17C0CCFCAC007FB812C0B912E0A26C17C033147C9C3C>61
D E
%EndDVIPSBitmapFont
%DVIPSBitmapFont: Ff cmmi9 9 30
/Ff 30 120 df<151015185DA45DA45DA44A5AA44AC7FCEC3FE0903801FFFC903807E31F
90391F060780017CEB01C001F0EB00E0D801E014F04848481378EA0780D80F00147C4815
3C003E5BA25A167C485BA44A13F85AED01F0A29138C003E06C15C00078EC0780ED0F0039
3C01801E001C5C000E14F839078183E03903E31F802600FFFEC7FCEB1FF00103C8FC1306
A45BA45BA45B131026447CB32E>30 D<123C127E12FFA4127E123C08087A8715>58
D<123C127EB4FCA21380A2127F123D1201A4EA0300A31206A35A5A5A1270122009177A87
15>I<171C177EEE01FEEE07FCEE1FF0EE7FC0923801FF00ED07FCED1FF0ED7FC04A48C7
FCEC07FCEC1FF0EC7FC04948C8FCEB07FCEB1FF0EB7FC04848C9FCEA07FCEA1FF0EA7FC0
48CAFCA2EA7FC0EA1FF0EA07FCEA01FF38007FC0EB1FF0EB07FCEB01FF9038007FC0EC1F
F0EC07FCEC01FF9138007FC0ED1FF0ED07FCED01FF9238007FC0EE1FF0EE07FCEE01FEEE
007E171C2F2E7AA93C>I<127012FCB4FCEA7FC0EA1FF0EA07FCEA01FF38007FC0EB1FF0
EB07FCEB01FF9038007FC0EC1FF0EC07FCEC01FF9138007FC0ED1FF0ED07FCED01FF9238
007FC0EE1FF0EE07FCEE01FEA2EE07FCEE1FF0EE7FC0923801FF00ED07FCED1FF0ED7FC0
4A48C7FCEC07FCEC1FF0EC7FC04948C8FCEB07FCEB1FF0EB7FC04848C9FCEA07FCEA1FF0
EA7FC048CAFC12FC12702F2E7AA93C>62 D<16035E5EA24C7EA2163F167FA216DFA2ED01
9FED031F831506160F150C1518A215301570156015C0839138018007140315001406A25C
141C14184A801603027FB5FC91B6FC9138C00003495AA249C7FC1306835B16015B5BA25B
13E0A21203D80FF04A7ED8FFFE91387FFFE0A233367DB53A>65 D<0107B612F017FE903B
001F80003F80EF0FE0EF07F04AC71203EF01F8A218FC147EA44A15F8170318F017074948
EC0FE018C0EF3F80EF7F004948EB01FCEE07F891B612C05F903A07E0001FF0EE01F8EE00
FE177F4948801880171F18C0495AA449C81380173FA2EF7F00137E17FE4C5A4C5A494A5A
4C5AEE3F800001DA01FEC7FCB712F816C036337DB23A>I<90260FFF80903807FFFC81D9
001F9138003F806FEC1E00181C1437DA33F01418A2EC31F802615DEC60FCA3DAC07E5CA2
81A2D901805D6F7EA26F7ED903004A5AED07E0A301066D6C48C7FCA2ED01F8A249903800
FC06A3167E495D163FA2EE1F8C491598A2EE0FD8A249EC07F0A3160301E05D16011201D8
07F01400B55D17403E337CB23D>78 D<0107B612E017FC903A001F8000FFEF1F80EF0FC0
4AC7EA07E018F01703A2027E15F8A44AEC07F0A3EF0FE0495AEF1FC01880EF3F00494814
7E5FEE03F0EE1FC049B6C7FC16F002E0C9FCA2495AA4495AA449CAFCA4137EA45BA31201
B512F0A235337CB231>80 D<010FB67E17F0903A001F8001FCEE007FEF1F804AC7EA0FC0
A2EF07E0A2027E15F0A44AEC0FE0A3EF1FC049481580EF3F00177E5F4948495AEE07E0EE
7F8091B500FCC7FC4914F09138E000FC163E8249486D7EA283A2495AA449C7121FA35F01
7E143FA2180CA2491618A218300001031F1360B500F0010F13E0933807C1C0C93803FF00
EE00FE36357CB23A>82 D<03FF1318020713E091391F00F038023CEB187002F0EB0CF0D9
01C013074948130349C713E01601130E131E011C15C0133CA3017C1580A3017E91C7FCA2
7F14C014F86DB47E6D13F86D13FF6D806D80D9003F7F02037F9138003FF8150715016F7E
A2167CA21208120C481578A31670003815F05E003C14015E007C4A5A007E4AC7FC007B14
0E6D5BD8F1E0137839E07C03E039C01FFF80268003FEC8FC2D377CB42F>I<0007B812C0
5A903AE000FC001F01801503001EC7FC001C4948130100181780123812304A5A12701260
EF03004A5A5AA2481602C7484890C7FCA44A5AA44AC9FCA4147EA45CA4495AA4495AA449
5AA3EB1FF0003FB512F0A232337EB22D>I<267FFFFC90383FFFE0A2C648C73801FC0049
EC00F05F485A5FA348484A5AA448484AC7FCA448481406A448485CA448C85AA4007E5DA4
485DA35EA25A4B5AA24BC8FC1506127C5D5D003C5C6C14E06C495A26078007C9FC3803E0
3E3800FFF8EB3FC033357AB234>I97 D<147F903803FFC090380FC0E090381E0030017C13
384913F83801F0013803E003EA07C015F0390F8001E0001F90C7FC90C8FC5AA2127EA412
7C12FCA2127CA21508150C15186C1430001E14E0EC01C06CEB0F003807C07E3801FFF038
007F801E227EA021>99 DI<14FE
EB07FF90381F03C0EB7C0001F013E0485A485A1207485A48C7FC48EB01C0EC0380007EEB
0F0014FE387FFFF8B5128000FCC8FCA45AA4151000781418007C14301560003CEB01C06C
EB0380000EEB1E00380780FC3803FFE0C690C7FC1D227DA024>I103 D
105 D107 D<133EEA07FF13FEEA003EA3137CA413
F8A4EA01F0A4EA03E0A4EA07C0A4EA0F80A4EA1F00A4123EA45AA213041306EAF80CA313
18A212F0133012781360EA3FC0EA0F8010357DB317>III<147F903803FFC090380FC1
F090381E0078017C7F5B48487F4848131F485AA2485A121F90C713805A1600007E5CA400
7C147E12FC157C007C14FC5D4A5AA24A5A003C495A6C495A4AC7FC6C133C3807C1F83801
FFE06C6CC8FC21227EA025>I<013E133F017FEBFFC09039C381C1E03A0183C700F002EE
13F8260303F81378167C00065B5CA2167E48485A12041200167C494813FCA490391F0001
F8A216F01503013E14E0A2ED07C0ED0F80017E1400017F131E5D90387D80789038F8C1F0
EC7FC06EC7FC91C8FC485AA4485AA4485AA3EAFFFEA2273082A027>I<3903E003E03907
F00FF8390C383C1C39183C703C90383EC07E003014FEEB3F800060EB00FC15F8013E1370
1500485A12401200A25BA4485AA4485AA4485AA4485AA26CC8FC1F227EA023>114
DI<1306130F5BA3133EA45BA45BA2B512F8A23801F000A4485AA4485AA4
485AA448C7FCA214101418003E1330A21460A214C0383C0180EB0300EA1E06131CEA0FF8
EA03E015307EAE1C>I<01F8130ED803FC131FD8070E1480D80C0F133F151F0018EB800F
1230EC0007485A1503133E00C015001240C65AA215065BA25D485AA25DA25D5B5DA26D5B
4A5A1200D97807C7FCEB3C1EEB1FF8EB07E021227EA025>118 D<01F81507D803FC9039
01800F80D8070ED903C013C0D80C0F0107131F170F00180180140712309139000F800348
5A1701133E00C0DA1F0013801240C65AA2033EEB03005BA34848491306A35FA24901785B
A26D01F85BA24A6C5B000002BC5B903A78031E018090273E0E0F07C7FC90391FFC07FE90
3903F001F832227EA037>I E
%EndDVIPSBitmapFont
/Fg 134[35 35 35 35 35 35 35 35 1[35 35 35 35 35 35 1[35
35 35 35 35 35 35 35 35 1[35 6[35 35 1[35 35 35 35 1[35
35 35 35 35 35 1[35 35 35 35 35 35 35 35 35 2[35 35 35
2[35 4[35 1[35 35 35 35 35 35 35 2[35 35 3[35 1[35 34[{
TeXBase1Encoding ReEncodeFont}61 58.1154 /Courier rf
/Fh 168[55 9[55 3[22 4[48 17[33 1[33 3[17 4[22 39[{
TeXBase1Encoding ReEncodeFont}8 66.4176 /Times-Italic
rf /Fi 82[22 22[33 28[33 1[48 33 33 18 26 22 33 33 33
33 52 18 33 1[18 33 33 22 29 33 29 33 29 10[48 48 41
37 2[37 1[48 59 41 8[44 1[48 7[33 33 2[33 33 33 33 33
33 18 17 1[17 41[37 2[{TeXBase1Encoding ReEncodeFont}47
66.4176 /Times-Roman rf /Fj 133[29 33 33 50 33 37 21
29 29 1[37 37 37 54 21 33 1[21 37 37 21 33 37 33 37 37
3[29 1[29 2[46 62 46 1[42 37 46 54 46 54 50 62 42 50
33 25 1[54 1[46 54 50 46 46 3[50 2[25 1[37 4[37 37 37
1[21 19 1[19 2[25 25 25 39[{TeXBase1Encoding ReEncodeFont}59
74.7198 /Times-Italic rf /Fk 133[33 37 37 54 37 42 25
29 33 42 42 37 42 62 21 42 1[21 42 37 25 33 42 33 42
37 8[54 1[54 54 50 2[58 46 2[71 50 2[29 2[46 50 54 54
1[54 6[25 1[37 37 37 37 37 37 37 37 2[19 4[25 25 37[42
2[{TeXBase1Encoding ReEncodeFont}52 74.7198 /Times-Bold
rf /Fl 134[50 50 72 50 55 33 39 44 1[55 50 55 83 28 1[33
28 1[50 33 44 55 44 55 50 7[72 72 2[72 66 55 72 1[61
78 72 94 66 78 1[39 1[78 61 66 72 72 66 72 10[50 50 50
50 50 50 2[25 46[{TeXBase1Encoding ReEncodeFont}49 99.6264
/Times-Bold rf /Fm 104[75 37 1[33 25[33 37 37 54 37 37
21 29 25 37 37 37 37 58 21 37 21 21 37 37 25 33 37 33
37 33 3[25 1[25 46 54 54 71 54 54 46 42 50 54 42 54 54
66 46 54 29 25 54 54 42 46 54 50 50 54 69 2[42 1[21 21
37 37 37 37 37 37 37 37 37 37 21 19 25 19 2[25 25 25
1[62 37 2[25 29[42 42 2[{TeXBase1Encoding ReEncodeFont}83
74.7198 /Times-Roman rf /Fn 82[33 51[50 3[55 28 50 33
1[55 55 55 83 22 50 1[22 55 55 28 55 55 50 1[55 9[94
3[66 72 1[66 2[83 55 2[28 3[66 72 72 1[66 7[55 55 1[55
3[55 55 55 1[28 1[28 44[{TeXBase1Encoding ReEncodeFont}39
99.6264 /Helvetica rf
%DVIPSBitmapFont: Fo cmsy9 9 6
/Fo 6 107 df<130EA7006014C000F8EB03E000FC130700FE130F393F8E3F80390FCE7E
003803FFF8C613E0EB3F80A2EBFFE0000313F8380FCE7E393F8E3F8039FE0E0FE000FC13
0700F813030060EB00C000001400A71B207BA226>3 D15 D<171C177EEE01FEEE07FCEE1FF0EE7FC0923801FF00ED
07FCED1FF0ED7FC04A48C7FCEC07FCEC1FF0EC7FC04948C8FCEB07FCEB1FF0EB7FC04848
C9FCEA07FCEA1FF0EA7FC048CAFCA2EA7FC0EA1FF0EA07FCEA01FF38007FC0EB1FF0EB07
FCEB01FF9038007FC0EC1FF0EC07FCEC01FF9138007FC0ED1FF0ED07FCED01FF9238007F
C0EE1FF0EE07FCEE01FEEE007E171C1700AC007FB712FCB812FEA26C16FC2F3E7AB03C>
20 D102 D<127CB47EEA07E0EA01F0EA00787F133E7FB3A66D7EA26D7E6D7EEB
01F89038007FC0EC1FE0EC7FC0903801F800EB03E0495A495AA249C7FCB3A6133E133C5B
485AEA07E0EAFF80007CC8FC1B4B7BB726>I<126012F0B3B3B3B31260044B78B715>106
D E
%EndDVIPSBitmapFont
/Fp 133[75 83 1[116 1[91 50 83 58 1[91 91 91 133 42 2[42
91 91 50 83 91 83 91 83 8[100 1[100 4[116 3[124 3[42
7[108 65[{TeXBase1Encoding ReEncodeFont}27 149.44 /Helvetica-Bold
rf end
%%EndProlog
%%BeginSetup
%%Feature: *Resolution 600dpi
TeXDict begin
%%BeginPaperSize: Letter
letter
%%EndPaperSize
%%EndSetup
%%Page: 1 1
1 0 bop -12 107 a Fp(An)42 b(Alg)q(ebraic)g(Appr)m(oac)o(h)g(f)m(or)g
(Incremental)f(Maintenance)i(of)953 273 y(Materializ)q(ed)f(XQuer)q(y)g
(Vie)n(ws)2848 198 y Fo(\003)382 611 y Fn(Maged)29 b(EL\255Sa)m(y)n
(ed,)h(Ling)f(W)l(ang,)f(Luping)i(Ding,)e(and)h(Elk)n(e)g(A.)f
(Rundensteiner)493 710 y(Depar)t(tment)h(of)e(Computer)j(Science)o(,)e
(W)m(orcester)g(P)-5 b(olytechnic)30 b(Institute)1335
807 y(W)m(orcester)-5 b(,)29 b(MA)f(01609\2552280)1244
894 y Fo(f)p Fm(maged)p Fo(j)p Fm(lingw)p Fo(j)p Fm(lisading)p
Fo(j)p Fm(rundenst)p Fo(g)p Fm(@cs.wpi.edu)-152 1202
y Fl(ABSTRA)-5 b(CT)-152 1322 y Fm(Modern)16 b(data)f(sources,)h
(including)f(structural)g(and)g(semi-structural)f(sources,)-152
1409 y(often)31 b(e)o(xport)g(XML)f(vie)n(ws)h(o)o(v)o(er)g(base)g
(data,)i(and)e(at)g(times)f(may)h(ma-)-152 1496 y(terialize)d(their)g
(vie)n(ws)h(by)g(storing)f(the)h(XML)f(query)h(result)f(to)h(pro)o
(vide)-152 1583 y(f)o(aster)22 b(data)g(access.)31 b(It)21
b(is)g(typically)h(more)g(ef)n(\002cient)f(to)g(maintain)h(a)f(vie)n(w)
-152 1671 y(by)30 b(incrementally)h(propagating)g(the)e(base)h(changes)
h(to)f(the)f(vie)n(w)h(than)-152 1758 y(by)d(re-computing)h(it)d(from)i
(scratch.)45 b(T)-5 b(echniques)28 b(for)e(the)g(incremental)-152
1845 y(maintenance)i(of)e(relational)g(vie)n(ws)h(ha)o(v)o(e)f(been)i
(e)o(xtensi)n(v)o(ely)f(studied)g(in)-152 1932 y(the)h(literature.)50
b(Ho)n(we)n(v)o(er)m(,)31 b(the)d(maintenance)h(of)f(vie)n(ws)g
(created)h(using)-152 2019 y(XQuery)24 b(is)f(as)g(of)g(no)n(w)h(une)o
(xplored.)37 b(In)23 b(this)g(paper)h(we)f(propose)i(an)e(al-)-152
2107 y(gebraic)29 b(approach)g(for)f(incremental)h(XQuery)f(vie)n(w)g
(maintenance.)52 b(In)-152 2194 y(our)24 b(approach,)j(an)d(update)g
(to)g(the)g(XML)f(source)i(is)e(transformed)i(into)f(a)-152
2281 y(set)18 b(of)g(well)g(de\002ned)h(update)g(primiti)n(v)o(es)f
(which)h(are)f(propagated)h(through)-152 2368 y(the)24
b(XML)f(algebra)h(tree.)36 b(This)23 b(algebraic)h(update)g
(propagation)h(process)-152 2455 y(generates)e(incremental)f(update)h
(primiti)n(v)o(es)f(to)g(be)g(applied)g(to)g(the)g(result)-152
2542 y(vie)n(w)-5 b(.)55 b(W)-6 b(e)29 b(brie\003y)g(discuss)h(our)f
(XQuery)h(vie)n(w)g(maintenance)g(system)-152 2630 y(implementation.)49
b(Our)28 b(e)o(xperiments)g(con\002rm)f(that)h(incremental)f(vie)n(w)
-152 2717 y(maintenance)21 b(is)d(indeed)i(f)o(aster)f(than)g
(re-computation.)-152 2861 y Fl(Categories)25 b(and)g(Subject)i
(Descriptors)-152 2981 y Fm(H.2.3)i([)p Fk(Database)h(Management)p
Fm(]:)43 b(Languages\227)p Fj(Query)31 b(langua)o(g)o(es)p
Fm(;)-152 3069 y(H.2.4)19 b([)p Fk(Database)g(Management)p
Fm(]:)k(Systems\227)p Fj(Query)d(pr)m(ocessing)-152 3213
y Fl(General)25 b(T)-9 b(erms)-152 3333 y Fm(Management,)21
b(Algorithms,)e(Performance)-152 3477 y Fl(K)n(eyw)o(ords)-152
3598 y Fm(XML,)g(XML)f(Query)i(Algebra,)f(Incremental)g(V)l(ie)n(w)g
(Maintenance)-152 3754 y Fl(1.)100 b(INTR)m(ODUCTION)-77
3862 y Fm(Database)25 b(vie)n(ws)g(ha)o(v)o(e)g(been)h(recognized)g(as)
f(an)g(important)g(technol-)-152 3949 y(ogy)k(for)e(data)h(w)o
(arehousing,)j(information)d(inte)o(gration)g(and)g(interoper)o(-)-152
4036 y(ability)-5 b(.)23 b(V)l(ie)n(ws)17 b(are)g(frequently)i
(materialized)e(to)h(speed)g(up)g(querying)h([4],)-152
4124 y(which)28 b(is)e(critical)h(for)g(applications)h(where)f(the)g
(data)g(is)g(remote)g(or)h(the)-152 4211 y(response)f(time)e(is)f
(critical.)42 b(Ho)n(we)n(v)o(er)25 b(materialized)h(vie)n(ws)f(need)h
(to)f(be)-152 4298 y(maintained)30 b(upon)g(updates)f(to)g(the)g(base)g
(data)g(in)f(order)h(to)g(k)o(eep)g(them)p -152 4365
797 4 v -152 4421 a Fo(\003)-113 4454 y Fm(This)34 b(w)o(ork)h(w)o(as)g
(supported)h(in)f(part)f(by)h(the)g(NSF)f(NYI)g(grant)h(IIS-)-152
4529 y(979624)21 b(and)f(the)f(NSF)e(grant)j(IIS-9988776.)-152
4873 y Fi(Permission)26 b(to)f(mak)o(e)h(digital)i(or)d(hard)g(copies)i
(of)e(all)h(or)f(part)g(of)g(this)h(w)o(ork)f(for)-152
4948 y(personal)f(or)f(classroom)g(use)f(is)g(granted)j(without)e(fee)h
(pro)o(vided)g(that)f(copies)h(are)-152 5022 y(not)c(made)f(or)g
(distrib)o(uted)i(for)e(pro\002t)g(or)g(commercial)i(adv)n(antage)h
(and)d(that)h(copies)-152 5097 y(bear)e(this)f(notice)i(and)e(the)g
(full)h(citation)h(on)e(the)g(\002rst)g(page.)25 b(T)-5
b(o)15 b(cop)o(y)j(otherwise,)g(to)-152 5172 y(republish,)g(to)e(post)f
(on)h(serv)o(ers)g(or)g(to)g(redistrib)o(ute)i(to)e(lists,)g(requires)i
(prior)e(speci\002c)-152 5246 y(permission)i(and/or)h(a)e(fee.)-152
5321 y Fh(WIDM'02,)h Fi(No)o(v)o(ember)g(4\2269,)f(2002,)g(McLean,)g(V)
l(ir)o(ginia,)i(USA.)-152 5396 y(Cop)o(yright)h(2002)d(A)m(CM)g
(1\25558113\255492\2554/02/0011)22 b(...)p Fm($)p Fi(5.00.)2040
1202 y Fm(consistent)29 b(with)f(the)g(base)h(data.)51
b(T)-5 b(echniques)29 b(for)f(vie)n(w)g(maintenance)2040
1289 y(ha)o(v)o(e)i(been)g(studied)h(e)o(xtensi)n(v)o(ely)f(in)g(the)f
(literature)h(for)f(relational)h(and)2040 1376 y(object-oriented)23
b(databases)g([6].)31 b(Incremental)22 b(vie)n(w)g(maintenance,)i(that)
2040 1463 y(is,)15 b(instead)h(of)f(re-computing)i(the)f(whole)f(vie)n
(w)-5 b(,)16 b(just)f(computing)i(the)e(delta)2040 1550
y(change)20 b(to)e(a)g(vie)n(w)h(in)f(response)i(to)e(a)g(change)i(of)e
(the)h(base)f(data,)h(has)g(been)2040 1637 y(sho)n(wn)h(to)f(be)g(an)g
(ef)n(fecti)n(v)o(e)g(solution)h([7,)f(8].)2115 1725
y(As)d(XML)g(is)g(becoming)i(the)f(standard)g(for)f(data)h(e)o(xchange)
h(o)o(v)o(er)f(the)g(In-)2040 1812 y(ternet,)h(publishing)h(data)f
(from)g(dif)n(ferent)g(data)h(sources)f(into)g(XML)g(vie)n(ws)2040
1899 y(has)k(also)f(become)h(increasingly)g(popular)g(in)f(recent)h
(years)f([2,)h(9].)29 b(Ho)n(w-)2040 1986 y(e)n(v)o(er)23
b(vie)n(w)f(maintenance)h(of)f(XML)g(vie)n(ws)h(has)f(recei)n(v)o(ed)h
(little)e(attention)2040 2073 y(so)26 b(f)o(ar)l(.)42
b(Unlik)o(e)26 b(relational)f(data,)i(XML)e(data)g(corresponds)j(to)d
(ordered,)2040 2160 y(nested)f(hierarchical)g(structures.)37
b(Furthermore)24 b(XML)f(vie)n(ws)h(allo)n(w)g(for)2040
2248 y(arbitrarily)d(comple)o(x)h(result)f(re-structuring.)30
b(As)21 b(a)g(consequence,)i(incre-)2040 2335 y(mental)j(maintenance)h
(of)e(XML)h(vie)n(ws)f(is)h(lik)o(ely)f(to)h(be)g(more)f(comple)o(x)
2040 2422 y(than)19 b(that)g(of)g(their)g(relational)g(counterparts.)
2115 2509 y(Recently)-5 b(,)35 b([1])c(has)h(proposed)i(an)e
(incremental)g(maintenance)h(algo-)2040 2596 y(rithm)27
b(for)g(materialized)h(vie)n(ws)f(o)o(v)o(er)h(semi-structured)f(data,)
j(based)e(on)2040 2684 y(the)f(graph-based)i(data)e(model)g(OEM)g(and)g
(the)g(query)h(language)g(Lorel.)2040 2771 y(Our)19 b(w)o(ork)h
(instead)g(is)f(based)h(on)g(the)f(XQuery)g(language,)i(a)e
(full-featured)2040 2858 y(SQL-style)28 b(XML)h(query)h(language)g
(that)f(has)g(become)h(a)f(W)-6 b(orld)29 b(W)m(ide)2040
2945 y(W)-6 b(eb)27 b(Consortium)h(\(W3C\))e(recommendation.)50
b([10])27 b(describes)h(an)f(e)o(x-)2040 3032 y(tension)18
b(of)g(the)f(XQuery)h(language)h(to)e(support)i(XML)e(updating,)i(and)f
(im-)2040 3119 y(plements)27 b(these)g(operations)g(using)g(relational)
f(technology)-5 b(.)47 b(In)26 b([3],)i(an)2040 3207
y(ef)n(\002cient)g(maintenance)i(technique)g(for)e(materialized)h(vie)n
(ws)f(o)o(v)o(er)h(web)2040 3294 y(data)21 b(w)o(as)f(proposed,)i
(using)f(XQL,)e(thus)i(limited)f(to)g(vie)n(ws)g(in)h(XP)o(ath)e(e)o
(x-)2040 3381 y(pressions.)2115 3468 y(While)c(man)o(y)h(systems)g
(emplo)o(y)h(XQuery)f(vie)n(ws)g([2,)g(9,)g(13],)h(to)e(the)h(best)2040
3555 y(of)25 b(our)h(kno)n(wledge,)i(no)e(solution)f(as)h(of)f(no)n(w)h
(handles)g(maintenance)g(of)2040 3642 y(materialized)17
b(XQuery)h(vie)n(ws.)23 b(In)17 b(this)g(paper)g(we)g(propose)i(the)e
(\002rst)f(solu-)2040 3730 y(tion)j(for)g(incremental)g(XQuery)h(vie)n
(w)f(maintenance.)24 b(W)-6 b(e)19 b(ha)o(v)o(e)g(designed)2040
3817 y(an)30 b(algebraic)h(solution)f(approach)h(based)g(on)f(the)g(XA)
-8 b(T)29 b(XML)h(algebra)2040 3904 y([13].)23 b(In)c(our)f(approach,)i
(an)f(update)g(to)f(the)g(XML)h(source)g(is)f(transformed)2040
3991 y(into)g(a)g(set)g(of)g(well)f(de\002ned)i(update)f(primiti)n(v)o
(es)g(to)g(be)g(propagated)i(trough)2040 4078 y(the)i(algebra)g(tree.)
32 b(Our)21 b(w)o(ork)h(mak)o(es)h(the)f(follo)n(wing)g(contrib)o
(utions:)30 b(\(1\))2040 4165 y(Proposal)h(of)g(a)g(set)g(of)f(update)i
(primiti)n(v)o(es)f(for)g(updating)h(XML)e(docu-)2040
4253 y(ments.)g(\(2\))21 b(General)h(strate)o(gy)f(for)h(XML)f(vie)n(w)
g(maintenance,)i(based)f(on)2040 4340 y(an)e(algebraic)g(approach)h
(for)e(incremental)h(update)g(re)n(writing.)k(\(3\))19
b(Imple-)2040 4427 y(mentation)j(of)g(the)f(vie)n(w)h(maintainer)g(as)g
(e)o(xtension)g(of)g(Rainbo)n(w)g(system)2040 4514 y([13].)h(\(4\))c
(Preliminary)f(results)h(con\002rming)g(that)g(our)g(update)g
(propagator)2040 4601 y(is)g(indeed)g(more)h(ef)n(\002cient)e(than)i
(re-computation.)2040 4747 y Fl(2.)99 b(B)m(A)-5 b(CKGR)m(OUND)2115
4855 y Fk(XML)19 b(Fundamentals.)26 b Fm(Figures)20 b(1)h(and)f(2)h
(sho)n(w)g(our)g(running)g(e)o(xam-)2040 4942 y(ple)h(of)h(tw)o(o)f
(XML)g(documents)i(on)e(books)i(and)f(re)n(vie)n(ws.)33
b(An)22 b Fj(XML)g(vie)o(w)2040 5029 y Fm(is)d(a)h(deri)n(v)o(ed)g(XML)
g(fragment)g(de\002ned)g(by)g(an)g(XML)f(query)-5 b(,)21
b(in)e(our)h(case,)2040 5116 y(using)27 b(the)f(XQuery)g(language.)46
b(Figure)26 b(3)g(sho)n(ws)h(the)f(vie)n(w)g(query)h(that)2040
5203 y(retrie)n(v)o(es)h(books)i(published)f(by)g(\224Mor)o(gan)g
(Kaufman)g(Publishers\224)g(and)2040 5290 y(their)f(respecti)n(v)o(e)h
(re)n(vie)n(ws.)52 b(A)28 b Fj(materialized)h(XML)e(vie)o(w)h
Fm(refers)g(to)g(the)2040 5378 y(stored)d(deri)n(v)o(ed)h(XML)e(data.)
41 b(Figure)24 b(4)h(sho)n(ws)g(the)g(materialized)g(XML)p
eop
%%Page: 2 2
2 1 bop -152 -69 a Fm(vie)n(w)18 b(generated)h(by)g(applying)g(the)f
(vie)n(w)g(query)h(in)e(Figure)h(3)g(to)g(the)g(XML)-152
19 y(documents)j(in)e(Figures)f(1)h(and)h(2.)-152 241
y Fg()-12 308 y()127 374
y(Advanced)f(Programming)h(in)g(the)406 440 y(Unix)h
(environment)127 507 y(Darcy)e(Gerbarg)127
573 y(Addison-Wesley)-12 640 y()-12
706 y()127 772 y(Data)g(on)g(the)h
(Web)127 839 y(Serge)e(Abiteboul)127
905 y(Morgan)g(Kaufmann)h(Publishers)-12
972 y()-12 1038 y()127 1105
y(TCP/IP)f(Illustrated)127 1171 y(W.)h
(Stevens)127 1237 y(Addison-Wesley)-12
1304 y()-152 1370 y()173 1617 y Fk(Figur)o(e)18
b(1:)23 b(Example)c(XML)f(document)g(bib)m(.xml.)-152
1679 y Fg()-12 1745 y()127 1812 y(Data)34
b(on)g(the)h(Web)127 1878 y()f(A)h(very)f(good)h
(discussion)e(of)i(semi-structured)406 1945 y(database)69
b(systems)34 b(and)g(XML)-12 2011 y()-12
2077 y()127 2144 y(Advanced)f(Programming)h(in)g(the)406
2210 y(Unix)h(environment)127 2277 y(A)f(clear)g(and)h
(detailed)e(discussion)h(of)406 2343 y(UNIX)h(programming)-12
2409 y()23 2476 y()127 2542 y(TCP/IP)e
(Illustrated)127 2609 y(One)h(of)g(the)h(best)f(books)g
(on)h(TCP/IP)-12 2675 y()-152 2742 y()104
2988 y Fk(Figur)o(e)18 b(2:)24 b(Example)19 b(XML)f(document)g(r)o(e)o
(views.xml.)-77 3187 y(XML)30 b(Algebra)h(XA)-7 b(T)g(.)31
b Fm(W)-6 b(e)30 b(translate)h(our)h(vie)n(w)f(queries)g(from)h(the)
-152 3275 y(XQuery)17 b(format)g(into)f(algebra)i(e)o(xpressions)f
(based)h(on)f(the)g(XML)f(algebra)-152 3362 y(called)23
b(XA)-8 b(T)21 b([13].)33 b(XA)-8 b(T)21 b(has)i(a)f(set)g(of)g
(well-de\002ned)h(algebra)g(operators)-152 3449 y(called)e(XA)-8
b(T)19 b(operators.)29 b(The)21 b(input)f(and)i(output)f(of)f(each)h
(XA)-8 b(T)20 b(operator)-152 3536 y(are)f(XA)-8 b(T)18
b(tables.)-77 3623 y(An)26 b Fj(XA)m(T)e(table)i Fm(is)g(an)g(order)o
(-sensiti)n(v)o(e)g(table)f(with)h(k)g(columns)g Ff(N)43
b Fe(=)-152 3710 y(\()p Ff(n)-76 3718 y Fd(1)-41 3710
y Ff(;)13 b(n)39 3718 y Fd(2)74 3710 y Ff(;)g(:::;)h(n)252
3719 y Fc(k)291 3710 y Fe(\))j Fm(where)h(each)g(column)g(name)g
Ff(n)1158 3718 y Fc(i)1202 3710 y Fm(\(1)g Fo(\024)f
Fm(i)g Fo(\024)g Fm(k\))g(can)h(be)g(ei-)-152 3798 y(ther)h(a)g(v)n
(ariable)h(binding)g(from)g(the)f(user)o(-speci\002ed)g(XQuery)-5
b(,)20 b(e.g.,)e($b,)i(or)-152 3885 y(an)e(internally)f(generated)h(v)n
(ariable,)g(e.g.,)f Ff(col)1058 3893 y Fd(1)1093 3885
y Fm(.)22 b(The)17 b(XA)-8 b(T)17 b(table)g(contains)-152
3972 y(a)k(sequence)h(of)f(tuples.)29 b(Each)20 b(tuple)h
Ff(t)872 3980 y Fc(j)925 3972 y Fm(is)f(a)h(v)o(ector)g(of)g(cells)f
(of)h(type:)27 b(\(1\))-152 4059 y(atomic)21 b(v)n(alue;)h(\(2\))e
(node)i(including)g(XML)e(Element,)h(XML)f(Document,)-152
4146 y(or)j(XML)g(Attrib)o(ute;)h(or)f(\(3\))g(ordered)h(collection)f
(of)g(an)o(y)h(mixture)f(of)g(\(1\))-152 4233 y(and)18
b(\(2\).)23 b(Figure)17 b(5)g(sho)n(ws)h(the)g(XA)-8
b(T)16 b(algebra)i(tree)f(for)h(our)f(e)o(xample)h(vie)n(w)-152
4321 y(query)24 b(in)g(Figure)f(3.)36 b(The)23 b(semantics)h(of)f(our)g
(query)h(from)g(Figure)f(5)g(can)-152 4408 y(best)h(be)f(understood)i
(by)e(vie)n(wing)h(the)f(intermediate)h(XA)-8 b(T)22
b(table)h(results)-152 4495 y(that)f(w)o(ould)g(be)h(produced)g(by)f
(each)h(operator)f(during)h(e)o(x)o(ecution)g(for)e(our)-152
4582 y(running)j(e)o(xample,)g(as)f(depicted)g(in)g(Figure)44
b(7)1137 4550 y Fb(1)1166 4582 y Fm(.)34 b(F)o(or)22
b(details)g(about)i(the)-152 4669 y(XA)-8 b(T)18 b(algebra)i(the)f
(reader)g(is)g(referred)g(to)g([13].)p -152 4694 797
4 v -149 4748 a Fd(1)-114 4780 y Fm(Please)24 b(ignore)h(the)g
(update-propagation)i(speci\002c)d(parts)h(in)f(Figure)49
b(7,)-152 4855 y(namely)21 b(the)f(shaded)i(parts)e(in)g(all)g(XA)-8
b(T)19 b(tables)h(abo)o(v)o(e)h(the)g(Join)f(operator)m(,)-152
4929 y(and)h(the)g(box)o(es)g(on)g(the)f(left)g(side)h(of)f(the)h
(\002gure.)27 b(Also)20 b(for)h(space)g(reasons)-152
5004 y(we)27 b(could)h(not)f(sho)n(w)g(the)g(full)g(contents)g(of)g
(the)g(intermediate)g(XA)-8 b(T)26 b(ta-)-152 5079 y(ble.)41
b(Thus)25 b(we)g(use)g(abbre)n(viations,)i(where)f(each)f(element)g(is)
g(identi\002ed)-152 5153 y(by)30 b(a)e(string)h(that)f(consists)i(of)e
(the)h(\002rst)f(letter)g(of)g(its)h(tag)f(name)i(plus)f(a)-152
5228 y(number)c(representing)g(the)f(global)h(order)f(of)g(this)g
(element)g(in)g(the)g(XML)-152 5303 y(documents.)44 b(F)o(or)25
b(e)o(xample,)i(we)e(refer)g(to)g(the)g(second)i(book)f(as)g(b2,)h(the)
-152 5378 y(title)f(of)g(third)h(book)h(as)e(t3,)i(and)g(so)e(on.)47
b(Some)26 b(of)h(the)g(columns)g(in)g(the)2040 -115 y
Fg()2180 -48 y(FOR)34 b($a)h(IN)f(document\("bib.xml"\)/book,)
2319 18 y($b)h(IN)f(document\("reviews.xml"\)/entry)2180
84 y(WHERE)g($a/title)g(=)g($b/title)g(and)2389 151 y($a/publisher)f(=)
i("Morgan)f(Kaufmann)g(Publishers")2180 217 y(RETURN)2249
284 y()2459 350 y($a/title,)f($b/review)2249
416 y()2040 483 y()2368 729 y
Fk(Figur)o(e)18 b(3:)23 b(V)m(iew)c(query)g(expr)o(essed)f(by)h(XQuery)
-5 b(.)2040 790 y Fg()2180 856 y()2319
923 y(Data)33 b(on)i(the)g(Web)2319 989
y()f(A)h(very)f(good)g(discussion)g(of)g(semi-structured)2598
1055 y(database)69 b(systems)34 b(and)g(XML)2180
1122 y()2040 1188 y()2040 1435
y Fk(Figur)o(e)17 b(4:)22 b(Materialized)17 b(view)g(generated)h(by)f
(applying)f(view)h(query)g(in)2040 1522 y(Figur)o(e)h(3)h(to)g(XML)f
(documents)g(in)g(Figur)o(es)g(1)h(and)g(2.)2239 1636
y
gsave currentpoint currentpoint translate 270 neg rotate neg exch
neg exch translate
2239 1636 a @beginspecial 49 @llx 39 @lly 504 @urx
720 @ury 1912 @rhi @setspecial
%%BeginDocument: figures/xat.EPS
%!PS-Adobe-3.0 EPSF-3.0
%%Title: Microsoft PowerPoint - t1.ppt
%%Creator: PScript5.dll Version 5.2
%%CreationDate: 9/9/2002 1:43:56
%%For: maged
%%BoundingBox: 49 39 504 720
%%Pages: (atend)
%%Orientation: Landscape
%%PageOrder: Special
%%DocumentNeededResources: (atend)
%%DocumentSuppliedResources: (atend)
%%DocumentData: Clean7Bit
%%TargetDevice: (Generic PostScript Printer) (2010.0) 2
%%LanguageLevel: 2
%%EndComments
%%BeginDefaults
%%PageBoundingBox: 18 8 593 784
%%ViewingOrientation: 0 1 -1 0
%%EndDefaults
%%BeginProlog
%%BeginResource: file Pscript_WinNT_ErrorHandler 5.0 0
/currentpacking where{pop/oldpack currentpacking def/setpacking where{pop false
setpacking}if}if/$brkpage 64 dict def $brkpage begin/prnt{dup type/stringtype
ne{=string cvs}if dup length 6 mul/tx exch def/ty 10 def currentpoint/toy exch
def/tox exch def 1 setgray newpath tox toy 2 sub moveto 0 ty rlineto tx 0
rlineto 0 ty neg rlineto closepath fill tox toy moveto 0 setgray show}bind def
/nl{currentpoint exch pop lmargin exch moveto 0 -10 rmoveto}def/=={/cp 0 def
typeprint nl}def/typeprint{dup type exec}readonly def/lmargin 72 def/rmargin 72
def/tprint{dup length cp add rmargin gt{nl/cp 0 def}if dup length cp add/cp
exch def prnt}readonly def/cvsprint{=string cvs tprint( )tprint}readonly def
/integertype{cvsprint}readonly def/realtype{cvsprint}readonly def/booleantype
{cvsprint}readonly def/operatortype{(--)tprint =string cvs tprint(-- )tprint}
readonly def/marktype{pop(-mark- )tprint}readonly def/dicttype{pop
(-dictionary- )tprint}readonly def/nulltype{pop(-null- )tprint}readonly def
/filetype{pop(-filestream- )tprint}readonly def/savetype{pop(-savelevel- )
tprint}readonly def/fonttype{pop(-fontid- )tprint}readonly def/nametype{dup
xcheck not{(/)tprint}if cvsprint}readonly def/stringtype{dup rcheck{(\()tprint
tprint(\))tprint}{pop(-string- )tprint}ifelse}readonly def/arraytype{dup rcheck
{dup xcheck{({)tprint{typeprint}forall(})tprint}{([)tprint{typeprint}forall(])
tprint}ifelse}{pop(-array- )tprint}ifelse}readonly def/packedarraytype{dup
rcheck{dup xcheck{({)tprint{typeprint}forall(})tprint}{([)tprint{typeprint}
forall(])tprint}ifelse}{pop(-packedarray- )tprint}ifelse}readonly def/courier
/Courier findfont 10 scalefont def end errordict/handleerror{systemdict begin
$error begin $brkpage begin newerror{/newerror false store vmstatus pop pop 0
ne{grestoreall}if errorname(VMerror)ne{showpage}if initgraphics courier setfont
lmargin 720 moveto errorname(VMerror)eq{userdict/ehsave known{clear userdict
/ehsave get restore 2 vmreclaim}if vmstatus exch pop exch pop PrtVMMsg}{
(ERROR: )prnt errorname prnt nl(OFFENDING COMMAND: )prnt/command load prnt
$error/ostack known{nl nl(STACK:)prnt nl nl $error/ostack get aload length{==}
repeat}if}ifelse systemdict/showpage get exec(%%[ Error: )print errorname
=print(; OffendingCommand: )print/command load =print( ]%%)= flush}if end end
end}dup 0 systemdict put dup 4 $brkpage put bind readonly put/currentpacking
where{pop/setpacking where{pop oldpack setpacking}if}if
%%EndResource
userdict /Pscript_WinNT_Incr 230 dict dup begin put
%%BeginResource: file Pscript_FatalError 5.0 0
userdict begin/FatalErrorIf{{initgraphics findfont 1 index 0 eq{exch pop}{dup
length dict begin{1 index/FID ne{def}{pop pop}ifelse}forall/Encoding
{ISOLatin1Encoding}stopped{StandardEncoding}if def currentdict end
/ErrFont-Latin1 exch definefont}ifelse exch scalefont setfont counttomark 3 div
cvi{moveto show}repeat showpage quit}{cleartomark}ifelse}bind def end
%%EndResource
userdict begin/PrtVMMsg{vmstatus exch sub exch pop gt{[
(This job requires more memory than is available in this printer.)100 500
(Try one or more of the following, and then print again:)100 485
(For the output format, choose Optimize For Portability.)115 470
(In the Device Settings page, make sure the Available PostScript Memory is accurate.)
115 455(Reduce the number of fonts in the document.)115 440
(Print the document in parts.)115 425 12/Times-Roman showpage
(%%[ PrinterError: Low Printer VM ]%%)= true FatalErrorIf}if}bind def end
version cvi 2016 ge{/VM?{pop}bind def}{/VM? userdict/PrtVMMsg get def}ifelse
105000 VM?
%%BeginResource: file Pscript_Win_Basic 5.0 0
/d/def load def/,/load load d/~/exch , d/?/ifelse , d/!/pop , d/`/begin , d/^
/index , d/@/dup , d/+/translate , d/$/roll , d/U/userdict , d/M/moveto , d/-
/rlineto , d/&/currentdict , d/:/gsave , d/;/grestore , d/F/false , d/T/true ,
d/N/newpath , d/E/end , d/Ac/arc , d/An/arcn , d/A/ashow , d/D/awidthshow , d/C
/closepath , d/V/div , d/O/eofill , d/L/fill , d/I/lineto , d/-c/curveto , d/-M
/rmoveto , d/+S/scale , d/Ji/setfont , d/Lc/setlinecap , d/Lj/setlinejoin , d
/Lw/setlinewidth , d/Lm/setmiterlimit , d/sd/setdash , d/S/show , d/LH/showpage
, d/K/stroke , d/W/widthshow , d/R/rotate , d/L2? false/languagelevel where{pop
languagelevel 2 ge{pop true}if}if d L2?{/xS/xshow , d/yS/yshow , d/zS/xyshow ,
d}if/b{bind d}bind d/bd{bind d}bind d/xd{~ d}bd/ld{, d}bd/bn/bind ld/lw/Lw ld
/lc/Lc ld/lj/Lj ld/sg/setgray ld/ADO_mxRot null d/self & d/OrgMx matrix
currentmatrix d/reinitialize{: OrgMx setmatrix[/TextInit/GraphInit/UtilsInit
counttomark{@ where{self eq}{F}?{cvx exec}{!}?}repeat cleartomark ;}b
/initialize{`{/Pscript_Win_Data where{!}{U/Pscript_Win_Data & put}?/ADO_mxRot ~
d/TextInitialised? F d reinitialize E}{U/Pscript_Win_Data 230 dict @ ` put
/ADO_mxRot ~ d/TextInitialised? F d reinitialize}?}b/terminate{!{& self eq
{exit}{E}?}loop E}b/suspend/terminate , d/resume{` Pscript_Win_Data `}b U `
/lucas 21690 d/featurebegin{countdictstack lucas[}b/featurecleanup{stopped
{cleartomark @ lucas eq{! exit}if}loop countdictstack ~ sub @ 0 gt{{E}repeat}
{!}?}b E/snap{transform 0.25 sub round 0.25 add ~ 0.25 sub round 0.25 add ~
itransform}b/dsnap{dtransform round ~ round ~ idtransform}b/nonzero_round{@ 0.5
ge{round}{@ -0.5 lt{round}{0 ge{1}{-1}?}?}?}b/nonzero_dsnap{dtransform
nonzero_round ~ nonzero_round ~ idtransform}b U<04>cvn{}put/rr{1 ^ 0 - 0 ~ -
neg 0 - C}b/irp{4 -2 $ + +S fx 4 2 $ M 1 ^ 0 - 0 ~ - neg 0 -}b/rp{4 2 $ M 1 ^ 0
- 0 ~ - neg 0 -}b/solid{[]0 sd}b/g{@ not{U/DefIf_save save put}if U/DefIf_bool
2 ^ put}b/DefIf_El{if U/DefIf_bool get not @{U/DefIf_save get restore}if}b/e
{DefIf_El !}b/UDF{L2?{undefinefont}{!}?}b/UDR{L2?{undefineresource}{! !}?}b
/freeVM{/Courier findfont[40 0 0 -40 0 0]makefont Ji 2 vmreclaim}b/hfRedefFont
{findfont @ length dict `{1 ^/FID ne{d}{! !}?}forall & E @ ` ~{/CharStrings 1
dict `/.notdef 0 d & E d}if/Encoding 256 array 0 1 255{1 ^ ~/.notdef put}for d
E definefont !}bind d/hfMkCIDFont{/CIDFont findresource @ length 2 add dict `{1
^ @/FID eq ~ @/XUID eq ~/UIDBase eq or or{! !}{d}?}forall/CDevProc ~ d/Metrics2
16 dict d/CIDFontName 1 ^ d & E 1 ^ ~/CIDFont defineresource ![~]composefont !}
bind d
%%EndResource
%%BeginResource: file Pscript_Win_Utils_L2 5.0 0
/rf/rectfill , d/fx{1 1 dtransform @ 0 ge{1 sub 0.5}{1 add -0.5}? 3 -1 $ @ 0 ge
{1 sub 0.5}{1 add -0.5}? 3 1 $ 4 1 $ idtransform 4 -2 $ idtransform}b/BZ{4 -2 $
snap + +S fx rf}b/rs/rectstroke , d/rc/rectclip , d/UtilsInit{currentglobal{F
setglobal}if}b/scol{! setcolor}b/colspA/DeviceGray d/colspABC/DeviceRGB d
/colspRefresh{colspABC setcolorspace}b/SetColSpace{colspABC setcolorspace}b
/resourcestatus where{!/ColorRendering/ProcSet resourcestatus{! ! T}{F}?}{F}?
not{/ColorRendering<>/defineresource where{!/ProcSet
defineresource !}{! !}?}if/buildcrdname{/ColorRendering/ProcSet findresource `
mark GetHalftoneName @ type @/nametype ne ~/stringtype ne and{!/none}if(.)
GetPageDeviceName @ type @/nametype ne ~/stringtype ne and{!/none}if(.)5 ^ 0 5
-1 1{^ length add}for string 6 1 $ 5 ^ 5{~ 1 ^ cvs length 1 ^ length 1 ^ sub
getinterval}repeat ! cvn 3 1 $ ! ! E}b/definecolorrendering{~ buildcrdname ~
/ColorRendering defineresource !}b/findcolorrendering where{!}{
/findcolorrendering{buildcrdname @/ColorRendering resourcestatus{! ! T}{
/ColorRendering/ProcSet findresource ` GetSubstituteCRD E F}?}b}?
/selectcolorrendering{findcolorrendering !/ColorRendering findresource
setcolorrendering}b/G2UBegin{findresource/FontInfo get/GlyphNames2Unicode get
`}bind d/G2CCBegin{findresource/FontInfo get/GlyphNames2HostCode get `}bind d
/G2UEnd{E}bind d/AddFontInfoBegin{/FontInfo 8 dict @ `}bind d/AddFontInfo{
/GlyphNames2Unicode 16 dict d/GlyphNames2HostCode 16 dict d}bind d
/AddFontInfoEnd{E d}bind d/T0AddCFFMtx2{/CIDFont findresource/Metrics2 get ` d
E}bind d
%%EndResource
end
%%EndProlog
%%BeginSetup
statusdict begin (%%[ ProductName: ) print product print ( ]%%)= flush end
[ 0 1 -1 0 0 0 ] false Pscript_WinNT_Incr dup /initialize get exec
featurebegin{
%%BeginNonPPDFeature: JobTimeout 0
0 /languagelevel where{pop languagelevel}{1}ifelse 2 ge{1 dict dup/JobTimeout 4 -1 roll put setuserparams}{statusdict/setjobtimeout get exec}ifelse
%%EndNonPPDFeature
}featurecleanup
featurebegin{
%%BeginNonPPDFeature: WaitTimeout 300
300 /languagelevel where{pop languagelevel}{1}ifelse 2 ge{1 dict dup/WaitTimeout 4 -1 roll put setuserparams}{statusdict/waittimeout 3 -1 roll put}ifelse
%%EndNonPPDFeature
}featurecleanup
featurebegin{
%%BeginFeature: *Resolution 300dpi
%%EndFeature
}featurecleanup
1 setlinecap 1 setlinejoin
/mysetup [ 0 72 300 V 72 300 V 0 18 7.99937 ] def
%%EndSetup
userdict begin /ehsave save def end
%%Page: 1 1
%%PageBoundingBox: 18 8 593 784
%%EndPageComments
%%BeginPageSetup
/DeviceRGB dup setcolorspace /colspABC exch def
mysetup concat colspRefresh
%%EndPageSetup
Pscript_WinNT_Incr begin
%%BeginResource: file Pscript_Win_GdiObject 5.0 0
/SavedCTM null d/CTMsave{/SavedCTM SavedCTM currentmatrix d}b/CTMrestore
{SavedCTM setmatrix}b/mp null d/ADO_mxRot null d/GDIHMatrix null d
/GDIHPatternDict 22 dict d GDIHPatternDict `/PatternType 1 d/PaintType 2 d/Reps
L2?{1}{5}? d/XStep 8 Reps mul d/YStep XStep d/BBox[0 0 XStep YStep]d/TilingType
1 d/PaintProc{` 1 Lw[]0 sd PaintData , exec E}b/FGnd null d/BGnd null d
/HS_Horizontal{horiz}b/HS_Vertical{vert}b/HS_FDiagonal{fdiag}b/HS_BDiagonal
{biag}b/HS_Cross{horiz vert}b/HS_DiagCross{fdiag biag}b/MaxXYStep XStep YStep
gt{XStep}{YStep}? d/horiz{Reps{0 4 M XStep 0 - 0 8 +}repeat 0 -8 Reps mul + K}b
/vert{Reps{4 0 M 0 YStep - 8 0 +}repeat 0 -8 Reps mul + K}b/biag{Reps{0 0 M
MaxXYStep @ - 0 YStep neg M MaxXYStep @ - 0 8 +}repeat 0 -8 Reps mul + 0 YStep
M 8 8 - K}b/fdiag{Reps{0 0 M MaxXYStep @ neg - 0 YStep M MaxXYStep @ neg - 0 8
+}repeat 0 -8 Reps mul + MaxXYStep @ M 8 -8 - K}b E/makehatch{4 -2 $/yOrg ~ d
/xOrg ~ d GDIHPatternDict/PaintData 3 -1 $ put CTMsave GDIHMatrix setmatrix
GDIHPatternDict matrix xOrg yOrg + mp CTMrestore ~ U ~ 2 ^ put}b/h0{/h0
/HS_Horizontal makehatch}b/h1{/h1/HS_Vertical makehatch}b/h2{/h2/HS_FDiagonal
makehatch}b/h3{/h3/HS_BDiagonal makehatch}b/h4{/h4/HS_Cross makehatch}b/h5{/h5
/HS_DiagCross makehatch}b/GDIBWPatternMx null d/pfprep{save 8 1 $
/PatternOfTheDay 8 1 $ GDIBWPatternDict `/yOrg ~ d/xOrg ~ d/PaintData ~ d/yExt
~ d/Width ~ d/BGnd ~ d/FGnd ~ d/Height yExt RepsV mul d/mx[Width 0 0 Height 0
0]d E build_pattern ~ !}b/pfbf{/fEOFill ~ d pfprep hbf fEOFill{O}{L}? restore}b
/GraphInit{GDIHMatrix null eq{/SavedCTM matrix d : ADO_mxRot concat 0 0 snap +
: 0.48 @ GDIHPatternDict ` YStep mul ~ XStep mul ~ nonzero_dsnap YStep V ~
XStep V ~ E +S/GDIHMatrix matrix currentmatrix readonly d ; : 0.24 -0.24 +S
GDIBWPatternDict ` Width Height E nonzero_dsnap +S/GDIBWPatternMx matrix
currentmatrix readonly d ; ;}if}b
%%EndResource
%%BeginResource: file Pscript_Win_GdiObject_L2 5.0 0
/GDIBWPatternDict 25 dict @ `/PatternType 1 d/PaintType 1 d/RepsV 1 d/RepsH 1 d
/BBox[0 0 RepsH 1]d/TilingType 1 d/XStep 1 d/YStep 1 d/Height 8 RepsV mul d
/Width 8 d/mx[Width 0 0 Height neg 0 Height]d/FGnd null d/BGnd null d
/SetBGndFGnd{BGnd null ne{BGnd aload ! scol BBox aload ! 2 ^ sub ~ 3 ^ sub ~
rf}if FGnd null ne{FGnd aload ! scol}if}b/PaintProc{` SetBGndFGnd RepsH{Width
Height F mx PaintData imagemask Width 0 +}repeat E}b E d/mp/makepattern , d
/build_pattern{CTMsave GDIBWPatternMx setmatrix/nupangle where{! nupangle -90
eq{nupangle R}if}if GDIBWPatternDict @ ` Width Height ne{Width Height gt{Width
Height V 1}{1 Height Width V}? +S}if xOrg yOrg E matrix + mp CTMrestore}b/hbf
{setpattern}b/hf{:/fEOFill ~ d ~ ! setpattern fEOFill{O}{L}? ;}b/pbf{: !
/fEOFill ~ d GDIBWPatternDict `/yOrg ~ d/xOrg ~ d/PaintData ~ d/OutputBPP ~ d
/Height ~ d/Width ~ d/PaintType 1 d/PatternType 1 d/TilingType 1 d/BBox[0 0
Width Height]d/XStep Width d/YStep Height d/mx xOrg yOrg matrix + d 20 dict @ `
/ImageType 1 d/Width Width d/Height Height d/ImageMatrix[1 0 0 1 0 0]d
/BitsPerComponent 8 d OutputBPP 24 eq{/Decode[0 1 0 1 0 1]d}{OutputBPP 8 eq{
/Decode[0 1]d}{/Decode[0 1 0 1 0 1 0 1]d}?}?/DataSource{PaintData}d E/ImageDict
~ d/PaintProc{` ImageDict image E}b & mx makepattern setpattern E fEOFill{O}{L}
? ;}b/mask_pbf{:/fEOFill ~ d 20 dict `/yOrg ~ d/xOrg ~ d/PaintData ~ d/Height ~
d/Width ~ d/PatternType 1 d/PaintType 2 d/TilingType 1 d/BBox[0 0 Width Height]
d/XStep Width d/YStep Height d/mx xOrg yOrg matrix + d/PaintProc{` Width Height
T 1 1 dtransform abs ~ abs ~ 0 0 3 -1 $ 0 0 6 array astore{PaintData}imagemask
E}b & mx makepattern setpattern E fEOFill{O}{L}? ;}b
%%EndResource
end reinitialize
/DeviceGray dup setcolorspace /colspABC exch def
: N 116 73 3000 2250 rp C
1 0 scol L ; 0 0 scol 0 Lj 1 Lc 3 Lw solid N 971 1873 M 408 1873 I 408 2023 I 971 2023 I C
: 1 0 scol O ; : [ 1 0 0 1 116 73 ] concat K
; Pscript_WinNT_Incr begin
%%BeginResource: file Pscript_Text 5.0 0
/TextInit{TextInitialised? not{/Pscript_Windows_Font & d/TextInitialised? T d
/fM[1 0 0 1 0 0]d/mFM matrix d/iMat[1 0 0.212557 1 0 0]d}if}b/copyfont{1 ^
length add dict `{1 ^/FID ne{d}{! !}?}forall & E}b/EncodeDict 11 dict d/bullets
{{/bullet}repeat}b/rF{3 copyfont @ ` ~ EncodeDict ~ get/Encoding ~ 3 ^/0 eq{&
/CharStrings known{CharStrings/Eth known not{! EncodeDict/ANSIEncodingOld get}
if}if}if d E}b/mF{@ 7 1 $ findfont ~{@/Encoding get @ StandardEncoding eq{! T}{
{ISOLatin1Encoding}stopped{! F}{eq}?{T}{@ ` T 32 1 127{Encoding 1 ^ get
StandardEncoding 3 -1 $ get eq and}for E}?}?}{F}?{1 ^ ~ rF}{0 copyfont}? 6 -2 $
! ! ~ !/pd_charset @ where{~ get 128 eq{@ FDV 2 copy get @ length array copy
put pd_CoverFCRange}if}{!}? 2 ^ ~ definefont fM 5 4 -1 $ put fM 4 0 put fM
makefont Pscript_Windows_Font 3 1 $ put}b/sLT{: Lw -M currentpoint snap M 0 - 0
Lc K ;}b/xUP null d/yUP null d/uW null d/xSP null d/ySP null d/sW null d/sSU{N
/uW ~ d/yUP ~ d/xUP ~ d}b/sU{xUP yUP uW sLT}b/sST{N/sW ~ d/ySP ~ d/xSP ~ d}b/sT
{xSP ySP sW sLT}b/sR{: + R 0 0 M}b/sRxy{: matrix astore concat 0 0 M}b/eR/; , d
/AddOrigFP{{&/FontInfo known{&/FontInfo get length 6 add}{6}? dict `
/WinPitchAndFamily ~ d/WinCharSet ~ d/OrigFontType ~ d/OrigFontStyle ~ d
/OrigFontName ~ d & E/FontInfo ~ d}{! ! ! ! !}?}b/mFS{makefont
Pscript_Windows_Font 3 1 $ put}b/mF42D{0 copyfont `/FontName ~ d 2 copy ~ sub 1
add dict `/.notdef 0 d 2 copy 1 ~{@ 3 ^ sub Encoding ~ get ~ d}for & E
/CharStrings ~ d ! ! & @ E/FontName get ~ definefont}b/mF42{15 dict ` @ 4 1 $
FontName ~ d/FontType 0 d/FMapType 2 d/FontMatrix[1 0 0 1 0 0]d 1 ^ 254 add 255
idiv @ array/Encoding ~ d 0 1 3 -1 $ 1 sub{@ Encoding 3 1 $ put}for/FDepVector
Encoding length array d/CharStrings 2 dict `/.notdef 0 d & E d 0 1 Encoding
length 1 sub{@ @ 10 lt{! FontName length 1 add string}{100 lt{FontName length 2
add string}{FontName length 3 add string}?}? @ 0 FontName @ length string cvs
putinterval @ 3 -1 $ @ 4 1 $ 3 string cvs FontName length ~ putinterval cvn 1 ^
256 mul @ 255 add 3 -1 $ 4 ^ findfont mF42D FDepVector 3 1 $ put}for & @ E
/FontName get ~ definefont ! ! ! mF}b/mF_OTF_V{~ ! ~ ! 4 -1 $ ! findfont 2 ^ ~
definefont fM @ @ 4 6 -1 $ neg put 5 0 put 90 matrix R matrix concatmatrix
makefont Pscript_Windows_Font 3 1 $ put}b/mF_TTF_V{3{~ !}repeat 3 -1 $ !
findfont 1 ^ ~ definefont Pscript_Windows_Font 3 1 $ put}b/UmF{L2?
{Pscript_Windows_Font ~ undef}{!}?}b/UmF42{@ findfont/FDepVector get{/FontName
get undefinefont}forall undefinefont}b
%%EndResource
end reinitialize
Pscript_WinNT_Incr begin
%%BeginResource: file Pscript_Encoding256 5.0 0
/CharCol256Encoding[/.notdef/breve/caron/dotaccent/dotlessi/fi/fl/fraction
/hungarumlaut/Lslash/lslash/minus/ogonek/ring/Zcaron/zcaron/.notdef/.notdef
/.notdef/.notdef/.notdef/.notdef/.notdef/.notdef/.notdef/.notdef/.notdef
/.notdef/.notdef/.notdef/.notdef/.notdef/space/exclam/quotedbl/numbersign
/dollar/percent/ampersand/quotesingle/parenleft/parenright/asterisk/plus/comma
/hyphen/period/slash/zero/one/two/three/four/five/six/seven/eight/nine/colon
/semicolon/less/equal/greater/question/at/A/B/C/D/E/F/G/H/I/J/K/L/M/N/O/P/Q/R/S
/T/U/V/W/X/Y/Z/bracketleft/backslash/bracketright/asciicircum/underscore/grave
/a/b/c/d/e/f/g/h/i/j/k/l/m/n/o/p/q/r/s/t/u/v/w/x/y/z/braceleft/bar/braceright
/asciitilde/.notdef/Euro/.notdef/quotesinglbase/florin/quotedblbase/ellipsis
/dagger/daggerdbl/circumflex/perthousand/Scaron/guilsinglleft/OE/.notdef
/.notdef/.notdef/.notdef/quoteleft/quoteright/quotedblleft/quotedblright/bullet
/endash/emdash/tilde/trademark/scaron/guilsinglright/oe/.notdef/.notdef
/Ydieresis/.notdef/exclamdown/cent/sterling/currency/yen/brokenbar/section
/dieresis/copyright/ordfeminine/guillemotleft/logicalnot/.notdef/registered
/macron/degree/plusminus/twosuperior/threesuperior/acute/mu/paragraph
/periodcentered/cedilla/onesuperior/ordmasculine/guillemotright/onequarter
/onehalf/threequarters/questiondown/Agrave/Aacute/Acircumflex/Atilde/Adieresis
/Aring/AE/Ccedilla/Egrave/Eacute/Ecircumflex/Edieresis/Igrave/Iacute
/Icircumflex/Idieresis/Eth/Ntilde/Ograve/Oacute/Ocircumflex/Otilde/Odieresis
/multiply/Oslash/Ugrave/Uacute/Ucircumflex/Udieresis/Yacute/Thorn/germandbls
/agrave/aacute/acircumflex/atilde/adieresis/aring/ae/ccedilla/egrave/eacute
/ecircumflex/edieresis/igrave/iacute/icircumflex/idieresis/eth/ntilde/ograve
/oacute/ocircumflex/otilde/odieresis/divide/oslash/ugrave/uacute/ucircumflex
/udieresis/yacute/thorn/ydieresis]def EncodeDict/256 CharCol256Encoding put
%%EndResource
end reinitialize
%%IncludeResource: font Times-Bold
Pscript_WinNT_Incr begin
%%BeginResource: file Pscript_Win_Euro_L2 5.0 0
/UseT3EuroFont{/currentdistillerparams where{pop currentdistillerparams
/CoreDistVersion get 4000 le}{false}ifelse}bind def/NewEuroT3Font?{dup/FontType
get 3 eq{dup/EuroFont known exch/BaseFont known and}{pop false}ifelse}bind def
/T1FontHasEuro{dup/CharStrings known not{dup NewEuroT3Font?{dup/EuroGlyphName
get exch/EuroFont get/CharStrings get exch known{true}{false}ifelse}{pop false}
ifelse}{dup/FontType get 1 eq{/CharStrings get/Euro known}{dup/InfoDict known{
/InfoDict get/Euro known}{/CharStrings get/Euro known}ifelse}ifelse}ifelse}bind
def/FontHasEuro{findfont dup/Blend known{pop true}{T1FontHasEuro}ifelse}bind
def/EuroEncodingIdx 1 def/EuroFontHdr{12 dict begin/FontInfo 10 dict dup begin
/version(001.000)readonly def/Notice(Copyright (c)1999 Adobe Systems
Incorporated. All Rights Reserved.)readonly def/FullName(Euro)readonly def
/FamilyName(Euro)readonly def/Weight(Regular)readonly def/isFixedPitch false
def/ItalicAngle 0 def/UnderlinePosition -100 def/UnderlineThickness 50 def end
readonly def/FontName/Euro def/Encoding 256 array 0 1 255{1 index exch/.notdef
put}for def/PaintType 0 def/FontType 1 def/FontMatrix[0.001 0 0 0.001 0 0]def
/FontBBox{-25 -23 1500 804}readonly def currentdict end dup/Private 20 dict dup
begin/ND{def}def/NP{put}def/lenIV -1 def/RD{string currentfile exch
readhexstring pop}def/-|{string currentfile exch readstring pop}executeonly def
/|-{def}executeonly def/|{put}executeonly def/BlueValues[-20 0 706 736 547 572]
|-/OtherBlues[-211 -203]|-/BlueScale 0.0312917 def/MinFeature{16 16}|-/StdHW
[60]|-/StdVW[71]|-/ForceBold false def/password 5839 def/Erode{8.5 dup 3 -1
roll 0.1 mul exch 0.5 sub mul cvi sub dup mul 71 0 dtransform dup mul exch dup
mul add le{pop pop 1.0 1.0}{pop pop 0.0 1.5}ifelse}def/OtherSubrs[{}{}{}
{systemdict/internaldict known not{pop 3}{1183615869 systemdict/internaldict
get exec dup/startlock known{/startlock get exec}{dup/strtlck known{/strtlck
get exec}{pop 3}ifelse}ifelse}ifelse}executeonly]|-/Subrs 5 array dup 0
<8E8B0C100C110C110C210B>put dup 1<8B8C0C100B>put dup 2<8B8D0C100B>put dup 3<0B>
put dup 4<8E8C8E0C100C110A0B>put |- 2 index/CharStrings 256 dict dup begin
/.notdef<8b8b0d0e>def end end put put dup/FontName get exch definefont pop}bind
def/AddEuroGlyph{2 index exch EuroEncodingIdx 1 eq{EuroFontHdr}if systemdict
begin/Euro findfont dup dup/Encoding get 5 1 roll/Private get begin/CharStrings
get dup 3 index known{pop pop pop pop end end}{begin 1 index exch def end end
end EuroEncodingIdx dup 1 add/EuroEncodingIdx exch def exch put}ifelse}bind def
/GetNewXUID{currentdict/XUID known{[7 XUID aload pop]true}{currentdict/UniqueID
known{[7 UniqueID]true}{false}ifelse}ifelse}bind def/BuildT3EuroFont{exch 16
dict begin dup/FontName exch def findfont dup/Encoding get/Encoding exch def
dup length 1 add dict copy dup/FID undef begin dup dup/FontName exch def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for def GetNewXUID{/XUID
exch def}if currentdict end definefont pop/BaseFont exch findfont 1000
scalefont def/EuroFont exch findfont 1000 scalefont def pop/EuroGlyphName exch
def/FontType 3 def/FontMatrix[.001 0 0 .001 0 0]def/FontBBox BaseFont/FontBBox
get def/Char 1 string def/BuildChar{exch dup begin/Encoding get 1 index get
/Euro eq{BaseFont T1FontHasEuro{false}{true}ifelse}{false}ifelse{EuroFont
setfont pop userdict/Idx 0 put EuroFont/Encoding get{EuroGlyphName eq{exit}
{userdict/Idx Idx 1 add put}ifelse}forall userdict/Idx get}{dup dup Encoding
exch get BaseFont/Encoding get 3 1 roll put BaseFont setfont}ifelse Char 0 3 -1
roll put Char stringwidth newpath 0 0 moveto Char true charpath flattenpath
pathbbox setcachedevice 0 0 moveto Char show end}bind def currentdict end dup
/FontName get exch definefont pop}bind def/AddEuroToT1Font{dup findfont dup
length 10 add dict copy dup/FID undef begin/EuroFont 3 -1 roll findfont 1000
scalefont def CharStrings dup length 1 add dict copy begin/Euro{EuroFont
setfont pop EuroGBBox aload pop setcachedevice 0 0 moveto EuroGName glyphshow}
bind def currentdict end/CharStrings exch def GetNewXUID{/XUID exch def}if 3 1
roll/EuroGBBox exch def/EuroGName exch def currentdict end definefont pop}bind
def/BuildNewFont{UseT3EuroFont{BuildT3EuroFont}{pop AddEuroToT1Font}ifelse}bind
def/UseObliqueEuro{findfont/FontMatrix get dup 2 get 0 eq exch dup 0 get exch 3
get eq and UseT3EuroFont or}bind def
%%EndResource
end reinitialize
7500 VM?
/Times-Bold FontHasEuro not
{
/Euro.Times-Bold
[500 0 19 -13 492 688 ]
<9EF8880DF84CA6037EA701F791C801F7FFC801F928A7018F0AC3F73203F852A6037EA701
F791C801F7FFC801F928A701F86DF89C15F73A0770068875877D778B08858B749A799308
7E916E946B8B08358BFB144773FB58086506774E05C1065A076706774E05C7069DFB27E1
FB0BF7188B088F0AC3F73203F84CA6037EA701F791C801F7FFC801F928A701B88BAA9F91
8E089C939892908B089F8B8F7D8E7508A606F7450772067A3F5240538B084F8B68EC89F7
2108F72F06A0C805FB4506BC07F75506A0C805FB690690F71CA9EFC88B088F0AF852A603
7EA701F791C801F7FFC801F928A701D58BB93A9C5008090E>
AddEuroGlyph
/Euro /Times-Bold /Times-Bold-Copy BuildNewFont
} if
F /F0 0 /256 T /Times-Bold mF
/F0S53 F0 [83 0 0 -83 0 0 ] mFS
F0S53 Ji
493 1970 M (S )[46 0]xS
/F0S36 F0 [54 0 0 -54 0 0 ] mFS
F0S36 Ji
560 1991 M <93>S
587 1991 M (bib.)[30 16 29 0]xS
676 1991 M (xml)[28 44 0]xS
763 1991 M <94>S
811 1945 M ($s1)[27 21 0]xS
N 1921 1873 M 1358 1873 I 1358 2023 I 1921 2023 I C
: 1 0 scol O ; : [ 1 0 0 1 116 73 ] concat K
; F0S53 Ji
1394 1970 M (S )[46 0]xS
F0S36 Ji
1461 1991 M <93>S
1488 1991 M (reviews.)[24 24 27 15 24 38 21 0]xS
1676 1991 M (xml)[27 44 0]xS
1762 1991 M <94>S
1810 1945 M ($s2)[27 21 0]xS
N 971 1626 M 408 1626 I 408 1773 I 971 1773 I C
: 1 0 scol O ; : [ 1 0 0 1 116 73 ] concat K
;
%%IncludeResource: font Symbol
F /F1 0 /2 F /Symbol mF
/F1S53 F1 [83 0 0 -83 0 0 ] mFS
F1S53 Ji
Pscript_WinNT_Incr begin
%%BeginResource: file Pscript_TextBold 5.0 0
/sB{1 copy 2 copy : sBdx 0 -M S ; : 0 sBdx -M S ; : sBdx sBdx -M S ; S}b/asB{3
copy 3 copy 3 copy : sBdx 0 -M A ; : 0 sBdx -M A ; : sBdx sBdx -M A ; A}b/wsB{4
copy 4 copy 4 copy : sBdx 0 -M W ; : 0 sBdx -M W ; : sBdx sBdx -M W ; W}b/awsB
{6 copy 6 copy 6 copy : sBdx 0 -M D ; : 0 sBdx -M D ; : sBdx sBdx -M D ; D}b
/xsB{2 copy 2 copy 2 copy : sBdx 0 -M xS ; : 0 sBdx -M xS ; : sBdx sBdx -M xS ;
xS}b/zsB{2 copy 2 copy 2 copy : sBdx 0 -M zS ; : 0 sBdx -M zS ; : sBdx sBdx -M
zS ; zS}b/ysB{2 copy 2 copy 2 copy : sBdx 0 -M yS ; : 0 sBdx -M yS ; : sBdx
sBdx -M yS ; yS}b
%%EndResource
end reinitialize
505 1724 M (f)
/sBdx 300 300 div def
sB
F0S36 Ji
570 1745 M ($s1, book )[27 21 27 13 14 29 27 27 29 0]xS
819 1699 M ($a)[27 0]xS
N 1921 1626 M 1358 1626 I 1358 1773 I 1921 1773 I C
: 1 0 scol O ; : [ 1 0 0 1 116 73 ] concat K
; F1S53 Ji
1459 1724 M (f)sB
F0S36 Ji
1503 1745 M ($s2, entry )[27 21 27 13 14 24 29 18 24 27 0]xS
1762 1699 M ($b)[27 0]xS
N 1921 1377 M 1358 1377 I 1358 1523 I 1921 1523 I C
: 1 0 scol O ; : [ 1 0 0 1 116 73 ] concat K
; F1S53 Ji
1402 1476 M (f)sB
F0S36 Ji
1446 1497 M ($b, review )[27 29 14 14 14 24 24 27 15 24 38 0]xS
1731 1451 M ($col12)[27 24 26 15 27 0]xS
N 971 1377 M 408 1377 I 408 1523 I 971 1523 I C
: 1 0 scol O ; : [ 1 0 0 1 116 73 ] concat K
; F1S53 Ji
484 1476 M (f)sB
F0S36 Ji
528 1497 M ($a, title )[27 27 13 14 14 18 15 18 15 24 0]xS
748 1451 M ($col11)[27 24 26 15 27 0]xS
N 1917 1148 M 1358 1148 I 1358 1297 I 1917 1297 I C
: 1 0 scol O ; : [ 1 0 0 1 116 73 ] concat K
; F1S53 Ji
1451 1247 M (f)sB
F0S36 Ji
1495 1268 M ($b, title )[27 29 14 14 18 15 18 15 24 0]xS
1704 1222 M ($col5)[27 24 26 15 0]xS
N 2216 898 M 191 898 I 191 1052 I 2216 1052 I C
: 1 0 scol O ; : [ 1 0 0 1 116 73 ] concat K
; F0S53 Ji
225 995 M (J )[42 0]xS
F0S36 Ji
288 1016 M (\(\($col11 == $col5\) AND \($col7 == "Morgan)[18 18 27 24 26 15 27 27 14 31 31 14 27 24 26 15 27 18 14 39 39 39 14 18 27 25 26 15 27 14 31 31
14 30 51 26 24 28 27 0]xS
1299 1016 M (Kaufmann)[42 28 30 19 44 28 30 0]xS
1563 1016 M (Publishers"\)\) )[34 30 30 15 15 22 29 24 24 21 30 18 18 0]xS
1887 970 M ($col1, $col12)[27 25 26 15 27 14 14 27 24 26 16 27 0]xS
N 1980 650 M 458 650 I 458 798 I 1980 798 I C
: 1 0 scol O ; : [ 1 0 0 1 116 73 ] concat K
; F0S53 Ji
568 747 M (T)S
F0S36 Ji
623 768 M ($col11$col12 )[31 36 27 27 30 27 39 24 27 15 25 38 31 27 25 26 15 27 27 27 25 26 16 27 27 31 15 36 27 27 30 27
39 24 28 15 24 38 31 0]xS
1722 722 M ($col13)[27 24 26 16 27 0]xS
N 1391 398 M 923 398 I 923 542 I 1391 542 I C
: 1 0 scol O ; : [ 1 0 0 1 116 73 ] concat K
; F0S53 Ji
1001 495 M (Agg )[60 42 42 0]xS
F0S36 Ji
1166 470 M ($col13)[27 24 26 15 27 0]xS
1 Lj N 658 1873 M 659 1812 I : [ 1 0 0 1 116 73 ] concat K
; N 676 1815 M 660 1783 I 643 1815 I C
O N 658 1623 M 659 1562 I : [ 1 0 0 1 116 73 ] concat K
; N 676 1565 M 660 1533 I 643 1565 I C
O N 658 1373 M 659 1312 I : [ 1 0 0 1 116 73 ] concat K
; N 676 1315 M 660 1283 I 643 1315 I C
O N 1608 1873 M 1609 1812 I : [ 1 0 0 1 116 73 ] concat K
; N 1626 1815 M 1610 1783 I 1593 1815 I C
O N 1608 1623 M 1609 1562 I : [ 1 0 0 1 116 73 ] concat K
; N 1626 1565 M 1610 1533 I 1593 1565 I C
O N 1608 1373 M 1609 1312 I : [ 1 0 0 1 116 73 ] concat K
; N 1626 1315 M 1610 1283 I 1593 1315 I C
O N 658 1164 M 793 1087 I : [ 1 0 0 1 116 73 ] concat K
; N 799 1104 M 820 1073 I 783 1076 I C
O N 1583 1133 M 1387 1081 I : [ 1 0 0 1 116 73 ] concat K
; N 1394 1066 M 1358 1073 I 1386 1098 I C
O N 1133 898 M 1134 837 I : [ 1 0 0 1 116 73 ] concat K
; N 1151 840 M 1134 807 I 1118 840 I C
O N 1141 398 M 1142 337 I : [ 1 0 0 1 116 73 ] concat K
; N 1159 340 M 1142 307 I 1126 340 I C
O 0 Lj N 974 1149 M 366 1149 I 366 1298 I 974 1298 I C
: 1 0 scol O ; : [ 1 0 0 1 116 73 ] concat K
; F1S53 Ji
421 1248 M (f)sB
F0S36 Ji
465 1269 M ($a, publisher )[27 27 13 14 30 30 29 15 15 22 29 24 24 0]xS
799 1223 M ($col7)[27 25 26 15 0]xS
N 1691 173 M 666 173 I 666 324 I 1691 324 I C
: 1 0 scol O ; : [ 1 0 0 1 116 73 ] concat K
; F0S53 Ji
756 270 M (T)S
F0S36 Ji
811 291 M ($col13 Result > )[31 39 24 22 29 15 18 31 27 25 26 15 27 27 31 15 14 39 24 21 30 15 18 14 31 0]xS
1454 245 M ($col14)[27 24 26 15 27 0]xS
N 2941 173 M 2391 173 I 2391 1015 I 2941 1015 I C
: [ 1 0 0 1 116 73 ] concat K
;
%%IncludeResource: font Times-Roman
7500 VM?
/Times-Roman FontHasEuro not
{
/Euro.Times-Roman
[500 0 24 -14 493 676 ]
AddEuroGlyph
/Euro /Times-Roman /Times-Roman-Copy BuildNewFont
} if
F /F2 0 /256 T /Times-Roman mF
/F2S64 F2 [100 0 0 -100 0 0 ] mFS
F2S64 Ji
2423 286 M (Operators)[72 50 44 33 44 28 50 33 0]xS
: N 2423 297 393 5 rp C
L ; /F2S4B F2 [75 0 0 -75 0 0 ] mFS
F2S4B Ji
2423 439 M (S)S
/F0S4B F0 [75 0 0 -75 0 0 ] mFS
F0S4B Ji
2484 439 M (: )[25 0]xS
/F2S53 F2 [83 0 0 -83 0 0 ] mFS
F2S53 Ji
2528 439 M (Source)[46 42 41 28 37 0]xS
/F1S64 F1 [100 0 0 -100 0 0 ] mFS
F1S64 Ji
2423 616 M (f)S
F2S64 Ji
2500 616 M (:)S
F2S53 Ji
2528 616 M (Navigate)[60 37 41 23 41 37 23 0]xS
F0S4B Ji
2423 796 M (J)S
F2S64 Ji
2486 796 M (: )[28 0]xS
F2S53 Ji
2538 796 M (Join)[33 42 23 0]xS
F0S4B Ji
2423 976 M (T)S
F2S64 Ji
2498 976 M (: )[28 0]xS
F2S53 Ji
2551 976 M (Tagger)[52 37 41 41 37 0]xS
1 Lj N 1141 639 M 1142 578 I : [ 1 0 0 1 116 73 ] concat K
; N 1159 581 M 1142 549 I 1126 581 I C
O LH
(%%[Page: 1]%%) =
%%PageTrailer
%%Trailer
%%DocumentNeededResources:
%%+ font Times-Bold
%%+ font Symbol
%%+ font Times-Roman
%%DocumentSuppliedResources:
%%+ procset Pscript_WinNT_ErrorHandler 5.0 0
%%+ procset Pscript_FatalError 5.0 0
%%+ procset Pscript_Win_Basic 5.0 0
%%+ procset Pscript_Win_Utils_L2 5.0 0
%%+ procset Pscript_Win_GdiObject 5.0 0
%%+ procset Pscript_Win_GdiObject_L2 5.0 0
%%+ procset Pscript_Text 5.0 0
%%+ procset Pscript_Encoding256 5.0 0
%%+ procset Pscript_Win_Euro_L2 5.0 0
%%+ procset Pscript_TextBold 5.0 0
Pscript_WinNT_Incr dup /terminate get exec
ehsave restore
%%Pages: 1
(%%[LastPage]%%) =
%%EOF
%%EndDocument
@endspecial 3304 1636 a
currentpoint grestore moveto
3304 1636 a 2127 2844 a Fk(Figur)o(e)f(5:)23
b(XA)-7 b(T)18 b(algebra)i(tr)o(ee)e(of)h(the)g(view)g(query)f(in)g
(Figur)o(e)g(3.)2040 3099 y Fl(3.)99 b(UPD)m(A)-9 b(TE)25
b(PR)m(OP)-7 b(A)i(GA)c(TION)22 b(STRA)-9 b(TEGY)2040
3281 y(3.1)99 b(A)-5 b(uxiliary)24 b(Inf)n(ormation)h(f)n(or)g
(Maintenance)2115 3389 y Fm(In)19 b(our)g(update)h(propagation)h
(approach,)f(we)f(assume)g(that)g(our)h(algebra)2040
3476 y(operators)26 b(may)g(ha)o(v)o(e)g(access)g(to)f(their)h
(materialized)f(input)h(and/or)g(out-)2040 3563 y(put)20
b(XA)-8 b(T)19 b(tables,)g(depending)j(on)e(the)g(type)g(of)g(operator)
g([5].)26 b(Our)19 b(update)2040 3650 y(propagator)29
b(will)f(also)g(maintain)g(additional)h(auxiliary)g(information)f(to)
2040 3737 y(aid)17 b(the)g(maintenance)h(process.)23
b(In)16 b(particular)m(,)h(we)g(k)o(eep)g(track)g(of)g(lineage)2040
3824 y(between)24 b(deri)n(v)o(ed)h(tuples.)38 b(W)-6
b(e)23 b(generate)h(unique)h(IDs)e(for)h(tuples)g(in)f(the)2040
3912 y(XA)-8 b(T)23 b(tables.)37 b(Each)24 b(tuple)g(k)o(eeps)h(track)f
(of)g(tuples)g(it)f(w)o(as)h(deri)n(v)o(ed)g(from)2040
3999 y(using)18 b(ID)f(references.)23 b(Lastly)-5 b(,)17
b(for)g(the)g(operators)h(which)g(will)e(create)h(col-)2040
4086 y(lections)k(of)g(XML)f(fragments)i(\(most)e(notably)i(the)f
(Aggre)o(gate)g(operator\))2040 4173 y(we)29 b(maintain)h(counts)g(for)
f(each)h(tuple)g(in)f(the)g(operator')l(s)h(output)g(XA)-8
b(T)2040 4260 y(table.)45 b(This)26 b(auxiliary)h(information)g(helps)g
(to)f(k)o(eep)h(track)g(of)f(dif)n(ferent)2040 4347 y(fragments)20
b(of)f(the)f(XML)h(document)i(spread)e(o)o(v)o(er)g(the)g(XA)-8
b(T)18 b(tables.)2040 4508 y Fl(3.2)99 b(Update)26 b(Primiti)o(v)o(es)
2115 4616 y Fm(Updates)21 b(to)g(an)f(XML)h(source)g(document)h(can)f
(be)g(transformed)h(into)e(a)2040 4704 y(sequence)c(of)f(primiti)n(v)o
(e)f(update)h(operations)h(called)e Ff(U)8 b(pdate)13
b(P)e(r)r(imitiv)s(es)p Fm(.)2040 4791 y(W)-6 b(e)23
b(de\002ne)i(tw)o(o)f(sets)f(of)h(update)h(primiti)n(v)o(es)f
Fj(up)p Fm(.)38 b(Belo)n(w)24 b(the)g(parameter)2040
4878 y Fj(pos)c Fm(corresponds)g(to)f(an)g(XP)o(ath)g(e)o(xpression)h
(used)f(to)g(access)h(elements.)2115 4965 y Fk(Update)13
b(Primiti)o(v)o(es)i(f)n(or)g(Updating)e(XML)g(Documents)i(\(xup\):)20
b Fm(The)o(y)2040 5052 y(operate)g(on)f(XML)g(documents)h(directly)-5
b(.)p 2040 5081 797 4 v 2040 5153 a(intermediate)24 b(XA)-8
b(T)23 b(tables)h(were)g(not)g(carried)h(from)e(the)i(input)f(XA)-8
b(T)23 b(ta-)2040 5228 y(ble)i(of)f(an)h(operator)g(to)f(its)g(output)h
(XA)-8 b(T)23 b(table.)40 b(This)24 b(process)h(is)f(called)2040
5303 y(XA)-8 b(T)27 b(Schema)h(Cleanup)g([12],)i(where)d(unused)i
(columns)g(are)e(remo)o(v)o(ed)2040 5378 y(for)19 b(optimization)g
(purposes.)p eop
%%Page: 3 3
3 2 bop -41 -69 a Fo(\017)38 b Fk(AddAtt)p Fj(\(a,)30
b(v)-6 b(,)32 b(pos\))p Fm(:)45 b(Add)29 b(a)g(ne)n(w)h(attrib)o(ute)f
Fj(a)g Fm(with)g(v)n(alue)h Fj(v)f Fm(at)35 19 y(position)20
b Fj(pos)p Fm(.)-41 108 y Fo(\017)38 b Fk(DeleteAtt)p
Fj(\(a,)19 b(pos\))p Fm(:)k(Delete)c(attrib)o(ute)f Fj(a)h
Fm(at)g(position)g Fj(pos)p Fm(.)-41 197 y Fo(\017)38
b Fk(ChangeAtt)p Fj(\(a,)19 b(v)-6 b(,)20 b(pos\))p Fm(:)25
b(Change)c(the)f(v)n(alue)g(of)g(attrib)o(ute)f Fj(a)h
Fm(at)f(po-)35 285 y(sition)g Fj(pos)g Fm(to)g(the)g(ne)n(w)g(v)n(alue)
h Fj(v)p Fm(.)-41 374 y Fo(\017)38 b Fk(AddEle)p Fj(\(e)o(,)17
b(pos\))p Fm(:)23 b(Add)c(a)f(ne)n(w)h(element)g Fj(e)f
Fm(at)g(position)h Fj(pos)p Fm(,)f(where)35 461 y(element)d
Fj(e)g Fm(can)g(be)h(a)e(singleton)i(element)f(or)g(ha)o(v)o(e)g
(nested)h(structure.)-41 551 y Fo(\017)38 b Fk(DeleteEle)p
Fj(\(pos\))p Fm(:)24 b(Delete)18 b(the)h(element)g(at)g(position)h
Fj(pos)p Fm(.)-41 640 y Fo(\017)38 b Fk(ChangeEle)p Fj(\(e)o(,)19
b(pos\))p Fm(:)25 b(Change)c(the)f(element)g(at)f(position)h
Fj(pos)h Fm(into)35 727 y(ne)n(w)e(element)h Fj(e)p Fm(.)-152
825 y Fk(Update)h(Primiti)o(v)o(es)g(f)n(or)g(Intermediate)g(Update)g
(Pr)o(opagation)f(\(iup\))p Fm(:)-152 913 y(Intermediate)30
b(results)e(in)h(the)g(XA)-8 b(T)28 b(algebra)i(tree)e(correspond)j(to)
e(XA)-8 b(T)-152 1000 y(tables,)24 b(i.e.,)f(the)o(y)g(contain)h
(collections)f(of)g(fragments.)36 b(Hence)24 b(we)f(need)-152
1087 y(to)i(ha)o(v)o(e)f(a)h(w)o(ay)g(to)f(specify)h(the)g(location)g
(of)f(the)h(XML)f(fragment)h(to)f(be)-152 1174 y(updated)d(in)d(XA)-8
b(T)18 b(tables.)-41 1254 y Fo(\017)38 b Fk(InsertT)-7
b(uple)p Fj(\(t,)29 b(id,)h(o\))p Fm(:)42 b(Insert)29
b(a)f(ne)n(w)h(tuple)f Fj(t)g Fm(with)g(ID)g Fj(id)h
Fm(into)35 1341 y(XA)-8 b(T)18 b(table)h(at)g(tuple)g(position)g
Fj(o)p Fm(.)-41 1431 y Fo(\017)38 b Fk(DeleteT)-7 b(uple)p
Fj(\(id\))p Fm(:)20 b(Delete)15 b(tuple)g(with)f(ID)h
Fj(id)f Fm(from)h(the)g(XA)-8 b(T)14 b(table.)-41 1523
y Fo(\017)38 b Fk(ChangeT)-7 b(uple)p Fj(\(xup,)26 b(ucol,)h(id\))p
Fm(:)36 b(Change)26 b(the)g(tuple)f(in)g(the)h(XA)-8
b(T)35 1611 y(table)21 b(by)g(applying)g(the)g(update)h(primiti)n(v)o
(e)e Fj(xup)h Fm(to)f(the)h(cell)f(in)h(col-)35 1698
y(umn)h Fj(ucol)f Fm(with)g(tuple)h(id)f Fj(id)p Fm(,)g(where)g
Fj(xup)h Fm(is)f(one)g(of)h(the)f(six)g(XML)35 1785 y(update)f(primiti)
n(v)o(es)f(described)h(abo)o(v)o(e.)-152 1934 y Fl(3.3)99
b(Ov)o(erall)24 b(Pr)n(opagation)h(Strategy)-77 2042
y Fm(The)19 b(o)o(v)o(erall)g(update)h(propagation)g(strate)o(gy)f(for)
g(our)g(system)g(is)g(sho)n(wn)-152 2129 y(in)29 b(Figure)f(6.)53
b(Each)29 b(node)g(in)g(the)f(XA)-8 b(T)28 b(algebra)h(tree)g(has)g
(kno)n(wledge)-152 2216 y(about)g(the)f(XA)-8 b(T)27
b(operator)h(associated)h(with)e(it,)j(its)d(input)h(XA)-8
b(T)27 b(tables,)-152 2303 y(output)c(XA)-8 b(T)20 b(table)i(and)g(the)
f(auxiliary)h(information)g(de\002ned)g(in)g(Section)-152
2390 y(3.1.)33 b(The)22 b(update)h(propagation)g(starts)f(from)g(the)g
(bottom)h(of)f(the)g(algebra)-152 2478 y(tree.)51 b(W)-6
b(e)28 b(assume)h(that)f(the)g(operator)h(associated)g(with)f(the)h
(leaf)f(node)-152 2565 y(\(generally)-5 b(,)25 b(the)f(Source)g
(operator\))g(recei)n(v)o(es)g(one)g(update)g(to)f(the)h(source)-152
2652 y(XML)e(document)i(at)e(a)g(time.)33 b(The)22 b(Source)g(operator)
h(accepts)g(an)g(update)-152 2739 y(of)c(an)o(y)g(of)f(the)g(six)h
(basic)f(update)i(types)f Fj(xup)p Fm(s)g(de\002ned)g(abo)o(v)o(e,)g
(and)g(propa-)-152 2826 y(gates)d(such)h(update)g(into)f(a)g(sequence)i
(of)e(zero)g(or)g(more)h(update)g(primiti)n(v)o(es)-152
2913 y(of)24 b(type)h Fj(iup)f Fm(to)g(its)g(parent)g(operator)l(.)40
b(All)23 b(other)h(operators)h(in)f(the)g(alge-)-152
3001 y(bra)d(tree)f(recei)n(v)o(e)i(as)e(input)h(sequences)h(XA)-8
b(T)h(-speci\002c)20 b(update)i(primiti)n(v)o(es)-152
3088 y Fj(iup)p Fm(s)d(from)g(their)f(children)i(nodes,)f(re)n(write)g
(them)f(into)h(sequences)i(of)d(ne)n(w)-152 3175 y(update)28
b(primiti)n(v)o(es)e Fj(iup)p Fm(s)h(and)g(propagate)h(them)f(upw)o
(ards.)47 b(The)27 b(update)-152 3262 y(primiti)n(v)o(es)18
b(are)g(propagated)i(through)f(the)f(tree)g(up)g(to)g(the)g(topmost)h
(opera-)-152 3349 y(tor)l(.)27 b(At)20 b(the)g(top,)h(the)f(propagated)
i(update)f(primiti)n(v)o(es)f(will)f(be)i(applied)g(to)-152
3436 y(the)g(materialized)f(XML)g(vie)n(w)h(to)f(refresh)h(it.)27
b(W)-6 b(e)19 b(ha)o(v)o(e)i(rules)f(for)h(update)-152
3524 y(propagation)29 b(for)f(each)g(of)g(the)g(algebra)g(operator)h
(\(operatorPropagate\))-152 3611 y([5],)19 b(these)g(rules)g(are)g(not)
g(discussed)h(here)f(due)h(to)f(space)g(limitation.)247
3709 y
gsave currentpoint currentpoint translate 270 neg rotate neg exch
neg exch translate
247 3709 a @beginspecial 26 @llx 56 @lly 483 @urx
797 @ury 1434 @rhi @setspecial
%%BeginDocument: figures/overallUpAlg.eps
%!PS-Adobe-3.0 EPSF-3.0
%%Title: Microsoft PowerPoint - tt.ppt
%%Creator: PScript5.dll Version 5.2
%%CreationDate: 7/10/2002 23:3:58
%%For: jsabbah
%%BoundingBox: 26 56 483 797
%%Pages: (atend)
%%Orientation: Landscape
%%PageOrder: Special
%%DocumentNeededResources: (atend)
%%DocumentSuppliedResources: (atend)
%%DocumentData: Clean7Bit
%%TargetDevice: (Generic PostScript Printer) (2010.0) 2
%%LanguageLevel: 2
%%EndComments
%%BeginDefaults
%%PageBoundingBox: 18 23 577 819
%%ViewingOrientation: 0 1 -1 0
%%EndDefaults
%%BeginProlog
%%BeginResource: file Pscript_WinNT_ErrorHandler 5.0 0
/currentpacking where{pop/oldpack currentpacking def/setpacking where{pop false
setpacking}if}if/$brkpage 64 dict def $brkpage begin/prnt{dup type/stringtype
ne{=string cvs}if dup length 6 mul/tx exch def/ty 10 def currentpoint/toy exch
def/tox exch def 1 setgray newpath tox toy 2 sub moveto 0 ty rlineto tx 0
rlineto 0 ty neg rlineto closepath fill tox toy moveto 0 setgray show}bind def
/nl{currentpoint exch pop lmargin exch moveto 0 -10 rmoveto}def/=={/cp 0 def
typeprint nl}def/typeprint{dup type exec}readonly def/lmargin 72 def/rmargin 72
def/tprint{dup length cp add rmargin gt{nl/cp 0 def}if dup length cp add/cp
exch def prnt}readonly def/cvsprint{=string cvs tprint( )tprint}readonly def
/integertype{cvsprint}readonly def/realtype{cvsprint}readonly def/booleantype
{cvsprint}readonly def/operatortype{(--)tprint =string cvs tprint(-- )tprint}
readonly def/marktype{pop(-mark- )tprint}readonly def/dicttype{pop
(-dictionary- )tprint}readonly def/nulltype{pop(-null- )tprint}readonly def
/filetype{pop(-filestream- )tprint}readonly def/savetype{pop(-savelevel- )
tprint}readonly def/fonttype{pop(-fontid- )tprint}readonly def/nametype{dup
xcheck not{(/)tprint}if cvsprint}readonly def/stringtype{dup rcheck{(\()tprint
tprint(\))tprint}{pop(-string- )tprint}ifelse}readonly def/arraytype{dup rcheck
{dup xcheck{({)tprint{typeprint}forall(})tprint}{([)tprint{typeprint}forall(])
tprint}ifelse}{pop(-array- )tprint}ifelse}readonly def/packedarraytype{dup
rcheck{dup xcheck{({)tprint{typeprint}forall(})tprint}{([)tprint{typeprint}
forall(])tprint}ifelse}{pop(-packedarray- )tprint}ifelse}readonly def/courier
/Courier findfont 10 scalefont def end errordict/handleerror{systemdict begin
$error begin $brkpage begin newerror{/newerror false store vmstatus pop pop 0
ne{grestoreall}if errorname(VMerror)ne{showpage}if initgraphics courier setfont
lmargin 720 moveto errorname(VMerror)eq{userdict/ehsave known{clear userdict
/ehsave get restore 2 vmreclaim}if vmstatus exch pop exch pop PrtVMMsg}{
(ERROR: )prnt errorname prnt nl(OFFENDING COMMAND: )prnt/command load prnt
$error/ostack known{nl nl(STACK:)prnt nl nl $error/ostack get aload length{==}
repeat}if}ifelse systemdict/showpage get exec(%%[ Error: )print errorname
=print(; OffendingCommand: )print/command load =print( ]%%)= flush}if end end
end}dup 0 systemdict put dup 4 $brkpage put bind readonly put/currentpacking
where{pop/setpacking where{pop oldpack setpacking}if}if
%%EndResource
userdict /Pscript_WinNT_Incr 230 dict dup begin put
%%BeginResource: file Pscript_FatalError 5.0 0
userdict begin/FatalErrorIf{{initgraphics findfont 1 index 0 eq{exch pop}{dup
length dict begin{1 index/FID ne{def}{pop pop}ifelse}forall/Encoding
{ISOLatin1Encoding}stopped{StandardEncoding}if def currentdict end
/ErrFont-Latin1 exch definefont}ifelse exch scalefont setfont counttomark 3 div
cvi{moveto show}repeat showpage quit}{cleartomark}ifelse}bind def end
%%EndResource
userdict begin/PrtVMMsg{vmstatus exch sub exch pop gt{[
(This job requires more memory than is available in this printer.)100 500
(Try one or more of the following, and then print again:)100 485
(For the output format, choose Optimize For Portability.)115 470
(In the Device Settings page, make sure the Available PostScript Memory is accurate.)
115 455(Reduce the number of fonts in the document.)115 440
(Print the document in parts.)115 425 12/Times-Roman showpage
(%%[ PrinterError: Low Printer VM ]%%)= true FatalErrorIf}if}bind def end
version cvi 2016 ge{/VM?{pop}bind def}{/VM? userdict/PrtVMMsg get def}ifelse
105000 VM?
%%BeginResource: file Pscript_Win_Basic 5.0 0
/d/def load def/,/load load d/~/exch , d/?/ifelse , d/!/pop , d/`/begin , d/^
/index , d/@/dup , d/+/translate , d/$/roll , d/U/userdict , d/M/moveto , d/-
/rlineto , d/&/currentdict , d/:/gsave , d/;/grestore , d/F/false , d/T/true ,
d/N/newpath , d/E/end , d/Ac/arc , d/An/arcn , d/A/ashow , d/D/awidthshow , d/C
/closepath , d/V/div , d/O/eofill , d/L/fill , d/I/lineto , d/-c/curveto , d/-M
/rmoveto , d/+S/scale , d/Ji/setfont , d/Lc/setlinecap , d/Lj/setlinejoin , d
/Lw/setlinewidth , d/Lm/setmiterlimit , d/sd/setdash , d/S/show , d/LH/showpage
, d/K/stroke , d/W/widthshow , d/R/rotate , d/L2? false/languagelevel where{pop
languagelevel 2 ge{pop true}if}if d L2?{/xS/xshow , d/yS/yshow , d/zS/xyshow ,
d}if/b{bind d}bind d/bd{bind d}bind d/xd{~ d}bd/ld{, d}bd/bn/bind ld/lw/Lw ld
/lc/Lc ld/lj/Lj ld/sg/setgray ld/ADO_mxRot null d/self & d/OrgMx matrix
currentmatrix d/reinitialize{: OrgMx setmatrix[/TextInit/GraphInit/UtilsInit
counttomark{@ where{self eq}{F}?{cvx exec}{!}?}repeat cleartomark ;}b
/initialize{`{/Pscript_Win_Data where{!}{U/Pscript_Win_Data & put}?/ADO_mxRot ~
d/TextInitialised? F d reinitialize E}{U/Pscript_Win_Data 230 dict @ ` put
/ADO_mxRot ~ d/TextInitialised? F d reinitialize}?}b/terminate{!{& self eq
{exit}{E}?}loop E}b/suspend/terminate , d/resume{` Pscript_Win_Data `}b U `
/lucas 21690 d/featurebegin{countdictstack lucas[}b/featurecleanup{stopped
{cleartomark @ lucas eq{! exit}if}loop countdictstack ~ sub @ 0 gt{{E}repeat}
{!}?}b E/snap{transform 0.25 sub round 0.25 add ~ 0.25 sub round 0.25 add ~
itransform}b/dsnap{dtransform round ~ round ~ idtransform}b/nonzero_round{@ 0.5
ge{round}{@ -0.5 lt{round}{0 ge{1}{-1}?}?}?}b/nonzero_dsnap{dtransform
nonzero_round ~ nonzero_round ~ idtransform}b U<04>cvn{}put/rr{1 ^ 0 - 0 ~ -
neg 0 - C}b/irp{4 -2 $ + +S fx 4 2 $ M 1 ^ 0 - 0 ~ - neg 0 -}b/rp{4 2 $ M 1 ^ 0
- 0 ~ - neg 0 -}b/solid{[]0 sd}b/g{@ not{U/DefIf_save save put}if U/DefIf_bool
2 ^ put}b/DefIf_El{if U/DefIf_bool get not @{U/DefIf_save get restore}if}b/e
{DefIf_El !}b/UDF{L2?{undefinefont}{!}?}b/UDR{L2?{undefineresource}{! !}?}b
/freeVM{/Courier findfont[40 0 0 -40 0 0]makefont Ji 2 vmreclaim}b/hfRedefFont
{findfont @ length dict `{1 ^/FID ne{d}{! !}?}forall & E @ ` ~{/CharStrings 1
dict `/.notdef 0 d & E d}if/Encoding 256 array 0 1 255{1 ^ ~/.notdef put}for d
E definefont !}bind d/hfMkCIDFont{/CIDFont findresource @ length 2 add dict `{1
^ @/FID eq ~ @/XUID eq ~/UIDBase eq or or{! !}{d}?}forall/CDevProc ~ d/Metrics2
16 dict d/CIDFontName 1 ^ d & E 1 ^ ~/CIDFont defineresource ![~]composefont !}
bind d
%%EndResource
%%BeginResource: file Pscript_Win_Utils_L2 5.0 0
/rf/rectfill , d/fx{1 1 dtransform @ 0 ge{1 sub 0.5}{1 add -0.5}? 3 -1 $ @ 0 ge
{1 sub 0.5}{1 add -0.5}? 3 1 $ 4 1 $ idtransform 4 -2 $ idtransform}b/BZ{4 -2 $
snap + +S fx rf}b/rs/rectstroke , d/rc/rectclip , d/UtilsInit{currentglobal{F
setglobal}if}b/scol{! setcolor}b/colspA/DeviceGray d/colspABC/DeviceRGB d
/colspRefresh{colspABC setcolorspace}b/SetColSpace{colspABC setcolorspace}b
/resourcestatus where{!/ColorRendering/ProcSet resourcestatus{! ! T}{F}?}{F}?
not{/ColorRendering<>/defineresource where{!/ProcSet
defineresource !}{! !}?}if/buildcrdname{/ColorRendering/ProcSet findresource `
mark GetHalftoneName @ type @/nametype ne ~/stringtype ne and{!/none}if(.)
GetPageDeviceName @ type @/nametype ne ~/stringtype ne and{!/none}if(.)5 ^ 0 5
-1 1{^ length add}for string 6 1 $ 5 ^ 5{~ 1 ^ cvs length 1 ^ length 1 ^ sub
getinterval}repeat ! cvn 3 1 $ ! ! E}b/definecolorrendering{~ buildcrdname ~
/ColorRendering defineresource !}b/findcolorrendering where{!}{
/findcolorrendering{buildcrdname @/ColorRendering resourcestatus{! ! T}{
/ColorRendering/ProcSet findresource ` GetSubstituteCRD E F}?}b}?
/selectcolorrendering{findcolorrendering !/ColorRendering findresource
setcolorrendering}b/G2UBegin{findresource/FontInfo get/GlyphNames2Unicode get
`}bind d/G2CCBegin{findresource/FontInfo get/GlyphNames2HostCode get `}bind d
/G2UEnd{E}bind d/AddFontInfoBegin{/FontInfo 8 dict @ `}bind d/AddFontInfo{
/GlyphNames2Unicode 16 dict d/GlyphNames2HostCode 16 dict d}bind d
/AddFontInfoEnd{E d}bind d/T0AddCFFMtx2{/CIDFont findresource/Metrics2 get ` d
E}bind d
%%EndResource
end
%%EndProlog
%%BeginSetup
statusdict begin (%%[ ProductName: ) print product print ( ]%%)= flush end
[ 0 1 -1 0 0 0 ] false Pscript_WinNT_Incr dup /initialize get exec
featurebegin{
%%BeginNonPPDFeature: JobTimeout 0
0 /languagelevel where{pop languagelevel}{1}ifelse 2 ge{1 dict dup/JobTimeout 4 -1 roll put setuserparams}{statusdict/setjobtimeout get exec}ifelse
%%EndNonPPDFeature
}featurecleanup
featurebegin{
%%BeginNonPPDFeature: WaitTimeout 300
300 /languagelevel where{pop languagelevel}{1}ifelse 2 ge{1 dict dup/WaitTimeout 4 -1 roll put setuserparams}{statusdict/waittimeout 3 -1 roll put}ifelse
%%EndNonPPDFeature
}featurecleanup
featurebegin{
%%BeginFeature: *Resolution 300dpi
%%EndFeature
}featurecleanup
1 setlinecap 1 setlinejoin
/mysetup [ 0 72 300 V 72 300 V 0 18 23.00031 ] def
%%EndSetup
userdict begin /ehsave save def end
%%Page: 1 1
%%PageBoundingBox: 18 23 577 819
%%EndPageComments
%%BeginPageSetup
/DeviceRGB dup setcolorspace /colspABC exch def
mysetup concat colspRefresh
%%EndPageSetup
Pscript_WinNT_Incr begin
%%BeginResource: file Pscript_Win_GdiObject 5.0 0
/SavedCTM null d/CTMsave{/SavedCTM SavedCTM currentmatrix d}b/CTMrestore
{SavedCTM setmatrix}b/mp null d/ADO_mxRot null d/GDIHMatrix null d
/GDIHPatternDict 22 dict d GDIHPatternDict `/PatternType 1 d/PaintType 2 d/Reps
L2?{1}{5}? d/XStep 8 Reps mul d/YStep XStep d/BBox[0 0 XStep YStep]d/TilingType
1 d/PaintProc{` 1 Lw[]0 sd PaintData , exec E}b/FGnd null d/BGnd null d
/HS_Horizontal{horiz}b/HS_Vertical{vert}b/HS_FDiagonal{fdiag}b/HS_BDiagonal
{biag}b/HS_Cross{horiz vert}b/HS_DiagCross{fdiag biag}b/MaxXYStep XStep YStep
gt{XStep}{YStep}? d/horiz{Reps{0 4 M XStep 0 - 0 8 +}repeat 0 -8 Reps mul + K}b
/vert{Reps{4 0 M 0 YStep - 8 0 +}repeat 0 -8 Reps mul + K}b/biag{Reps{0 0 M
MaxXYStep @ - 0 YStep neg M MaxXYStep @ - 0 8 +}repeat 0 -8 Reps mul + 0 YStep
M 8 8 - K}b/fdiag{Reps{0 0 M MaxXYStep @ neg - 0 YStep M MaxXYStep @ neg - 0 8
+}repeat 0 -8 Reps mul + MaxXYStep @ M 8 -8 - K}b E/makehatch{4 -2 $/yOrg ~ d
/xOrg ~ d GDIHPatternDict/PaintData 3 -1 $ put CTMsave GDIHMatrix setmatrix
GDIHPatternDict matrix xOrg yOrg + mp CTMrestore ~ U ~ 2 ^ put}b/h0{/h0
/HS_Horizontal makehatch}b/h1{/h1/HS_Vertical makehatch}b/h2{/h2/HS_FDiagonal
makehatch}b/h3{/h3/HS_BDiagonal makehatch}b/h4{/h4/HS_Cross makehatch}b/h5{/h5
/HS_DiagCross makehatch}b/GDIBWPatternMx null d/pfprep{save 8 1 $
/PatternOfTheDay 8 1 $ GDIBWPatternDict `/yOrg ~ d/xOrg ~ d/PaintData ~ d/yExt
~ d/Width ~ d/BGnd ~ d/FGnd ~ d/Height yExt RepsV mul d/mx[Width 0 0 Height 0
0]d E build_pattern ~ !}b/pfbf{/fEOFill ~ d pfprep hbf fEOFill{O}{L}? restore}b
/GraphInit{GDIHMatrix null eq{/SavedCTM matrix d : ADO_mxRot concat 0 0 snap +
: 0.48 @ GDIHPatternDict ` YStep mul ~ XStep mul ~ nonzero_dsnap YStep V ~
XStep V ~ E +S/GDIHMatrix matrix currentmatrix readonly d ; : 0.24 -0.24 +S
GDIBWPatternDict ` Width Height E nonzero_dsnap +S/GDIBWPatternMx matrix
currentmatrix readonly d ; ;}if}b
%%EndResource
%%BeginResource: file Pscript_Win_GdiObject_L2 5.0 0
/GDIBWPatternDict 25 dict @ `/PatternType 1 d/PaintType 1 d/RepsV 1 d/RepsH 1 d
/BBox[0 0 RepsH 1]d/TilingType 1 d/XStep 1 d/YStep 1 d/Height 8 RepsV mul d
/Width 8 d/mx[Width 0 0 Height neg 0 Height]d/FGnd null d/BGnd null d
/SetBGndFGnd{BGnd null ne{BGnd aload ! scol BBox aload ! 2 ^ sub ~ 3 ^ sub ~
rf}if FGnd null ne{FGnd aload ! scol}if}b/PaintProc{` SetBGndFGnd RepsH{Width
Height F mx PaintData imagemask Width 0 +}repeat E}b E d/mp/makepattern , d
/build_pattern{CTMsave GDIBWPatternMx setmatrix/nupangle where{! nupangle -90
eq{nupangle R}if}if GDIBWPatternDict @ ` Width Height ne{Width Height gt{Width
Height V 1}{1 Height Width V}? +S}if xOrg yOrg E matrix + mp CTMrestore}b/hbf
{setpattern}b/hf{:/fEOFill ~ d ~ ! setpattern fEOFill{O}{L}? ;}b/pbf{: !
/fEOFill ~ d GDIBWPatternDict `/yOrg ~ d/xOrg ~ d/PaintData ~ d/OutputBPP ~ d
/Height ~ d/Width ~ d/PaintType 1 d/PatternType 1 d/TilingType 1 d/BBox[0 0
Width Height]d/XStep Width d/YStep Height d/mx xOrg yOrg matrix + d 20 dict @ `
/ImageType 1 d/Width Width d/Height Height d/ImageMatrix[1 0 0 1 0 0]d
/BitsPerComponent 8 d OutputBPP 24 eq{/Decode[0 1 0 1 0 1]d}{OutputBPP 8 eq{
/Decode[0 1]d}{/Decode[0 1 0 1 0 1 0 1]d}?}?/DataSource{PaintData}d E/ImageDict
~ d/PaintProc{` ImageDict image E}b & mx makepattern setpattern E fEOFill{O}{L}
? ;}b/mask_pbf{:/fEOFill ~ d 20 dict `/yOrg ~ d/xOrg ~ d/PaintData ~ d/Height ~
d/Width ~ d/PatternType 1 d/PaintType 2 d/TilingType 1 d/BBox[0 0 Width Height]
d/XStep Width d/YStep Height d/mx xOrg yOrg matrix + d/PaintProc{` Width Height
T 1 1 dtransform abs ~ abs ~ 0 0 3 -1 $ 0 0 6 array astore{PaintData}imagemask
E}b & mx makepattern setpattern E fEOFill{O}{L}? ;}b
%%EndResource
end reinitialize
/DeviceGray dup setcolorspace /colspABC exch def
: N 158 39 3000 2250 rp C
1 0 scol L ; 0 0 scol Pscript_WinNT_Incr begin
%%BeginResource: file Pscript_Text 5.0 0
/TextInit{TextInitialised? not{/Pscript_Windows_Font & d/TextInitialised? T d
/fM[1 0 0 1 0 0]d/mFM matrix d/iMat[1 0 0.212557 1 0 0]d}if}b/copyfont{1 ^
length add dict `{1 ^/FID ne{d}{! !}?}forall & E}b/EncodeDict 11 dict d/bullets
{{/bullet}repeat}b/rF{3 copyfont @ ` ~ EncodeDict ~ get/Encoding ~ 3 ^/0 eq{&
/CharStrings known{CharStrings/Eth known not{! EncodeDict/ANSIEncodingOld get}
if}if}if d E}b/mF{@ 7 1 $ findfont ~{@/Encoding get @ StandardEncoding eq{! T}{
{ISOLatin1Encoding}stopped{! F}{eq}?{T}{@ ` T 32 1 127{Encoding 1 ^ get
StandardEncoding 3 -1 $ get eq and}for E}?}?}{F}?{1 ^ ~ rF}{0 copyfont}? 6 -2 $
! ! ~ !/pd_charset @ where{~ get 128 eq{@ FDV 2 copy get @ length array copy
put pd_CoverFCRange}if}{!}? 2 ^ ~ definefont fM 5 4 -1 $ put fM 4 0 put fM
makefont Pscript_Windows_Font 3 1 $ put}b/sLT{: Lw -M currentpoint snap M 0 - 0
Lc K ;}b/xUP null d/yUP null d/uW null d/xSP null d/ySP null d/sW null d/sSU{N
/uW ~ d/yUP ~ d/xUP ~ d}b/sU{xUP yUP uW sLT}b/sST{N/sW ~ d/ySP ~ d/xSP ~ d}b/sT
{xSP ySP sW sLT}b/sR{: + R 0 0 M}b/sRxy{: matrix astore concat 0 0 M}b/eR/; , d
/AddOrigFP{{&/FontInfo known{&/FontInfo get length 6 add}{6}? dict `
/WinPitchAndFamily ~ d/WinCharSet ~ d/OrigFontType ~ d/OrigFontStyle ~ d
/OrigFontName ~ d & E/FontInfo ~ d}{! ! ! ! !}?}b/mFS{makefont
Pscript_Windows_Font 3 1 $ put}b/mF42D{0 copyfont `/FontName ~ d 2 copy ~ sub 1
add dict `/.notdef 0 d 2 copy 1 ~{@ 3 ^ sub Encoding ~ get ~ d}for & E
/CharStrings ~ d ! ! & @ E/FontName get ~ definefont}b/mF42{15 dict ` @ 4 1 $
FontName ~ d/FontType 0 d/FMapType 2 d/FontMatrix[1 0 0 1 0 0]d 1 ^ 254 add 255
idiv @ array/Encoding ~ d 0 1 3 -1 $ 1 sub{@ Encoding 3 1 $ put}for/FDepVector
Encoding length array d/CharStrings 2 dict `/.notdef 0 d & E d 0 1 Encoding
length 1 sub{@ @ 10 lt{! FontName length 1 add string}{100 lt{FontName length 2
add string}{FontName length 3 add string}?}? @ 0 FontName @ length string cvs
putinterval @ 3 -1 $ @ 4 1 $ 3 string cvs FontName length ~ putinterval cvn 1 ^
256 mul @ 255 add 3 -1 $ 4 ^ findfont mF42D FDepVector 3 1 $ put}for & @ E
/FontName get ~ definefont ! ! ! mF}b/mF_OTF_V{~ ! ~ ! 4 -1 $ ! findfont 2 ^ ~
definefont fM @ @ 4 6 -1 $ neg put 5 0 put 90 matrix R matrix concatmatrix
makefont Pscript_Windows_Font 3 1 $ put}b/mF_TTF_V{3{~ !}repeat 3 -1 $ !
findfont 1 ^ ~ definefont Pscript_Windows_Font 3 1 $ put}b/UmF{L2?
{Pscript_Windows_Font ~ undef}{!}?}b/UmF42{@ findfont/FDepVector get{/FontName
get undefinefont}forall undefinefont}b
%%EndResource
end reinitialize
Pscript_WinNT_Incr begin
%%BeginResource: file Pscript_Encoding256 5.0 0
/CharCol256Encoding[/.notdef/breve/caron/dotaccent/dotlessi/fi/fl/fraction
/hungarumlaut/Lslash/lslash/minus/ogonek/ring/Zcaron/zcaron/.notdef/.notdef
/.notdef/.notdef/.notdef/.notdef/.notdef/.notdef/.notdef/.notdef/.notdef
/.notdef/.notdef/.notdef/.notdef/.notdef/space/exclam/quotedbl/numbersign
/dollar/percent/ampersand/quotesingle/parenleft/parenright/asterisk/plus/comma
/hyphen/period/slash/zero/one/two/three/four/five/six/seven/eight/nine/colon
/semicolon/less/equal/greater/question/at/A/B/C/D/E/F/G/H/I/J/K/L/M/N/O/P/Q/R/S
/T/U/V/W/X/Y/Z/bracketleft/backslash/bracketright/asciicircum/underscore/grave
/a/b/c/d/e/f/g/h/i/j/k/l/m/n/o/p/q/r/s/t/u/v/w/x/y/z/braceleft/bar/braceright
/asciitilde/.notdef/Euro/.notdef/quotesinglbase/florin/quotedblbase/ellipsis
/dagger/daggerdbl/circumflex/perthousand/Scaron/guilsinglleft/OE/.notdef
/.notdef/.notdef/.notdef/quoteleft/quoteright/quotedblleft/quotedblright/bullet
/endash/emdash/tilde/trademark/scaron/guilsinglright/oe/.notdef/.notdef
/Ydieresis/.notdef/exclamdown/cent/sterling/currency/yen/brokenbar/section
/dieresis/copyright/ordfeminine/guillemotleft/logicalnot/.notdef/registered
/macron/degree/plusminus/twosuperior/threesuperior/acute/mu/paragraph
/periodcentered/cedilla/onesuperior/ordmasculine/guillemotright/onequarter
/onehalf/threequarters/questiondown/Agrave/Aacute/Acircumflex/Atilde/Adieresis
/Aring/AE/Ccedilla/Egrave/Eacute/Ecircumflex/Edieresis/Igrave/Iacute
/Icircumflex/Idieresis/Eth/Ntilde/Ograve/Oacute/Ocircumflex/Otilde/Odieresis
/multiply/Oslash/Ugrave/Uacute/Ucircumflex/Udieresis/Yacute/Thorn/germandbls
/agrave/aacute/acircumflex/atilde/adieresis/aring/ae/ccedilla/egrave/eacute
/ecircumflex/edieresis/igrave/iacute/icircumflex/idieresis/eth/ntilde/ograve
/oacute/ocircumflex/otilde/odieresis/divide/oslash/ugrave/uacute/ucircumflex
/udieresis/yacute/thorn/ydieresis]def EncodeDict/256 CharCol256Encoding put
%%EndResource
end reinitialize
%%IncludeResource: font Times-Roman
Pscript_WinNT_Incr begin
%%BeginResource: file Pscript_Win_Euro_L2 5.0 0
/UseT3EuroFont{/currentdistillerparams where{pop currentdistillerparams
/CoreDistVersion get 4000 le}{false}ifelse}bind def/NewEuroT3Font?{dup/FontType
get 3 eq{dup/EuroFont known exch/BaseFont known and}{pop false}ifelse}bind def
/T1FontHasEuro{dup/CharStrings known not{dup NewEuroT3Font?{dup/EuroGlyphName
get exch/EuroFont get/CharStrings get exch known{true}{false}ifelse}{pop false}
ifelse}{dup/FontType get 1 eq{/CharStrings get/Euro known}{dup/InfoDict known{
/InfoDict get/Euro known}{/CharStrings get/Euro known}ifelse}ifelse}ifelse}bind
def/FontHasEuro{findfont dup/Blend known{pop true}{T1FontHasEuro}ifelse}bind
def/EuroEncodingIdx 1 def/EuroFontHdr{12 dict begin/FontInfo 10 dict dup begin
/version(001.000)readonly def/Notice(Copyright (c)1999 Adobe Systems
Incorporated. All Rights Reserved.)readonly def/FullName(Euro)readonly def
/FamilyName(Euro)readonly def/Weight(Regular)readonly def/isFixedPitch false
def/ItalicAngle 0 def/UnderlinePosition -100 def/UnderlineThickness 50 def end
readonly def/FontName/Euro def/Encoding 256 array 0 1 255{1 index exch/.notdef
put}for def/PaintType 0 def/FontType 1 def/FontMatrix[0.001 0 0 0.001 0 0]def
/FontBBox{-25 -23 1500 804}readonly def currentdict end dup/Private 20 dict dup
begin/ND{def}def/NP{put}def/lenIV -1 def/RD{string currentfile exch
readhexstring pop}def/-|{string currentfile exch readstring pop}executeonly def
/|-{def}executeonly def/|{put}executeonly def/BlueValues[-20 0 706 736 547 572]
|-/OtherBlues[-211 -203]|-/BlueScale 0.0312917 def/MinFeature{16 16}|-/StdHW
[60]|-/StdVW[71]|-/ForceBold false def/password 5839 def/Erode{8.5 dup 3 -1
roll 0.1 mul exch 0.5 sub mul cvi sub dup mul 71 0 dtransform dup mul exch dup
mul add le{pop pop 1.0 1.0}{pop pop 0.0 1.5}ifelse}def/OtherSubrs[{}{}{}
{systemdict/internaldict known not{pop 3}{1183615869 systemdict/internaldict
get exec dup/startlock known{/startlock get exec}{dup/strtlck known{/strtlck
get exec}{pop 3}ifelse}ifelse}ifelse}executeonly]|-/Subrs 5 array dup 0
<8E8B0C100C110C110C210B>put dup 1<8B8C0C100B>put dup 2<8B8D0C100B>put dup 3<0B>
put dup 4<8E8C8E0C100C110A0B>put |- 2 index/CharStrings 256 dict dup begin
/.notdef<8b8b0d0e>def end end put put dup/FontName get exch definefont pop}bind
def/AddEuroGlyph{2 index exch EuroEncodingIdx 1 eq{EuroFontHdr}if systemdict
begin/Euro findfont dup dup/Encoding get 5 1 roll/Private get begin/CharStrings
get dup 3 index known{pop pop pop pop end end}{begin 1 index exch def end end
end EuroEncodingIdx dup 1 add/EuroEncodingIdx exch def exch put}ifelse}bind def
/GetNewXUID{currentdict/XUID known{[7 XUID aload pop]true}{currentdict/UniqueID
known{[7 UniqueID]true}{false}ifelse}ifelse}bind def/BuildT3EuroFont{exch 16
dict begin dup/FontName exch def findfont dup/Encoding get/Encoding exch def
dup length 1 add dict copy dup/FID undef begin dup dup/FontName exch def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for def GetNewXUID{/XUID
exch def}if currentdict end definefont pop/BaseFont exch findfont 1000
scalefont def/EuroFont exch findfont 1000 scalefont def pop/EuroGlyphName exch
def/FontType 3 def/FontMatrix[.001 0 0 .001 0 0]def/FontBBox BaseFont/FontBBox
get def/Char 1 string def/BuildChar{exch dup begin/Encoding get 1 index get
/Euro eq{BaseFont T1FontHasEuro{false}{true}ifelse}{false}ifelse{EuroFont
setfont pop userdict/Idx 0 put EuroFont/Encoding get{EuroGlyphName eq{exit}
{userdict/Idx Idx 1 add put}ifelse}forall userdict/Idx get}{dup dup Encoding
exch get BaseFont/Encoding get 3 1 roll put BaseFont setfont}ifelse Char 0 3 -1
roll put Char stringwidth newpath 0 0 moveto Char true charpath flattenpath
pathbbox setcachedevice 0 0 moveto Char show end}bind def currentdict end dup
/FontName get exch definefont pop}bind def/AddEuroToT1Font{dup findfont dup
length 10 add dict copy dup/FID undef begin/EuroFont 3 -1 roll findfont 1000
scalefont def CharStrings dup length 1 add dict copy begin/Euro{EuroFont
setfont pop EuroGBBox aload pop setcachedevice 0 0 moveto EuroGName glyphshow}
bind def currentdict end/CharStrings exch def GetNewXUID{/XUID exch def}if 3 1
roll/EuroGBBox exch def/EuroGName exch def currentdict end definefont pop}bind
def/BuildNewFont{UseT3EuroFont{BuildT3EuroFont}{pop AddEuroToT1Font}ifelse}bind
def/UseObliqueEuro{findfont/FontMatrix get dup 2 get 0 eq exch dup 0 get exch 3
get eq and UseT3EuroFont or}bind def
%%EndResource
end reinitialize
7500 VM?
/Times-Roman FontHasEuro not
{
/Euro.Times-Roman
[500 0 24 -14 493 676 ]
AddEuroGlyph
/Euro /Times-Roman /Times-Roman-Copy BuildNewFont
} if
F /F0 0 /256 T /Times-Roman mF
/F0S9A F0 [154 0 0 -154 0 0 ] mFS
F0S9A Ji
188 203 M (function)[51 77 77 68 43 43 77 0]xS
740 203 M (propagateUpdate)[77 51 77 77 68 78 68 43 68 111 77 77 68 43 0]xS
1830 203 M (\(Node )[52 111 77 78 68 0]xS
%%IncludeResource: font Times-Italic
7500 VM?
/Times-Italic FontHasEuro not
{
/Euro.Times-Italic
[500 0 23 -7 578 676 ]
AddEuroGlyph
/Euro /Times-Italic /Times-Italic-Copy BuildNewFont
} if
F /F1 0 /256 T /Times-Italic mF
/F1S9A F1 [154 0 0 -154 0 0 ] mFS
F1S9A Ji
2255 203 M (n)S
F0S9A Ji
2332 203 M (, Update )[39 39 111 77 77 68 43 68 0]xS
F1S9A Ji
2893 203 M (up)[77 0]xS
F0S9A Ji
3047 203 M (\))S
343 391 M (Sequence )[86 68 77 77 68 77 68 68 0]xS
F1S9A Ji
971 391 M (r)S
%%IncludeResource: font Symbol
F /F2 0 /2 F /Symbol mF
/F2S9AI34Y00 F2 [154 0 52.668 -154 0 0 ] mFS
F2S9AI34Y00 Ji
1069 391 M S
/F2S9A F2 [154 0 0 -154 0 0 ] mFS
F2S9A Ji
1260 391 M S
F0S9A Ji
1387 391 M (, )[39 0]xS
F1S9A Ji
1465 391 M (s)S
F2S9AI34Y00 Ji
1563 391 M S
F2S9A Ji
1754 391 M S
F0S9A Ji
343 573 M (if \()[43 50 39 0]xS
F1S9A Ji
526 573 M (n)S
F0S9A Ji
642 573 M (is leaf\))[43 60 39 43 68 68 51 0]xS
F1S9A Ji
497 761 M (r )[60 0]xS
F2S9AI34Y00 Ji
596 761 M S
F1S9A Ji
786 761 M (n.op.)[77 39 77 77 0]xS
1095 761 M (operatorPropagate)[76 77 68 60 77 43 77 60 94 60 77 77 77 77 78 43 0]xS
2323 761 M (\(up\))[51 77 77 0]xS
F0S9A Ji
343 943 M (else)[68 43 60 0]xS
497 1127 M (for \()[50 78 51 39 0]xS
F1S9A Ji
766 1127 M (all children ch)[77 43 43 39 68 77 43 42 77 60 68 77 39 68 0]xS
/F1S68 F1 [104 0 0 -104 0 0 ] mFS
F1S68 Ji
1664 1165 M (i)S
F1S9A Ji
1732 1127 M (of n)[77 43 39 0]xS
F0S9A Ji
1968 1127 M (\))S
F1S9A Ji
651 1315 M (s )[60 0]xS
F2S9AI34Y00 Ji
750 1315 M S
F1S9A Ji
940 1315 M (s +)[60 39 0]xS
1181 1315 M (propagateUpdate)[77 60 77 77 77 77 77 43 68 111 77 77 77 44 0]xS
2307 1315 M (\(ch)[51 68 0]xS
F1S68 Ji
2503 1353 M (i )[29 0]xS
F1S9A Ji
2558 1315 M (,)S
2623 1315 M (up\))[77 77 0]xS
F0S9A Ji
497 1497 M (for \()[50 78 51 39 0]xS
F1S9A Ji
766 1497 M (all updates)[77 43 43 39 77 77 77 77 43 68 0]xS
1486 1497 M (up)[77 0]xS
F1S68 Ji
1640 1535 M (i)S
F1S9A Ji
1708 1497 M (in s)[43 77 39 0]xS
F0S9A Ji
1927 1497 M (\))S
F1S9A Ji
651 1685 M (r )[60 0]xS
F2S9AI34Y00 Ji
750 1685 M S
F1S9A Ji
940 1685 M (r + n.op. )[60 39 104 38 77 39 77 77 39 0]xS
1529 1685 M (operatorPropagate)[77 77 68 60 77 43 77 60 93 60 77 77 77 77 77 43 0]xS
2756 1685 M (\()S
2807 1685 M (up)[77 0]xS
F1S68 Ji
2961 1723 M (i)S
F1S9A Ji
2990 1685 M (\))S
F0S9A Ji
343 1867 M (return )[51 68 43 77 51 77 0]xS
F1S9A Ji
749 1867 M (r)S
LH
(%%[Page: 1]%%) =
%%PageTrailer
%%Trailer
%%BoundingBox: 18 23 577 819
%%DocumentNeededResources:
%%+ font Times-Roman
%%+ font Times-Italic
%%+ font Symbol
%%DocumentSuppliedResources:
%%+ procset Pscript_WinNT_ErrorHandler 5.0 0
%%+ procset Pscript_FatalError 5.0 0
%%+ procset Pscript_Win_Basic 5.0 0
%%+ procset Pscript_Win_Utils_L2 5.0 0
%%+ procset Pscript_Win_GdiObject 5.0 0
%%+ procset Pscript_Win_GdiObject_L2 5.0 0
%%+ procset Pscript_Text 5.0 0
%%+ procset Pscript_Encoding256 5.0 0
%%+ procset Pscript_Win_Euro_L2 5.0 0
Pscript_WinNT_Incr dup /terminate get exec
ehsave restore
%%Pages: 1
(%%[LastPage]%%) =
%%EOF
%%EndDocument
@endspecial 984 3709 a
currentpoint grestore moveto
984 3709 a 219 4589 a Fk(Figur)o(e)f(6:)23
b(V)m(iew)c(maintenance)f(algorithm.)-152 4747 y Fl(3.4)99
b(Update)26 b(Pr)n(opagation)f(Example)-77 4855 y Fm(Gi)n(v)o(en)17
b(our)g(e)o(xample)g(vie)n(w)f(query)i(tree)e(depicted)h(in)g(Figure)32
b(7,)17 b(assume)-152 4942 y(the)k(follo)n(wing)f(update)i(primiti)n(v)
o(e)e(is)f(applied)i(to)g(the)f(bib)m(.xml)g(document:)-152
5029 y Fj(Chang)o(eEle\()p Ff(<)p Fj(publisher)p Ff(>)p
Fj(Mor)m(gan)e(Kaufmann)e(Publisher)o(s)p Ff(<)p Fj(/publisher)p
Ff(>)-152 5116 y Fj(,book[1].publisher[1]:bib\))p Fm(.)27
b(This)19 b(update)h(changes)h(the)e(publisher)h(ele-)-152
5203 y(ment)j(of)g(the)g(\002rst)f(book)i(element)f(to)g(be)g(\224Mor)o
(gan)h(Kaufmann)g(Publish-)-152 5290 y(ers\224.)44 b(Then)27
b(we)f(e)o(xpect)g(a)g(ne)n(w)g Ff(B)t(ook)926 5298 y
Fc(Rev)r(iew)1162 5290 y Fm(element)g(to)g(be)g(inserted)-152
5378 y(into)19 b(the)g(result)g(vie)n(w)-5 b(.)2040 3236
y
gsave currentpoint currentpoint translate 0 neg rotate neg exch neg
exch translate
2040 3236 a @beginspecial 17 @llx 10 @lly 495 @urx
783 @ury 4064 @rhi @setspecial
%%BeginDocument: figures/XATtree.eps
%!PS-Adobe-3.0 EPSF-3.0
%%BoundingBox: 17 10 495 783
%%LanguageLevel: 1
%%Creator: CorelDRAW 9
%%Title: Xat1.eps
%%CreationDate: Mon Sep 09 22:31:37 2002
%%DocumentProcessColors: Cyan Magenta Yellow Black
%%DocumentSuppliedResources: (atend)
%%EndComments
%%BeginProlog
/AutoFlatness false def
/AutoSteps 0 def
/CMYKMarks true def
/UseLevel 1 def
%Build: CorelDRAW 9 Version 9.337
%Color profile: Generic offset separations profile
%%BeginResource: procset wCorel9Dict 9.0 0
/wCorel9Dict 300 dict def wCorel9Dict begin
% Copyright (c)1992-1999 Corel Corporation
% All rights reserved. v9.0 r0.5
/bd{bind def}bind def/ld{load def}bd/xd{exch def}bd/_ null def/rp{{pop}repeat}
bd/@cp/closepath ld/@gs/gsave ld/@gr/grestore ld/@np/newpath ld/Tl/translate ld
/$sv 0 def/@sv{/$sv save def}bd/@rs{$sv restore}bd/spg/showpage ld/showpage{}
bd currentscreen/@dsp xd/$dsp/@dsp def/$dsa xd/$dsf xd/$sdf false def/$SDF
false def/$Scra 0 def/SetScr/setscreen ld/@ss{2 index 0 eq{$dsf 3 1 roll 4 -1
roll pop}if exch $Scra add exch load SetScr}bd/SepMode_5 where{pop}{/SepMode_5
0 def}ifelse/CurrentInkName_5 where{pop}{/CurrentInkName_5(Composite)def}
ifelse/$ink_5 where{pop}{/$ink_5 -1 def}ifelse/$c 0 def/$m 0 def/$y 0 def/$k 0
def/$t 1 def/$n _ def/$o 0 def/$fil 0 def/$C 0 def/$M 0 def/$Y 0 def/$K 0 def
/$T 1 def/$N _ def/$O 0 def/$PF false def/s1c 0 def/s1m 0 def/s1y 0 def/s1k 0
def/s1t 0 def/s1n _ def/$bkg false def/SK 0 def/SM 0 def/SY 0 def/SC 0 def/$op
false def matrix currentmatrix/$ctm xd/$ptm matrix def/$ttm matrix def/$stm
matrix def/$ffpnt true def/CorelDrawReencodeVect[16#0/grave 16#5/breve
16#6/dotaccent 16#8/ring 16#A/hungarumlaut 16#B/ogonek 16#C/caron 16#D/dotlessi
16#27/quotesingle 16#60/grave 16#7C/bar
16#82/quotesinglbase/florin/quotedblbase/ellipsis/dagger/daggerdbl
16#88/circumflex/perthousand/Scaron/guilsinglleft/OE
16#91/quoteleft/quoteright/quotedblleft/quotedblright/bullet/endash/emdash
16#98/tilde/trademark/scaron/guilsinglright/oe 16#9F/Ydieresis
16#A1/exclamdown/cent/sterling/currency/yen/brokenbar/section
16#a8/dieresis/copyright/ordfeminine/guillemotleft/logicalnot/minus/registered/macron
16#b0/degree/plusminus/twosuperior/threesuperior/acute/mu/paragraph/periodcentered
16#b8/cedilla/onesuperior/ordmasculine/guillemotright/onequarter/onehalf/threequarters/questiondown
16#c0/Agrave/Aacute/Acircumflex/Atilde/Adieresis/Aring/AE/Ccedilla
16#c8/Egrave/Eacute/Ecircumflex/Edieresis/Igrave/Iacute/Icircumflex/Idieresis
16#d0/Eth/Ntilde/Ograve/Oacute/Ocircumflex/Otilde/Odieresis/multiply
16#d8/Oslash/Ugrave/Uacute/Ucircumflex/Udieresis/Yacute/Thorn/germandbls
16#e0/agrave/aacute/acircumflex/atilde/adieresis/aring/ae/ccedilla
16#e8/egrave/eacute/ecircumflex/edieresis/igrave/iacute/icircumflex/idieresis
16#f0/eth/ntilde/ograve/oacute/ocircumflex/otilde/odieresis/divide
16#f8/oslash/ugrave/uacute/ucircumflex/udieresis/yacute/thorn/ydieresis]def
/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def/Comp?{
/LumSepsDict where{pop false}{/AldusSepsDict where{pop false}{1 0 0 0 @gs
setcmykcolor currentcmykcolor @gr add add add 0 ne 0 1 0 0 @gs setcmykcolor
currentcmykcolor @gr add add add 0 ne 0 0 1 0 @gs setcmykcolor currentcmykcolor
@gr add add add 0 ne 0 0 0 1 @gs setcmykcolor currentcmykcolor @gr add add add
0 ne and and and}ifelse}ifelse}bd/@PL{/LV where{pop LV 2 ge L2? not and{@np
/Courier findfont 12 scalefont setfont 72 144 m
(The PostScript level set in the Corel application is higher than)show 72 132 m
(the PostScript level of this device. Change the PS Level in the Corel)show 72
120 m(application to Level 1 by selecting the PostScript tab in the print)show
72 108 m(dialog, and selecting Level 1 from the Compatibility drop down list.)
show flush spg quit}if}if}bd/@BeginSysCorelDict{systemdict/Corel30Dict known
{systemdict/Corel30Dict get exec}if systemdict/CorelLexDict known{1 systemdict
/CorelLexDict get exec}if}bd/@EndSysCorelDict{systemdict/Corel30Dict known
{end}if/EndCorelLexDict where{pop EndCorelLexDict}if}bd AutoFlatness{/@ifl{dup
currentflat exch sub 10 gt{
([Error: PathTooComplex; OffendingCommand: AnyPaintingOperator]\n)print flush
@np exit}{currentflat 2 add setflat}ifelse}bd/@fill/fill ld/fill{currentflat{
{@fill}stopped{@ifl}{exit}ifelse}bind loop setflat}bd/@eofill/eofill ld/eofill
{currentflat{{@eofill}stopped{@ifl}{exit}ifelse}bind loop setflat}bd/@clip
/clip ld/clip{currentflat{{@clip}stopped{@ifl}{exit}ifelse}bind loop setflat}
bd/@eoclip/eoclip ld/eoclip{currentflat{{@eoclip}stopped{@ifl}{exit}ifelse}
bind loop setflat}bd/@stroke/stroke ld/stroke{currentflat{{@stroke}stopped
{@ifl}{exit}ifelse}bind loop setflat}bd}if L2?{/@ssa{true setstrokeadjust}bd}{
/@ssa{}bd}ifelse/d/setdash ld/j/setlinejoin ld/J/setlinecap ld/M/setmiterlimit
ld/w/setlinewidth ld/O{/$o xd}bd/R{/$O xd}bd/W/eoclip ld/c/curveto ld/C/c ld/l
/lineto ld/L/l ld/rl/rlineto ld/m/moveto ld/n/newpath ld/N/newpath ld/P{11 rp}
bd/u{}bd/U{}bd/A{pop}bd/q/@gs ld/Q/@gr ld/&{}bd/@j{@sv @np}bd/@J{@rs}bd/g{1
exch sub/$k xd/$c 0 def/$m 0 def/$y 0 def/$t 1 def/$n _ def/$fil 0 def}bd/G{1
sub neg/$K xd _ 1 0 0 0/$C xd/$M xd/$Y xd/$T xd/$N xd}bd/k{1 index type
/stringtype eq{/$t xd/$n xd}{/$t 0 def/$n _ def}ifelse/$k xd/$y xd/$m xd/$c xd
/$fil 0 def}bd/K{1 index type/stringtype eq{/$T xd/$N xd}{/$T 0 def/$N _ def}
ifelse/$K xd/$Y xd/$M xd/$C xd}bd/x/k ld/X/K ld/sf{1 index type/stringtype eq{
/s1t xd/s1n xd}{/s1t 0 def/s1n _ def}ifelse/s1k xd/s1y xd/s1m xd/s1c xd}bd/i{
dup 0 ne{setflat}{pop}ifelse}bd/v{4 -2 roll 2 copy 6 -2 roll c}bd/V/v ld/y{2
copy c}bd/Y/y ld/@w{matrix rotate/$ptm xd matrix scale $ptm dup concatmatrix
/$ptm xd 1 eq{$ptm exch dup concatmatrix/$ptm xd}if 1 w}bd/@g{1 eq dup/$sdf xd
{/$scp xd/$sca xd/$scf xd}if}bd/@G{1 eq dup/$SDF xd{/$SCP xd/$SCA xd/$SCF xd}
if}bd/@D{2 index 0 eq{$dsf 3 1 roll 4 -1 roll pop}if 3 copy exch $Scra add exch
load SetScr/$dsp xd/$dsa xd/$dsf xd}bd/$ngx{$SDF{$SCF SepMode_5 0 eq{$SCA}
{$dsa}ifelse $SCP @ss}if}bd/p{/$pm xd 7 rp/$pyf xd/$pxf xd/$pn xd/$fil 1 def}
bd/@MN{2 copy le{pop}{exch pop}ifelse}bd/@MX{2 copy ge{pop}{exch pop}ifelse}bd
/InRange{3 -1 roll @MN @MX}bd/@sqr{dup 0 rl dup 0 exch rl neg 0 rl @cp}bd
/currentscale{1 0 dtransform matrix defaultmatrix idtransform dup mul exch dup
mul add sqrt 0 1 dtransform matrix defaultmatrix idtransform dup mul exch dup
mul add sqrt}bd/@unscale{}bd/wDstChck{2 1 roll dup 3 -1 roll eq{1 add}if}bd
/@dot{dup mul exch dup mul add 1 exch sub}bd/@lin{exch pop abs 1 exch sub}bd
/cmyk2rgb{3{dup 5 -1 roll add 1 exch sub dup 0 lt{pop 0}if exch}repeat pop}bd
/rgb2cmyk{3{1 exch sub 3 1 roll}repeat 3 copy @MN @MN 3{dup 5 -1 roll sub neg
exch}repeat}bd/rgb2g{2 index .299 mul 2 index .587 mul add 1 index .114 mul add
4 1 roll pop pop pop}bd/WaldoColor_5 where{pop}{/SetRgb/setrgbcolor ld/GetRgb
/currentrgbcolor ld/SetGry/setgray ld/GetGry/currentgray ld/SetRgb2 systemdict
/setrgbcolor get def/GetRgb2 systemdict/currentrgbcolor get def/SetHsb
systemdict/sethsbcolor get def/GetHsb systemdict/currenthsbcolor get def
/rgb2hsb{SetRgb2 GetHsb}bd/hsb2rgb{3 -1 roll dup floor sub 3 1 roll SetHsb
GetRgb2}bd/setcmykcolor where{pop/LumSepsDict where{pop/SetCmyk_5{LumSepsDict
/setcmykcolor get exec}def}{/AldusSepsDict where{pop/SetCmyk_5{AldusSepsDict
/setcmykcolor get exec}def}{/SetCmyk_5/setcmykcolor ld}ifelse}ifelse}{
/SetCmyk_5{cmyk2rgb SetRgb}bd}ifelse/currentcmykcolor where{pop/GetCmyk
/currentcmykcolor ld}{/GetCmyk{GetRgb rgb2cmyk}bd}ifelse/setoverprint where
{pop}{/setoverprint{/$op xd}bd}ifelse/currentoverprint where{pop}{
/currentoverprint{$op}bd}ifelse/@tc_5{5 -1 roll dup 1 ge{pop}{4{dup 6 -1 roll
mul exch}repeat pop}ifelse}bd/@trp{exch pop 5 1 roll @tc_5}bd
/setprocesscolor_5{SepMode_5 0 eq{SetCmyk_5}{0 4 $ink_5 sub index exch pop 5 1
roll pop pop pop pop SepsColor true eq{$ink_5 3 gt{1 sub neg SetGry}{0 0 0 4
$ink_5 roll SetCmyk_5}ifelse}{1 sub neg SetGry}ifelse}ifelse}bd
/findcmykcustomcolor where{pop}{/findcmykcustomcolor{5 array astore}bd}ifelse
/setcustomcolor where{pop}{/setcustomcolor{exch aload pop SepMode_5 0 eq{pop
@tc_5 setprocesscolor_5}{CurrentInkName_5 eq{4 index}{0}ifelse 6 1 roll 5 rp 1
sub neg SetGry}ifelse}bd}ifelse/@scc_5{dup type/booleantype eq{setoverprint}{1
eq setoverprint}ifelse dup _ eq{pop setprocesscolor_5 pop}{findcmykcustomcolor
exch setcustomcolor}ifelse SepMode_5 0 eq{true}{GetGry 1 eq currentoverprint
and not}ifelse}bd/colorimage where{pop/ColorImage{colorimage}def}{/ColorImage{
/ncolors xd/$multi xd $multi true eq{ncolors 3 eq{/daqB xd/daqG xd/daqR xd pop
pop exch pop abs{daqR pop daqG pop daqB pop}repeat}{/daqK xd/daqY xd/daqM xd
/daqC xd pop pop exch pop abs{daqC pop daqM pop daqY pop daqK pop}repeat}
ifelse}{/dataaq xd{dataaq ncolors dup 3 eq{/$dat xd 0 1 $dat length 3 div 1 sub
{dup 3 mul $dat 1 index get 255 div $dat 2 index 1 add get 255 div $dat 3 index
2 add get 255 div rgb2g 255 mul cvi exch pop $dat 3 1 roll put}for $dat 0 $dat
length 3 idiv getinterval pop}{4 eq{/$dat xd 0 1 $dat length 4 div 1 sub{dup 4
mul $dat 1 index get 255 div $dat 2 index 1 add get 255 div $dat 3 index 2 add
get 255 div $dat 4 index 3 add get 255 div cmyk2rgb rgb2g 255 mul cvi exch pop
$dat 3 1 roll put}for $dat 0 $dat length ncolors idiv getinterval}if}ifelse}
image}ifelse}bd}ifelse/setcmykcolor{1 5 1 roll _ currentoverprint @scc_5
/$ffpnt xd}bd/currentcmykcolor{GetCmyk}bd/setrgbcolor{rgb2cmyk setcmykcolor}bd
/currentrgbcolor{currentcmykcolor cmyk2rgb}bd/sethsbcolor{hsb2rgb setrgbcolor}
bd/currenthsbcolor{currentrgbcolor rgb2hsb}bd/setgray{dup dup setrgbcolor}bd
/currentgray{currentrgbcolor rgb2g}bd/InsideDCS false def/IMAGE/image ld/image
{InsideDCS{IMAGE}{/EPSDict where{pop SepMode_5 0 eq{IMAGE}{dup type/dicttype eq
{dup/ImageType get 1 ne{IMAGE}{dup dup/BitsPerComponent get 8 eq exch
/BitsPerComponent get 1 eq or currentcolorspace 0 get/DeviceGray eq and{
CurrentInkName_5(Black)eq{IMAGE}{dup/DataSource get/TCC xd/Height get abs{TCC
pop}repeat}ifelse}{IMAGE}ifelse}ifelse}{2 index 1 ne{CurrentInkName_5(Black)eq
{IMAGE}{/TCC xd pop pop exch pop abs{TCC pop}repeat}ifelse}{IMAGE}ifelse}
ifelse}ifelse}{IMAGE}ifelse}ifelse}bd}ifelse/WaldoColor_5 true def/@sft{$tllx
$pxf add dup $tllx gt{$pwid sub}if/$tx xd $tury $pyf sub dup $tury lt{$phei
add}if/$ty xd}bd/@stb{pathbbox/$ury xd/$urx xd/$lly xd/$llx xd}bd/@ep{{cvx exec
}forall}bd/@tp{@sv/$in true def 2 copy dup $lly le{/$in false def}if $phei sub
$ury ge{/$in false def}if dup $urx ge{/$in false def}if $pwid add $llx le{/$in
false def}if $in{@np 2 copy m $pwid 0 rl 0 $phei neg rl $pwid neg 0 rl 0 $phei
rl clip @np $pn cvlit load aload pop 7 -1 roll 5 index sub 7 -1 roll 3 index
sub Tl matrix currentmatrix/$ctm xd @ep pop pop pop pop}{pop pop}ifelse @rs}bd
/@th{@sft 0 1 $tly 1 sub{dup $psx mul $tx add{dup $llx gt{$pwid sub}{exit}
ifelse}loop exch $phei mul $ty exch sub 0 1 $tlx 1 sub{$pwid mul 3 copy 3 -1
roll add exch @tp pop}for pop pop}for}bd/@tv{@sft 0 1 $tlx 1 sub{dup $pwid mul
$tx add exch $psy mul $ty exch sub{dup $ury lt{$phei add}{exit}ifelse}loop 0 1
$tly 1 sub{$phei mul 3 copy sub @tp pop}for pop pop}for}bd/$fm 0 def/wfill{1
$fm eq{fill}{eofill}ifelse}bd/wclip{1 $fm eq{clip}{eoclip}ifelse}bd/@pf{@gs
$ctm setmatrix $pm concat @stb wclip @sv Bburx Bbury $pm itransform/$tury xd
/$turx xd Bbllx Bblly $pm itransform/$tlly xd/$tllx xd newpath $tllx $tlly m
$tllx $tury l $turx $tury l $turx $tlly l $tllx $tlly m @cp pathbbox @rs/$tury
xd/$turx xd/$tlly xd/$tllx xd/$wid $turx $tllx sub def/$hei $tury $tlly sub def
@gs $vectpat{1 0 0 0 0 _ $o @scc_5{wfill}if}{$t $c $m $y $k $n $o @scc_5{
SepMode_5 0 eq $pfrg or{$tllx $tlly Tl $wid $hei scale <00> 8 1 false[8 0 0 1 0
0]{}imagemask}{/$bkg true def}ifelse}if}ifelse @gr $wid 0 gt $hei 0 gt and{$pn
cvlit load aload pop/$pd xd 3 -1 roll sub/$phei xd exch sub/$pwid xd $wid $pwid
div ceiling 1 add/$tlx xd $hei $phei div ceiling 1 add/$tly xd $psx 0 eq{@tv}{
@th}ifelse}if @gr @np/$bkg false def}bd/@Pf{@sv SepMode_5 0 eq $Psc 0 ne or
$ink_5 3 eq or{0 J 0 j[]0 d $t $c $m $y $k $n $o @scc_5 pop $ctm setmatrix 72
1000 div dup matrix scale dup concat dup Bburx exch Bbury exch itransform
ceiling cvi/Bbury xd ceiling cvi/Bburx xd Bbllx exch Bblly exch itransform
floor cvi/Bblly xd floor cvi/Bbllx xd $Prm aload pop $Psn load exec}{1 SetGry
wfill}ifelse @rs @np}bd/F{matrix currentmatrix $sdf{$scf $sca $scp @ss}if $fil
1 eq{@pf}{$fil 2 eq{@ff}{$fil 3 eq{@Pf}{$t $c $m $y $k $n $o @scc_5{wfill}
{@np}ifelse}ifelse}ifelse}ifelse $sdf{$dsf $dsa $dsp @ss}if setmatrix}bd/f{@cp
F}bd/S{matrix currentmatrix $ctm setmatrix $SDF{$SCF $SCA $SCP @ss}if $T $C $M
$Y $K $N $O @scc_5{matrix currentmatrix $ptm concat stroke setmatrix}
{@np}ifelse $SDF{$dsf $dsa $dsp @ss}if setmatrix}bd/s{@cp S}bd/B{@gs F @gr S}
bd/b{@cp B}bd/_E{5 array astore exch cvlit xd}bd/@cc{currentfile $dat
readhexstring pop}bd/@sm{/$ctm $ctm currentmatrix def}bd/@E{/Bbury xd/Bburx xd
/Bblly xd/Bbllx xd}bd/@c{@cp}bd/@p{/$fil 1 def 1 eq dup/$vectpat xd{/$pfrg true
def}{@gs $t $c $m $y $k $n $o @scc_5/$pfrg xd @gr}ifelse/$pm xd/$psy xd/$psx xd
/$pyf xd/$pxf xd/$pn xd}bd/@P{/$fil 3 def/$Psn xd/$Psc xd array astore/$Prm xd
}bd/@ii{concat 3 index 3 index m 3 index 1 index l 2 copy l 1 index 3 index l 3
index 3 index l clip pop pop pop pop}bd/tcc{@cc}def/@i{@sm @gs @ii 6 index 1 ne
{/$frg true def pop pop}{1 eq{s1t s1c s1m s1y s1k s1n $O @scc_5/$frg xd}{/$frg
false def}ifelse 1 eq{@gs $ctm setmatrix F @gr}if}ifelse @np/$ury xd/$urx xd
/$lly xd/$llx xd/$bts xd/$hei xd/$wid xd/$dat $wid $bts mul 8 div ceiling cvi
string def $bkg $frg or{$SDF{$SCF $SCA $SCP @ss}if $llx $lly Tl $urx $llx sub
$ury $lly sub scale $bkg{$t $c $m $y $k $n $o @scc_5 pop}if $wid $hei abs $bts
1 eq{$bkg}{$bts}ifelse[$wid 0 0 $hei neg 0 $hei 0 gt{$hei}{0}ifelse]/tcc load
$bts 1 eq{imagemask}{image}ifelse $SDF{$dsf $dsa $dsp @ss}if}{$hei abs{tcc pop}
repeat}ifelse @gr $ctm setmatrix}bd/@I{@sm @gs @ii @np/$ury xd/$urx xd/$lly xd
/$llx xd/$ncl xd/$bts xd/$hei xd/$wid xd $ngx $llx $lly Tl $urx $llx sub $ury
$lly sub scale $wid $hei abs $bts[$wid 0 0 $hei neg 0 $hei 0 gt{$hei}{0}ifelse
]$msimage false eq $ncl 1 eq or{/$dat $wid $bts mul $ncl mul 8 div ceiling cvi
string def/@cc load false $ncl ColorImage}{$wid $bts mul 8 div ceiling cvi $ncl
3 eq{dup dup/$dat1 exch string def/$dat2 exch string def/$dat3 exch string def
/@cc1 load/@cc2 load/@cc3 load}{dup dup dup/$dat1 exch string def/$dat2 exch
string def/$dat3 exch string def/$dat4 exch string def/@cc1 load/@cc2 load
/@cc3 load/@cc4 load}ifelse true $ncl ColorImage}ifelse $SDF{$dsf $dsa $dsp
@ss}if @gr $ctm setmatrix}bd/@cc1{currentfile $dat1 readhexstring pop}bd/@cc2{
currentfile $dat2 readhexstring pop}bd/@cc3{currentfile $dat3 readhexstring pop
}bd/@cc4{currentfile $dat4 readhexstring pop}bd/$msimage false def/COMP 0 def
/MaskedImage false def L2?{/@I_2{@sm @gs @ii @np/$ury xd/$urx xd/$lly xd/$llx
xd/$ncl xd/$bts xd/$hei xd/$wid xd/$dat $wid $bts mul $ncl mul 8 div ceiling
cvi string def $ngx $ncl 1 eq{/DeviceGray}{$ncl 3 eq{/DeviceRGB}{/DeviceCMYK}
ifelse}ifelse setcolorspace $llx $lly Tl $urx $llx sub $ury $lly sub scale 8
dict begin/ImageType 1 def/Width $wid def/Height $hei abs def/BitsPerComponent
$bts def/Decode $ncl 1 eq{[0 1]}{$ncl 3 eq{[0 1 0 1 0 1]}{[0 1 0 1 0 1 0 1]}
ifelse}ifelse def/ImageMatrix[$wid 0 0 $hei neg 0 $hei 0 gt{$hei}{0}ifelse]def
/DataSource currentfile/ASCII85Decode filter COMP 1 eq{/DCTDecode filter}{COMP
2 eq{/RunLengthDecode filter}if}ifelse def currentdict end image $SDF{$dsf $dsa
$dsp @ss}if @gr $ctm setmatrix}bd}{/@I_2{}bd}ifelse/@I_3{@sm @gs @ii @np/$ury
xd/$urx xd/$lly xd/$llx xd/$ncl xd/$bts xd/$hei xd/$wid xd/$dat $wid $bts mul
$ncl mul 8 div ceiling cvi string def $ngx $ncl 1 eq{/DeviceGray}{$ncl 3 eq
{/DeviceRGB}{/DeviceCMYK}ifelse}ifelse setcolorspace $llx $lly Tl $urx $llx sub
$ury $lly sub scale/ImageDataDict 8 dict def ImageDataDict begin/ImageType 1
def/Width $wid def/Height $hei abs def/BitsPerComponent $bts def/Decode $ncl 1
eq{[0 1]}{$ncl 3 eq{[0 1 0 1 0 1]}{[0 1 0 1 0 1 0 1]}ifelse}ifelse def
/ImageMatrix[$wid 0 0 $hei neg 0 $hei 0 gt{$hei}{0}ifelse]def/DataSource
currentfile/ASCII85Decode filter COMP 1 eq{/DCTDecode filter}{COMP 2 eq{
/RunLengthDecode filter}if}ifelse def end/MaskedImageDict 7 dict def
MaskedImageDict begin/ImageType 3 def/InterleaveType 3 def/MaskDict
ImageMaskDict def/DataDict ImageDataDict def end MaskedImageDict image $SDF
{$dsf $dsa $dsp @ss}if @gr $ctm setmatrix}bd/@SetMask{/$mbts xd/$mhei xd/$mwid
xd/ImageMaskDict 8 dict def ImageMaskDict begin/ImageType 1 def/Width $mwid def
/Height $mhei abs def/BitsPerComponent $mbts def/DataSource maskstream def
/ImageMatrix[$mwid 0 0 $mhei neg 0 $mhei 0 gt{$mhei}{0}ifelse]def/Decode[1 0]
def end}bd/@B{@gs S @gr F}bd/@b{@cp @B}bd/@sep{CurrentInkName_5(Composite)eq
{/$ink_5 -1 def}{CurrentInkName_5(Cyan)eq{/$ink_5 0 def}{CurrentInkName_5
(Magenta)eq{/$ink_5 1 def}{CurrentInkName_5(Yellow)eq{/$ink_5 2 def}{
CurrentInkName_5(Black)eq{/$ink_5 3 def}{/$ink_5 4 def}ifelse}ifelse}ifelse}
ifelse}ifelse}bd/@whi{@gs -72000 dup m -72000 72000 l 72000 dup l 72000 -72000
l @cp 1 SetGry fill @gr}bd/@neg{[{1 exch sub}/exec cvx currenttransfer/exec
cvx]cvx settransfer @whi}bd/deflevel 0 def/@sax{/deflevel deflevel 1 add def}
bd/@eax{/deflevel deflevel dup 0 gt{1 sub}if def deflevel 0 gt{/eax load}{eax}
ifelse}bd/eax{{exec}forall}bd/@rax{deflevel 0 eq{@rs @sv}if}bd/@daq{dup type
/arraytype eq{{}forall}if}bd/@BMP{/@cc xd UseLevel 3 eq MaskedImage true eq and
{7 -2 roll pop pop @I_3}{12 index 1 gt UseLevel 2 eq UseLevel 3 eq or and{7 -2
roll pop pop @I_2}{11 index 1 eq{12 -1 roll pop @i}{7 -2 roll pop pop @I}
ifelse}ifelse}ifelse}bd systemdict/pdfmark known not{/pdfmark/cleartomark ld}
if
/z{exch findfont exch scalefont setfont}bd/ZB{9 dict dup begin 4 1 roll
/FontType 3 def/FontMatrix xd/FontBBox xd/Encoding 256 array def 0 1 255{
Encoding exch/.notdef put}for/CharStrings 256 dict def CharStrings/.notdef{}
put/Metrics 256 dict def Metrics/.notdef 3 -1 roll put/BuildChar{exch dup
/$char exch/Encoding get 3 index get def dup/Metrics get $char get aload pop
setcachedevice begin Encoding exch get CharStrings exch get end exec}def end
definefont pop}bd/ZBAddChar{findfont begin dup 4 1 roll dup 6 1 roll Encoding 3
1 roll put CharStrings 3 1 roll put Metrics 3 1 roll put end}bd/Z{findfont dup
maxlength 2 add dict exch dup{1 index/FID ne{3 index 3 1 roll put}{pop pop}
ifelse}forall pop dup dup/Encoding get 256 array copy dup/$fe xd/Encoding exch
put dup/Fontname 3 index put 3 -1 roll dup length 0 ne{0 exch{dup type 0 type
eq{exch pop}{$fe exch 2 index exch put 1 add}ifelse}forall pop}if dup 256 dict
dup/$met xd/Metrics exch put dup/FontMatrix get 0 get 1000 mul 1 exch div 3
index length 256 eq{0 1 255{dup $fe exch get dup/.notdef eq{pop pop}{5 index 3
-1 roll get 2 index mul $met 3 1 roll put}ifelse}for}if pop definefont pop pop
}bd/@ftx{{currentpoint 3 -1 roll(0)dup 3 -1 roll 0 exch put dup @gs true
charpath $ctm setmatrix @@txt @gr @np stringwidth pop 3 -1 roll add exch m}
forall}bd/@ft{matrix currentmatrix exch $sdf{$scf $sca $scp @ss}if $fil 1 eq
{/@@txt/@pf ld @ftx}{$fil 2 eq{/@@txt/@ff ld @ftx}{$fil 3 eq{/@@txt/@Pf ld
@ftx}{$t $c $m $y $k $n $o @scc_5{show}{pop}ifelse}ifelse}ifelse}ifelse $sdf
{$dsf $dsa $dsp @ss}if setmatrix}bd/@st{matrix currentmatrix exch $SDF{$SCF
$SCA $SCP @ss}if $T $C $M $Y $K $N $O @scc_5{{currentpoint 3 -1 roll(0)dup 3 -1
roll 0 exch put dup @gs true charpath $ctm setmatrix $ptm concat stroke @gr @np
stringwidth pop 3 -1 roll add exch m}forall}{pop}ifelse $SDF{$dsf $dsa $dsp
@ss}if setmatrix}bd/@te{@ft}bd/@tr{@st}bd/@ta{dup @gs @ft @gr @st}bd/@t@a{dup
@gs @st @gr @ft}bd/@tm{@sm concat}bd/e{/t{@te}def}bd/r{/t{@tr}def}bd/o{/t{pop}
def}bd/a{/t{@ta}def}bd/@a{/t{@t@a}def}bd/t{@te}def/T{@np $ctm setmatrix/$ttm
matrix def}bd/ddt{t}def/@t{/$stm $stm currentmatrix def 3 1 roll m $ttm concat
ddt $stm setmatrix}bd/@n{/$ttm exch matrix rotate def}bd/@s{}bd/@l{}bd
/_lineorientation 0 def/_bitfont null def/_bitlobyte 0 def/_bitkey null def
/_bithibyte 0 def
end
%%EndResource
%%EndProlog
%%BeginSetup
wCorel9Dict begin
@BeginSysCorelDict
2.6131 setmiterlimit
1.00 setflat
/$fst 128 def
%%BeginResource: font TimesNewRoman
%!FontType1-1.0: TimesNewRoman 001.003
%%Creator: Corel PostScript Engine
10 dict begin
/FontName /TimesNewRoman def
/PaintType 0 def
/FontType 1 def
/FontMatrix [0.001 0 0 0.001 0 0] readonly def
/Encoding 256 array 0 1 255 {1 index exch /.notdef put} for
dup 36 /dollar put
dup 115 /s put
dup 49 /one put
dup 44 /comma put
dup 98 /b put
dup 111 /o put
dup 107 /k put
dup 97 /a put
dup 50 /two put
dup 101 /e put
dup 110 /n put
dup 116 /t put
dup 114 /r put
dup 121 /y put
dup 147 /quotedblleft put
dup 105 /i put
dup 46 /period put
dup 120 /x put
dup 109 /m put
dup 108 /l put
dup 148 /quotedblright put
dup 118 /v put
dup 119 /w put
dup 51 /three put
dup 99 /c put
dup 40 /parenleft put
dup 61 /equal put
dup 53 /five put
dup 41 /parenright put
dup 65 /A put
dup 78 /N put
dup 68 /D put
dup 55 /seven put
dup 34 /quotedbl put
dup 77 /M put
dup 103 /g put
dup 75 /K put
dup 117 /u put
dup 102 /f put
dup 80 /P put
dup 104 /h put
dup 112 /p put
dup 60 /less put
dup 66 /B put
dup 95 /underscore put
dup 82 /R put
dup 62 /greater put
dup 47 /slash put
dup 123 /braceleft put
dup 125 /braceright put
dup 52 /four put
dup 54 /six put
dup 56 /eight put
dup 57 /nine put
dup 67 /C put
dup 84 /T put
dup 69 /E put
dup 91 /bracketleft put
dup 93 /bracketright put
dup 58 /colon put
dup 73 /I put
dup 100 /d put
dup 83 /S put
readonly def
/FontBBox {0 0 0 0} readonly def
currentdict end
currentfile eexec
A22DD33CB9A1B84FC323D538B9AE6C6014672C02872FAD31037218C4EC2B7124C58AFC4A0E2584B50A778936CFE1053450FEC35486F87A4DA48EF5124EE42DE6
9DDB8A5C33C2868DDADC1C9B4725483A678DFD1BEF77D7BDC50D39DB17FF02031F39030455C675716EB1B292EA6078E9937BB936698E457C365396CC5708EAAB
921AD0271E16D4A5F1689C7D8DEDA69051F9EA8B689EDEA8949F2C93CE777268FD3CE5D1713388D0E33A640C77DFB1D300C88E302BEFDF0083AF060D407FD007
23D3F76465C679461FC0471E7F6EFFFCB5A8E513C1661D98B93E8667005CB8B30093BCB089336AFAB7D61973B6F27AC993F52C52238826E221A63575C2C867DB
E9C0264C99B65994DB79F83B4627E129923C7C8B2B1DC893406379ACC5112861D3FD02DCBC1DCA1A3A6D099243096269F96F1BE23D8EB837FB4E7DCC9FE6C04E
66D32805134F305D97233C026AB518C5530489A76F9FD36970ED317F1A5FEC06EA5AF1C50AABD8F03D100A43D8FC71E1EB41600E4B30300C85B79E0DC367EAA8
608C85762412D6F025D49FF0BAEEB19D5CBA950C02E4627DC5D68047DD59F5967FB16306EFF6A7085B7396B86239D06351EDC304FC1F63BB058504EE3C2626AB
1B303DE5275BDC1C2DC85EE96CE0661B75371B523CB4CF500A52DEF9089500FD3A07BB21117C46020FC1981D3D5A74BD19671F87EBADC378BB500CAD91BA7B71
32BDB80E73C568456251A86358E48D26BC6D4371B5AEEB7368555DCE1B4B28EB9F05D563FA00F0DA973AB79F09954944CA54D4DA1184A9C2FFD5E1893C068801
D15A198B3133B8099D10A4212DA2EFFFB7CA39194648E67CDCFC5DE3AD4D84C1D777139ABA6C39E62B0A270C17C02A90A63742AFA151B83CBE397BAF27F3E3AD
710EE256EF9880A0B73BB57A44E412E78175402656CDD5C4C4D41146CB7D11AFC5504CA9D4F1795E2282749F51202BCFF449FF5332AE9B9504D5A68F689B46E4
D57B03F7D690A61F8C858FF0D8B812B5DC08E1D5CCF6EA99BD56175C549B148834F93AB0E34D4C8950EE4468B71A75D6AEEC574065F929147671CACECD92A928
37A662687DCE83B69E8463C8DD725F96C3AFD882B10B27CF9CBE6626297C002C091F373D5B0197FF4C17CDBE076B5BFB2E408BF82CB2371DA7A154F1EA47B548
6DD92EDC51BFF0079F787680BE8FFB7716AC7FE2801BFAF13333E9BF65CC0A0D82E27E911E1D141154DD8A807392B4B4004373CB185D043F4D3218D82A6F2CC4
6C3C7AA1A4EC5E860DA9CC26362351F1C824DA247C02CBC1ABA7A9D1C8A02C38FF70B91A80043B4A4ED5551313213982EE879F45F8CE491C8F18333A6DEDE31D
FDB53895C0C466108A0CB6704BD3C560D4672321A7F6C298A1E4C6F4F2B5705DD47A4752A2242BE02DEE300670ED722ADA9F265C86FB0C35D9E773777BCDCC62
886EBB04C7672873CC62E4C57222B97163E049833D305DF236E859C469645261ACD7E8B9F00F390FBCACF448BC5496B8FD9F496B557A3E85F6699B8414C19058
B22A2A6C5BE4315BDC85437B8C50DBC37F63563BFEEA6C5B6AFC8EE6F675A7A6C66DA4F4A4ED127FD1F406F06BF7EB02C7004C2FBBC0F688C459E98AD95546F2
B57F3C274434152407E1C8426C53CCDA7647D90271D5034AB49F4FC0E447C8CAFEA99967D3AECCC266AB259BCEB0DF7442B24182248CDFC8A87FB08EF134700F
106884B9621EC0C7BF0852C5CFBDFDA6E5FF41ADD377E56BF624909D3295AA2EB4FA9B21DF3EA28299D07E93C4FF10C1ED8BE3268CC263F40650BDC2EF292389
400EB3C04BF4A7EDE56AD54759E6FC59AB455D8F374CD14A6458F93D447EE80334FCD9B672A3C6DA424DBA035C90E2F366556B55929C404147111A8B30F9E59E
50186DCC4619BC14B58D667740FDE5EA3A5780727FB84FC74DC3C458D4F6D44E6A2655F6F506ACF7F04D0ADF687F85A812D9B3EA1B1F4131B24014BB15D17572
0C01F4C3F8B3AC7197E89A919C4F88A88A375F99B7870B473D8222615416EF66F2EE36F2424D73DA204EBE609309C4E65A358E73F2AA1C0D8D9E83EF1C177E56
5167ADD3200D9126AB4549DAE0A4868E411C3B0C23E5ED54746C572202E35E6805CDA2DF2730D21B84F885711F57FDBD1323BBF7D5E72818FBBB4881238B124F
C0A2CDE93FFE028335ECD156735539AD9D5448231FE44315CBE8E5F69AA042A4C7A28919B78525FE2967B77C1DF65B1D3DB9BC8EB6F5E16E7B6E74257226C044
291BFC5A17F7E8A0FC4CB3241A820663BC6CC1BF0D787E6F6D971DB0FFE1EF805A015AB8AA6368DE56E1949679FD596CF0732CF36C6D7ED4DFA7BA66CE6DD9EA
9C7040F91CD7360CD23F863428C65D7AC3CCD113AC0768969AFD97FAA3E94897251A5E8DFD7DB676D7AF2997FC534B29DBE4596A39EA6587A18DF7BD37CD0B9E
41529664AC584E7867B6D7116C8C7116E008A2DDBBC11797F39110993CD6EDC695822B3700CD2F33399A65B82574D5C3D1B15CE3EA58E35E342E43E96E61626C
667BAE44F565AA237FF2B7EA102E280AF433D9BED796A2148C0353165310B65FF9CF4D5EE6DBE42E310F427EFD5753A091B7E30349D04C05BFE746616BB9E374
F5EE17792BCA9D1E112319480224F05C1059EE91F4D2DB26B7F01EB2488A0E4099BF793A775FDF1E01916E104730070805484B4A4D7721BFADE6BA7BBFD77521
97BD75E43DAB6AE2A9D5B921F1D3B43CBDC655FC6694B3A07348513727A74C25880C88A195134CD4864EEE483FE1D1BFFC5ABD059B89242A98D71FFB5296457B
9569F0095F4EC389FAF6F9C5AA0B85F309A6542127C8D84EFD9ED51F1F5F2B6515060E996DEC1A2DAAAF3A1AEE425D551A08BD9765DCBC8A9E334959E74650EB
3D52B465C873879EA038A2B5CEC4DE4228B9DA473CC6EFBEC2D8D40314AEBA553D9738E73B6ED41D14ED8941A0C9207CD995A09A3BD5DFAA4B84A85E670CCD85
3FE86A58D27EF933B73B1AE80D5CFEA5BF0F073339BABF05F81EE395AB20BFF7BCAF4F17CC0A3F9843F0CBFDF3AB8BE440D8822E122D7E74A1FCD20AC0D35C6B
7AA4650DED245ED4D8662070CFD55A4FCB4DE1BE175BDF22C9E946495D0A1026B32677B8DC9BD002F03E05E5698917AF00D5ECC81A1FCE8F77779326321FF8C7
CBF4767FFD6C46D197E359F35BDD0B1ACB872A6D0511A974C4E020467289DEE8375F564FDBF310F5FAAEF61AD158AC448E39851CB9F96690B9E0A05937195743
9521A11AB7644C46A40B11BB0F099612D0AB22AE12388CE84B4399C05EB0595C25A035982968FD934D1107A4CFE1E977D752971BA658520DAF37208C4F63112C
620C8397AFF26FDF2CBACF5FCBBA3CAA70D4277B115FCA41B3FE93E403F957C34E24FAC477899394A668C5405431AEFDF3096761C12936025DEB15EA0855022E
B7E4E8E0B0730CE618525A56329AF780382BAE2DD3AC4539B63AB4620C3F65951451211CA7F9EAA3C2F6D26CB06F64470C3A04AC430A91AF95162102D857BA0E
FF79A8D7D2A4CD18EFA27E2F96810AEDD9B36B11E032F7C6FBE4A98A28A5FE14764564F7EC69C54B06CB6225588B47ECD3F0A228B2E51061EEBC1E4C14873656
F1DD5C5BAC70FF4781A697FAACAD25ACAA9D72F7E4B2407FDA4253050DE095B50ADADA7A43B6B2882F13D86EDA0F22E2EC8638B7ED26063C5D300BBBF499BA91
10E032A4DB363F7854F5904D55A77476CE5F7C89F4E4878F85754BA7E471D789DE35DA574B47B6AEB3A47168E51E80826159CEB19DA9CF45179DF7FD6A0F4E4F
A5DEEF2C3763723BFA06782F4B6C0CEAD552894B83A2FCDE65FDCFD2C425BE02DF3AA3E8345EF5DCDC6EF414839D6D914DC7A1D5BBA3C9F7380562AAB8BF8CB2
C0E9E1B9E23D51307826307FB6A862EFF3DF8696F09F1A2641EB33B1C2B5242520DA66EEF26643BE52DA50FAE073870723EBA51882324F1A118E2B5F5AA333D2
3FA890DD67120C19FC0A438B09191EBD0409C81035513968F216583F7263337E50358364348A2028D16E908258BA8561C4992EA06ACDFCCA39740B33DE7C1343
1B3BCFC718AE919E3DCF34DA8044BFFD8B3F7BB6A37012B6FEFD4E166F05E135AE7851F011DC69461FC7B80806FD22B20708194E3765766EEAA1FCFC2E963032
617C8620A82B49ADFBDFA184822FC50B456CC69A4C789A8510B4082F69421D5F16F465A23A4B488D08963214A653BB6F66525A9DE746002B5D8BC02F9EFF0F22
B94B834FBBDE9E899DD9C34659C62CF60D8C55834B3791A754D46E755D88EA610B7A71C79B6FF2903E16A256A3963EA7540B9E922AC3874B514EFFD75262DD8F
26E34DF1056D070CE420115146B1477EE94F98B44D031975361C934A3462AC8766410EC099343B5BAB7D14FAB9173F857EA1E9876D666519F4E2020771616674
69F3661DABC9258CA212C6ED4CAB0541618E55D92D6FF915A6CE26471935807343C21263B2B4448FDF3C4162686FC3E6A212F9E3905346CA87AD6A67C51B58D0
8B9F83FE62732E285B26CCF6E5E37E84347AF8234ADBA1F65121EFDCB6DD3F9141DE286F594B44264662877410092CA1794FB40869123131F9CF02C4EDABA2C1
D9BC7F0AB41D933EAEEC96F2B496A37812933A6A0AC1AD39DFF27797BC54EAB725B829B0F7D520495C78B43604F6D85067464E8099F8682BF266D661C3C2658A
713CA0CD9A6447B1BF0EB24A914F4902F3ADAB190A4CF7251E24C6108F5160A64D261027CD76983B95CAE4D41EBC804EF60BBD18DA854DBCD059F2B015AB1EF2
09416B4FB68EA553586517C92613FD786C42308815982197A4A1013E402AE1352AFD1DEF0A1FE57F1700D43001A7F6E4F88C45666049E778CC35C02C00B828AA
7FF917CCCF9505616B40C84F6BE2586300870F85E9176A653D60B979025774C83F4F862B1CF979919AEEEBE696A4FF30A40580612E91FA4C7CE5F838277F779E
482F5778DD9115870869DF3B489E9DD2A64B0FA5D219EED95E1BFF6E1EB647A041254CD7D9E235DBAD1EB8F11FE7A2737EA4D58A6566CB851C210AA785B7E54A
7AB438D69EC3B98FA45DFAC36FA1C4553B60B8AC3E4F076E5568B9DA3E25221BD2964F2A056D9255FB181E984167B662A1EE39493FF171B7C31C08760029438F
7553544F3E762C5FF0E15697C05B44FD91351D171D79EAF6A84537C333A0FCD8E50BB76B941C7AD11D5E1AFEFCE60696C38159514EFE960D401E3A83F1B52575
BCA2A760A841E56F23C9F8F826F04D581E225223FD0A654A9F213F1BEBDA9985AE5ABE7076B423440FA2FCBC7617D675554726C4C4177F2D6EFB1F2F7F1557BA
8E10ED787304D269B6E137C3574307745570AC6EFD23C30B0E5B49A9AED40FDB321B9E4CB3A2CAF78CC1854D9AABA2BA755826CFF154CE4117C2CAE9B6C9624D
200B412DBF0AF579C5392FA1BD612B6322D4FDD8DD93617A15EBBFA6D5294DE795A25FA4DD353A2C7D79CAB93E9124234406451A30EE776CF346CAD54F00434D
5B6E47A28131D143D9AF857716FC2D5B394A362011BBC3A3B48769B617A22828D8AEBB006E612041045BC01C4983D7720C31878321E5200844E58F0D35B1A8C1
4EAEA6F450792472B6403D15430B9D1C252D1BF1FAE5BBF3D638C983C2FE3BF6E9C11EB823C54E69D4434ECA5056E531C3D234205EE986980EA28A2097298245
6BCA911A130A096F9ACD8C1145A50EEB02709F771BE122B7850D4A6D0A7E244C1E7A860CA24EB56646E87FBFEB5F5BFCAC14F64634BFF1342314D8BD0C1F90CD
5D2F4D12C720D760FA03A3697B17A963EBF7982970F46809CC15F22A1F4D4F0E9DF204A0DCD96876552DD87FA4334FE7CE57E097215429462912C237FDD16214
DA85BCAE36147D3BF46178DADFE5EB79C118AEA4E0DAFB5BC7340A475CBFEE92B41E7F3614A43F6B3F2ECFF578079C35A8FD89E288BF5C0DF362B592FDAE5AF8
0D442894827B93330F68B3E55B0185553A34F72BB56EA3BF5EC31026C87297BFBA4F6E3E0C55D82AA53C5A08FE0F33D897F987C21F5D10999EB781569968A856
7B92868A75049B56BCFEAD72260082FCA0D6072BF82A80AB32529032D394F3B854D6FB492B0FB77DA8D8A1E5254EBEEE3C0D477E5C7F0B72DC8F233D564E8419
136EF8DB089D827C991987B62C1DF65EE165157305FB4F355FCE32857111F65FB1B92146AD0A26DF7FE9DED3BC7098A6D5D5D52A8ACCCEE88832507D3CA2CE3E
8F913D84CC37D96B18D3D369D576797DC98659BF5DD18EEF0E45083964E6ECFF4D6E2F4759B34DAF2F458AD34D1F1E56FF5EFDE0BC4E012F7CE17A8D8DF2445B
23B5B637CF878AFB8EEF2C4B9ED8B836456FCD536C478FA3DDA3A9EDD483D4CD2FB562BBF28AEF2C48E1B3F7EEE86220CB0939F41E1079891A318F7DFEF8890B
B7574D8F98CA7BEB58E3A17E8F2949984E2F21C9AB1998DA586492D7CD879AC4627D7E4B1F66768AA440DCCFC120BB838845A91769D2CE114E226865EC593898
669D88C7DFE218F596036911B2B89FF4BADDD3E395DD0C5D64655506E544E56D408BE21FF9FDD79B72CDE0C6CE3F59402FFEEF0994F0EC72720846B98998DDB8
E70DAB849CDFD10F5640DBBDFD217DDE5E1B2226EB83B05247E1C384324C07256D2E62013D967A6C13B5A7B69264228494280781D602850C2735937B4A4B0566
17F021A8DA555D389CD06EFCEDBC53AAA4A8E286B6191B228979F28FFE8576357DDB017A94A67C52EA4E5886315F3C01169865983A70D67B24F4F0BF7569FC10
0B1BA9CEADC5B1ADE33FC54B8C323E589E7AB12F8185F38274A05CADF2CD63CEE4A244A3A4ED9E6E3EBCDC81A54588FBF98F93117DDFF02859E6D80A861E6F34
DF2E91B4FEBB6682D8B56CD9B49F42C908DAE95B35A8EDA8683AC6E1C9EA45D10576FB4F7D4B23B008B91ECB5CE500452834E8D5A107925C412A6B17031500A7
86B99BD0E5A05BB5D531943B41392A7CD25DD9BC325DD3A921754EC6DFC0C2B71959427C4886C4F24B2AFCB0FD41678DBC23D6F505CC32E8BE40810790CF20C6
5C5F0BF1CEE56B4C5D1C795FC6D8C480E482359D11585B5B725209D9AE00270059ADB8317AEF1BB3AE5A1C5027CCA16D933C705F4AB1D1BBCC63225B92026AA9
F8172E26ECD7841EA08F6FDFED6487922C51985BB7071293DEA0CCC59F6D0835F9CA985A3668FF6D44B0792900244D340A01792ADF9ABAEFEB3E93CB4CD3FD32
9DB729F2882207CB6B8196EC76A9D894DD77BC297771824FB86EBA66ECBB3E275D5BD4940AC5B6B87D4751FBF55478EFE2ABD5507DC7D1DE032239AA72D5A4EF
0EF84B26EE942F0865E7A1520C4914BFFE79164E23D76293DD0946A78A944BCAA57DD593767C828C39ACD1B32D32262BFE4F4EEB6098D4E91F3F434531A31B3A
EDB1754E08BB5A41F0121AE69C22AAE26F6F78345D7BF8B60C0C9DB6C17A839BE66EE067CCBDC6D1A8FDE771C240B953F3D99182BA9521B02A4B10126402CAAF
DE4CADCFA0F55B074F57AA69412EE09AE0DDA3034913976CBB5CF79C07570586A70AEDA06A9B442854F6D75BB2E12A387E4880543833EF225E80F13F1F4268B2
ACFD7FB3043266E2B723936E7830A1E8A8E637EA6135CE3E2B7EE2133B7B88648B5E78992E8F60C03686FA2955D1F3AD0CC90695412B47E7B5D19B25DE2D3C88
CDE0C7801D8C27454B5D2DCF1F22786412B1E1F4F8E1D5F11827AE0580405A23201997D27D2510E156B5BC9AF2BD3098FEBA0075A0FF4F116D89CAE6765BC00C
F9EE0C0F8F543BDF5626BF521A21F909FDFB14ADF144C8047C0F893E5D37721931AAA94CF1EB85394DFEFBBF5842E94DAA6751715B3D44C6E15ADAC052D6CC8C
21C7FC52F8446F8E53D73234139726C44E3C4F83CE828C43AE5C3C9433817EEB83A9E59607B73DDD961B0A41B9650D2D1975A9B92CBCA0B495EAA8F20E62B63F
C699EF6ECF3B6879AF914872B57DECB7F235027605660F116A12224418A68A3982F49C14DE3B5A9B8D083E20F0B95DAF488BB0899E504BC13B230CD6D85A91E1
0BB60CC3779921CAFDC7CA7C9A9F2BD1C72A3405A4FF7C6C9828F7EE01A845172D48DB8241321684B8876FC05D015C8B300926571454D61374855102A3B8AC00
10E41F701F1CC5163D3DD6F65D3DFD99449CEA3D8BF8102886009A9CEFE18F5766FA5B301B549D7B3F6725EA190AAFDEEBA9ECA9F8F2E7B8E5F49C5BF12E0749
11558AF6E846BCF0B624915F8597F81199F435B6BC2C9D33DB4C328E8A995D8ABCD119D55D1C79B886900722F92A0AA95FB785F42536A75029E7A21DDA1513D2
2034C2D071B1B2801B3966987A27897227F8748F3D781162B10AA2F747CC764A2F5575E922180F5390B4ABD60EA1AAB18C967AC9F5203B3A0FECB3A6A2CE5E5B
98A0C31DE47577AC62480C45946B279B6BA5300AF14EE8BD673ED874E3C197DAFF2FECEDF0F8258C1FC18B4C5FCC8AC15CEB336FDC94CCB412922E8D6E49D635
00D2896F765EDF315552C133ACFA800C3BB459281F36D2A46812AA668A62B397BE253A60915B5042B1800B1578E675F417D4CAB7583654F885C53A1D38B61959
188D5D23627AF47AC6D367C68140C6A51F1269C8B044589C60B5216BE41E46F53DB3ED2DBC87AC667C76780947B04B01565F330600320BFE88B5118288754BCF
F9E6882FECA4CC72708949BEE0574E8819D20CC9221C3FC4830C095447D4DDCB56320A9348700691CCDC93A5DFFF5E71E95765C5967393FAF979521EDF483072
C57D480C240E7303A2A1CFF7BBAA2A7AE8A834D5B246D9DCB0F3C0196DCCD67FBF3CBE20E3F13D45DF3D7EBEF423B587B6CB9804818CA32031C6C35526C2B1AE
F6DE68B7C3BAC561ABE5F5017F002DAF0680F5419B16CCB084AB7C995484EC1548255E032C95DF0897A0EAE41A4CC58D9D4B89C894EFD589A8008CFEFB264D05
21A1F2B2254ED1D4F44B69156DF396AA721E4DAD46BC5F26177F6BA97D2D4847E54954266731AA390DB414621DB48D29347A875B0C4A86B91F0031F766C378D5
EC99D8201FD65D012CEC9AFB15D350A1EDC19A69650D8E23CF450B1C624BC40CC0A2FC5E565ED4EB60230E0F42B334BFDF4CB1C127D921FED0A15FF02F73B14E
98E655E1623655C6798735B65F5AE3774EB7477F4ADA29FEA443AC655FB196E2E8EC4FDE94634A9DA8E2814A8017339E4C16C7F62D262F833A8C5C6CB524CDB6
3A06FF333F56919292747014C07E8B98A2FAC6D549BB919CB4EFFBB56DE15BBEFFAFCF5C3EC77EC4D3639B40A77A59AD34D446B833C7162961F4E4C816B1F7A3
3FCB16AFF7C1F99523800615AF5C06C047D8503BDE1A657A3F0B4B6974A923C28669510F556857F7CDFEFE4FADC5039EE1AE2052A5615C15F4C0A95A99CD7644
40466BF52665CF7A943C4892C51CF05A9778FB54ED5C4A6710FE73FAA7BCF3A6A866EAE1D1133479AB529F234D89FF0E6DF4737B871D6E62FFA570C870934848
50F2971112ACA9F86239CA455FE41025CCEE84AA54139585564F82EC6171AA113235B1977743CB8319622B99C884E2F36F7E2CABAA29105C78EA5B706AAE9C00
E1F3B1D8222B142498CE62A08DCF90F72EF5A694E9B6718F159FF3814A260033BC492325A5A7E74510CA52CA9C45F46EC0F896B954F946D1E0B64EA52DA68024
3117447837663AE516B1E0BE1A60A97157D6A9A03DB6622C608E889CB425089D9BCB5F51E4F79A02891045622272589915733314BF5FB47BF982EEC98773C298
7216EC23C7733B69EC2536D513C05E2C43AF1BA6834EED74A71F85C555E8BBD3B16006C902DB39C025C6D2E1C94A4A42C681500C18E0BFD1705DD74A77877B22
33151155589FBFDA6FC8BCC758977A75D1D8255C9370B0BDD8E845425B7766007178A7409AB14C39E3171FA8D3E2D4BA88A6BAF3C9D14BBD2F61AB2FA7877F9B
976F18B187DE26FA586D22F4A4BF4C11B6A2EC04CD5B9BD9A7AC8F1D80854E0C8321FC4EF7B7BBB22167CBA3F03A805098B47BF5A4E107122ADF9A0ADE8E58A2
8B7A71E7254F2FA752560D17A84014E312D33A3C79B1B30FDCB09096AC8AB1F40E349110BEB32E0D346C2350CAD5D0E4457E6DFABF0ABD0D73B8C411305F891A
31D43EDAEC8688B90706FA32D9129665C6768D836C980567A2A43F816420213E9655405EC0BFA3FA7CF1B0AFF503C2232E7BA2CDC6A9DD5A60F9FD06553F3B74
F586BA0AEBAC87679663A7A4F5D4A9F781F321C6E50FC46F91EA7463692EB37CB8246CED429C8C096778B75A08DA280B9223697CBCC936B546A0EA9F20BAF37F
BC318E6AD9ED3FBBE72E889CDCBA524E775C5504BFE90AE80F613FCE418F4F588E106C304356328600609F830D28D0E595B5335A35B9E27419A0EB1236C8C0A2
DB08E2C3A9BE8F101D4D40CB334352DB20AA37FCA5580664EB77F54E6FD747B52907E6CA9AD4C424E9290E35E5201C70C60010D0F03B6BB31420736B5F481F62
2C0DF573891AD41DC2A740D56FB6D595D189740DE47779FC0536AD3F4F15F05EFF7763E6A85DA2A4491035AF6A64DD8DB9348F46637448B3DE3AFC5B2A9A9205
2340641BC47571A0B9BD483D0006BAE8BE2D31DA7047DEFD116EBBE45AA049CF53973F26400196EE56A7FB7356142D7FD0CCCC846EE7192BA85C0193F1EF059F
C0743B37FF0D6EB8CDA034DD48E66860EBE68DDD0B8EF3813C318A4C5D749063C786658D0335F74C0C04E2967FBD7AE9A2D2D74C170C44AF3AB3610C337E5000
B7A0A263292693595B87E7299B97C008F1A45668C2BC58F598E6E970CC0C64884E08F28CD73DF20E0E0972093FDD8130F0BBFD5A13BD97911C697FF3ED0A0481
9C44A2DDEF148D9754883EFBC3FB7C9B740E7C6FC175CF80C7B6164225A9ED7BE8959E2E806F4236807CB518BD4268664E2874ABD61E2D83576810158F270132
ABD00E9D3E072980EB6C60FF71E0978A4B089FCC01458FAF872AE15D680C6C3E87817F441C1CF32EF9B5584C8367ABB575D5383D1CB863506B0D6EBD3BD98755
2ACB66E8A9287080490CE91566EB0E85FEB02E3BAA26017B2ECD97DCABE6FF3168815B92F80EDFB0B984A3FB9D4CEA5DD6FBE6EA9020A53F06F4A7CB0D691528
AA72695554C6F3DE4AEAC22455ABC1A6F4A51A60BBAE1C60B686ED82C5F71A7F2A9D68A6AA25AB8103D7FD97917474A397F647696D3C4572BCE3EA6F9F62DB61
3E0E7E2E30785AAF2CC7A22C0F7A9A07E8D4D547566D110472B6588A2877E1DCC800519F24394C5BA1C1FD3FCDB3C6C0662B58C01AEA4DAE6F00C7A839651B79
35BED98A96AF62237ADABF44178DD66E0DE741627EF025E6B527544F9147FC1EC9DF73BB7DDD039D521BDA4823B2710723FF1F70FC3C59260E317494654E0D1C
8C0F50741B952498357E99914BE9B1AD0C5FB5AB296A261E3FC0F2FD4D3B5A4406800AA1817D186794D2B023C3773619CB1A2F235E7356C24141A08F4C766370
4FB970DE7B4FAC0D2DBA2A6FB7B36AE7D69352F424CEF79345DDA1A41FAE1CB8EED0080E78CCC3879BEF6C78BE944B8B55AEDD6D5D235D1993B6562FB01617B2
0D6BE774FFADBA33CA58D054C579F168B51BE2523195BC84B6149957AC60805D275FFACA4590FB50A98A7D964DA96244C876DB4E1367FE233237597A2825CE4C
4009C064C67E60015502A2EED3372079735E99F0F5A6BA405202E51DA8042EC76674FC2A820B9428F45EB1A2FEF5AB064EAB56F6037BFD1C329270E856CDA882
D9CD0544595925C9DCFB055F6477D8C417F71B479B6D30FDED3042294244A2A7AAFD61D70D62CF12BB9427F41E8D2C57C1091F2B2379B28450E27F3B030C0048
CEE1AFB6BEA0D7D643A2C458F04144C026DE5C82846B76AB7D34DA015F6782EB91E10BC049F105CE81B013368D9B43ABF26C07E6542DFC89699EF14595FDD4B9
953CF008C11DAB3A3FA61E398B9FC3AC4139941B24CEF7AA4C64E242C4AB2C637C1A2A7EC1F5398302A77D2E5A894CF6958A617B8B70267744CCF4880D5B91CF
2C8F9268941902B42326FC8691FE7D02E1C6CB729E70B6BAB4CC02B2858A22AF47D1100C8EB448E8FED8C56D57B16EE4D666914ECB064B9E00DDEEFD97F8FBAC
0342A97309334DD8B845FBBE9E795FA244924C4D3F17644F0D095E03135E8EE9940F766A7F8E140E7C3E353007D2BDDAD217423168000A5F8B014779ECE01B9C
F9F2D6692CC6DFD59F775E52A096A7982605B804BD013BC7E2C56EA5DC6F2B5447C613DFA9AB2684088997153AE874CB52778BA5F7EEEA4A34E6C5D3853595D0
0FCC2B1DCD009F6D022A0CB2BCB012FFBA3E0625DD30F37FFB7ED218F39C6479274F0FC98C4C31093F12E67371DD9F1AFC1F67D8C3A8F006144FF7CE098361AC
82F746C5DD9B4D4118E7AF819CABA99D551AFBA48ADC86FF5E0F348BD9661E1F24750AE1FBCD36480547EEBEDAFCF1799DCFCF12040CBEF1FC8F65DCA0254970
C2EE8F762A7752A35C70E5BA56925CBDF3C7F69B14BEA6382305563096E39660A08A5F8485D879F4FA42AFBA123377E6E6032DF98DAA5220409079E749AEB5FD
9DE058599FECD8992724BD2C4F4E56D9571B97C12B66EDBD5D457E96E7ACAC69FEDB8FB2E16887C0BDAE603538105324BABAC74433D8FAD2A9308459AC74F2ED
4091EC4572FF97EE4907F55D24734DA41A2AEEFC5D5D3D88B477FD64F7386C10AADA4476658C6EE85FD4046A28CE06003A6F3349E6AEDF066EE18B4A8D9866CC
54701FF91201289F1F7C497E8E215DED2A636F5D8A6477099C933EA5F738142219C553C65B54DDC831F33E694F08DC727ED53ADE09D084BB26DAD70367ED76B1
B98ABA5169E618EB77440347981E682F9D510B31F0966E228D750EEDA30B3915E8108C10104540A95C8595FC03C7E6C7AB102F3381004E0623F9A0F8C6EE20DC
7C1E642338DFF5CD448997D629480999C2A9CC1B245246D5B21091DDB78EB7D5A42E84EA12D44AD8B65DEFACB6132960AF00ACF8EAB69470BF8DE40503976A85
4232D206EA244D8032FB2AB07D0E00EAB0CF91905D8506DDFC4C4EEBD2989246E38B15DE56F480787B100ADBAA01D4CF0B37A5C7CAF150A5306BD7A242E39C92
9025985906A48E39E036301A814C03C895B9A6524703CEEFC15D5D6F6A2597180027A9D1977ADCE18042165C4E7669DFF27CD9206F6AF500DBA1EACF0251E64B
5FF1325D78A08F43273CD5F83DC425761BA9B9064D01C9BAA41EC8702F0C861A398FFFF837B2256D3349408EA8904CB02BFBAC38E394827CEAB4E263FACB3139
8C640F5B720391B20177764F4BE6D68B8888CD2CFA6299157B418166EFDDAC0323C4A67553479A15B06513E5289C93DE1BAAAB1F978C27BF76B3FAD297AB6A4C
68E83166F24D004793F99C3A65294F451E3531D4F24E669A4C08EE443C45592B9CBCAFF4AEA0D1631A1A1C0F262DBFCADD37C53C1C2DBB833C679C7D238B8F69
B76B407D2B7DC7F5DADF0DF7918D4E84455D6A02112B0D14F3A479543C435EFFC848652DE60D351EDDB35B27373F3B6B7CB22EB0719DC59C0BF4D0F3BE9E1592
CD899A185E3C211BEE4FE2BCF4712B08F58DE9E34E89970B87E1A4BA6E8F6BDD11A8DFBEB841966E05EB12E8256B9C8B54E8768029E6F6ED7A141460DE301475
53E11E8A3A5DC9142C8D43D35DC4454D7B798D50592B413EFDC3E00CBFF7268455F4B75F384475F51F60FAAEF82EB4521718C0D7FF227FBF216A83B2744521A8
5FF70BEFAB9BC98C161FECCF6216682C94FD1E4890FC99D22DF0DA3AC6C8E731B26D2B0D2D49A47A81B0F6A703DB59544CF740C15FFB0738B3CD49ADFD60786D
8619B66F3EF10E0D1151535E06627F3C1D0017DE77A6B94993988F875BE0E953EF055E6AF457E147EEF3BC8ED88ED5FD2AE1ACA2D8795A2AFCB54C9AA825AF5F
C33935563AF2B7CF157C78FD8520C4D8849FFBFE4D70669F00D844A1A2A64825108D5821F0CE4C389487BA8C7A0CDB9274928FC1132A8EA2D55A461AEE49C76D
23DF41D8C7A95BD6CEFA40346BCFBFF57FAE40D3F692BDCCC6DD31AC1B187E7CF21F85A1A046293E15BD0D57C231A7963078C7A9BAC33B33587503527CA040CE
428ED9F81E84F25BCE91B7CE0A2B71F9B3C19AC0143CC8FE108B227C72F00381F7318AEF110808DE66586A888B6AFEFDE95170373500651AF542771EE0855DB1
E26D73F70643EEE3B586B3440CFAAB56D0614CBE71AF0B8174DFF3CB304AB34C1625866774C036623BCBB7C4D4F0B86D6C74E33AE02C02F04417AA2C2022A5BC
E9229FB5FFDE0DB27CF5F635013395376017D0A873C16CA5DF7787E68A17CA0C870E60D6DE56C29ED6126487923D5F74A0EF44B1DDFCF87558B0D9B038F11504
523C558301485BBD2AB09767FC314A8FB08938488B1EACEB004AFC71C22610A270DE1D0389ECC07804075E281D979C21BAE5D9EF8BDF41CC7DDC49B38A963E9D
DB818FEB4C212646816021AEC9DB370738E0FFDF2B154423757741075F2C491F92BB48C24AF96CDD6CC27C4034F398D39F981BF80DF62D22C7B064E9DCE2FBAC
115189C4FEBE638ED9E75781188634E8FB47B68EC3B5A5EB33097F52375AD7D67EB86B995922802CC326E96F53DF85CE4C0BB0F4D2FEE091B58263AD9DC33162
ADCF33F044966F5F4694BA7CF6624254C00712C711BD590E238281E0BF5816A10DCC1036EF46DA3CFF62F7879D12366F77E7B66683ACE37DA471AAE26BC0F13E
11E63DC34F975AEBE5D0266363EFFA311AB3E20A788D32A51382B4CAF4EA2D4D1DCAD1E446023D743206D2241A66B0A61D939E7419829552FEAC99647F5CA8D2
8DCFFFFCAD3DFDAC28BDB2026EE6B0440013D9078EFE6B8FBA8DB1AC4AC8A9C29971794CFB88B3FEA0675D23AE16D02C1BEC9C423AB4C51886F240C8026F63CD
9800FAEC36C1AC8016A6D4CD7D2490CC4031749BA150574D5CD8E748F14A85DD99E0F7763A9437609A7F2F9E8DD2D8AEAC0422B7DBAF9DE2B5424D4CBC081D3E
2FCA9D46486B1BF21B2C3F45B37044FB6B4ED04E3561855FD7520A13D8A119C07BA9BA41F4088A87B58EC731A5A8F2D2F8C4BC191FD1F3AC062E3AAC7B3D5E89
0DAFD041CA3185DDB0F3612FD60A2F8186F466D547A3C244627316B49EE7907E7CC9AAA3189A03AC7A33497870897D78DB1F3C64D53FCF79C416D4CD31406201
FB0C71CB32381C4CE0B0B603F2531B817774D8CFC00FE57804D0D808F0262CA1A663C5D9C1B8FDC00FBC37D01C6450CFC5539BCC66838EE29045AB9EC177008D
432B7EE84FB71A20DAE4F4471BF362741837E3DBD6CACA463E21892DF2DD18CF33618889C49CCFA78E350110CEDFDCF47FAF9625939D530345D299EF0306AB40
052121CE93E433013755B84C875E3FBF126FE8DBF19B054BCB4FF9CAE3F91BF6A282CF61D4D54846AE1392F3553F1F1B02C551AD3F189B7293CB2172FFD1125F
62A09D312313C455764E2AEBE0C08995AB6075DE34A66CEBB23FA3500A461E52EF2C588BD4C1A074F6A250E6CDE9EF142DDFEE3F2823DA177DD628B2DF03F5EA
3C66AD73EB9F9449CB0933101491E9967CF8F1203254EDD370039DA905821C146172F4ECD006C6C8D67E87301C081E48EADC8E9441A9262807A50D33D5483D9C
E0BE9EC05F099B4412828BFFCB190D0D7A593298982DEFAFEEB00083E4E22A232810555339E5D0D4326BEBEEEE49ABFDE0FFFFDD3198D20803F02B91CE887D03
83A28894F9AB6510ED26A4214E86EA1398CD00E4D7E785A4F81600D16ACBBAC8579AA72113721F4DBFE6242C1E9F8FB0B91BAF1EB89FF403ED59CED350C60BCD
4F994B37F7AC4A9126FBBA43C5E04D64B5869FD6A28DBC97ABA0BDE9B9448B691614C10B217C2D5A90A7A31E9801E7298ADF6312ED97FA7752262E78C4BC386D
746EE8EAF0D664DE114938624DD4520858EE21BC3B3C77C30CA6367243D0373F49F25DBBD68CB319509485AAD4C7962FA1C0CB7D7EAC5CDF9B9D9E04595BF614
935939E52089CA7B316C082601EF5AC896CC6C76650B38E8064C101E487F3132113CC64F00B6533618C0E7191EA76381351B3803EDC3DA821A549FCC91F99337
946C9B7A807B9C7DC301A3D20BCADE27C667D27F9E58BE0411995D4EB25D7506E334D9FA79C14EF05C92AAC2164D825BB101A13060853B0F7523A63DFC12D3BD
BB7CDCD0616B9B9DA9D528B24049AFBF9683495051D9EC3A41CB2604BCB4C800EF0BECBE1EF614F990503C7C118EBCFA37E71D435AA6A47AD717E540ABF8B4BD
B6B8CAE5716FF504C1F69D436B5C58D3CF008673FF68B51FA32254185F4AE2475145311B59EF450B096DB160769E764418A632F58A4021012FBE80114EACBA9D
2661DB1CE633C26765B7983C6B0172F2188273D13840850A0EA68430585C6C2FE015A2FDB6ED98159CD88B03C0EFEB3FCB5770B57458DB05E0856099988EF600
F52B1672E0FB51AE26AC5C7D111EEC99965C9C9775CEFED7BF0CAC4E9BBD0C611728F381D0B838B74BF33AC428E58B9DC660A9740ACC43200F4611348502A946
98E0AE83FC6A00420C6C1AAF9132CF6A12B2A6A60A7CEE75C8222FC637C15AF02B2328C31124E4508503C81CF6A6CD41B106CA9F4A763284CD72772A69C72CA0
7998921817CE45190F40DFA45B8C990151B8E8911C763AD207186C7AFCA144D8B63457EEB353D90E147FF2D5F4E9650DB52A73CA52E1C10C0A0654EBF722BC6F
3702C77E36921529167AB64A38D52C677D3EE3474A69B52BD94C98A4E0146DDD452242F9949F235AFF7989D753701ACF0E476E1A8A6E219CA0AA985A617AD025
F44D5814F37BF6746353729B484D4B7A53A8CA7012D9BF0B99F0977C13D3651C61A68A4EB1624E12F3BF82FCBB9B66EC9E7DFA933074A0025024FA186500FCFA
634E1D2BF55279B33937BEADD4B25E5D09C35293BB96C0F3A0DDFCABD01CBCFA2DDCADDF8BBE0DF8BA10626FF9BF469D016F3F90E65C01A3F31F2D0004267A7F
B4654D49ED52621B69EA828562A44491A185C76D01E9BDBA903C42394360B815F776EE4508D7422C5DBA7FB1C20EE4B44E5D9738DBFAC9963565E1D01178C1DB
D32C74FDE73F0A23E9DD3A9F66182480B45E1FC21C0CA9CAFA477704B3F45AB6A2D5473682CDF229475FC334907D6ABECAA00AEFF972C5270D9AD95DE4728722
EB64DF4A0FC42850CE4950CAC3B074B5D382BB3487D4206E788AF6CDC21CBC
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark
%%EndResource
[ 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0
0 0 0 0 0 0 0 0 0 0 0 0 0 778 778 250
333 408 500 500 833 778 180 333 333 500 564 250 333 250 278 500
500 500 500 500 500 500 500 500 500 278 278 564 564 564 444 921
722 667 667 722 611 556 722 722 333 389 722 611 889 722 722 556
722 667 556 611 722 722 944 722 722 611 333 278 333 469 500 333
444 500 444 500 444 333 500 500 278 278 500 278 778 500 500 500
500 333 389 278 500 500 722 500 500 444 480 200 480 541 778 500
778 333 500 444 1000 500 500 333 1000 556 333 889 778 611 778 778
333 333 444 444 350 500 1000 333 980 389 333 722 778 444 722 250
333 500 500 500 500 200 500 333 760 276 500 564 333 760 500 400
549 300 300 333 576 453 250 333 300 310 500 750 750 750 444 722
722 722 722 722 722 889 667 611 611 611 611 333 333 333 333 722
722 722 722 722 722 722 564 722 722 722 722 722 722 556 500 444
444 444 444 444 444 667 444 444 444 444 444 278 278 278 278 500
500 500 500 500 500 500 549 500 500 500 500 500 500 500 500 ]
CorelDrawReencodeVect /_R16-TimesNewRoman /TimesNewRoman Z
%%BeginResource: font Verdana
%!FontType1-1.0: Verdana 001.003
%%Creator: Corel PostScript Engine
10 dict begin
/FontName /Verdana def
/PaintType 0 def
/FontType 1 def
/FontMatrix [0.001 0 0 0.001 0 0] readonly def
/Encoding 256 array 0 1 255 {1 index exch /.notdef put} for
dup 60 /less put
dup 101 /e put
dup 110 /n put
dup 116 /t put
dup 114 /r put
dup 121 /y put
dup 62 /greater put
dup 51 /three put
dup 47 /slash put
dup 50 /two put
dup 49 /one put
dup 98 /b put
dup 111 /o put
dup 107 /k put
dup 105 /i put
dup 108 /l put
dup 118 /v put
dup 119 /w put
dup 112 /p put
dup 117 /u put
dup 115 /s put
dup 104 /h put
dup 66 /B put
dup 95 /underscore put
dup 82 /R put
dup 44 /comma put
dup 125 /braceright put
dup 41 /parenright put
dup 46 /period put
readonly def
/FontBBox {0 0 0 0} readonly def
currentdict end
currentfile eexec
A22DD33CB9A1B84FC323D538B9AE6C6014672C02872FAD31037218C4EC2B7124C58AFC4A0E2584B50A778936CFE1053450FEC35486F87A4DA48EF5124EE42DE6
9DDB8A5C33C2868DDADC1C9B4725483A678DFD1BEF77D7BDC50D39DB17FF02031F39030455C675716EB1B292EA6078E9937BB936698E457C365396CC5708EAAB
921AD0271E16D4A5F1689C7D8DEDA69051F9EA8B689EDEA8949F2C93CE777268FD3CE5D1713388D0E33A640C77DFB1D300C88E302BEFDF0083AF060D407FD007
23D3F76465C679461FC0471E7F6EFFFCB5A8E513C1661D98B93E8667005CB8B30093BCB089336AFAB7D61973B6F27AC993F52C52238826E221A63575C2C867DB
E9C0264C99B65994DB79F83B4627E129923C7C8B2B18C455E915E8B66E481761D09CAD95505BF73F376F78015DEC913486199E5E7731D35DD027C9BC536F7C2C
1B29B3EE48E9252E79FD3DD1EFD052797378695B9FF3F00FB13E80A8EDA06F496B2872FDB6253F632FFDEF70381CE952EC8B8FEE2D4328F5D9335D30A7D9B95A
250D8CA0A11564065CD22892CF9550C9B193F329ABAD8894A86EE9E3008DF367F53E41D85D17075D22959000049B53F422AE0B6035D16D54E744662AF5A15992
081C22A392BB51B8ED490379238490D83A6644135B8DEBE209C7325504469911F7920973456771BB03E89F90C5BE79838FAF43BBD570119602EACC20E55B3CC1
BEDC5B0DCE3310157C2BCC13598F5E35854203634AB6A871D58BE8F9FBE25596DA770312EA6D292D5A94766D58A31C00601851A4A090B7835A1F44A0C7649429
0B3A7FD6A75C5E271E615EA79EA6C4BD10B15BE4725167DBFCF958FCD784A23442E910E5A57610DFA9163C00E6191D3ED581A708E235645FBBE00134294225F9
3C91942FEC07AFC2C9A12E531B7F6FF8F3095400333CF9CD0946EED748BC29466900E1854C27862A25576B88E96A85670B55FEDFBE9131516C9755F702C23016
81FD07A96329ADF6FB327F47B138DE22A1DE11652DBD3E4EB52BEC7F5E18C49062126D5AB5914F343FB81EC6EE452371FFB0C44501B1BA9CF1DE27859E710C6B
D94A735F1FAF340DDB765E415C74306503715C8FCE4B12CFC27C20559CFA214DC1E27F85A29566B3DA1E04F04D80B12804301008EBD6A326E060031486A826C4
6F318307AD4797DEFFBE2E3F48E29A7274DB5D0A48DEBE3DF24A2B17721537A86C2F3D9335CD75B75AB7FFEC92B4BBA5ADC3D55301E528E1F0E3DDED5578BF8A
2E7FCC3222388F2D7D89897B4739C73C5CC33EBDA80AE5E9BE17B64F2C980D514008AF9A8522DB374431C5485486B9A9B11FA6395EA100D415300D1CCABC97E7
97DE330C1E2E4FCE446E2F6E01E16323A166E23CF931580B4F141A15ACF9F977AFAC9DBC4962E80048E09F4E2F63431F491C957A9E5822711246BD16EA706917
1147DF807BC4793F7857ECA504C1AD91E80A3A0EBD05E13AF95BA5D0C56F738316E3D328FE155F03E630756999B2FEFE9CF7407ABC360CDD641A34DBE6D93F5B
C605B492588DE618742BA19039CB0BA31EF5DD74A5F4E87C0370C33506965089808F4423798834AF09ADA6F31794EAB14E52BCD114630BA9344260758F629000
3787A0F4AAB89F071BA00559113604422763011BD14D094A17A48850B0723B74F4A9535CDCC8CF65BF8E4C6BDD5789896B33F1533A311A8859D9DE5D19B5C32A
A221AD8EA50BCA5AFD4A8B405D6DDEF94E6D00AE083F40678BCDD79B02B16882E9341F27B34C636EB3F0DE58F72B5BD7CDCA4BFE9DBCD4112615F72583560A6A
CE0F78C715457E7317F8894FF3F243826F4E7C6CB17EB36A377952404A480401733EDB87C2D50FCFA1568DF0CBE7C4F700EBB24F96A01403BC2441478A7D73B3
13AD2B17A85A6A04B344C5F25FA8857F7AC01F4DF1A2A76AE2C370E4ACD036BE9E8333540278DA573A4E835A8AE3244542BFC689F7B088CBFC6CBE8F12B7A186
77DE5FF103FAE113D079FAB111748649570B429D74C4CA644610D1A7A0E86C9ABC47BCD63B5F7950A66D62A1F0E5308FFC47D20C9BFB356FE0099C28AE3858FD
1094F2F6D78B0CE10C4ABA145D6BB3B37C570E7A24C5F721CFE43C5120F583C333F72AD444A8B1DC44E71A1E20448031BB70299330F642FEC211D423BA6D6B23
53DA49CCB3F6C3661D03CDE3E82BFDFCABBB8B7A44CCE7798DFC201FBA269962A93B5A553716906040ADA66028D8C1DA850D9CACE6B671F9C95548F5F9B1BF25
EB4FE96669F2A65CF943AFB3D1F93FE6B043B70013701E8224D7EEFF41C28BA2A2EFB0C4062804D187BD59B444F768A561C0848865E6AC52D4BD2E366EDA13DA
44B45B459CCCEA4441F983F2AD7FD0320D85E1D3A64329C2226319D254DA20F02B0337897477BA4F93F88565BDC88C3060367DBAAC19835BC5E169449D62CE33
F9CA5BEF071024936F2C5577864BDA4869D84F5F8610B20FC78C056B923551E0AD077492C92E2349F240AA41EEDB5690DE77D60308FA346A1F6546A62C7B3E20
004CAC36926355F956E8C47B312B1C96F32694109B6D208415F7698BA3A5183807FA2E8EA77D7B1FFBDFB1824A42757328E96AC17D347FDDD1E625AF051A6EB4
6252FDA06415D0EF76C34EEB38D8E1CFA47BB85A70D14CEE864CB43528D1ADB36982EC65B0DEB4C8C9244110CAB71DBC89A1EBE5E578453FEDE29CFB389DEDBF
63337E1AEF594850A8CCA98C666F1216F9531C64463B358436D059B68FDA3A198A7CA119880359C47B4C327DC500654068E3EA318DD89C75BA248E7E0230AC11
7C09651E8F024B0B269ABA86C06141CDDE3F6284F7EE2AA698E2A55E32B893C1A849E40FFE28FD5D1CCA37ECEEB0C54ABB606025E89C49341B08257754BD6246
624DEF78B94E745B3B1AC7FE588AA3F0E78241C4DF26B7BE326DE10F7B1BDA2A7BDA6AEA5308EBFB87A347977EFDCDB6D8F3A5DF929E95C32B34E61670AC7E0C
ACE0A6388AA8EE49E861B18491399E02D8D6D8A594E83B4C7BE8EF098D219D4BD44620A91637F3F049BF6C97AEAC9167615BB64B780B61D2351C3CFD8A05D707
F5460D8E41E6BE44341BB77A26CD391448D2822A0AEE3002976386F1612A40DF224E0577D09CBB8238290E7383A190F634891BD03216C12962A24AB1AABF2C16
DAFDAF9C7C7106AB6611EEF645EC32F50D6A9C363145C42D970996A184C8ADC9E8DAD2F1973E2CCD541ACC835D3E58B80781177A45A0107E22A521FA4C0C34B3
41AEA4BDD0DF7BDBD33C151D6C9A94D282D55D572C175BF705C0204C1401206343CA8A5DA98DE2AD436DA21EFBE62D8E49B978A78DCECED5FA58234774C904B9
2AED04BFAFE1D30F24904292C0535BDD1E48E9A336A92E492F3394C15696042CC61AB28B3B40768E7931D9B02723C774CF165EFB141C0668B11DA3837B6296D8
DD3EE2C532A1A63099AF9A292399CDA0947CE9CDF6230805676F8E7B3CBEA09685975D7EF0D9584811AB7E2E8D0DE433C814CDDD1BE3DE293C00D11AFBED4A8A
9D7661525C199519289DEE56F9DEF4FE7E03A59D117D400A2C0A1EE1FAB25AA76297C74A350DAA9C3E1FB7886C52A51ACFD555645EC22C21484411ED0F4974A7
98ED784F8984E51445212EDB8F42835A267FE042156A6E081FE262283DABF334E70418FFE9031B1AA8015E6E68EB42F4B3D242924C1DC509E3FD9080EB8B0EBA
6E93E918D49A7922538325C9A6412FFA8A70CBFA0BD3CCDB8749CA86FB0672DBA627E79A3E2BC78A196FF9AB192522FB65C13179E504B3F566AC0BD5E0F8D649
537C6562CC5CF0B55CE23A52B35E6CAAFC94FC3D165C5CE66AB9FE95B4716C974715A31CD2D9CA6FBEA6298BFC6E073EDDC912D56AFE7937C25813BF5D7332E1
ED5C994DA2E0FCC4B7F0A2DF05E0754F20353C36758C045D5581604AAEABEB8213A777AF8FC64504088EF25107189667FE9E5373EEE42446FD0BBAB9954BBFE4
02CFDA907EB28E8EA44BAE7C601C7822C5724AE54D5FE370A1E994B7C5CC4703AAE64EE73113C69159CB97974264EDFF7B530E53E8595BF9859F0F7429B7392E
D88F301B04E0BE65118DE7FFB763924C4D7FD499966DBCFB81FF5F93B33C15E2498D27131CE82D287E4F8ED328F2D868EE36A79E635861CCF7CC494B097E87CA
06F409110650143FB84C80C855DFBD304E1B018FE4EDFB3A1D8209EC75B965E873C2FB81F620F3C5886FC7E1091ED27F941A847363F0FD8A512D5BD0124764D8
356327C880374792852BAE805BBF6CCAF78C61A2568C8A344BDC3C18DB6F0872033F072F02EA9312C7349CF3F58D60ED5DF9B9797CAC86674503C9F36842B429
5CAA202741AD243609C38E622FB480AC410D328919C8B7E79A32B2A27F4C6D0FA7BE877269595F0A46D2B92104D8925A5E794D058F6C5432C632284AA4A4A72E
62592842FF2981117A4EA5EB1FD905C94782C118D9EA7640AEA51C891EDF77226DF7D3E49F2C2419E9D6BD409920DA9AA049D140F0B852D2D039DC78BE879BEF
C844EF5636824C35880E99255E6B808448F70BE8136BC8E38085B05D6E97975930A1365C1428E031B0BCEB7E0AEACEBF4A70BC2A0C15D5C00433A99D6811BEB2
8968DF9D39D2E397890AA13863989486656D692D251FD38EF75CDE08640730A878DB41F3660BAB57E196FE9E3378227A64F2D0D93A1F9E3B2EEC13F2387E0D57
49F17565EF2D9CC9036D41AD84CB154712110445D277B5E88AEB0D828C1B4C3A5DCBE378AF33C21ACBE86F31A5540C0A322E97FE7ED5F28232AE5CB66EC39C44
61C723FC1A970BC3FFF1DF2D174229B770E0B08E3589F59BA30B2366FC6CCC911E2A065C801206F46FED0642761D93AD654A366523F6E8EF8E58E4E33B3EE8BB
4B6B3A4FBFF196305B4FB174B365E5A75F19345FD10668EB4137EAE96A0C9E584387B2DA64D5A95B61E14AF1F5B2C4A3BA3C7EE43DD6430ED2A0E99C35CD868F
3CB70391EF9140B32F965D38C1D1682FEF481A02B148FD0D6DA2A78BAC3A196C00150FFDEE641C8BDDFD454DC6247D38611D983586FADE642F8AFD10A4628100
D7F57F517253B23C2BCF70B073EE06C942558504932C26109935264EAE82941A6D4463FADADFAD3F287D89392AC25212EF48B0F6940FFCC100D1614B314AE764
C952DB38E96DC98F8B0B1673C9B6A5B9A4D6E347CDEAD7B4F225002E5FB181D3842C4EBA8387F7CA42BE5EB5EA678C09C045592F7AAA5D87985DFF8573C5A9E3
4438032CBB68CDE6ED30E978E63C35054B1D1F652C1F163C3568E2CD3B81F4BA22182A774199F0879EAE8D5CE251478E473F6BB8EDCC8BCC88B1F438FF422195
74787FBD13E0ED212477E86D9D66E6514B23E24EB1B3B0E8FB668732AB44DB68BBB68037598137CC76BE9FA47F2991ADB1EEC6CC3665618FBEAAB20DD8C01594
E15F4CBB296C5EF2340C6964153E13EC8A76F34FE8CE65ECE9E0D72F553B9ABD67C07F00FD3E08DCA19FED4A27394A4C4CBC86C8396C62C51193121D4742D008
BE0F4F4AFD6927EE7A89C3068FC04A146A4AE85EADC37D5A6D02E410CBAE1AF61E3CA5DF649FD6FBFE5C63543291A48C0A84CAC3D78B7E16B06D9D416A88BFE2
0DDAA4CA26CDF7C9BEF3072B27312A5E01C587C07CB86D5244107C02C1C53A3A13E5719B972132F85B89EDBF
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark
%%EndResource
[ 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0
0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 352
394 459 818 636 1076 727 269 454 454 636 818 364 454 364 454 636
636 636 636 636 636 636 636 636 636 454 454 818 818 818 545 1000
684 686 698 771 632 575 775 752 421 455 693 557 843 748 787 603
787 695 684 616 732 684 989 685 615 685 454 454 454 818 636 636
601 623 521 623 596 352 623 633 274 344 592 274 973 633 607 623
623 427 521 394 633 592 818 592 592 525 635 454 635 818 1000 636
1000 269 636 459 818 636 636 636 1522 684 454 1070 1000 685 1000 1000
269 269 459 459 545 636 1000 636 977 521 454 982 1000 525 615 352
394 636 636 636 636 454 636 636 1000 545 645 818 454 1000 636 542
818 542 542 636 642 636 364 636 542 545 645 1000 1000 1000 545 684
684 684 684 684 684 984 698 632 632 632 632 421 421 421 421 775
748 787 787 787 787 787 818 787 732 732 732 732 615 606 620 601
601 601 601 601 601 955 521 596 596 596 596 274 274 274 274 612
633 607 607 607 607 607 818 607 633 633 633 633 592 623 592 ]
CorelDrawReencodeVect /_R17-Verdana /Verdana Z
%%BeginResource: font Verdana-Bold
%!FontType1-1.0: Verdana-Bold 001.003
%%Creator: Corel PostScript Engine
10 dict begin
/FontName /Verdana-Bold def
/PaintType 0 def
/FontType 1 def
/FontMatrix [0.001 0 0 0.001 0 0] readonly def
/Encoding 256 array 0 1 255 {1 index exch /.notdef put} for
dup 36 /dollar put
dup 115 /s put
dup 50 /two put
dup 73 /I put
dup 68 /D put
dup 49 /one put
readonly def
/FontBBox {0 0 0 0} readonly def
currentdict end
currentfile eexec
A22DD33CB9A1B84FC323D538B9AE6C6014672C02872FAD31037218C4EC2B7124C58AFC4A0E2584B50A778936CFE1053450FEC35486F87A4DA48EF5124EE42DE6
9DDB8A5C33C2868DDADC1C9B4725483A678DFD1BEF77D7BDC50D39DB17FF02031F39030455C675716EB1B292EA6078E9937BB936698E457C365396CC5708EAAB
921AD0271E16D4A5F1689C7D8DEDA69051F9EA8B689EDEA8949F2C93CE777268FD3CE5D1713388D0E33A640C77DFB1D300C88E302BEFDF0083AF060D407FD007
23D3F76465C679461FC0471E7F6EFFFCB5A8E513C1661D98B93E8667005CB8B30093BCB089336AFAB7D61973B6F27AC993F52C52238826E221A63575C2C867DB
E9C0264C99B65994DB79F83B4627E129923C7C8B2B13CDD7F7B517C71B7F516E328F8121312A93F755BF9D6D4561B88AE31B66D8D58E8C76A4C71958B6F1B075
BF1EB7316311C303CEB599C85AAF2EE8943DC03E5CDE9AF4D69743D0B95D5150596E51B85E3D1D90B78C211A148950AB5D034BDF36009DBA05E94F823E17B9A2
CC5F6BD419320FDDC493EA25BC8310CC2F63AA46B7F07858F7CC2B9326323419848D834A50AC288D58CCE255DA67EC2D703FC9A935428F7B64F7B94D8705FF22
12E80E6EE9DDCEB382D371B3DC39FCD4F2C91687081DB40F24BBBA0AE753CEC624253B9C930114A288EC272D56C3DCAE896EDD2985D8C74C464D2B8FFCEEA181
115422EA5ECCE592CA734915055756B454D988284EF6400D35C55CAAB651A587D075B9411F8232CCC3603D485916BDE74909E0BD1702DDAAA98925B84E88322F
5BB470E22A51B21FA0ADF8BF0C6214D8D6554E46E97144D808CE8785FCD01B7EE85D94277852CE75D7A37397A3682C5BDE7BD41A66FB79DDC4D5CC8AC649DF96
FE14F09E29EBCE00CA624469F7CA3BEB2993477B8113CBFED60E03B80C54B8A8A329ABAF0A17391BAF68A526B00BF75B1F446429CD080F997B3AF0529ED89459
81AB8A68E863ADD8B3A9478B9545F2FE60FC56700F5D740415C569815E6EC02BB3BBB5E052B52657703299FEE6176ACB790DA02CDFF7A3BDDB91043CCA162466
39C1CC6BB1BCCE836F33C82D15EB47BBFA29E6E76E0CFAE1EB9D8F43A77F67544AF1B2FCE12FF1CDF14EA6913491209563C46095303735968DCB0937D5A61E0F
11A63FE04B3AF2987D02CB02FD310BD2C64B665B148C47F99AA585F81399F3DCB70E233A490AC9353ED35EC78B52A0386AAFCFC0141347D6AB08C9C69F780A49
35F910A75A0E531E2B8CCDC637FFF6D4E898F405D0241BF464D71FB33FA3F80BFAE3ABCB332B5B7A6563A32FA64336F22C7983B3374C6570D9AA96971CF5A4EB
15F8BA218CD989D3E1B7DFDEEF134D1517956C68F9C7521FE2D236DED651EDB74E0AC463982B680AFC9293864516E4E8E11867E2427784BFBBD14F88EBBC6AD2
5E3640654213C474D97AAC88E703F7F6C48B8FCCF8EBE4BD53F80160000EBD2074B1A0919C5C995881FE3132F1305B9D341B32CEAF07B5754FF1601870FD56A1
9AA7571DE8B683060E3FBE800965BDF206183BAEDE2CAF951065640E997BC8493A7E31D8CF3004168C9476D06305069760378C140D07D6F72C0B101D38D70C91
9B6EAFF277153C85848D67F7D656CCCBC212BBF9C1E78899A84D4AF2727548A9F1DC0FFE290097AC24FCD8EB1AD16A79C216320D620CC78465B78251F8184880
C82372941C39F3654E5B58CE93130105A58BC4460B481CA984C8EC519FA4EAA17D8CA93419123F99ACF0AA42DDF8CA55E7223C2F6299012D70DDF0917889EE55
F378EF4D81C3D08C1D175B189B5288D7832A026D6E4BB81040A5BDF4AED3E51BC4091449E0CE3A0415F39D1076C98EA1068395C635C53AF02206FCCE0C03759E
A7EFA88992852DD40F6E219FEDD7DB35153B38459961A11FC1643E6F174D540922B7AA505EF5CC7C0FD6032F962EC206EA895F8A98C3E0257CC0762F80BE4728
4AF8D871FAF2637329D28FC0070845409908804AAF494CF340C07F56B0354E2C189D7DC580878B0850B433C408D68612EE82C187FA68C8FE970F99817FCB903A
7A6F663845A0329782D25D1FB052
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark
%%EndResource
[ 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0
0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 342
402 587 867 711 1272 862 332 544 544 711 867 361 480 361 690 711
711 711 711 711 711 711 711 711 711 402 402 867 867 867 617 964
776 762 724 830 683 650 811 837 546 555 771 637 948 847 850 733
850 782 711 682 812 764 1129 764 737 692 544 690 544 867 711 711
668 699 588 699 664 422 699 712 342 403 671 342 1058 712 687 699
699 497 593 456 712 650 980 669 651 597 711 544 711 867 1000 711
1000 332 711 587 1049 711 711 711 1777 711 544 1135 1000 692 1000 1000
332 332 587 587 711 711 1000 711 964 593 544 1068 1000 597 737 342
402 711 711 711 711 544 711 711 964 598 850 867 480 964 711 587
867 598 598 711 721 711 361 711 598 598 850 1182 1182 1182 617 776
776 776 776 776 776 1094 724 683 683 683 683 546 546 546 546 830
847 850 850 850 850 850 867 850 812 812 812 812 737 735 713 668
668 668 668 668 668 1018 588 664 664 664 664 342 342 342 342 679
712 687 687 687 687 687 867 687 712 712 712 712 651 699 651 ]
CorelDrawReencodeVect /_R17-Verdana-Bold /Verdana-Bold Z
%%BeginResource: font TimesNewRoman-Bold
%!FontType1-1.0: TimesNewRoman-Bold 001.003
%%Creator: Corel PostScript Engine
10 dict begin
/FontName /TimesNewRoman-Bold def
/PaintType 0 def
/FontType 1 def
/FontMatrix [0.001 0 0 0.001 0 0] readonly def
/Encoding 256 array 0 1 255 {1 index exch /.notdef put} for
dup 80 /P put
dup 36 /dollar put
dup 98 /b put
dup 73 /I put
dup 68 /D put
dup 97 /a put
dup 99 /c put
dup 111 /o put
dup 108 /l put
dup 49 /one put
dup 50 /two put
dup 55 /seven put
dup 53 /five put
dup 76 /L put
dup 82 /R put
dup 51 /three put
dup 52 /four put
dup 74 /J put
dup 84 /T put
dup 65 /A put
dup 103 /g put
readonly def
/FontBBox {0 0 0 0} readonly def
currentdict end
currentfile eexec
A22DD33CB9A1B84FC323D538B9AE6C6014672C02872FAD31037218C4EC2B7124C58AFC4A0E2584B50A778936CFE1053450FEC35486F87A4DA48EF5124EE42DE6
9DDB8A5C33C2868DDADC1C9B4725483A678DFD1BEF77D7BDC50D39DB17FF02031F39030455C675716EB1B292EA6078E9937BB936698E457C365396CC5708EAAB
921AD0271E16D4A5F1689C7D8DEDA69051F9EA8B689EDEA8949F2C93CE777268FD3CE5D1713388D0E33A640C77DFB1D300C88E302BEFDF0083AF060D407FD007
23D3F76465C679461FC0471E7F6EFFFCB5A8E513C1661D98B93E8667005CB8B30093BCB089336AFAB7D61973B6F27AC993F52C52238826E221A63575C2C867DB
E9C0264C99B65994DB79F83B4627E129923C7C8B2B19F7108D2FA38DA243ECD4202C074ACDE3089686681826E347D5E3708CB34B0418440AF32644B01E717DD1
4D34A1081AF4CD64E21BA804A1E3545FD6F83ADB89C1561F1235DCE437CD8443558FB9C6282E98CEC7570B9F06F9566D37841EB962673A93DABC61C28EE445A6
5FDD62E039A33FB1093A47B470BB2717E65C254D3A2A313A0D5657ED9357D69C38FFF6F56A3B6111CFD0CBF8C2BA492C306390C3DC489DC5D41935DAD74832DF
4609E53A12DDA94FE071379F0119E49276818BFD5C682304B89312E1E5E544DF1B6AF368EC7543215569ECA5940A72074CD751B1936EC489DF9E693969C20CC8
C805C075C6783833BE198B2EF5F48843A4C1064A1A8E6E963BDE6026EADA64928DF95A99318326E2798C7E3F3E006A4A206BE1782602949500C87E1827277E59
9499DDB44A50A7E6883BCF23F1585FFAAF923E032FF769BB18675AD79DB86B56096183C6C41F1DA5F2EA2AC8C78F1BFE88815BE79DCA61074D50B032D394B28C
813C69A2294F7B927D197563147C4598D87A798B18EA58957693D66CFA2E9111097FD235DAF5FC092E1EEDEDCD85A27E066E7DE9F1D80694AA8BCCA5F8CA62FF
751A716D7ADD758B4AADB1209B6800A7DB356FEB2919206BD217CD41F96D68124C9F537E1F0E8B3C82743329F0086B3B6E2E573617FB576D566F5BF374D78B9E
249A098556DB650C635F1C179248E655BEC3C9DE2800628F93E2EA8EDC061044F996E925FF466D5956C7424ED85BE35D69ACCAB0E8D1432F89666C54EC271A0B
5C6C29A1D00BEE459406AC453B263A7BE8B69674379173B1BC9D268D4372A252BC8CE8CEC1B5C7032E75215730115A5252D25DCD89AF13D408B73D6CE2497E3B
48DF516678F9D1F4E84A18E5EFA0241F51F6C586F5DB9968E4949438FB03FBE9E94096A4BC527CE70534C33910128989896EFCCBE5D1BCFA0EBC8E313BF00D3A
CFB8012E8F8B8286774EE53FE7502262B1EF28DFDEF7F158A51B778B02C1BB056171C548A18985E4757A639E6F4ADC7CA369D1AEE3FA5BEA8B74D663ED42EB03
3DFBF67B6A360DE50A68D27C6D2500E57415D9A9A1137A0E7AFD32AB2A269D39400D18979632817FC0EBCEA815C6DF7D6071BBCBC948BC0A17A8DC5C6B607817
7DD223F7DFD8416695992A77AAED2AA6C61DF13E2197DB73A5D85C2A4CF822DC337477816069577129FE8159FFAA3B3F233279FC0FDBE1493DAC7771440FAC0C
F026746B59334A9703067D36CA3CE404D2A787A42F9AEA4E126FE7122AF21D4680DEE939883FE19601699863E80E1D8A4EDDDC0A42E8FAD656ED89B5208650E1
5486DA353CA0A5C824DBC45ED389EBAF2AE09F8AB1BE5D41BF90298E9DE1274BD7A20D0DA9232F2EC36905D1A22707C68820D9F16FC73915A345A819CF45EB36
C348F18D18455D1671203988EECD8401BACD48D79DA7BCCACACC9C611921F7A5FFE546F447A978517B3E2C46A74BF982ADDE07F39B55A9DFA1AC005655851720
D7EDF2B69E4F220457A6DCCFCF5A9D0531FE94E930E1450310067B12D55004B5C059D3BED3B7118F9F2626275D9F274A639A286D9467727A277287BB432E933F
6C6FC7C4E4C8B89C8BE31CB6083C03AF394A5A2100B985C94C7C889AF9B38468C365D9888A00FDDB5EA72ECC5EACFEB03075D66F0E2F392D645DF5145C05EB09
EDA9A6962EFFF68FFB501D670CD7FB57D91302CA3F96DAEE6931F9787A9045AA3291C830CF5DAAC95AD1F46503F3BC8C9F28D1F7C5E8FD18EBE1FE9AFFB37262
6D80F8A94B6C0254668EB389FB096C13F8A388761843F1E29FBA7F2A32486798046C9B4CA9AE14AED58F21526523299F53EDBBEC4BBA544BA5CAD5808777FE16
771CA42B1EABBC5DF97BAF9DB1471E134947CA87BB740053AAA07B1212A91FD027429D76C2906FF120E907B519B0E755F7D2805B1AA712E1D43A41B8C49B3B06
FE3C62AE4F0A9C04F11FAFE15B7C4C615953FBAC25BC8B867A2CA0CF72D9425CF166D0651DCA0C93252AF5F768FCB2AF8CF375C761796B63B41D5FC2299B830B
53F08A9C65ADC604BE7C9EB7EB4CD99E5F45FA2B1CEF9903E1E85AC076314CD54A416E010A94929F34ACF4B99CD331BEC196C2AF8A5683CB7EA65E6124D7CC84
A399720B5F75ABBA9CD5726773C91100ABEA2DC46A1F3F4E3C98C010993931BED3E6A635DDD3DB9EA1AC4506F7D965964CE5D2CE0350174AE5814714226BC0B9
26DD84348019E4C75B7E7E1A9F77118E775F2E1F4EC7C04F2CF34FF8D68A71D5F826DB8846EAD412C34A46AD481EC14EA6307B39E7194DD3546DB2C4B968AF95
C4E481230B5604D395C9DFCB0475FDA855C914532814AE49CBFEFA75F886993BC1C20646977FFC884C2AF7219DD8919AFE040DB6801D8C89A01978FA249BFE88
A5C4A796CB3A81F52171C670E6F205B9C52DF21543DAE729DFD7AFE49B0A4060A4B8B0D8AFBAB77CA356E52FE9694C44DE88F3FE0AA5200E2E994897AB9EF4D1
BD697A43731EFA7F74221C29F505A397AA445DFD830F92C6AE013E4CB53B7A13B3E29F1E679A925A01792186A14B16B84FAD820383ED05BE8056D38E2A339176
27E5BFE7E03AD0C7DB0B931B01EAA4BE25BE0CEF169B652C5AFC2057A27C148602B4CA32D355D3CC432C2F834CC9AF975A337F35DE2F3CDA495DEF793BA2BFFD
1F0B9F3F9122AE7EDB5A0BF11C86AF8AFAA54B572EFBB26460968CDE3ABD064448E87826BD3763F35F129DEC60DA6606022CAA65BFD6EC5149D7856D86A85863
76F1F70DE45E0AAB9A5234FC2055AD3DADB5F270AFEAA7FC79F004AF95902A4EE24234E5A692D6A0B28E872FCCCBE66530CDB33577377B488807E011774E142C
F16955582175C2DCC875510F83873A35EB1AA190A18CD76C91A90B788C02B58F06F24FCE33EBA2F1AAA9B9203BEA3DB498FAD31FD84EA1592D055A44FC002272
5A3DBC7E54F2505BCEE3AB3E5A86448257CFD51FC2C4E86F3E3C81DC2F567D59E914D24A1923F915A9EB3A0E90738328F6A4BCCD0B8261D1319CE0EF66C48C63
A83872967D47633A6FFD535495C545B755B2DDF99B29E723A8B51F5D66A7C3F73A361AEBAFD3AFF54914725744252AF800C7022978D7EFD0621CB6B7AE392046
EABE7F15CB5D2623E4EA8ADBCC2B7D2BE051B77570A358A4BD67A01722B826C1D61DA74DE5D0D48169E1EB07ADD3CB5FDA0C2B3BD0D905B326E9396F20FC54B8
3CCE6E66C2CC2FF7C279C1BD86A93BA2CF6B918B7CFAE6B892E3ED565363CC65525B4BC89273BC3CEB5E7242A5D4F034110523D471D17E2170ECBE4F427AA535
007287884CD5130A61627FAFF6F22CEA7648842923A4A459AB7794D7B78579C6FFCE5E4ECE53BD3558EF317497A6013A3F96432EABE77E6BDD19FD7BA6896D8C
4FE1A43FB9C20232A1CAFC59E7C1F3E5CAE677A612F364AC9F5BD9753AEE96ACA68B0CEAFB7E0AC5040C5492727BA25CA06F6D5067164DF9D60A722BFD27DC2D
F44DDBAB6CE644FCD1FF84D9034B7C8F5F289B19D44772A3D96F8B93086A37D81A9F985E26BA0991494E904CEFB9BBFC68F872BF5BC41EEC602E04DD50B91454
CE446FEAFDD64D417FC6E8AC549A33A62D16C87B967B4883207110183BE9EB5B2EE1AC0C3CAE9EF070668B3B741F22D9FEE731D7EACF26187CEBBE8752562963
90CA5CAD1C50F5EF1512CCCD2838677D877261A4D2AED00F9D73486A0CEA0C85E7EB04018080174970A4E5AFEA0B3C96A564A1430B387868E31B49E744256F30
CA39B51313C8528FA350118E237590C2386FC0B6A2D5B0C0EA7DFC72056ADE41F6F56FEEE755C9C70EE0E9261CEF95789DE7274832FF169AC8B64EF3BE645F4B
745282628B3CAA6093C2920BC211C2E005796944D115B4DC4A787E8897015A01C92FD037275B2944EA3B6B11E81240D15123FB9EDD92A0C4E3FFA6D174A756A3
0FD96B1E8BB69ADECA7817BA469AC6FEDF159326F6826E7481FD3E3D0D4A94D9F559B6D5BE0D7C1F502FE263BEF2C50B6CA497A46DAE2CB747FB435AB61CE0BB
CEC6EAF92763440F0523EB99AD26837D617148E96101A21054E9D3DD7FAA08C7B37C33D298896FCA875F9A6C3D68C57A7938891FB8676C8B6918C095DE67A813
38DD3820720D00FCA74070565B6D060C58BB9484054A25DF246A82A8ED56C3582E8EBE3ED672DFD33CDCC6687B9444E66B6570B263D9853C7F9CCA1B0B7126FE
8170A23EC3747886A95D594EBA2AC216F94938AE19CE45BC732490BC56F9B0D6C04C33DBB9263795F295B9084BBC18BC6F44F56841D8FE5FE9FE05ECE108229B
E84111E60485F2681FF68C9A6F0D2EB8E6E5FBE89806BC5768E48EE0CE7AA0E241BF1B54C6EA92B6C7243CF1BA3BC0774322C0E7789C7C0368FCA60B82385DF1
C5C58AC76D8B6543C288F9647FE50022234C8D9FF88EC5C109811A41D482DA03F93955F02E8F909FC8DC42F5D23E61FFCCC3F29169F5506F8241D475CF255751
6F69E42D409F4F79BC5205886A828D88050514600D382691260B69A832AC02801968D003EBFD447889161BDD9DBE83B5A2D0840C6E3664BE53E8B374A980A928
C0858D320C0CED59165492D07146D3223AF78A8CACCADDA5392E198845A18171B1BBB4441DBDC9D8DF8BC8CDC154149AD20CB763B65EFD817EDBA0FF8486BAC9
A7BAFDE0805A9344D9C2224E39E31C9CC0402AA1DE51F75B2006AF35475B1318604E98A98B0A419E5EEC210C8F941DAEFA8F12D16FA6C53FC6177B8FC29FD409
0224909022B834593750AD314A72C06D55F67413D4339DD1527409F041392CF7CAFEC8480A9F6555279E22DFB05E202DB6A1C5FA44ABF6FE0522D14503D6080C
3BA8E26004A2EF9A5F217AF0562FC8A3C3492C45C78B3EEDC63D954BF39F420102BFBBC9C4742C03EC033C9F86D2F27D93C0F0C39A20E87D0AB4E9E2C81BF457
C678CDFB25B58F89A2BA3CE62E683F2AF22BE3309C20559DBF3189F68DF834A224BBD99811E3A956B4AE0F551E6E982809E9AC44061022E6B0E240FF7DBA05BE
C661C6F7CEF1AEABEC739A70BC976B17A531B810914BD430568A2F3E0EC808D9D052B69DB9EBABB34328B6381A0BFC78841AAD173E19E6C0085ABEF7A043DE76
3DDEB443AAE78294870549447214EC6BC0635554017390DC053EA4537105B02E429A36937BB340EFEB1D13AF2E3A79342AAC84D61E57294CAC20F9DDDEAA3590
15196CABB416A6328C1F12CC94BDE4B5E82B3A9CEB60E307A1308960B84758F2A07C6D832D28CE01D43CAA95B822DEBFE345343A1B46A8608AE67D012D78D815
18FE7AB36C451952DD1C6F1ACB4F54F146F037A6CCF94F1D69718C42D820D0C0483FA1CE115AFB37E96C6BF9468F65EFF30F357F13A1FF08581E9FF6E38C8719
935B6704914674868E4FF4EB1692D285F8750365E35B6A33FF65E907AC9EC13537E1ABBCD28AF0BE598AEF61A4B35ED2B04098DA46E19860A0452ED83505A5F7
CA6E90042B7E2542946B2308173838DB089C83E7627C4E3EC44A9A4098EBEAB44D4A20BA3D5B86196CCF3FA68E22986F61F4E033E9F04EA3282B85CC4521A34A
0DA590B1CB9E31568F6F4D4C1DB7742B94F4B4E69CAD6C580897FED080F3DC1279BCD7B60E9C0FD5BA9DDC8E62B7BDC92E0DE2C1962DCD817BA1D79456151890
1DE3ECEB66688AE90E80F770E77EE4DB43C278525B3FEADD02DB33831D412166CF907205D61ABCAC789B781EDE775A23D77C2A0E87935EA3062F63D33D026143
25D6B7D89BE0709B09D3BE308A732674CB17F90717D3A01C5B378F
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark
%%EndResource
[ 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0
0 0 0 0 0 0 0 0 0 0 0 0 0 778 778 250
333 555 500 500 1000 833 278 333 333 500 570 250 333 250 278 500
500 500 500 500 500 500 500 500 500 333 333 570 570 570 500 930
722 667 722 722 667 611 778 778 389 500 778 667 944 722 778 611
778 722 556 667 722 722 1000 722 722 667 333 278 333 581 500 333
500 556 444 556 444 333 500 556 278 333 556 278 833 556 500 556
556 444 389 333 556 500 722 500 500 444 394 220 394 520 778 500
778 333 500 500 1000 500 500 333 1000 556 333 1000 778 667 778 778
333 333 500 500 350 500 1000 333 1000 389 333 722 778 444 722 250
333 500 500 500 500 220 500 333 747 300 500 570 333 747 500 400
549 300 300 333 576 540 250 333 300 330 500 750 750 750 500 722
722 722 722 722 722 1000 722 667 667 667 667 389 389 389 389 722
722 778 778 778 778 778 570 778 722 722 722 722 722 611 556 500
500 500 500 500 500 722 444 444 444 444 444 278 278 278 278 500
556 500 500 500 500 500 549 500 556 556 556 556 500 556 500 ]
CorelDrawReencodeVect /_R16-TimesNewRoman-Bold /TimesNewRoman-Bold Z
%%BeginResource: font Symbol
%!FontType1-1.0: Symbol 001.003
%%Creator: Corel PostScript Engine
10 dict begin
/FontName /Symbol def
/PaintType 0 def
/FontType 1 def
/FontMatrix [0.001 0 0 0.001 0 0] readonly def
/Encoding 256 array 0 1 255 {1 index exch /.notdef put} for
dup 32 /c32 put
dup 33 /c33 put
dup 34 /c34 put
dup 35 /c35 put
dup 36 /c36 put
dup 37 /c37 put
dup 38 /c38 put
dup 39 /c39 put
dup 40 /c40 put
dup 41 /c41 put
dup 42 /c42 put
dup 43 /c43 put
dup 44 /c44 put
dup 45 /c45 put
dup 46 /c46 put
dup 47 /c47 put
dup 48 /c48 put
dup 49 /c49 put
dup 50 /c50 put
dup 51 /c51 put
dup 52 /c52 put
dup 53 /c53 put
dup 54 /c54 put
dup 55 /c55 put
dup 56 /c56 put
dup 57 /c57 put
dup 58 /c58 put
dup 59 /c59 put
dup 60 /c60 put
dup 61 /c61 put
dup 62 /c62 put
dup 63 /c63 put
dup 64 /c64 put
dup 65 /c65 put
dup 66 /c66 put
dup 67 /c67 put
dup 68 /c68 put
dup 69 /c69 put
dup 70 /c70 put
dup 71 /c71 put
dup 72 /c72 put
dup 73 /c73 put
dup 74 /c74 put
dup 75 /c75 put
dup 76 /c76 put
dup 77 /c77 put
dup 78 /c78 put
dup 79 /c79 put
dup 80 /c80 put
dup 81 /c81 put
dup 82 /c82 put
dup 83 /c83 put
dup 84 /c84 put
dup 85 /c85 put
dup 86 /c86 put
dup 87 /c87 put
dup 88 /c88 put
dup 89 /c89 put
dup 90 /c90 put
dup 91 /c91 put
dup 92 /c92 put
dup 93 /c93 put
dup 94 /c94 put
dup 95 /c95 put
dup 96 /c96 put
dup 97 /c97 put
dup 98 /c98 put
dup 99 /c99 put
dup 100 /c100 put
dup 101 /c101 put
dup 102 /c102 put
dup 103 /c103 put
dup 104 /c104 put
dup 105 /c105 put
dup 106 /c106 put
dup 107 /c107 put
dup 108 /c108 put
dup 109 /c109 put
dup 110 /c110 put
dup 111 /c111 put
dup 112 /c112 put
dup 113 /c113 put
dup 114 /c114 put
dup 115 /c115 put
dup 116 /c116 put
dup 117 /c117 put
dup 118 /c118 put
dup 119 /c119 put
dup 120 /c120 put
dup 121 /c121 put
dup 122 /c122 put
dup 123 /c123 put
dup 124 /c124 put
dup 125 /c125 put
dup 126 /c126 put
dup 127 /c127 put
dup 128 /c128 put
dup 129 /c129 put
dup 130 /c130 put
dup 131 /c131 put
dup 132 /c132 put
dup 133 /c133 put
dup 134 /c134 put
dup 135 /c135 put
dup 136 /c136 put
dup 137 /c137 put
dup 138 /c138 put
dup 139 /c139 put
dup 140 /c140 put
dup 141 /c141 put
dup 142 /c142 put
dup 143 /c143 put
dup 144 /c144 put
dup 145 /c145 put
dup 146 /c146 put
dup 147 /c147 put
dup 148 /c148 put
dup 149 /c149 put
dup 150 /c150 put
dup 151 /c151 put
dup 152 /c152 put
dup 153 /c153 put
dup 154 /c154 put
dup 155 /c155 put
dup 156 /c156 put
dup 157 /c157 put
dup 158 /c158 put
dup 159 /c159 put
dup 160 /c160 put
dup 161 /c161 put
dup 162 /c162 put
dup 163 /c163 put
dup 164 /c164 put
dup 165 /c165 put
dup 166 /c166 put
dup 167 /c167 put
dup 168 /c168 put
dup 169 /c169 put
dup 170 /c170 put
dup 171 /c171 put
dup 172 /c172 put
dup 173 /c173 put
dup 174 /c174 put
dup 175 /c175 put
dup 176 /c176 put
dup 177 /c177 put
dup 178 /c178 put
dup 179 /c179 put
dup 180 /c180 put
dup 181 /c181 put
dup 182 /c182 put
dup 183 /c183 put
dup 184 /c184 put
dup 185 /c185 put
dup 186 /c186 put
dup 187 /c187 put
dup 188 /c188 put
dup 189 /c189 put
dup 190 /c190 put
dup 191 /c191 put
dup 192 /c192 put
dup 193 /c193 put
dup 194 /c194 put
dup 195 /c195 put
dup 196 /c196 put
dup 197 /c197 put
dup 198 /c198 put
dup 199 /c199 put
dup 200 /c200 put
dup 201 /c201 put
dup 202 /c202 put
dup 203 /c203 put
dup 204 /c204 put
dup 205 /c205 put
dup 206 /c206 put
dup 207 /c207 put
dup 208 /c208 put
dup 209 /c209 put
dup 210 /c210 put
dup 211 /c211 put
dup 212 /c212 put
dup 213 /c213 put
dup 214 /c214 put
dup 215 /c215 put
dup 216 /c216 put
dup 217 /c217 put
dup 218 /c218 put
dup 219 /c219 put
dup 220 /c220 put
dup 221 /c221 put
dup 222 /c222 put
dup 223 /c223 put
dup 224 /c224 put
dup 225 /c225 put
dup 226 /c226 put
dup 227 /c227 put
dup 228 /c228 put
dup 229 /c229 put
dup 230 /c230 put
dup 231 /c231 put
dup 232 /c232 put
dup 233 /c233 put
dup 234 /c234 put
dup 235 /c235 put
dup 236 /c236 put
dup 237 /c237 put
dup 238 /c238 put
dup 239 /c239 put
dup 240 /c240 put
dup 241 /c241 put
dup 242 /c242 put
dup 243 /c243 put
dup 244 /c244 put
dup 245 /c245 put
dup 246 /c246 put
dup 247 /c247 put
dup 248 /c248 put
dup 249 /c249 put
dup 250 /c250 put
dup 251 /c251 put
dup 252 /c252 put
dup 253 /c253 put
dup 254 /c254 put
dup 255 /c255 put
readonly def
/FontBBox {0 0 0 0} readonly def
currentdict end
currentfile eexec
A22DD33CB9A1B84FC323D538B9AE6C6014672C02872FAD31037218C4EC2B7124C58AFC4A0E2584B50A778936CFE1053450FEC35486F87A4DA48EF5124EE42DE6
9DDB8A5C33C2868DDADC1C9B4725483A678DFD1BEF77D7BDC50D39DB17FF02031F39030455C675716EB1B292EA6078E9937BB936698E457C365396CC5708EAAB
921AD0271E16D4A5F1689C7D8DEDA69051F9EA8B689EDEA8949F2C93CE777268FD3CE5D1713388D0E33A640C77DFB1D300C88E302BEFDF0083AF060D407FD007
23D3F76465C679461FC0471E7F6EFFFCB5A8E513C1661D98B93E8667005CB8B30093BCB089336AFAB7D61973B6F27AC993F52C52238826E221A63575C2C867DB
E9C0264C99B65994DB79F83B4627E129923C7C8B2B18D54F9E0F0F9280A6425EED2E2B7BB29DA8D3D977AE0F4D887F72309ABE6CB09B8D1F5600779F7C13696C
8F3E4BF69127EC72FD447C37CF4AB75A587241DBD67A93BC2D95C3E739F46F46E59508D7EF0715311852A151F0B72EEF94C92FB9D681A7C90806A9A7212BA671
3157DE0274F1147CFF2A2BE5D36454409846A4EA782129E62F0C5DB020255007E528639905536747F75ED14BA4A6AF4AEEDFD44E83B178FDDB4DB479D833FE25
C23A8FC54CB27D4FC05163B85D9EE25DDDBE07AD8F7FC0F5753782782B882DA5B3FDCEA6A42646DF71DF8A20A73D92A7E2A6CD8741CDD44F20C155845E88DFEC
58CD3D4DEBF89416D4DFC6EDCC8E1CB9D74440184689DE853FBACCD340A624220A74C70C83F019929203E6A0438DBF1320A3A6EE71ACC9B1984444C002A1C018
6C1F74B95C8395A2B451AEA80E3DB932FECD5E330DF1463A15058601127F569743A86F6FD045F6464E92E6CB05C25998288E2060111E74EE3837CEFA72A4C889
5EA8FFAB845899FF543128EB8D1800AEAED871DA356823F5ADB5DC32E52A33838514642961FF0047C15E1FD668A73497C55583C70E75A1700000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark
%%EndResource
%%EndSetup
%%Page: 1 1
%LogicalPage: 1
%%BeginPageSetup
@sv
@sm
@sv
%%EndPageSetup
@rax %Note: Object
190.90602 96.72321 258.63789 117.10857 @E
0 O 0 @g
0.24 0.01 0.12 0.00 k
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
190.90602 96.72321 m
190.90602 117.10857 L
258.63789 117.10857 L
258.63789 96.72321 L
190.90602 96.72321 L
@c
B
@rax 204.05764 99.53036 210.32249 114.26031 @E
[0.00021304 0.00000000 0.00000000 0.00021304 204.05779778 102.17182693] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/Symbol 56443.00000 z
0 0 (f) @t
T
@rax 212.51254 98.61676 237.39676 105.27506 @E
[0.00021304 0.00000000 0.00000000 0.00021304 212.51252873 99.91727462] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 ($s1, book) @t
T
@rax 239.66164 103.87729 245.33603 110.53587 @E
[0.00021304 0.00000000 0.00000000 0.00021304 239.66174417 105.17796770] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 ($a) @t
T
@rax %Note: Object
382.26501 96.72321 449.99688 117.10857 @E
0 O 0 @g
0.24 0.01 0.12 0.00 k
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
382.26501 96.72321 m
382.26501 117.10857 L
449.99688 117.10857 L
449.99688 96.72321 L
382.26501 96.72321 L
@c
B
@rax 394.75928 99.53036 401.02413 114.26031 @E
[0.00021304 0.00000000 0.00000000 0.00021304 394.75930662 102.17182693] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/Symbol 56443.00000 z
0 0 (f) @t
T
@rax 403.96564 98.61676 429.17868 105.27506 @E
[0.00021304 0.00000000 0.00000000 0.00021304 403.96562602 99.91727462] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 ($s2, entry) @t
T
@rax 431.39650 103.87729 437.40850 110.53587 @E
[0.00021304 0.00000000 0.00000000 0.00021304 431.39668713 105.17796770] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 ($b) @t
T
@rax %Note: Object
416.08346 117.10857 416.08460 118.23619 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
416.08403 117.10857 m
416.08403 118.23619 L
S
@rax %Note: Object
413.17200 117.95414 419.09017 123.77849 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
419.09017 117.95414 m
416.17814 123.77849 L
413.17200 117.95414 L
419.09017 117.95414 L
@c
F
@rax %Note: Object
416.08346 90.05329 416.08460 91.18063 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
416.08403 90.05329 m
416.08403 91.18063 L
S
@rax %Note: Object
413.17200 90.89887 419.09017 96.72321 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
419.09017 90.89887 m
416.17814 96.72321 L
413.17200 90.89887 L
419.09017 90.89887 L
@c
F
@rax %Note: Object
224.72447 117.10857 224.72561 118.23619 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
224.72504 117.10857 m
224.72504 118.23619 L
S
@rax %Note: Object
221.81272 117.95414 227.73118 123.77849 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
227.73118 117.95414 m
224.72504 123.77849 L
221.81272 117.95414 L
227.73118 117.95414 L
@c
F
@rax %Note: Object
224.72447 90.05329 224.72561 91.18063 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
224.72504 90.05329 m
224.72504 91.18063 L
S
@rax %Note: Object
221.81272 90.89887 227.73118 96.72321 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
227.73118 90.89887 m
224.72504 96.72321 L
221.81272 90.89887 L
227.73118 90.89887 L
@c
F
@rax %Note: Object
190.90602 35.84891 258.63789 56.23455 @E
0 O 0 @g
0.24 0.01 0.12 0.00 k
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
190.90602 35.84891 m
190.90602 56.23455 L
258.63789 56.23455 L
258.63789 35.84891 L
190.90602 35.84891 L
@c
B
@rax 203.86998 42.63477 211.14028 52.62236 @E
[0.00021304 0.00000000 0.00000000 0.00021304 203.86990066 44.58562266] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 42332.00000 z
0 0 (S) @t
T
@rax 211.10315 41.03036 222.95679 47.68894 @E
[0.00021304 0.00000000 0.00000000 0.00021304 211.10330039 42.33107035] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (\223bib.) @t
T
@rax 223.03389 41.03036 232.38652 47.68894 @E
[0.00021304 0.00000000 0.00000000 0.00021304 223.03391489 42.33107035] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (xml) @t
T
@rax 232.24025 41.03036 234.90850 47.68894 @E
[0.00021304 0.00000000 0.00000000 0.00021304 232.24023430 42.33107035] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (\224) @t
T
@rax 237.12520 46.29118 245.47663 52.94948 @E
[0.00021304 0.00000000 0.00000000 0.00021304 237.12513315 47.59176343] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 ($s1) @t
T
@rax %Note: Object
382.26501 35.84891 449.99688 56.23455 @E
0 O 0 @g
0.24 0.01 0.12 0.00 k
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
382.26501 35.84891 m
382.26501 56.23455 L
449.99688 56.23455 L
449.99688 35.84891 L
382.26501 35.84891 L
@c
B
@rax 389.78022 42.63477 397.05080 52.62236 @E
[0.00021304 0.00000000 0.00000000 0.00021304 389.78045921 44.58562266] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 42332.00000 z
0 0 (S) @t
T
@rax 397.01395 41.03036 419.88161 47.68894 @E
[0.00021304 0.00000000 0.00000000 0.00021304 397.01385893 42.33107035] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (\223reviews.) @t
T
@rax 419.74781 41.03036 429.10072 47.68894 @E
[0.00021304 0.00000000 0.00000000 0.00021304 419.74791830 42.33107035] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (xml) @t
T
@rax 429.04800 41.03036 431.71625 47.68894 @E
[0.00021304 0.00000000 0.00000000 0.00021304 429.04797322 42.33107035] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (\224) @t
T
@rax 433.93294 46.29118 442.28466 52.94948 @E
[0.00021304 0.00000000 0.00000000 0.00021304 433.93308511 47.59176343] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 ($s2) @t
T
@rax %Note: Object
416.08346 56.23455 416.08460 57.36189 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
416.08403 56.23455 m
416.08403 57.36189 L
S
@rax %Note: Object
413.17200 57.07984 419.09017 62.90447 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
419.09017 57.07984 m
416.17814 62.90447 L
413.17200 57.07984 L
419.09017 57.07984 L
@c
F
@rax %Note: Object
224.72447 56.23455 224.72561 57.36189 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
224.72504 56.23455 m
224.72504 57.36189 L
S
@rax %Note: Object
221.81272 57.07984 227.73118 62.90447 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
227.73118 57.07984 m
224.72504 62.90447 L
221.81272 57.07984 L
227.73118 57.07984 L
@c
F
@rax %Note: Object
371.74365 121.52409 391.09550 134.20602 @E
/$fm 0 def
371.74365 121.52409 m
371.74365 134.20602 L
391.09550 134.20602 L
391.09550 121.52409 L
371.74365 121.52409 L
@c
N
@rax 377.19213 124.35676 380.19827 131.01506 @E
[0.00021304 0.00000000 0.00000000 0.00021304 377.19220481 125.65726171] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
371.74365 134.11219 391.09550 146.79439 @E
/$fm 0 def
371.74365 134.11219 m
371.74365 146.79439 L
391.09550 146.79439 L
391.09550 134.11219 L
371.74365 134.11219 L
@c
N
@rax 377.19213 136.94485 380.19827 143.60343 @E
[0.00021304 0.00000000 0.00000000 0.00021304 377.19220481 138.24551611] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
371.74365 146.70028 391.09550 159.38249 @E
/$fm 0 def
371.74365 146.70028 m
371.74365 159.38249 L
391.09550 159.38249 L
391.09550 146.70028 L
371.74365 146.70028 L
@c
N
@rax 377.19213 149.53323 380.19827 156.19153 @E
[0.00021304 0.00000000 0.00000000 0.00021304 377.19220481 150.83377050] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
371.74365 159.28866 391.09550 173.75556 @E
/$fm 0 def
371.74365 159.28866 m
371.74365 173.75556 L
391.09550 173.75556 L
391.09550 159.28866 L
371.74365 159.28866 L
@c
N
@rax 379.07121 162.17178 383.66164 170.49515 @E
[0.00021304 0.00000000 0.00000000 0.00021304 379.07117594 163.79760609] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (P) @t
T
@rax %Note: Object
391.00167 121.52409 466.81257 134.20602 @E
/$fm 0 def
391.00167 121.52409 m
391.00167 134.20602 L
466.81257 134.20602 L
466.81257 121.52409 L
391.00167 121.52409 L
@c
N
@rax 396.45043 124.30091 458.02063 131.60750 @E
[0.00021304 0.00000000 0.00000000 0.00021304 396.45038063 125.56331316] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (e3) @t
T
@rax %Note: Object
352.48564 121.52409 371.83776 134.20602 @E
/$fm 0 def
352.48564 121.52409 m
352.48564 134.20602 L
371.83776 134.20602 L
371.83776 121.52409 L
352.48564 121.52409 L
@c
N
@rax 357.93411 124.35676 360.94025 131.01506 @E
[0.00021304 0.00000000 0.00000000 0.00021304 357.93424203 125.65726171] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
391.00167 134.11219 466.81257 146.79439 @E
/$fm 0 def
391.00167 134.11219 m
391.00167 146.79439 L
466.81257 146.79439 L
466.81257 134.11219 L
391.00167 134.11219 L
@c
N
@rax 396.45043 136.88901 458.02063 144.19587 @E
[0.00021304 0.00000000 0.00000000 0.00021304 396.45038063 138.15156755] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (e2) @t
T
@rax %Note: Object
352.48564 134.11219 371.83776 146.79439 @E
/$fm 0 def
352.48564 134.11219 m
352.48564 146.79439 L
371.83776 146.79439 L
371.83776 134.11219 L
352.48564 134.11219 L
@c
N
@rax 357.93411 136.94485 360.94025 143.60343 @E
[0.00021304 0.00000000 0.00000000 0.00021304 357.93424203 138.24551611] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
391.00167 146.70028 466.81257 159.38249 @E
/$fm 0 def
391.00167 146.70028 m
391.00167 159.38249 L
466.81257 159.38249 L
466.81257 146.70028 L
391.00167 146.70028 L
@c
N
@rax 396.45043 149.47739 458.02063 156.78397 @E
[0.00021304 0.00000000 0.00000000 0.00021304 396.45038063 150.73982195] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (e1) @t
T
@rax %Note: Object
352.48564 146.70028 371.83776 159.38249 @E
/$fm 0 def
352.48564 146.70028 m
352.48564 159.38249 L
371.83776 159.38249 L
371.83776 146.70028 L
352.48564 146.70028 L
@c
N
@rax 357.93411 149.53323 360.94025 156.19153 @E
[0.00021304 0.00000000 0.00000000 0.00021304 357.93424203 150.83377050] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
391.00167 159.28866 466.81257 173.75556 @E
/$fm 0 def
391.00167 159.28866 m
391.00167 173.75556 L
466.81257 173.75556 L
466.81257 159.28866 L
391.00167 159.28866 L
@c
N
@rax 424.91480 162.17178 432.85181 170.49515 @E
[0.00021304 0.00000000 0.00000000 0.00021304 424.91466282 163.79760609] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($b) @t
T
@rax %Note: Object
352.48564 159.28866 371.83776 173.75556 @E
/$fm 0 def
352.48564 159.28866 m
352.48564 173.75556 L
371.83776 173.75556 L
371.83776 159.28866 L
352.48564 159.28866 L
@c
N
@rax 357.93411 162.17178 366.28639 170.49515 @E
[0.00021304 0.00000000 0.00000000 0.00021304 357.93424203 163.79760609] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
352.48564 173.75499 466.71874 173.75613 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
352.48564 173.75556 m
466.71874 173.75556 L
S
@rax %Note: Object
352.48564 159.38192 466.71874 159.38306 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
352.48564 159.38249 m
466.71874 159.38249 L
S
@rax %Note: Object
352.48564 146.79383 466.71874 146.79496 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
352.48564 146.79439 m
466.71874 146.79439 L
S
@rax %Note: Object
352.48564 134.20545 466.71874 134.20658 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
352.48564 134.20602 m
466.71874 134.20602 L
S
@rax %Note: Object
352.48564 121.61735 466.71874 121.61849 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
352.48564 121.61792 m
466.71874 121.61792 L
S
@rax %Note: Object
352.48507 121.61792 352.48620 173.75556 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
352.48564 173.75556 m
352.48564 121.61792 L
S
@rax %Note: Object
391.00110 121.61792 391.00224 173.75556 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
391.00167 173.75556 m
391.00167 121.61792 L
S
@rax %Note: Object
466.71817 121.61792 466.71931 173.75556 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
466.71874 173.75556 m
466.71874 121.61792 L
S
@rax %Note: Object
371.74309 121.61792 371.74422 173.75556 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
371.74365 173.75556 m
371.74365 121.61792 L
S
@rax %Note: Object
371.74365 121.52409 391.09550 134.20602 @E
/$fm 0 def
371.74365 121.52409 m
371.74365 134.20602 L
391.09550 134.20602 L
391.09550 121.52409 L
371.74365 121.52409 L
@c
N
@rax 377.19213 124.35676 380.19827 131.01506 @E
[0.00021304 0.00000000 0.00000000 0.00021304 377.19220481 125.65726171] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
371.74365 134.11219 391.09550 146.79439 @E
/$fm 0 def
371.74365 134.11219 m
371.74365 146.79439 L
391.09550 146.79439 L
391.09550 134.11219 L
371.74365 134.11219 L
@c
N
@rax 377.19213 136.94485 380.19827 143.60343 @E
[0.00021304 0.00000000 0.00000000 0.00021304 377.19220481 138.24551611] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
371.74365 146.70028 391.09550 159.38249 @E
/$fm 0 def
371.74365 146.70028 m
371.74365 159.38249 L
391.09550 159.38249 L
391.09550 146.70028 L
371.74365 146.70028 L
@c
N
@rax 377.19213 149.53323 380.19827 156.19153 @E
[0.00021304 0.00000000 0.00000000 0.00021304 377.19220481 150.83377050] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
371.74365 159.28866 391.09550 173.75556 @E
/$fm 0 def
371.74365 159.28866 m
371.74365 173.75556 L
391.09550 173.75556 L
391.09550 159.28866 L
371.74365 159.28866 L
@c
N
@rax 379.07121 162.17178 383.66164 170.49515 @E
[0.00021304 0.00000000 0.00000000 0.00021304 379.07117594 163.79760609] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (P) @t
T
@rax %Note: Object
391.00167 121.52409 466.81257 134.20602 @E
/$fm 0 def
391.00167 121.52409 m
391.00167 134.20602 L
466.81257 134.20602 L
466.81257 121.52409 L
391.00167 121.52409 L
@c
N
@rax 396.45043 124.30091 458.02063 131.60750 @E
[0.00021304 0.00000000 0.00000000 0.00021304 396.45038063 125.56331316] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (e3) @t
T
@rax %Note: Object
352.48564 121.52409 371.83776 134.20602 @E
/$fm 0 def
352.48564 121.52409 m
352.48564 134.20602 L
371.83776 134.20602 L
371.83776 121.52409 L
352.48564 121.52409 L
@c
N
@rax 357.93411 124.35676 360.94025 131.01506 @E
[0.00021304 0.00000000 0.00000000 0.00021304 357.93424203 125.65726171] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
391.00167 134.11219 466.81257 146.79439 @E
/$fm 0 def
391.00167 134.11219 m
391.00167 146.79439 L
466.81257 146.79439 L
466.81257 134.11219 L
391.00167 134.11219 L
@c
N
@rax 396.45043 136.88901 458.02063 144.19587 @E
[0.00021304 0.00000000 0.00000000 0.00021304 396.45038063 138.15156755] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (e2) @t
T
@rax %Note: Object
352.48564 134.11219 371.83776 146.79439 @E
/$fm 0 def
352.48564 134.11219 m
352.48564 146.79439 L
371.83776 146.79439 L
371.83776 134.11219 L
352.48564 134.11219 L
@c
N
@rax 357.93411 136.94485 360.94025 143.60343 @E
[0.00021304 0.00000000 0.00000000 0.00021304 357.93424203 138.24551611] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
391.00167 146.70028 466.81257 159.38249 @E
/$fm 0 def
391.00167 146.70028 m
391.00167 159.38249 L
466.81257 159.38249 L
466.81257 146.70028 L
391.00167 146.70028 L
@c
N
@rax 396.45043 149.47739 458.02063 156.78397 @E
[0.00021304 0.00000000 0.00000000 0.00021304 396.45038063 150.73982195] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (e1) @t
T
@rax %Note: Object
352.48564 146.70028 371.83776 159.38249 @E
/$fm 0 def
352.48564 146.70028 m
352.48564 159.38249 L
371.83776 159.38249 L
371.83776 146.70028 L
352.48564 146.70028 L
@c
N
@rax 357.93411 149.53323 360.94025 156.19153 @E
[0.00021304 0.00000000 0.00000000 0.00021304 357.93424203 150.83377050] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
391.00167 159.28866 466.81257 173.75556 @E
/$fm 0 def
391.00167 159.28866 m
391.00167 173.75556 L
466.81257 173.75556 L
466.81257 159.28866 L
391.00167 159.28866 L
@c
N
@rax 424.91480 162.17178 432.85181 170.49515 @E
[0.00021304 0.00000000 0.00000000 0.00021304 424.91466282 163.79760609] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($b) @t
T
@rax %Note: Object
352.48564 159.28866 371.83776 173.75556 @E
/$fm 0 def
352.48564 159.28866 m
352.48564 173.75556 L
371.83776 173.75556 L
371.83776 159.28866 L
352.48564 159.28866 L
@c
N
@rax 357.93411 162.17178 366.28639 170.49515 @E
[0.00021304 0.00000000 0.00000000 0.00021304 357.93424203 163.79760609] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
352.48564 173.75499 466.71874 173.75613 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
352.48564 173.75556 m
466.71874 173.75556 L
S
@rax %Note: Object
352.48564 159.38192 466.71874 159.38306 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
352.48564 159.38249 m
466.71874 159.38249 L
S
@rax %Note: Object
352.48564 146.79383 466.71874 146.79496 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
352.48564 146.79439 m
466.71874 146.79439 L
S
@rax %Note: Object
352.48564 134.20545 466.71874 134.20658 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
352.48564 134.20602 m
466.71874 134.20602 L
S
@rax %Note: Object
352.48564 121.61735 466.71874 121.61849 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
352.48564 121.61792 m
466.71874 121.61792 L
S
@rax %Note: Object
352.48507 121.61792 352.48620 173.75556 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
352.48564 173.75556 m
352.48564 121.61792 L
S
@rax %Note: Object
391.00110 121.61792 391.00224 173.75556 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
391.00167 173.75556 m
391.00167 121.61792 L
S
@rax %Note: Object
466.71817 121.61792 466.71931 173.75556 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
466.71874 173.75556 m
466.71874 121.61792 L
S
@rax %Note: Object
371.74309 121.61792 371.74422 173.75556 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
371.74365 173.75556 m
371.74365 121.61792 L
S
@rax %Note: Object
197.38772 123.49644 212.98224 136.17865 @E
/$fm 0 def
197.38772 123.49644 m
197.38772 136.17865 L
212.98224 136.17865 L
212.98224 123.49644 L
197.38772 123.49644 L
@c
N
@rax 202.83647 126.32967 205.84233 132.98797 @E
[0.00021304 0.00000000 0.00000000 0.00021304 202.83646655 127.63018139] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
197.38772 136.08482 212.98224 148.76674 @E
/$fm 0 def
197.38772 136.08482 m
197.38772 148.76674 L
212.98224 148.76674 L
212.98224 136.08482 L
197.38772 136.08482 L
@c
N
@rax 202.83647 138.91776 205.84233 145.57606 @E
[0.00021304 0.00000000 0.00000000 0.00021304 202.83646655 140.21822275] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
197.38772 148.67291 212.98224 161.35512 @E
/$fm 0 def
197.38772 148.67291 m
197.38772 161.35512 L
212.98224 161.35512 L
212.98224 148.67291 L
197.38772 148.67291 L
@c
N
@rax 202.83647 151.50586 205.84233 158.16444 @E
[0.00021304 0.00000000 0.00000000 0.00021304 202.83646655 152.80647715] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
197.38772 161.26129 212.98224 175.72847 @E
/$fm 0 def
197.38772 161.26129 m
197.38772 175.72847 L
212.98224 175.72847 L
212.98224 161.26129 L
197.38772 161.26129 L
@c
N
@rax 202.83647 164.14441 207.42690 172.46778 @E
[0.00021304 0.00000000 0.00000000 0.00021304 202.83646655 165.77031273] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (P) @t
T
@rax %Note: Object
212.88841 123.49644 283.06290 136.17865 @E
/$fm 0 def
212.88841 123.49644 m
212.88841 136.17865 L
283.06290 136.17865 L
283.06290 123.49644 L
212.88841 123.49644 L
@c
N
@rax 218.33688 126.17972 277.51861 133.48658 @E
[0.00021304 0.00000000 0.00000000 0.00021304 218.33691315 127.44228428] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (b2) @t
T
@rax %Note: Object
178.12998 123.49644 197.48183 136.17865 @E
/$fm 0 def
178.12998 123.49644 m
178.12998 136.17865 L
197.48183 136.17865 L
197.48183 123.49644 L
178.12998 123.49644 L
@c
N
@rax 183.57846 126.32967 186.58431 132.98797 @E
[0.00021304 0.00000000 0.00000000 0.00021304 183.57850376 127.63018139] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
212.88841 136.08482 283.06290 148.76674 @E
/$fm 0 def
212.88841 136.08482 m
212.88841 148.76674 L
283.06290 148.76674 L
283.06290 136.08482 L
212.88841 136.08482 L
@c
N
@rax 218.33688 138.76781 277.51861 146.07468 @E
[0.00021304 0.00000000 0.00000000 0.00021304 218.33691315 140.03032564] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (b2) @t
T
@rax %Note: Object
178.12998 136.08482 197.48183 148.76674 @E
/$fm 0 def
178.12998 136.08482 m
178.12998 148.76674 L
197.48183 148.76674 L
197.48183 136.08482 L
178.12998 136.08482 L
@c
N
@rax 183.57846 138.91776 186.58431 145.57606 @E
[0.00021304 0.00000000 0.00000000 0.00021304 183.57850376 140.21822275] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
212.88841 148.76674 282.96879 161.35512 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
212.88841 161.35512 m
212.88841 148.76674 L
282.96879 148.76674 L
282.96879 161.35512 L
212.88841 161.35512 L
@c
F
@rax 218.33688 151.45002 277.51861 158.75688 @E
[0.00021304 0.00000000 0.00000000 0.00021304 218.33691315 152.71252859] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (b1) @t
T
@rax %Note: Object
178.12998 148.67291 197.48183 161.35512 @E
/$fm 0 def
178.12998 148.67291 m
178.12998 161.35512 L
197.48183 161.35512 L
197.48183 148.67291 L
178.12998 148.67291 L
@c
N
@rax 183.57846 151.50586 186.58431 158.16444 @E
[0.00021304 0.00000000 0.00000000 0.00021304 183.57850376 152.80647715] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
212.88841 161.26129 283.06290 175.72847 @E
/$fm 0 def
212.88841 161.26129 m
212.88841 175.72847 L
283.06290 175.72847 L
283.06290 161.26129 L
212.88841 161.26129 L
@c
N
@rax 244.17099 164.14441 251.68592 172.46778 @E
[0.00021304 0.00000000 0.00000000 0.00021304 244.17084880 165.77031273] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($a) @t
T
@rax %Note: Object
178.12998 161.26129 197.48183 175.72847 @E
/$fm 0 def
178.12998 161.26129 m
178.12998 175.72847 L
197.48183 175.72847 L
197.48183 161.26129 L
178.12998 161.26129 L
@c
N
@rax 183.57846 164.14441 191.93046 172.46778 @E
[0.00021304 0.00000000 0.00000000 0.00021304 183.57850376 165.77031273] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
178.12998 175.72791 282.96879 175.72904 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
178.12998 175.72847 m
282.96879 175.72847 L
S
@rax %Note: Object
178.12998 161.35455 282.96879 161.35569 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
178.12998 161.35512 m
282.96879 161.35512 L
S
@rax %Note: Object
178.12998 148.76617 282.96879 148.76731 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
178.12998 148.76674 m
282.96879 148.76674 L
S
@rax %Note: Object
178.12998 136.17808 282.96879 136.17921 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
178.12998 136.17865 m
282.96879 136.17865 L
S
@rax %Note: Object
178.12998 123.58998 282.96879 123.59112 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
178.12998 123.59055 m
282.96879 123.59055 L
S
@rax %Note: Object
178.12942 123.59055 178.13055 175.72847 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
178.12998 175.72847 m
178.12998 123.59055 L
S
@rax %Note: Object
212.88784 123.59055 212.88898 175.72847 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
212.88841 175.72847 m
212.88841 123.59055 L
S
@rax %Note: Object
282.96822 123.59055 282.96935 175.72847 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
282.96879 175.72847 m
282.96879 123.59055 L
S
@rax %Note: Object
197.38715 123.59055 197.38828 175.72847 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
197.38772 175.72847 m
197.38772 123.59055 L
S
@rax %Note: Object
197.38772 123.49644 212.98224 136.17865 @E
/$fm 0 def
197.38772 123.49644 m
197.38772 136.17865 L
212.98224 136.17865 L
212.98224 123.49644 L
197.38772 123.49644 L
@c
N
@rax 202.83647 126.32967 205.84233 132.98797 @E
[0.00021304 0.00000000 0.00000000 0.00021304 202.83646655 127.63018139] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
197.38772 136.08482 212.98224 148.76674 @E
/$fm 0 def
197.38772 136.08482 m
197.38772 148.76674 L
212.98224 148.76674 L
212.98224 136.08482 L
197.38772 136.08482 L
@c
N
@rax 202.83647 138.91776 205.84233 145.57606 @E
[0.00021304 0.00000000 0.00000000 0.00021304 202.83646655 140.21822275] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
197.38772 148.67291 212.98224 161.35512 @E
/$fm 0 def
197.38772 148.67291 m
197.38772 161.35512 L
212.98224 161.35512 L
212.98224 148.67291 L
197.38772 148.67291 L
@c
N
@rax 202.83647 151.50586 205.84233 158.16444 @E
[0.00021304 0.00000000 0.00000000 0.00021304 202.83646655 152.80647715] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
197.38772 161.26129 212.98224 175.72847 @E
/$fm 0 def
197.38772 161.26129 m
197.38772 175.72847 L
212.98224 175.72847 L
212.98224 161.26129 L
197.38772 161.26129 L
@c
N
@rax 202.83647 164.14441 207.42690 172.46778 @E
[0.00021304 0.00000000 0.00000000 0.00021304 202.83646655 165.77031273] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (P) @t
T
@rax %Note: Object
212.88841 123.49644 283.06290 136.17865 @E
/$fm 0 def
212.88841 123.49644 m
212.88841 136.17865 L
283.06290 136.17865 L
283.06290 123.49644 L
212.88841 123.49644 L
@c
N
@rax 218.33688 126.17972 277.51861 133.48658 @E
[0.00021304 0.00000000 0.00000000 0.00021304 218.33691315 127.44228428] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (b2) @t
T
@rax %Note: Object
178.12998 123.49644 197.48183 136.17865 @E
/$fm 0 def
178.12998 123.49644 m
178.12998 136.17865 L
197.48183 136.17865 L
197.48183 123.49644 L
178.12998 123.49644 L
@c
N
@rax 183.57846 126.32967 186.58431 132.98797 @E
[0.00021304 0.00000000 0.00000000 0.00021304 183.57850376 127.63018139] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
212.88841 136.08482 283.06290 148.76674 @E
/$fm 0 def
212.88841 136.08482 m
212.88841 148.76674 L
283.06290 148.76674 L
283.06290 136.08482 L
212.88841 136.08482 L
@c
N
@rax 218.33688 138.76781 277.51861 146.07468 @E
[0.00021304 0.00000000 0.00000000 0.00021304 218.33691315 140.03032564] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (b2) @t
T
@rax %Note: Object
178.12998 136.08482 197.48183 148.76674 @E
/$fm 0 def
178.12998 136.08482 m
178.12998 148.76674 L
197.48183 148.76674 L
197.48183 136.08482 L
178.12998 136.08482 L
@c
N
@rax 183.57846 138.91776 186.58431 145.57606 @E
[0.00021304 0.00000000 0.00000000 0.00021304 183.57850376 140.21822275] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
212.88841 148.76674 282.96879 161.35512 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
212.88841 161.35512 m
212.88841 148.76674 L
282.96879 148.76674 L
282.96879 161.35512 L
212.88841 161.35512 L
@c
F
@rax 218.33688 151.45002 277.51861 158.75688 @E
[0.00021304 0.00000000 0.00000000 0.00021304 218.33691315 152.71252859] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (b1) @t
T
@rax %Note: Object
178.12998 148.67291 197.48183 161.35512 @E
/$fm 0 def
178.12998 148.67291 m
178.12998 161.35512 L
197.48183 161.35512 L
197.48183 148.67291 L
178.12998 148.67291 L
@c
N
@rax 183.57846 151.50586 186.58431 158.16444 @E
[0.00021304 0.00000000 0.00000000 0.00021304 183.57850376 152.80647715] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
212.88841 161.26129 283.06290 175.72847 @E
/$fm 0 def
212.88841 161.26129 m
212.88841 175.72847 L
283.06290 175.72847 L
283.06290 161.26129 L
212.88841 161.26129 L
@c
N
@rax 244.17099 164.14441 251.68592 172.46778 @E
[0.00021304 0.00000000 0.00000000 0.00021304 244.17084880 165.77031273] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($a) @t
T
@rax %Note: Object
178.12998 161.26129 197.48183 175.72847 @E
/$fm 0 def
178.12998 161.26129 m
178.12998 175.72847 L
197.48183 175.72847 L
197.48183 161.26129 L
178.12998 161.26129 L
@c
N
@rax 183.57846 164.14441 191.93046 172.46778 @E
[0.00021304 0.00000000 0.00000000 0.00021304 183.57850376 165.77031273] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
178.12998 175.72791 282.96879 175.72904 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
178.12998 175.72847 m
282.96879 175.72847 L
S
@rax %Note: Object
178.12998 161.35455 282.96879 161.35569 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
178.12998 161.35512 m
282.96879 161.35512 L
S
@rax %Note: Object
178.12998 148.76617 282.96879 148.76731 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
178.12998 148.76674 m
282.96879 148.76674 L
S
@rax %Note: Object
178.12998 136.17808 282.96879 136.17921 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
178.12998 136.17865 m
282.96879 136.17865 L
S
@rax %Note: Object
178.12998 123.58998 282.96879 123.59112 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
178.12998 123.59055 m
282.96879 123.59055 L
S
@rax %Note: Object
178.12942 123.59055 178.13055 175.72847 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
178.12998 175.72847 m
178.12998 123.59055 L
S
@rax %Note: Object
212.88784 123.59055 212.88898 175.72847 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
212.88841 175.72847 m
212.88841 123.59055 L
S
@rax %Note: Object
282.96822 123.59055 282.96935 175.72847 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
282.96879 175.72847 m
282.96879 123.59055 L
S
@rax %Note: Object
197.38715 123.59055 197.38828 175.72847 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
197.38772 175.72847 m
197.38772 123.59055 L
S
@rax %Note: Object
377.75594 179.86167 445.48781 200.24702 @E
0 O 0 @g
0.24 0.01 0.12 0.00 k
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
377.75594 179.86167 m
377.75594 200.24702 L
445.48781 200.24702 L
445.48781 179.86167 L
377.75594 179.86167 L
@c
B
@rax 386.86819 182.66882 393.13304 197.39877 @E
[0.00021304 0.00000000 0.00000000 0.00021304 386.86826700 185.31033422] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/Symbol 56443.00000 z
0 0 (f) @t
T
@rax 393.06841 181.75493 402.08627 188.41351 @E
[0.00021304 0.00000000 0.00000000 0.00021304 393.06844564 183.05556887] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 ($b,) @t
T
@rax 402.08683 181.00375 419.94652 187.66205 @E
[0.00021304 0.00000000 0.00000000 0.00021304 402.08686793 182.30419346] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (review) @t
T
@rax 419.84192 187.01603 436.20435 193.67433 @E
[0.00021304 0.00000000 0.00000000 0.00021304 419.84186685 188.31647498] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 ($col12) @t
T
@rax %Note: Object
193.16069 182.39811 260.89228 202.78346 @E
0 O 0 @g
0.24 0.01 0.12 0.00 k
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
193.16069 182.39811 m
193.16069 202.78346 L
260.89228 202.78346 L
260.89228 182.39811 L
193.16069 182.39811 L
@c
B
@rax 204.80939 185.20526 211.07424 199.93521 @E
[0.00021304 0.00000000 0.00000000 0.00021304 204.80938623 187.84673220] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/Symbol 56443.00000 z
0 0 (f) @t
T
@rax 211.00932 184.29165 230.54230 190.94995 @E
[0.00021304 0.00000000 0.00000000 0.00021304 211.00935183 185.59217989] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 ($a, title) @t
T
@rax 232.80406 189.55219 248.94283 196.21077 @E
[0.00021304 0.00000000 0.00000000 0.00021304 232.80392563 190.85287297] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 ($col1) @t
61647 0 (1) @t
T
@rax %Note: Object
226.97887 175.72847 226.98000 176.85581 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
226.97943 175.72847 m
226.97943 176.85581 L
S
@rax %Note: Object
224.06740 176.57376 229.98586 182.39811 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
229.98586 176.57376 m
226.97943 182.39811 L
224.06740 176.57376 L
229.98586 176.57376 L
@c
F
@rax %Note: Object
167.32658 206.63490 239.66164 219.31710 @E
/$fm 0 def
167.32658 206.63490 m
167.32658 219.31710 L
239.66164 219.31710 L
239.66164 206.63490 L
167.32658 206.63490 L
@c
N
@rax 172.77506 209.31817 234.07030 216.62476 @E
[0.00021304 0.00000000 0.00000000 0.00021304 172.77527194 210.58057853] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (b3 ) @t
T
@rax %Note: Object
167.32658 219.22328 239.66164 231.90548 @E
/$fm 0 def
167.32658 219.22328 m
167.32658 231.90548 L
239.66164 231.90548 L
239.66164 219.22328 L
167.32658 219.22328 L
@c
N
@rax 172.77506 221.90627 231.95679 229.21313 @E
[0.00021304 0.00000000 0.00000000 0.00021304 172.77527194 223.16883293] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (b2) @t
T
@rax %Note: Object
167.32658 231.90548 239.56781 244.49329 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
167.32658 244.49329 m
167.32658 231.90548 L
239.56781 231.90548 L
239.56781 244.49329 L
167.32658 244.49329 L
@c
F
@rax 172.77506 234.58847 231.95679 241.89506 @E
[0.00021304 0.00000000 0.00000000 0.00021304 172.77527194 235.85082284] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (b1) @t
T
@rax %Note: Object
167.32658 244.39946 239.66164 258.86636 @E
/$fm 0 def
167.32658 244.39946 m
167.32658 258.86636 L
239.66164 258.86636 L
239.66164 244.39946 L
167.32658 244.39946 L
@c
N
@rax 199.64239 247.28287 207.15761 255.60624 @E
[0.00021304 0.00000000 0.00000000 0.00021304 199.64242867 248.90882002] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($a) @t
T
@rax %Note: Object
151.82617 206.63490 167.42041 219.31710 @E
/$fm 0 def
151.82617 206.63490 m
151.82617 219.31710 L
167.42041 219.31710 L
167.42041 206.63490 L
151.82617 206.63490 L
@c
N
@rax 157.27493 209.46784 160.28079 216.12643 @E
[0.00021304 0.00000000 0.00000000 0.00021304 157.27482533 210.76847564] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
151.82617 219.22328 167.42041 231.90548 @E
/$fm 0 def
151.82617 219.22328 m
151.82617 231.90548 L
167.42041 231.90548 L
167.42041 219.22328 L
151.82617 219.22328 L
@c
N
@rax 157.27493 222.05622 160.28079 228.71452 @E
[0.00021304 0.00000000 0.00000000 0.00021304 157.27482533 223.35673004] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
151.82617 231.81137 167.42041 244.49329 @E
/$fm 0 def
151.82617 231.81137 m
151.82617 244.49329 L
167.42041 244.49329 L
167.42041 231.81137 L
151.82617 231.81137 L
@c
N
@rax 157.27493 234.64431 160.28079 241.30261 @E
[0.00021304 0.00000000 0.00000000 0.00021304 157.27482533 235.94477140] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
151.82617 244.39946 167.42041 258.86636 @E
/$fm 0 def
151.82617 244.39946 m
151.82617 258.86636 L
167.42041 258.86636 L
167.42041 244.39946 L
151.82617 244.39946 L
@c
N
@rax 157.27493 247.28287 161.86535 255.60624 @E
[0.00021304 0.00000000 0.00000000 0.00021304 157.27482533 248.90882002] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (P) @t
T
@rax %Note: Object
239.56781 206.63490 304.48148 219.31710 @E
/$fm 0 def
239.56781 206.63490 m
239.56781 219.31710 L
304.48148 219.31710 L
304.48148 206.63490 L
239.56781 206.63490 L
@c
N
@rax 245.01628 209.31817 296.85118 216.62476 @E
[0.00021304 0.00000000 0.00000000 0.00021304 245.01638580 210.58057853] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t3) @t
T
@rax %Note: Object
132.56816 206.63490 151.92000 219.31710 @E
/$fm 0 def
132.56816 206.63490 m
132.56816 219.31710 L
151.92000 219.31710 L
151.92000 206.63490 L
132.56816 206.63490 L
@c
N
@rax 138.01691 209.46784 141.02277 216.12643 @E
[0.00021304 0.00000000 0.00000000 0.00021304 138.01686255 210.76847564] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
239.56781 219.22328 304.48148 231.90548 @E
/$fm 0 def
239.56781 219.22328 m
239.56781 231.90548 L
304.48148 231.90548 L
304.48148 219.22328 L
239.56781 219.22328 L
@c
N
@rax 245.01628 221.90627 296.85118 229.21313 @E
[0.00021304 0.00000000 0.00000000 0.00021304 245.01638580 223.16883293] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t2) @t
T
@rax %Note: Object
132.56816 219.22328 151.92000 231.90548 @E
/$fm 0 def
132.56816 219.22328 m
132.56816 231.90548 L
151.92000 231.90548 L
151.92000 219.22328 L
132.56816 219.22328 L
@c
N
@rax 138.01691 222.05622 141.02277 228.71452 @E
[0.00021304 0.00000000 0.00000000 0.00021304 138.01686255 223.35673004] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
239.56781 231.81137 304.48148 244.49329 @E
/$fm 0 def
239.56781 231.81137 m
239.56781 244.49329 L
304.48148 244.49329 L
304.48148 231.81137 L
239.56781 231.81137 L
@c
N
@rax 245.01628 234.49436 296.85118 241.80123 @E
[0.00021304 0.00000000 0.00000000 0.00021304 245.01638580 235.75687429] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t1) @t
T
@rax %Note: Object
132.56816 231.81137 151.92000 244.49329 @E
/$fm 0 def
132.56816 231.81137 m
132.56816 244.49329 L
151.92000 244.49329 L
151.92000 231.81137 L
132.56816 231.81137 L
@c
N
@rax 138.01691 234.64431 141.02277 241.30261 @E
[0.00021304 0.00000000 0.00000000 0.00021304 138.01686255 235.94477140] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
239.56781 244.39946 304.48148 258.86636 @E
/$fm 0 def
239.56781 244.39946 m
239.56781 258.86636 L
304.48148 258.86636 L
304.48148 244.39946 L
239.56781 244.39946 L
@c
N
@rax 261.73786 247.28287 281.77682 255.60624 @E
[0.00021304 0.00000000 0.00000000 0.00021304 261.73795060 248.90882002] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($co) @t
50933 0 (l1) @t
76426 0 (1) @t
T
@rax %Note: Object
132.56816 244.39946 151.92000 258.86636 @E
/$fm 0 def
132.56816 244.39946 m
132.56816 258.86636 L
151.92000 258.86636 L
151.92000 244.39946 L
132.56816 244.39946 L
@c
N
@rax 138.01691 247.28287 146.36891 255.60624 @E
[0.00021304 0.00000000 0.00000000 0.00021304 138.01686255 248.90882002] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
132.56816 258.86580 304.38765 258.86693 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
132.56816 258.86636 m
304.38765 258.86636 L
S
@rax %Note: Object
132.56816 244.49272 304.38765 244.49386 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
132.56816 244.49329 m
304.38765 244.49329 L
S
@rax %Note: Object
132.56816 231.90491 304.38765 231.90605 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
132.56816 231.90548 m
304.38765 231.90548 L
S
@rax %Note: Object
132.56816 219.31654 304.38765 219.31767 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
132.56816 219.31710 m
304.38765 219.31710 L
S
@rax %Note: Object
132.56816 206.72816 304.38765 206.72929 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
132.56816 206.72872 m
304.38765 206.72872 L
S
@rax %Note: Object
132.56759 206.72872 132.56872 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
132.56816 258.86636 m
132.56816 206.72872 L
S
@rax %Note: Object
239.56724 206.72872 239.56838 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
239.56781 258.86636 m
239.56781 206.72872 L
S
@rax %Note: Object
304.38709 206.72872 304.38822 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
304.38765 258.86636 m
304.38765 206.72872 L
S
@rax %Note: Object
151.82561 206.72872 151.82674 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
151.82617 258.86636 m
151.82617 206.72872 L
S
@rax %Note: Object
167.32602 206.72872 167.32715 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
167.32658 258.86636 m
167.32658 206.72872 L
S
@rax %Note: Object
167.32658 206.63490 239.66164 219.31710 @E
/$fm 0 def
167.32658 206.63490 m
167.32658 219.31710 L
239.66164 219.31710 L
239.66164 206.63490 L
167.32658 206.63490 L
@c
N
@rax 172.77506 209.31817 234.07030 216.62476 @E
[0.00021304 0.00000000 0.00000000 0.00021304 172.77527194 210.58057853] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (b3 ) @t
T
@rax %Note: Object
167.32658 219.22328 239.66164 231.90548 @E
/$fm 0 def
167.32658 219.22328 m
167.32658 231.90548 L
239.66164 231.90548 L
239.66164 219.22328 L
167.32658 219.22328 L
@c
N
@rax 172.77506 221.90627 231.95679 229.21313 @E
[0.00021304 0.00000000 0.00000000 0.00021304 172.77527194 223.16883293] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (b2) @t
T
@rax %Note: Object
167.32658 231.90548 239.56781 244.49329 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
167.32658 244.49329 m
167.32658 231.90548 L
239.56781 231.90548 L
239.56781 244.49329 L
167.32658 244.49329 L
@c
F
@rax 172.77506 234.58847 231.95679 241.89506 @E
[0.00021304 0.00000000 0.00000000 0.00021304 172.77527194 235.85082284] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (b1) @t
T
@rax %Note: Object
167.32658 244.39946 239.66164 258.86636 @E
/$fm 0 def
167.32658 244.39946 m
167.32658 258.86636 L
239.66164 258.86636 L
239.66164 244.39946 L
167.32658 244.39946 L
@c
N
@rax 199.64239 247.28287 207.15761 255.60624 @E
[0.00021304 0.00000000 0.00000000 0.00021304 199.64242867 248.90882002] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($a) @t
T
@rax %Note: Object
151.82617 206.63490 167.42041 219.31710 @E
/$fm 0 def
151.82617 206.63490 m
151.82617 219.31710 L
167.42041 219.31710 L
167.42041 206.63490 L
151.82617 206.63490 L
@c
N
@rax 157.27493 209.46784 160.28079 216.12643 @E
[0.00021304 0.00000000 0.00000000 0.00021304 157.27482533 210.76847564] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
151.82617 219.22328 167.42041 231.90548 @E
/$fm 0 def
151.82617 219.22328 m
151.82617 231.90548 L
167.42041 231.90548 L
167.42041 219.22328 L
151.82617 219.22328 L
@c
N
@rax 157.27493 222.05622 160.28079 228.71452 @E
[0.00021304 0.00000000 0.00000000 0.00021304 157.27482533 223.35673004] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
151.82617 231.81137 167.42041 244.49329 @E
/$fm 0 def
151.82617 231.81137 m
151.82617 244.49329 L
167.42041 244.49329 L
167.42041 231.81137 L
151.82617 231.81137 L
@c
N
@rax 157.27493 234.64431 160.28079 241.30261 @E
[0.00021304 0.00000000 0.00000000 0.00021304 157.27482533 235.94477140] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
151.82617 244.39946 167.42041 258.86636 @E
/$fm 0 def
151.82617 244.39946 m
151.82617 258.86636 L
167.42041 258.86636 L
167.42041 244.39946 L
151.82617 244.39946 L
@c
N
@rax 157.27493 247.28287 161.86535 255.60624 @E
[0.00021304 0.00000000 0.00000000 0.00021304 157.27482533 248.90882002] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (P) @t
T
@rax %Note: Object
239.56781 206.63490 304.48148 219.31710 @E
/$fm 0 def
239.56781 206.63490 m
239.56781 219.31710 L
304.48148 219.31710 L
304.48148 206.63490 L
239.56781 206.63490 L
@c
N
@rax 245.01628 209.31817 296.85118 216.62476 @E
[0.00021304 0.00000000 0.00000000 0.00021304 245.01638580 210.58057853] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t3) @t
T
@rax %Note: Object
132.56816 206.63490 151.92000 219.31710 @E
/$fm 0 def
132.56816 206.63490 m
132.56816 219.31710 L
151.92000 219.31710 L
151.92000 206.63490 L
132.56816 206.63490 L
@c
N
@rax 138.01691 209.46784 141.02277 216.12643 @E
[0.00021304 0.00000000 0.00000000 0.00021304 138.01686255 210.76847564] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
239.56781 219.22328 304.48148 231.90548 @E
/$fm 0 def
239.56781 219.22328 m
239.56781 231.90548 L
304.48148 231.90548 L
304.48148 219.22328 L
239.56781 219.22328 L
@c
N
@rax 245.01628 221.90627 296.85118 229.21313 @E
[0.00021304 0.00000000 0.00000000 0.00021304 245.01638580 223.16883293] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t2) @t
T
@rax %Note: Object
132.56816 219.22328 151.92000 231.90548 @E
/$fm 0 def
132.56816 219.22328 m
132.56816 231.90548 L
151.92000 231.90548 L
151.92000 219.22328 L
132.56816 219.22328 L
@c
N
@rax 138.01691 222.05622 141.02277 228.71452 @E
[0.00021304 0.00000000 0.00000000 0.00021304 138.01686255 223.35673004] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
239.56781 231.81137 304.48148 244.49329 @E
/$fm 0 def
239.56781 231.81137 m
239.56781 244.49329 L
304.48148 244.49329 L
304.48148 231.81137 L
239.56781 231.81137 L
@c
N
@rax 245.01628 234.49436 296.85118 241.80123 @E
[0.00021304 0.00000000 0.00000000 0.00021304 245.01638580 235.75687429] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t1) @t
T
@rax %Note: Object
132.56816 231.81137 151.92000 244.49329 @E
/$fm 0 def
132.56816 231.81137 m
132.56816 244.49329 L
151.92000 244.49329 L
151.92000 231.81137 L
132.56816 231.81137 L
@c
N
@rax 138.01691 234.64431 141.02277 241.30261 @E
[0.00021304 0.00000000 0.00000000 0.00021304 138.01686255 235.94477140] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
239.56781 244.39946 304.48148 258.86636 @E
/$fm 0 def
239.56781 244.39946 m
239.56781 258.86636 L
304.48148 258.86636 L
304.48148 244.39946 L
239.56781 244.39946 L
@c
N
@rax 261.73786 247.28287 281.77682 255.60624 @E
[0.00021304 0.00000000 0.00000000 0.00021304 261.73795060 248.90882002] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($co) @t
50933 0 (l1) @t
76426 0 (1) @t
T
@rax %Note: Object
132.56816 244.39946 151.92000 258.86636 @E
/$fm 0 def
132.56816 244.39946 m
132.56816 258.86636 L
151.92000 258.86636 L
151.92000 244.39946 L
132.56816 244.39946 L
@c
N
@rax 138.01691 247.28287 146.36891 255.60624 @E
[0.00021304 0.00000000 0.00000000 0.00021304 138.01686255 248.90882002] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
132.56816 258.86580 304.38765 258.86693 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
132.56816 258.86636 m
304.38765 258.86636 L
S
@rax %Note: Object
132.56816 244.49272 304.38765 244.49386 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
132.56816 244.49329 m
304.38765 244.49329 L
S
@rax %Note: Object
132.56816 231.90491 304.38765 231.90605 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
132.56816 231.90548 m
304.38765 231.90548 L
S
@rax %Note: Object
132.56816 219.31654 304.38765 219.31767 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
132.56816 219.31710 m
304.38765 219.31710 L
S
@rax %Note: Object
132.56816 206.72816 304.38765 206.72929 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
132.56816 206.72872 m
304.38765 206.72872 L
S
@rax %Note: Object
132.56759 206.72872 132.56872 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
132.56816 258.86636 m
132.56816 206.72872 L
S
@rax %Note: Object
239.56724 206.72872 239.56838 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
239.56781 258.86636 m
239.56781 206.72872 L
S
@rax %Note: Object
304.38709 206.72872 304.38822 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
304.38765 258.86636 m
304.38765 206.72872 L
S
@rax %Note: Object
151.82561 206.72872 151.82674 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
151.82617 258.86636 m
151.82617 206.72872 L
S
@rax %Note: Object
167.32602 206.72872 167.32715 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
167.32658 258.86636 m
167.32658 206.72872 L
S
@rax %Note: Object
342.52781 204.66227 414.95669 219.31710 @E
/$fm 0 def
342.52781 204.66227 m
342.52781 219.31710 L
414.95669 219.31710 L
414.95669 204.66227 L
342.52781 204.66227 L
@c
N
@rax 347.97628 209.41200 409.54649 216.71887 @E
[0.00021304 0.00000000 0.00000000 0.00021304 347.97633417 210.67452709] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (e3) @t
T
@rax %Note: Object
342.52781 219.22328 414.95669 231.90548 @E
/$fm 0 def
342.52781 219.22328 m
342.52781 231.90548 L
414.95669 231.90548 L
414.95669 219.22328 L
342.52781 219.22328 L
@c
N
@rax 347.97628 222.00038 409.54649 229.30696 @E
[0.00021304 0.00000000 0.00000000 0.00021304 347.97633417 223.26278148] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (e2) @t
T
@rax %Note: Object
342.52781 231.81137 414.95669 244.49329 @E
/$fm 0 def
342.52781 231.81137 m
342.52781 244.49329 L
414.95669 244.49329 L
414.95669 231.81137 L
342.52781 231.81137 L
@c
N
@rax 347.97628 234.58847 409.54649 241.89506 @E
[0.00021304 0.00000000 0.00000000 0.00021304 347.97633417 235.85082284] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (e1) @t
T
@rax %Note: Object
342.52781 244.39946 414.95669 258.86636 @E
/$fm 0 def
342.52781 244.39946 m
342.52781 258.86636 L
414.95669 258.86636 L
414.95669 244.39946 L
342.52781 244.39946 L
@c
N
@rax 374.74980 247.28287 382.68709 255.60624 @E
[0.00021304 0.00000000 0.00000000 0.00021304 374.74975539 248.90882002] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($b) @t
T
@rax %Note: Object
327.02769 204.66227 342.62164 219.31710 @E
/$fm 0 def
327.02769 204.66227 m
327.02769 219.31710 L
342.62164 219.31710 L
342.62164 204.66227 L
327.02769 204.66227 L
@c
N
@rax 332.47616 209.46784 335.48202 216.12643 @E
[0.00021304 0.00000000 0.00000000 0.00021304 332.47610061 210.76847564] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
327.02769 219.22328 342.62164 231.90548 @E
/$fm 0 def
327.02769 219.22328 m
327.02769 231.90548 L
342.62164 231.90548 L
342.62164 219.22328 L
327.02769 219.22328 L
@c
N
@rax 332.47616 222.05622 335.48202 228.71452 @E
[0.00021304 0.00000000 0.00000000 0.00021304 332.47610061 223.35673004] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
327.02769 231.81137 342.62164 244.49329 @E
/$fm 0 def
327.02769 231.81137 m
327.02769 244.49329 L
342.62164 244.49329 L
342.62164 231.81137 L
327.02769 231.81137 L
@c
N
@rax 332.47616 234.64431 335.48202 241.30261 @E
[0.00021304 0.00000000 0.00000000 0.00021304 332.47610061 235.94477140] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
327.02769 244.39946 342.62164 258.86636 @E
/$fm 0 def
327.02769 244.39946 m
327.02769 258.86636 L
342.62164 258.86636 L
342.62164 244.39946 L
327.02769 244.39946 L
@c
N
@rax 332.47616 247.28287 337.06658 255.60624 @E
[0.00021304 0.00000000 0.00000000 0.00021304 332.47610061 248.90882002] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (P) @t
T
@rax %Note: Object
414.86287 204.66227 494.14961 219.31710 @E
/$fm 0 def
414.86287 204.66227 m
414.86287 219.31710 L
494.14961 219.31710 L
494.14961 204.66227 L
414.86287 204.66227 L
@c
N
@rax 420.31134 209.31817 488.82047 216.62476 @E
[0.00021304 0.00000000 0.00000000 0.00021304 420.31139660 210.58057853] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r3) @t
T
@rax %Note: Object
307.76939 204.66227 327.12123 219.31710 @E
/$fm 0 def
307.76939 204.66227 m
307.76939 219.31710 L
327.12123 219.31710 L
327.12123 204.66227 L
307.76939 204.66227 L
@c
N
@rax 313.21786 209.46784 316.22400 216.12643 @E
[0.00021304 0.00000000 0.00000000 0.00021304 313.21792479 210.76847564] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
414.86287 219.22328 494.14961 231.90548 @E
/$fm 0 def
414.86287 219.22328 m
414.86287 231.90548 L
494.14961 231.90548 L
494.14961 219.22328 L
414.86287 219.22328 L
@c
N
@rax 420.31134 221.90627 488.82047 229.21313 @E
[0.00021304 0.00000000 0.00000000 0.00021304 420.31139660 223.16883293] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r2) @t
T
@rax %Note: Object
307.76939 219.22328 327.12123 231.90548 @E
/$fm 0 def
307.76939 219.22328 m
307.76939 231.90548 L
327.12123 231.90548 L
327.12123 219.22328 L
307.76939 219.22328 L
@c
N
@rax 313.21786 222.05622 316.22400 228.71452 @E
[0.00021304 0.00000000 0.00000000 0.00021304 313.21792479 223.35673004] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
414.86287 231.81137 494.14961 244.49329 @E
/$fm 0 def
414.86287 231.81137 m
414.86287 244.49329 L
494.14961 244.49329 L
494.14961 231.81137 L
414.86287 231.81137 L
@c
N
@rax 420.31134 234.49436 488.82047 241.80123 @E
[0.00021304 0.00000000 0.00000000 0.00021304 420.31139660 235.75687429] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r1) @t
T
@rax %Note: Object
307.76939 231.81137 327.12123 244.49329 @E
/$fm 0 def
307.76939 231.81137 m
307.76939 244.49329 L
327.12123 244.49329 L
327.12123 231.81137 L
307.76939 231.81137 L
@c
N
@rax 313.21786 234.64431 316.22400 241.30261 @E
[0.00021304 0.00000000 0.00000000 0.00021304 313.21792479 235.94477140] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
414.86287 244.39946 494.14961 258.86636 @E
/$fm 0 def
414.86287 244.39946 m
414.86287 258.86636 L
494.14961 258.86636 L
494.14961 244.39946 L
414.86287 244.39946 L
@c
N
@rax 444.17254 247.28287 464.62620 255.60624 @E
[0.00021304 0.00000000 0.00000000 0.00021304 444.17262560 248.90882002] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($co) @t
50933 0 (l12) @t
T
@rax %Note: Object
307.76939 244.39946 327.12123 258.86636 @E
/$fm 0 def
307.76939 244.39946 m
307.76939 258.86636 L
327.12123 258.86636 L
327.12123 244.39946 L
307.76939 244.39946 L
@c
N
@rax 313.21786 247.28287 321.56986 255.60624 @E
[0.00021304 0.00000000 0.00000000 0.00021304 313.21792479 248.90882002] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
307.76939 258.86580 494.05578 258.86693 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
307.76939 258.86636 m
494.05578 258.86636 L
S
@rax %Note: Object
307.76939 244.49272 494.05578 244.49386 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
307.76939 244.49329 m
494.05578 244.49329 L
S
@rax %Note: Object
307.76939 231.90491 494.05578 231.90605 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
307.76939 231.90548 m
494.05578 231.90548 L
S
@rax %Note: Object
307.76939 219.31654 494.05578 219.31767 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
307.76939 219.31710 m
494.05578 219.31710 L
S
@rax %Note: Object
307.76939 204.75581 494.05578 204.75694 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
307.76939 204.75638 m
494.05578 204.75638 L
S
@rax %Note: Object
307.76882 204.75638 307.76995 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
307.76939 258.86636 m
307.76939 204.75638 L
S
@rax %Note: Object
414.86230 204.75638 414.86343 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
414.86287 258.86636 m
414.86287 204.75638 L
S
@rax %Note: Object
494.05521 204.75638 494.05635 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
494.05578 258.86636 m
494.05578 204.75638 L
S
@rax %Note: Object
327.02712 204.75638 327.02825 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
327.02769 258.86636 m
327.02769 204.75638 L
S
@rax %Note: Object
342.52724 204.75638 342.52838 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
342.52781 258.86636 m
342.52781 204.75638 L
S
@rax %Note: Object
342.52781 204.66227 414.95669 219.31710 @E
/$fm 0 def
342.52781 204.66227 m
342.52781 219.31710 L
414.95669 219.31710 L
414.95669 204.66227 L
342.52781 204.66227 L
@c
N
@rax 347.97628 209.41200 409.54649 216.71887 @E
[0.00021304 0.00000000 0.00000000 0.00021304 347.97633417 210.67452709] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (e3) @t
T
@rax %Note: Object
342.52781 219.22328 414.95669 231.90548 @E
/$fm 0 def
342.52781 219.22328 m
342.52781 231.90548 L
414.95669 231.90548 L
414.95669 219.22328 L
342.52781 219.22328 L
@c
N
@rax 347.97628 222.00038 409.54649 229.30696 @E
[0.00021304 0.00000000 0.00000000 0.00021304 347.97633417 223.26278148] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (e2) @t
T
@rax %Note: Object
342.52781 231.81137 414.95669 244.49329 @E
/$fm 0 def
342.52781 231.81137 m
342.52781 244.49329 L
414.95669 244.49329 L
414.95669 231.81137 L
342.52781 231.81137 L
@c
N
@rax 347.97628 234.58847 409.54649 241.89506 @E
[0.00021304 0.00000000 0.00000000 0.00021304 347.97633417 235.85082284] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (e1) @t
T
@rax %Note: Object
342.52781 244.39946 414.95669 258.86636 @E
/$fm 0 def
342.52781 244.39946 m
342.52781 258.86636 L
414.95669 258.86636 L
414.95669 244.39946 L
342.52781 244.39946 L
@c
N
@rax 374.74980 247.28287 382.68709 255.60624 @E
[0.00021304 0.00000000 0.00000000 0.00021304 374.74975539 248.90882002] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($b) @t
T
@rax %Note: Object
327.02769 204.66227 342.62164 219.31710 @E
/$fm 0 def
327.02769 204.66227 m
327.02769 219.31710 L
342.62164 219.31710 L
342.62164 204.66227 L
327.02769 204.66227 L
@c
N
@rax 332.47616 209.46784 335.48202 216.12643 @E
[0.00021304 0.00000000 0.00000000 0.00021304 332.47610061 210.76847564] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
327.02769 219.22328 342.62164 231.90548 @E
/$fm 0 def
327.02769 219.22328 m
327.02769 231.90548 L
342.62164 231.90548 L
342.62164 219.22328 L
327.02769 219.22328 L
@c
N
@rax 332.47616 222.05622 335.48202 228.71452 @E
[0.00021304 0.00000000 0.00000000 0.00021304 332.47610061 223.35673004] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
327.02769 231.81137 342.62164 244.49329 @E
/$fm 0 def
327.02769 231.81137 m
327.02769 244.49329 L
342.62164 244.49329 L
342.62164 231.81137 L
327.02769 231.81137 L
@c
N
@rax 332.47616 234.64431 335.48202 241.30261 @E
[0.00021304 0.00000000 0.00000000 0.00021304 332.47610061 235.94477140] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
327.02769 244.39946 342.62164 258.86636 @E
/$fm 0 def
327.02769 244.39946 m
327.02769 258.86636 L
342.62164 258.86636 L
342.62164 244.39946 L
327.02769 244.39946 L
@c
N
@rax 332.47616 247.28287 337.06658 255.60624 @E
[0.00021304 0.00000000 0.00000000 0.00021304 332.47610061 248.90882002] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (P) @t
T
@rax %Note: Object
414.86287 204.66227 494.14961 219.31710 @E
/$fm 0 def
414.86287 204.66227 m
414.86287 219.31710 L
494.14961 219.31710 L
494.14961 204.66227 L
414.86287 204.66227 L
@c
N
@rax 420.31134 209.31817 488.82047 216.62476 @E
[0.00021304 0.00000000 0.00000000 0.00021304 420.31139660 210.58057853] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r3) @t
T
@rax %Note: Object
307.76939 204.66227 327.12123 219.31710 @E
/$fm 0 def
307.76939 204.66227 m
307.76939 219.31710 L
327.12123 219.31710 L
327.12123 204.66227 L
307.76939 204.66227 L
@c
N
@rax 313.21786 209.46784 316.22400 216.12643 @E
[0.00021304 0.00000000 0.00000000 0.00021304 313.21792479 210.76847564] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
414.86287 219.22328 494.14961 231.90548 @E
/$fm 0 def
414.86287 219.22328 m
414.86287 231.90548 L
494.14961 231.90548 L
494.14961 219.22328 L
414.86287 219.22328 L
@c
N
@rax 420.31134 221.90627 488.82047 229.21313 @E
[0.00021304 0.00000000 0.00000000 0.00021304 420.31139660 223.16883293] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r2) @t
T
@rax %Note: Object
307.76939 219.22328 327.12123 231.90548 @E
/$fm 0 def
307.76939 219.22328 m
307.76939 231.90548 L
327.12123 231.90548 L
327.12123 219.22328 L
307.76939 219.22328 L
@c
N
@rax 313.21786 222.05622 316.22400 228.71452 @E
[0.00021304 0.00000000 0.00000000 0.00021304 313.21792479 223.35673004] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
414.86287 231.81137 494.14961 244.49329 @E
/$fm 0 def
414.86287 231.81137 m
414.86287 244.49329 L
494.14961 244.49329 L
494.14961 231.81137 L
414.86287 231.81137 L
@c
N
@rax 420.31134 234.49436 488.82047 241.80123 @E
[0.00021304 0.00000000 0.00000000 0.00021304 420.31139660 235.75687429] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r1) @t
T
@rax %Note: Object
307.76939 231.81137 327.12123 244.49329 @E
/$fm 0 def
307.76939 231.81137 m
307.76939 244.49329 L
327.12123 244.49329 L
327.12123 231.81137 L
307.76939 231.81137 L
@c
N
@rax 313.21786 234.64431 316.22400 241.30261 @E
[0.00021304 0.00000000 0.00000000 0.00021304 313.21792479 235.94477140] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
414.86287 244.39946 494.14961 258.86636 @E
/$fm 0 def
414.86287 244.39946 m
414.86287 258.86636 L
494.14961 258.86636 L
494.14961 244.39946 L
414.86287 244.39946 L
@c
N
@rax 444.17254 247.28287 464.62620 255.60624 @E
[0.00021304 0.00000000 0.00000000 0.00021304 444.17262560 248.90882002] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($co) @t
50933 0 (l12) @t
T
@rax %Note: Object
307.76939 244.39946 327.12123 258.86636 @E
/$fm 0 def
307.76939 244.39946 m
307.76939 258.86636 L
327.12123 258.86636 L
327.12123 244.39946 L
307.76939 244.39946 L
@c
N
@rax 313.21786 247.28287 321.56986 255.60624 @E
[0.00021304 0.00000000 0.00000000 0.00021304 313.21792479 248.90882002] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
307.76939 258.86580 494.05578 258.86693 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
307.76939 258.86636 m
494.05578 258.86636 L
S
@rax %Note: Object
307.76939 244.49272 494.05578 244.49386 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
307.76939 244.49329 m
494.05578 244.49329 L
S
@rax %Note: Object
307.76939 231.90491 494.05578 231.90605 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
307.76939 231.90548 m
494.05578 231.90548 L
S
@rax %Note: Object
307.76939 219.31654 494.05578 219.31767 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
307.76939 219.31710 m
494.05578 219.31710 L
S
@rax %Note: Object
307.76939 204.75581 494.05578 204.75694 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
307.76939 204.75638 m
494.05578 204.75638 L
S
@rax %Note: Object
307.76882 204.75638 307.76995 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
307.76939 258.86636 m
307.76939 204.75638 L
S
@rax %Note: Object
414.86230 204.75638 414.86343 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
414.86287 258.86636 m
414.86287 204.75638 L
S
@rax %Note: Object
494.05521 204.75638 494.05635 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
494.05578 258.86636 m
494.05578 204.75638 L
S
@rax %Note: Object
327.02712 204.75638 327.02825 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
327.02769 258.86636 m
327.02769 204.75638 L
S
@rax %Note: Object
342.52724 204.75638 342.52838 258.86636 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
342.52781 258.86636 m
342.52781 204.75638 L
S
@rax %Note: Object
146.56564 292.30980 209.31846 304.99200 @E
/$fm 0 def
146.56564 292.30980 m
146.56564 304.99200 L
209.31846 304.99200 L
209.31846 292.30980 L
146.56564 292.30980 L
@c
N
@rax 152.01411 294.99279 203.84872 302.29965 @E
[0.00021304 0.00000000 0.00000000 0.00021304 152.01413225 296.25527076] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t3) @t
T
@rax %Note: Object
146.56564 304.89789 209.31846 317.58038 @E
/$fm 0 def
146.56564 304.89789 m
146.56564 317.58038 L
209.31846 317.58038 L
209.31846 304.89789 L
146.56564 304.89789 L
@c
N
@rax 152.01411 307.58117 203.84872 314.88775 @E
[0.00021304 0.00000000 0.00000000 0.00021304 152.01413225 308.84352516] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t2) @t
T
@rax %Note: Object
146.56564 317.48598 209.31846 330.16847 @E
/$fm 0 def
146.56564 317.48598 m
146.56564 330.16847 L
209.31846 330.16847 L
209.31846 317.48598 L
146.56564 317.48598 L
@c
N
@rax 152.01411 320.16926 203.84872 327.47613 @E
[0.00021304 0.00000000 0.00000000 0.00021304 152.01413225 321.43177955] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t1) @t
T
@rax %Note: Object
146.56564 330.07436 209.31846 344.54154 @E
/$fm 0 def
146.56564 330.07436 m
146.56564 344.54154 L
209.31846 344.54154 L
209.31846 330.07436 L
146.56564 330.07436 L
@c
N
@rax 166.66894 332.95776 188.58671 341.28085 @E
[0.00021304 0.00000000 0.00000000 0.00021304 166.66904185 334.58351225] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($) @t
26457 0 (col1) @t
85245 0 (1) @t
T
@rax %Note: Object
131.06494 292.30980 146.65946 304.99200 @E
/$fm 0 def
131.06494 292.30980 m
131.06494 304.99200 L
146.65946 304.99200 L
146.65946 292.30980 L
131.06494 292.30980 L
@c
N
@rax 136.51370 295.14246 139.51956 301.80104 @E
[0.00021304 0.00000000 0.00000000 0.00021304 136.51368565 296.44316788] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
131.06494 304.89789 146.65946 317.58038 @E
/$fm 0 def
131.06494 304.89789 m
131.06494 317.58038 L
146.65946 317.58038 L
146.65946 304.89789 L
131.06494 304.89789 L
@c
N
@rax 136.51370 307.73083 139.51956 314.38913 @E
[0.00021304 0.00000000 0.00000000 0.00021304 136.51368565 309.03142227] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
131.06494 317.48598 146.65946 330.16847 @E
/$fm 0 def
131.06494 317.48598 m
131.06494 330.16847 L
146.65946 330.16847 L
146.65946 317.48598 L
131.06494 317.48598 L
@c
N
@rax 136.51370 320.31921 139.51956 326.97751 @E
[0.00021304 0.00000000 0.00000000 0.00021304 136.51368565 321.61967667] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
131.06494 330.07436 146.65946 344.54154 @E
/$fm 0 def
131.06494 330.07436 m
131.06494 344.54154 L
146.65946 344.54154 L
146.65946 330.07436 L
131.06494 330.07436 L
@c
N
@rax 136.51370 332.95776 141.10413 341.28085 @E
[0.00021304 0.00000000 0.00000000 0.00021304 136.51368565 334.58351225] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (P) @t
T
@rax %Note: Object
209.22463 292.30980 307.86321 304.99200 @E
/$fm 0 def
209.22463 292.30980 m
209.22463 304.99200 L
307.86321 304.99200 L
307.86321 292.30980 L
209.22463 292.30980 L
@c
N
@rax 214.67310 294.99279 300.00728 302.29965 @E
[0.00021304 0.00000000 0.00000000 0.00021304 214.67313249 296.25527076] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (p3) @t
T
@rax %Note: Object
111.80721 292.30980 131.15906 304.99200 @E
/$fm 0 def
111.80721 292.30980 m
111.80721 304.99200 L
131.15906 304.99200 L
131.15906 292.30980 L
111.80721 292.30980 L
@c
N
@rax 117.25569 295.14246 120.26154 301.80104 @E
[0.00021304 0.00000000 0.00000000 0.00021304 117.25572287 296.44316788] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
209.22463 304.89789 307.86321 317.58038 @E
/$fm 0 def
209.22463 304.89789 m
209.22463 317.58038 L
307.86321 317.58038 L
307.86321 304.89789 L
209.22463 304.89789 L
@c
N
@rax 214.67310 307.58117 300.00728 314.88775 @E
[0.00021304 0.00000000 0.00000000 0.00021304 214.67313249 308.84352516] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (p2) @t
T
@rax %Note: Object
111.80721 304.89789 131.15906 317.58038 @E
/$fm 0 def
111.80721 304.89789 m
111.80721 317.58038 L
131.15906 317.58038 L
131.15906 304.89789 L
111.80721 304.89789 L
@c
N
@rax 117.25569 307.73083 120.26154 314.38913 @E
[0.00021304 0.00000000 0.00000000 0.00021304 117.25572287 309.03142227] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
209.22463 317.58038 307.76939 330.16847 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
209.22463 330.16847 m
209.22463 317.58038 L
307.76939 317.58038 L
307.76939 330.16847 L
209.22463 330.16847 L
@c
F
@rax 214.67310 320.16926 300.00728 327.47613 @E
[0.00021304 0.00000000 0.00000000 0.00021304 214.67313249 321.43177955] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (p1) @t
T
@rax %Note: Object
111.80721 317.48598 131.15906 330.16847 @E
/$fm 0 def
111.80721 317.48598 m
111.80721 330.16847 L
131.15906 330.16847 L
131.15906 317.48598 L
111.80721 317.48598 L
@c
N
@rax 117.25569 320.31921 120.26154 326.97751 @E
[0.00021304 0.00000000 0.00000000 0.00021304 117.25572287 321.61967667] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
209.22463 330.07436 307.86321 344.54154 @E
/$fm 0 def
209.22463 330.07436 m
209.22463 344.54154 L
307.86321 344.54154 L
307.86321 330.07436 L
209.22463 330.07436 L
@c
N
@rax 250.08917 332.95776 266.78523 341.28085 @E
[0.00021304 0.00000000 0.00000000 0.00021304 250.08918177 334.58351225] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($co) @t
50933 0 (l7) @t
T
@rax %Note: Object
111.80721 330.07436 131.15906 344.54154 @E
/$fm 0 def
111.80721 330.07436 m
111.80721 344.54154 L
131.15906 344.54154 L
131.15906 330.07436 L
111.80721 330.07436 L
@c
N
@rax 117.25569 332.95776 125.60769 341.28085 @E
[0.00021304 0.00000000 0.00000000 0.00021304 117.25572287 334.58351225] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
111.80721 344.54098 307.76939 344.54211 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
111.80721 344.54154 m
307.76939 344.54154 L
S
@rax %Note: Object
111.80721 330.16791 307.76939 330.16904 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
111.80721 330.16847 m
307.76939 330.16847 L
S
@rax %Note: Object
111.80721 317.57981 307.76939 317.58094 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
111.80721 317.58038 m
307.76939 317.58038 L
S
@rax %Note: Object
111.80721 304.99143 307.76939 304.99257 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
111.80721 304.99200 m
307.76939 304.99200 L
S
@rax %Note: Object
111.80721 292.40334 307.76939 292.40447 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
111.80721 292.40391 m
307.76939 292.40391 L
S
@rax %Note: Object
111.80665 292.40391 111.80778 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
111.80721 344.54154 m
111.80721 292.40391 L
S
@rax %Note: Object
209.22406 292.40391 209.22520 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
209.22463 344.54154 m
209.22463 292.40391 L
S
@rax %Note: Object
307.76882 292.40391 307.76995 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
307.76939 344.54154 m
307.76939 292.40391 L
S
@rax %Note: Object
131.06438 292.40391 131.06551 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
131.06494 344.54154 m
131.06494 292.40391 L
S
@rax %Note: Object
146.56507 292.40391 146.56620 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
146.56564 344.54154 m
146.56564 292.40391 L
S
@rax %Note: Object
146.56564 292.30980 209.31846 304.99200 @E
/$fm 0 def
146.56564 292.30980 m
146.56564 304.99200 L
209.31846 304.99200 L
209.31846 292.30980 L
146.56564 292.30980 L
@c
N
@rax 152.01411 294.99279 203.84872 302.29965 @E
[0.00021304 0.00000000 0.00000000 0.00021304 152.01413225 296.25527076] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t3) @t
T
@rax %Note: Object
146.56564 304.89789 209.31846 317.58038 @E
/$fm 0 def
146.56564 304.89789 m
146.56564 317.58038 L
209.31846 317.58038 L
209.31846 304.89789 L
146.56564 304.89789 L
@c
N
@rax 152.01411 307.58117 203.84872 314.88775 @E
[0.00021304 0.00000000 0.00000000 0.00021304 152.01413225 308.84352516] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t2) @t
T
@rax %Note: Object
146.56564 317.48598 209.31846 330.16847 @E
/$fm 0 def
146.56564 317.48598 m
146.56564 330.16847 L
209.31846 330.16847 L
209.31846 317.48598 L
146.56564 317.48598 L
@c
N
@rax 152.01411 320.16926 203.84872 327.47613 @E
[0.00021304 0.00000000 0.00000000 0.00021304 152.01413225 321.43177955] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t1) @t
T
@rax %Note: Object
146.56564 330.07436 209.31846 344.54154 @E
/$fm 0 def
146.56564 330.07436 m
146.56564 344.54154 L
209.31846 344.54154 L
209.31846 330.07436 L
146.56564 330.07436 L
@c
N
@rax 166.66894 332.95776 188.58671 341.28085 @E
[0.00021304 0.00000000 0.00000000 0.00021304 166.66904185 334.58351225] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($) @t
26457 0 (col1) @t
85245 0 (1) @t
T
@rax %Note: Object
131.06494 292.30980 146.65946 304.99200 @E
/$fm 0 def
131.06494 292.30980 m
131.06494 304.99200 L
146.65946 304.99200 L
146.65946 292.30980 L
131.06494 292.30980 L
@c
N
@rax 136.51370 295.14246 139.51956 301.80104 @E
[0.00021304 0.00000000 0.00000000 0.00021304 136.51368565 296.44316788] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
131.06494 304.89789 146.65946 317.58038 @E
/$fm 0 def
131.06494 304.89789 m
131.06494 317.58038 L
146.65946 317.58038 L
146.65946 304.89789 L
131.06494 304.89789 L
@c
N
@rax 136.51370 307.73083 139.51956 314.38913 @E
[0.00021304 0.00000000 0.00000000 0.00021304 136.51368565 309.03142227] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
131.06494 317.48598 146.65946 330.16847 @E
/$fm 0 def
131.06494 317.48598 m
131.06494 330.16847 L
146.65946 330.16847 L
146.65946 317.48598 L
131.06494 317.48598 L
@c
N
@rax 136.51370 320.31921 139.51956 326.97751 @E
[0.00021304 0.00000000 0.00000000 0.00021304 136.51368565 321.61967667] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
131.06494 330.07436 146.65946 344.54154 @E
/$fm 0 def
131.06494 330.07436 m
131.06494 344.54154 L
146.65946 344.54154 L
146.65946 330.07436 L
131.06494 330.07436 L
@c
N
@rax 136.51370 332.95776 141.10413 341.28085 @E
[0.00021304 0.00000000 0.00000000 0.00021304 136.51368565 334.58351225] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (P) @t
T
@rax %Note: Object
209.22463 292.30980 307.86321 304.99200 @E
/$fm 0 def
209.22463 292.30980 m
209.22463 304.99200 L
307.86321 304.99200 L
307.86321 292.30980 L
209.22463 292.30980 L
@c
N
@rax 214.67310 294.99279 300.00728 302.29965 @E
[0.00021304 0.00000000 0.00000000 0.00021304 214.67313249 296.25527076] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (p3) @t
T
@rax %Note: Object
111.80721 292.30980 131.15906 304.99200 @E
/$fm 0 def
111.80721 292.30980 m
111.80721 304.99200 L
131.15906 304.99200 L
131.15906 292.30980 L
111.80721 292.30980 L
@c
N
@rax 117.25569 295.14246 120.26154 301.80104 @E
[0.00021304 0.00000000 0.00000000 0.00021304 117.25572287 296.44316788] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
209.22463 304.89789 307.86321 317.58038 @E
/$fm 0 def
209.22463 304.89789 m
209.22463 317.58038 L
307.86321 317.58038 L
307.86321 304.89789 L
209.22463 304.89789 L
@c
N
@rax 214.67310 307.58117 300.00728 314.88775 @E
[0.00021304 0.00000000 0.00000000 0.00021304 214.67313249 308.84352516] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (p2) @t
T
@rax %Note: Object
111.80721 304.89789 131.15906 317.58038 @E
/$fm 0 def
111.80721 304.89789 m
111.80721 317.58038 L
131.15906 317.58038 L
131.15906 304.89789 L
111.80721 304.89789 L
@c
N
@rax 117.25569 307.73083 120.26154 314.38913 @E
[0.00021304 0.00000000 0.00000000 0.00021304 117.25572287 309.03142227] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
209.22463 317.58038 307.76939 330.16847 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
209.22463 330.16847 m
209.22463 317.58038 L
307.76939 317.58038 L
307.76939 330.16847 L
209.22463 330.16847 L
@c
F
@rax 214.67310 320.16926 300.00728 327.47613 @E
[0.00021304 0.00000000 0.00000000 0.00021304 214.67313249 321.43177955] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (p1) @t
T
@rax %Note: Object
111.80721 317.48598 131.15906 330.16847 @E
/$fm 0 def
111.80721 317.48598 m
111.80721 330.16847 L
131.15906 330.16847 L
131.15906 317.48598 L
111.80721 317.48598 L
@c
N
@rax 117.25569 320.31921 120.26154 326.97751 @E
[0.00021304 0.00000000 0.00000000 0.00021304 117.25572287 321.61967667] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
209.22463 330.07436 307.86321 344.54154 @E
/$fm 0 def
209.22463 330.07436 m
209.22463 344.54154 L
307.86321 344.54154 L
307.86321 330.07436 L
209.22463 330.07436 L
@c
N
@rax 250.08917 332.95776 266.78523 341.28085 @E
[0.00021304 0.00000000 0.00000000 0.00021304 250.08918177 334.58351225] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($co) @t
50933 0 (l7) @t
T
@rax %Note: Object
111.80721 330.07436 131.15906 344.54154 @E
/$fm 0 def
111.80721 330.07436 m
111.80721 344.54154 L
131.15906 344.54154 L
131.15906 330.07436 L
111.80721 330.07436 L
@c
N
@rax 117.25569 332.95776 125.60769 341.28085 @E
[0.00021304 0.00000000 0.00000000 0.00021304 117.25572287 334.58351225] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
111.80721 344.54098 307.76939 344.54211 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
111.80721 344.54154 m
307.76939 344.54154 L
S
@rax %Note: Object
111.80721 330.16791 307.76939 330.16904 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
111.80721 330.16847 m
307.76939 330.16847 L
S
@rax %Note: Object
111.80721 317.57981 307.76939 317.58094 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
111.80721 317.58038 m
307.76939 317.58038 L
S
@rax %Note: Object
111.80721 304.99143 307.76939 304.99257 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
111.80721 304.99200 m
307.76939 304.99200 L
S
@rax %Note: Object
111.80721 292.40334 307.76939 292.40447 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
111.80721 292.40391 m
307.76939 292.40391 L
S
@rax %Note: Object
111.80665 292.40391 111.80778 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
111.80721 344.54154 m
111.80721 292.40391 L
S
@rax %Note: Object
209.22406 292.40391 209.22520 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
209.22463 344.54154 m
209.22463 292.40391 L
S
@rax %Note: Object
307.76882 292.40391 307.76995 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
307.76939 344.54154 m
307.76939 292.40391 L
S
@rax %Note: Object
131.06438 292.40391 131.06551 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
131.06494 344.54154 m
131.06494 292.40391 L
S
@rax %Note: Object
146.56507 292.40391 146.56620 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
146.56564 344.54154 m
146.56564 292.40391 L
S
@rax %Note: Object
173.62063 353.46586 421.72072 373.85121 @E
0 O 0 @g
0.24 0.01 0.12 0.00 k
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
173.62063 353.46586 m
173.62063 373.85121 L
421.72072 373.85121 L
421.72072 353.46586 L
173.62063 353.46586 L
@c
B
@rax 192.59688 356.59502 198.60888 369.91191 @E
[0.00021304 0.00000000 0.00000000 0.00021304 192.59692606 359.19632970] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 56443.00000 z
0 0 (J) @t
T
@rax 200.86384 354.88970 308.37827 361.54800 @E
[0.00021304 0.00000000 0.00000000 0.00021304 200.86375990 356.19018894] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (\050\050$col1) @t
80443 0 (1 == $col5\051) @t
218089 0 (AND $col7 == \050"Mor) @t
463934 0 (gan) @t
T
@rax 310.11789 354.88970 335.49222 361.54800 @E
[0.00021304 0.00000000 0.00000000 0.00021304 310.11783547 356.19018894] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (Kaufmann) @t
T
@rax 336.89140 354.88970 369.90482 361.54800 @E
[0.00021304 0.00000000 0.00000000 0.00021304 336.89125668 356.19018894] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (Publishers"\051\051) @t
T
@rax 369.86485 360.90198 402.58970 367.56028 @E
[0.00021304 0.00000000 0.00000000 0.00021304 369.86485653 362.20247047] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 ($col1, $col12) @t
T
@rax %Note: Object
205.93644 344.54154 259.76523 352.71439 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
205.93644 344.54154 m
259.76523 352.71439 L
S
@rax %Note: Object
259.10759 349.70825 265.30781 355.53260 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
259.95317 349.70825 m
265.30781 353.55969 L
259.10759 355.53260 L
259.95317 349.70825 L
@c
F
@rax %Note: Object
358.77969 344.54154 394.57134 352.33852 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
394.57134 344.54154 m
358.77969 352.33852 L
S
@rax %Note: Object
353.23710 349.42649 359.71909 355.15672 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
359.71909 355.15672 m
353.23710 353.55969 L
358.49792 349.42649 L
359.71909 355.15672 L
@c
F
@rax %Note: Object
347.60069 292.30980 431.20885 304.99200 @E
/$fm 0 def
347.60069 292.30980 m
347.60069 304.99200 L
431.20885 304.99200 L
431.20885 292.30980 L
347.60069 292.30980 L
@c
N
@rax 353.04917 294.99279 421.55858 302.29965 @E
[0.00021304 0.00000000 0.00000000 0.00021304 353.04934318 296.25527076] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r3) @t
T
@rax %Note: Object
347.60069 304.89789 431.20885 317.58038 @E
/$fm 0 def
347.60069 304.89789 m
347.60069 317.58038 L
431.20885 317.58038 L
431.20885 304.89789 L
347.60069 304.89789 L
@c
N
@rax 353.04917 307.58117 421.55858 314.88775 @E
[0.00021304 0.00000000 0.00000000 0.00021304 353.04934318 308.84352516] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r2) @t
T
@rax %Note: Object
347.60069 317.48598 431.20885 330.16847 @E
/$fm 0 def
347.60069 317.48598 m
347.60069 330.16847 L
431.20885 330.16847 L
431.20885 317.48598 L
347.60069 317.48598 L
@c
N
@rax 353.04917 320.16926 421.55858 327.47613 @E
[0.00021304 0.00000000 0.00000000 0.00021304 353.04934318 321.43177955] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r1) @t
T
@rax %Note: Object
347.60069 330.07436 431.20885 344.54154 @E
/$fm 0 def
347.60069 330.07436 m
347.60069 344.54154 L
431.20885 344.54154 L
431.20885 330.07436 L
347.60069 330.07436 L
@c
N
@rax 378.13153 332.95776 400.46400 341.28085 @E
[0.00021304 0.00000000 0.00000000 0.00021304 378.13169037 334.58351225] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($) @t
26457 0 (col1) @t
87191 0 (2) @t
T
@rax %Note: Object
332.10028 292.30980 347.69452 304.99200 @E
/$fm 0 def
332.10028 292.30980 m
332.10028 304.99200 L
347.69452 304.99200 L
347.69452 292.30980 L
332.10028 292.30980 L
@c
N
@rax 337.54876 295.14246 340.55490 301.80104 @E
[0.00021304 0.00000000 0.00000000 0.00021304 337.54889657 296.44316788] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
332.10028 304.89789 347.69452 317.58038 @E
/$fm 0 def
332.10028 304.89789 m
332.10028 317.58038 L
347.69452 317.58038 L
347.69452 304.89789 L
332.10028 304.89789 L
@c
N
@rax 337.54876 307.73083 340.55490 314.38913 @E
[0.00021304 0.00000000 0.00000000 0.00021304 337.54889657 309.03142227] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
332.10028 317.48598 347.69452 330.16847 @E
/$fm 0 def
332.10028 317.48598 m
332.10028 330.16847 L
347.69452 330.16847 L
347.69452 317.48598 L
332.10028 317.48598 L
@c
N
@rax 337.54876 320.31921 340.55490 326.97751 @E
[0.00021304 0.00000000 0.00000000 0.00021304 337.54889657 321.61967667] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
332.10028 330.07436 347.69452 344.54154 @E
/$fm 0 def
332.10028 330.07436 m
332.10028 344.54154 L
347.69452 344.54154 L
347.69452 330.07436 L
332.10028 330.07436 L
@c
N
@rax 337.54876 332.95776 342.13946 341.28085 @E
[0.00021304 0.00000000 0.00000000 0.00021304 337.54889657 334.58351225] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (P) @t
T
@rax %Note: Object
431.11502 292.30980 493.86756 304.99200 @E
/$fm 0 def
431.11502 292.30980 m
431.11502 304.99200 L
493.86756 304.99200 L
493.86756 292.30980 L
431.11502 292.30980 L
@c
N
@rax 436.56350 294.99279 488.39811 302.29965 @E
[0.00021304 0.00000000 0.00000000 0.00021304 436.56343165 296.25527076] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t3) @t
T
@rax %Note: Object
312.84198 292.30980 332.19411 304.99200 @E
/$fm 0 def
312.84198 292.30980 m
312.84198 304.99200 L
332.19411 304.99200 L
332.19411 292.30980 L
312.84198 292.30980 L
@c
N
@rax 318.29102 295.14246 321.29688 301.80104 @E
[0.00021304 0.00000000 0.00000000 0.00021304 318.29093379 296.44316788] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
431.11502 304.89789 493.86756 317.58038 @E
/$fm 0 def
431.11502 304.89789 m
431.11502 317.58038 L
493.86756 317.58038 L
493.86756 304.89789 L
431.11502 304.89789 L
@c
N
@rax 436.56350 307.58117 488.39811 314.88775 @E
[0.00021304 0.00000000 0.00000000 0.00021304 436.56343165 308.84352516] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t2) @t
T
@rax %Note: Object
312.84198 304.89789 332.19411 317.58038 @E
/$fm 0 def
312.84198 304.89789 m
312.84198 317.58038 L
332.19411 317.58038 L
332.19411 304.89789 L
312.84198 304.89789 L
@c
N
@rax 318.29102 307.73083 321.29688 314.38913 @E
[0.00021304 0.00000000 0.00000000 0.00021304 318.29093379 309.03142227] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
431.11502 317.48598 493.86756 330.16847 @E
/$fm 0 def
431.11502 317.48598 m
431.11502 330.16847 L
493.86756 330.16847 L
493.86756 317.48598 L
431.11502 317.48598 L
@c
N
@rax 436.56350 320.16926 488.39811 327.47613 @E
[0.00021304 0.00000000 0.00000000 0.00021304 436.56343165 321.43177955] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t1) @t
T
@rax %Note: Object
312.84198 317.48598 332.19411 330.16847 @E
/$fm 0 def
312.84198 317.48598 m
312.84198 330.16847 L
332.19411 330.16847 L
332.19411 317.48598 L
312.84198 317.48598 L
@c
N
@rax 318.29102 320.31921 321.29688 326.97751 @E
[0.00021304 0.00000000 0.00000000 0.00021304 318.29093379 321.61967667] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
431.11502 330.07436 493.86756 344.54154 @E
/$fm 0 def
431.11502 330.07436 m
431.11502 344.54154 L
493.86756 344.54154 L
493.86756 330.07436 L
431.11502 330.07436 L
@c
N
@rax 454.03654 332.95776 470.73260 341.28085 @E
[0.00021304 0.00000000 0.00000000 0.00021304 454.03658490 334.58351225] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($co) @t
50933 0 (l5) @t
T
@rax %Note: Object
312.84198 330.07436 332.19411 344.54154 @E
/$fm 0 def
312.84198 330.07436 m
312.84198 344.54154 L
332.19411 344.54154 L
332.19411 330.07436 L
312.84198 330.07436 L
@c
N
@rax 318.29102 332.95776 326.64302 341.28085 @E
[0.00021304 0.00000000 0.00000000 0.00021304 318.29093379 334.58351225] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
312.84198 344.54098 493.77373 344.54211 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
312.84198 344.54154 m
493.77373 344.54154 L
S
@rax %Note: Object
312.84198 330.16791 493.77373 330.16904 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
312.84198 330.16847 m
493.77373 330.16847 L
S
@rax %Note: Object
312.84198 317.57981 493.77373 317.58094 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
312.84198 317.58038 m
493.77373 317.58038 L
S
@rax %Note: Object
312.84198 304.99143 493.77373 304.99257 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
312.84198 304.99200 m
493.77373 304.99200 L
S
@rax %Note: Object
312.84198 292.40334 493.77373 292.40447 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
312.84198 292.40391 m
493.77373 292.40391 L
S
@rax %Note: Object
312.84142 292.40391 312.84255 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
312.84198 344.54154 m
312.84198 292.40391 L
S
@rax %Note: Object
431.11446 292.40391 431.11559 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
431.11502 344.54154 m
431.11502 292.40391 L
S
@rax %Note: Object
493.77317 292.40391 493.77430 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
493.77373 344.54154 m
493.77373 292.40391 L
S
@rax %Note: Object
332.09972 292.40391 332.10085 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
332.10028 344.54154 m
332.10028 292.40391 L
S
@rax %Note: Object
347.60013 292.40391 347.60126 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
347.60069 344.54154 m
347.60069 292.40391 L
S
@rax %Note: Object
347.60069 292.30980 431.20885 304.99200 @E
/$fm 0 def
347.60069 292.30980 m
347.60069 304.99200 L
431.20885 304.99200 L
431.20885 292.30980 L
347.60069 292.30980 L
@c
N
@rax 353.04917 294.99279 421.55858 302.29965 @E
[0.00021304 0.00000000 0.00000000 0.00021304 353.04934318 296.25527076] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r3) @t
T
@rax %Note: Object
347.60069 304.89789 431.20885 317.58038 @E
/$fm 0 def
347.60069 304.89789 m
347.60069 317.58038 L
431.20885 317.58038 L
431.20885 304.89789 L
347.60069 304.89789 L
@c
N
@rax 353.04917 307.58117 421.55858 314.88775 @E
[0.00021304 0.00000000 0.00000000 0.00021304 353.04934318 308.84352516] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r2) @t
T
@rax %Note: Object
347.60069 317.48598 431.20885 330.16847 @E
/$fm 0 def
347.60069 317.48598 m
347.60069 330.16847 L
431.20885 330.16847 L
431.20885 317.48598 L
347.60069 317.48598 L
@c
N
@rax 353.04917 320.16926 421.55858 327.47613 @E
[0.00021304 0.00000000 0.00000000 0.00021304 353.04934318 321.43177955] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r1) @t
T
@rax %Note: Object
347.60069 330.07436 431.20885 344.54154 @E
/$fm 0 def
347.60069 330.07436 m
347.60069 344.54154 L
431.20885 344.54154 L
431.20885 330.07436 L
347.60069 330.07436 L
@c
N
@rax 378.13153 332.95776 400.46400 341.28085 @E
[0.00021304 0.00000000 0.00000000 0.00021304 378.13169037 334.58351225] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($) @t
26457 0 (col1) @t
87191 0 (2) @t
T
@rax %Note: Object
332.10028 292.30980 347.69452 304.99200 @E
/$fm 0 def
332.10028 292.30980 m
332.10028 304.99200 L
347.69452 304.99200 L
347.69452 292.30980 L
332.10028 292.30980 L
@c
N
@rax 337.54876 295.14246 340.55490 301.80104 @E
[0.00021304 0.00000000 0.00000000 0.00021304 337.54889657 296.44316788] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
332.10028 304.89789 347.69452 317.58038 @E
/$fm 0 def
332.10028 304.89789 m
332.10028 317.58038 L
347.69452 317.58038 L
347.69452 304.89789 L
332.10028 304.89789 L
@c
N
@rax 337.54876 307.73083 340.55490 314.38913 @E
[0.00021304 0.00000000 0.00000000 0.00021304 337.54889657 309.03142227] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
332.10028 317.48598 347.69452 330.16847 @E
/$fm 0 def
332.10028 317.48598 m
332.10028 330.16847 L
347.69452 330.16847 L
347.69452 317.48598 L
332.10028 317.48598 L
@c
N
@rax 337.54876 320.31921 340.55490 326.97751 @E
[0.00021304 0.00000000 0.00000000 0.00021304 337.54889657 321.61967667] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
332.10028 330.07436 347.69452 344.54154 @E
/$fm 0 def
332.10028 330.07436 m
332.10028 344.54154 L
347.69452 344.54154 L
347.69452 330.07436 L
332.10028 330.07436 L
@c
N
@rax 337.54876 332.95776 342.13946 341.28085 @E
[0.00021304 0.00000000 0.00000000 0.00021304 337.54889657 334.58351225] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (P) @t
T
@rax %Note: Object
431.11502 292.30980 493.86756 304.99200 @E
/$fm 0 def
431.11502 292.30980 m
431.11502 304.99200 L
493.86756 304.99200 L
493.86756 292.30980 L
431.11502 292.30980 L
@c
N
@rax 436.56350 294.99279 488.39811 302.29965 @E
[0.00021304 0.00000000 0.00000000 0.00021304 436.56343165 296.25527076] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t3) @t
T
@rax %Note: Object
312.84198 292.30980 332.19411 304.99200 @E
/$fm 0 def
312.84198 292.30980 m
312.84198 304.99200 L
332.19411 304.99200 L
332.19411 292.30980 L
312.84198 292.30980 L
@c
N
@rax 318.29102 295.14246 321.29688 301.80104 @E
[0.00021304 0.00000000 0.00000000 0.00021304 318.29093379 296.44316788] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (3) @t
T
@rax %Note: Object
431.11502 304.89789 493.86756 317.58038 @E
/$fm 0 def
431.11502 304.89789 m
431.11502 317.58038 L
493.86756 317.58038 L
493.86756 304.89789 L
431.11502 304.89789 L
@c
N
@rax 436.56350 307.58117 488.39811 314.88775 @E
[0.00021304 0.00000000 0.00000000 0.00021304 436.56343165 308.84352516] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t2) @t
T
@rax %Note: Object
312.84198 304.89789 332.19411 317.58038 @E
/$fm 0 def
312.84198 304.89789 m
312.84198 317.58038 L
332.19411 317.58038 L
332.19411 304.89789 L
312.84198 304.89789 L
@c
N
@rax 318.29102 307.73083 321.29688 314.38913 @E
[0.00021304 0.00000000 0.00000000 0.00021304 318.29093379 309.03142227] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
431.11502 317.48598 493.86756 330.16847 @E
/$fm 0 def
431.11502 317.48598 m
431.11502 330.16847 L
493.86756 330.16847 L
493.86756 317.48598 L
431.11502 317.48598 L
@c
N
@rax 436.56350 320.16926 488.39811 327.47613 @E
[0.00021304 0.00000000 0.00000000 0.00021304 436.56343165 321.43177955] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t1) @t
T
@rax %Note: Object
312.84198 317.48598 332.19411 330.16847 @E
/$fm 0 def
312.84198 317.48598 m
312.84198 330.16847 L
332.19411 330.16847 L
332.19411 317.48598 L
312.84198 317.48598 L
@c
N
@rax 318.29102 320.31921 321.29688 326.97751 @E
[0.00021304 0.00000000 0.00000000 0.00021304 318.29093379 321.61967667] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
431.11502 330.07436 493.86756 344.54154 @E
/$fm 0 def
431.11502 330.07436 m
431.11502 344.54154 L
493.86756 344.54154 L
493.86756 330.07436 L
431.11502 330.07436 L
@c
N
@rax 454.03654 332.95776 470.73260 341.28085 @E
[0.00021304 0.00000000 0.00000000 0.00021304 454.03658490 334.58351225] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($co) @t
50933 0 (l5) @t
T
@rax %Note: Object
312.84198 330.07436 332.19411 344.54154 @E
/$fm 0 def
312.84198 330.07436 m
312.84198 344.54154 L
332.19411 344.54154 L
332.19411 330.07436 L
312.84198 330.07436 L
@c
N
@rax 318.29102 332.95776 326.64302 341.28085 @E
[0.00021304 0.00000000 0.00000000 0.00021304 318.29093379 334.58351225] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
312.84198 344.54098 493.77373 344.54211 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
312.84198 344.54154 m
493.77373 344.54154 L
S
@rax %Note: Object
312.84198 330.16791 493.77373 330.16904 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
312.84198 330.16847 m
493.77373 330.16847 L
S
@rax %Note: Object
312.84198 317.57981 493.77373 317.58094 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
312.84198 317.58038 m
493.77373 317.58038 L
S
@rax %Note: Object
312.84198 304.99143 493.77373 304.99257 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
312.84198 304.99200 m
493.77373 304.99200 L
S
@rax %Note: Object
312.84198 292.40334 493.77373 292.40447 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
312.84198 292.40391 m
493.77373 292.40391 L
S
@rax %Note: Object
312.84142 292.40391 312.84255 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
312.84198 344.54154 m
312.84198 292.40391 L
S
@rax %Note: Object
431.11446 292.40391 431.11559 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
431.11502 344.54154 m
431.11502 292.40391 L
S
@rax %Note: Object
493.77317 292.40391 493.77430 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
493.77373 344.54154 m
493.77373 292.40391 L
S
@rax %Note: Object
332.09972 292.40391 332.10085 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
332.10028 344.54154 m
332.10028 292.40391 L
S
@rax %Note: Object
347.60013 292.40391 347.60126 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
347.60069 344.54154 m
347.60069 292.40391 L
S
@rax %Note: Object
376.53449 265.53657 444.26665 285.92192 @E
0 O 0 @g
0.24 0.01 0.12 0.00 k
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
376.53449 265.53657 m
376.53449 285.92192 L
444.26665 285.92192 L
444.26665 265.53657 L
376.53449 265.53657 L
@c
B
@rax 389.87433 268.34372 396.13918 283.07339 @E
[0.00021304 0.00000000 0.00000000 0.00021304 389.87440776 270.98502645] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/Symbol 56443.00000 z
0 0 (f) @t
T
@rax 396.07455 267.42983 406.59534 274.08841 @E
[0.00021304 0.00000000 0.00000000 0.00021304 396.07458641 268.73047414] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 ($b,) @t
T
@rax 406.59591 266.67836 417.44891 273.33666 @E
[0.00021304 0.00000000 0.00000000 0.00021304 406.59597256 267.97888569] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (title) @t
T
@rax 417.49313 272.69065 430.84970 279.34894 @E
[0.00021304 0.00000000 0.00000000 0.00021304 417.49315295 273.99116722] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 ($col5) @t
T
@rax %Note: Object
321.29688 393.20334 404.81121 405.79143 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
321.29688 405.79143 m
321.29688 393.20334 L
404.81121 393.20334 L
404.81121 405.79143 L
321.29688 405.79143 L
@c
F
@rax 326.74564 395.79250 399.48151 403.09909 @E
[0.00021304 0.00000000 0.00000000 0.00021304 326.74566475 397.05482841] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r2 review >) @t
T
@rax %Note: Object
258.63789 393.20334 321.29688 405.79143 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
258.63789 405.79143 m
258.63789 393.20334 L
321.29688 393.20334 L
321.29688 405.79143 L
258.63789 405.79143 L
@c
F
@rax 264.08636 395.79250 315.92126 403.09909 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.08645147 397.05482841] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t1) @t
T
@rax %Note: Object
238.15871 393.20334 258.63789 405.79143 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
238.15871 405.79143 m
238.15871 393.20334 L
258.63789 393.20334 L
258.63789 405.79143 L
238.15871 405.79143 L
@c
F
@rax 243.60718 395.94217 246.61304 402.60047 @E
[0.00021304 0.00000000 0.00000000 0.00021304 243.60715746 397.24272552] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
217.20954 393.20334 238.15871 405.79143 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
217.20954 405.79143 m
217.20954 393.20334 L
238.15871 393.20334 L
238.15871 405.79143 L
217.20954 405.79143 L
@c
F
@rax 222.65802 395.94217 225.66416 402.60047 @E
[0.00021304 0.00000000 0.00000000 0.00021304 222.65812067 397.24272552] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
197.95153 393.20334 217.20954 405.79143 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
197.95153 405.79143 m
197.95153 393.20334 L
217.20954 393.20334 L
217.20954 405.79143 L
197.95153 405.79143 L
@c
F
@rax 203.40000 395.94217 206.40614 402.60047 @E
[0.00021304 0.00000000 0.00000000 0.00021304 203.40015788 397.24272552] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
321.29688 380.52085 404.90504 393.20334 @E
/$fm 0 def
321.29688 380.52085 m
321.29688 393.20334 L
404.90504 393.20334 L
404.90504 380.52085 L
321.29688 380.52085 L
@c
N
@rax 326.74564 383.20413 399.48151 390.51071 @E
[0.00021304 0.00000000 0.00000000 0.00021304 326.74566475 384.46657402] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r1 review >) @t
T
@rax %Note: Object
321.29688 405.69732 404.90504 420.16450 @E
/$fm 0 def
321.29688 405.69732 m
321.29688 420.16450 L
404.90504 420.16450 L
404.90504 405.69732 L
321.29688 405.69732 L
@c
N
@rax 351.82800 408.58072 374.16019 416.90409 @E
[0.00021304 0.00000000 0.00000000 0.00021304 351.82801195 410.20656111] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($) @t
26457 0 (col1) @t
87191 0 (2) @t
T
@rax %Note: Object
238.15871 380.52085 258.73172 393.20334 @E
/$fm 0 def
238.15871 380.52085 m
238.15871 393.20334 L
258.73172 393.20334 L
258.73172 380.52085 L
238.15871 380.52085 L
@c
N
@rax 243.60718 383.35380 246.61304 390.01238 @E
[0.00021304 0.00000000 0.00000000 0.00021304 243.60715746 384.65447113] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
238.15871 405.69732 258.73172 420.16450 @E
/$fm 0 def
238.15871 405.69732 m
238.15871 420.16450 L
258.73172 420.16450 L
258.73172 405.69732 L
238.15871 405.69732 L
@c
N
@rax 243.60718 408.58072 253.21039 416.90409 @E
[0.00021304 0.00000000 0.00000000 0.00021304 243.60715746 410.20656111] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (LP) @t
T
@rax %Note: Object
258.63789 380.52085 321.39099 393.20334 @E
/$fm 0 def
258.63789 380.52085 m
258.63789 393.20334 L
321.39099 393.20334 L
321.39099 380.52085 L
258.63789 380.52085 L
@c
N
@rax 264.08636 383.20413 315.92126 390.51071 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.08645147 384.46657402] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t2) @t
T
@rax %Note: Object
258.63789 405.69732 321.39099 420.16450 @E
/$fm 0 def
258.63789 405.69732 m
258.63789 420.16450 L
321.39099 420.16450 L
321.39099 405.69732 L
258.63789 405.69732 L
@c
N
@rax 278.74148 408.58072 300.65896 416.90409 @E
[0.00021304 0.00000000 0.00000000 0.00021304 278.74136107 410.20656111] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($) @t
26457 0 (col1) @t
85245 0 (1) @t
T
@rax %Note: Object
217.20954 380.52085 238.25254 393.20334 @E
/$fm 0 def
217.20954 380.52085 m
217.20954 393.20334 L
238.25254 393.20334 L
238.25254 380.52085 L
217.20954 380.52085 L
@c
N
@rax 222.65802 383.35380 225.66416 390.01238 @E
[0.00021304 0.00000000 0.00000000 0.00021304 222.65812067 384.65447113] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
217.20954 405.69732 238.25254 420.16450 @E
/$fm 0 def
217.20954 405.69732 m
217.20954 420.16450 L
238.25254 420.16450 L
238.25254 405.69732 L
217.20954 405.69732 L
@c
N
@rax 222.65802 408.58072 232.67594 416.90409 @E
[0.00021304 0.00000000 0.00000000 0.00021304 222.65812067 410.20656111] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (RP) @t
T
@rax %Note: Object
197.95153 380.52085 217.30365 393.20334 @E
/$fm 0 def
197.95153 380.52085 m
197.95153 393.20334 L
217.30365 393.20334 L
217.30365 380.52085 L
197.95153 380.52085 L
@c
N
@rax 203.40000 383.35380 206.40614 390.01238 @E
[0.00021304 0.00000000 0.00000000 0.00021304 203.40015788 384.65447113] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
197.95153 405.69732 217.30365 420.16450 @E
/$fm 0 def
197.95153 405.69732 m
197.95153 420.16450 L
217.30365 420.16450 L
217.30365 405.69732 L
197.95153 405.69732 L
@c
N
@rax 203.40000 408.58072 211.75228 416.90409 @E
[0.00021304 0.00000000 0.00000000 0.00021304 203.40015788 410.20656111] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
197.95153 420.16394 404.81121 420.16507 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
197.95153 420.16450 m
404.81121 420.16450 L
S
@rax %Note: Object
197.95153 405.79087 404.81121 405.79200 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
197.95153 405.79143 m
404.81121 405.79143 L
S
@rax %Note: Object
197.95153 380.61439 404.81121 380.61553 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
197.95153 380.61496 m
404.81121 380.61496 L
S
@rax %Note: Object
197.95096 380.61496 197.95209 420.16450 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
197.95153 420.16450 m
197.95153 380.61496 L
S
@rax %Note: Object
404.81065 380.61496 404.81178 420.16450 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
404.81121 420.16450 m
404.81121 380.61496 L
S
@rax %Note: Object
217.20898 380.61496 217.21011 420.16450 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
217.20954 420.16450 m
217.20954 380.61496 L
S
@rax %Note: Object
258.63732 380.61496 258.63846 420.16450 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
258.63789 420.16450 m
258.63789 380.61496 L
S
@rax %Note: Object
238.15814 380.61496 238.15928 420.16450 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
238.15871 420.16450 m
238.15871 380.61496 L
S
@rax %Note: Object
321.29631 380.61496 321.29745 420.16450 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
321.29688 420.16450 m
321.29688 380.61496 L
S
@rax %Note: Object
197.95153 393.20277 404.81121 393.20391 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
197.95153 393.20334 m
404.81121 393.20334 L
S
@rax %Note: Object
321.29688 393.20334 404.81121 405.79143 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
321.29688 405.79143 m
321.29688 393.20334 L
404.81121 393.20334 L
404.81121 405.79143 L
321.29688 405.79143 L
@c
F
@rax 326.74564 395.79250 399.48151 403.09909 @E
[0.00021304 0.00000000 0.00000000 0.00021304 326.74566475 397.05482841] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r2 review >) @t
T
@rax %Note: Object
258.63789 393.20334 321.29688 405.79143 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
258.63789 405.79143 m
258.63789 393.20334 L
321.29688 393.20334 L
321.29688 405.79143 L
258.63789 405.79143 L
@c
F
@rax 264.08636 395.79250 315.92126 403.09909 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.08645147 397.05482841] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t1) @t
T
@rax %Note: Object
238.15871 393.20334 258.63789 405.79143 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
238.15871 405.79143 m
238.15871 393.20334 L
258.63789 393.20334 L
258.63789 405.79143 L
238.15871 405.79143 L
@c
F
@rax 243.60718 395.94217 246.61304 402.60047 @E
[0.00021304 0.00000000 0.00000000 0.00021304 243.60715746 397.24272552] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
217.20954 393.20334 238.15871 405.79143 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
217.20954 405.79143 m
217.20954 393.20334 L
238.15871 393.20334 L
238.15871 405.79143 L
217.20954 405.79143 L
@c
F
@rax 222.65802 395.94217 225.66416 402.60047 @E
[0.00021304 0.00000000 0.00000000 0.00021304 222.65812067 397.24272552] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
197.95153 393.20334 217.20954 405.79143 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
197.95153 405.79143 m
197.95153 393.20334 L
217.20954 393.20334 L
217.20954 405.79143 L
197.95153 405.79143 L
@c
F
@rax 203.40000 395.94217 206.40614 402.60047 @E
[0.00021304 0.00000000 0.00000000 0.00021304 203.40015788 397.24272552] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
321.29688 380.52085 404.90504 393.20334 @E
/$fm 0 def
321.29688 380.52085 m
321.29688 393.20334 L
404.90504 393.20334 L
404.90504 380.52085 L
321.29688 380.52085 L
@c
N
@rax 326.74564 383.20413 399.48151 390.51071 @E
[0.00021304 0.00000000 0.00000000 0.00021304 326.74566475 384.46657402] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r1 review >) @t
T
@rax %Note: Object
321.29688 405.69732 404.90504 420.16450 @E
/$fm 0 def
321.29688 405.69732 m
321.29688 420.16450 L
404.90504 420.16450 L
404.90504 405.69732 L
321.29688 405.69732 L
@c
N
@rax 351.82800 408.58072 374.16019 416.90409 @E
[0.00021304 0.00000000 0.00000000 0.00021304 351.82801195 410.20656111] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($) @t
26457 0 (col1) @t
87191 0 (2) @t
T
@rax %Note: Object
238.15871 380.52085 258.73172 393.20334 @E
/$fm 0 def
238.15871 380.52085 m
238.15871 393.20334 L
258.73172 393.20334 L
258.73172 380.52085 L
238.15871 380.52085 L
@c
N
@rax 243.60718 383.35380 246.61304 390.01238 @E
[0.00021304 0.00000000 0.00000000 0.00021304 243.60715746 384.65447113] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
238.15871 405.69732 258.73172 420.16450 @E
/$fm 0 def
238.15871 405.69732 m
238.15871 420.16450 L
258.73172 420.16450 L
258.73172 405.69732 L
238.15871 405.69732 L
@c
N
@rax 243.60718 408.58072 253.21039 416.90409 @E
[0.00021304 0.00000000 0.00000000 0.00021304 243.60715746 410.20656111] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (LP) @t
T
@rax %Note: Object
258.63789 380.52085 321.39099 393.20334 @E
/$fm 0 def
258.63789 380.52085 m
258.63789 393.20334 L
321.39099 393.20334 L
321.39099 380.52085 L
258.63789 380.52085 L
@c
N
@rax 264.08636 383.20413 315.92126 390.51071 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.08645147 384.46657402] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t2) @t
T
@rax %Note: Object
258.63789 405.69732 321.39099 420.16450 @E
/$fm 0 def
258.63789 405.69732 m
258.63789 420.16450 L
321.39099 420.16450 L
321.39099 405.69732 L
258.63789 405.69732 L
@c
N
@rax 278.74148 408.58072 300.65896 416.90409 @E
[0.00021304 0.00000000 0.00000000 0.00021304 278.74136107 410.20656111] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($) @t
26457 0 (col1) @t
85245 0 (1) @t
T
@rax %Note: Object
217.20954 380.52085 238.25254 393.20334 @E
/$fm 0 def
217.20954 380.52085 m
217.20954 393.20334 L
238.25254 393.20334 L
238.25254 380.52085 L
217.20954 380.52085 L
@c
N
@rax 222.65802 383.35380 225.66416 390.01238 @E
[0.00021304 0.00000000 0.00000000 0.00021304 222.65812067 384.65447113] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
217.20954 405.69732 238.25254 420.16450 @E
/$fm 0 def
217.20954 405.69732 m
217.20954 420.16450 L
238.25254 420.16450 L
238.25254 405.69732 L
217.20954 405.69732 L
@c
N
@rax 222.65802 408.58072 232.67594 416.90409 @E
[0.00021304 0.00000000 0.00000000 0.00021304 222.65812067 410.20656111] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (RP) @t
T
@rax %Note: Object
197.95153 380.52085 217.30365 393.20334 @E
/$fm 0 def
197.95153 380.52085 m
197.95153 393.20334 L
217.30365 393.20334 L
217.30365 380.52085 L
197.95153 380.52085 L
@c
N
@rax 203.40000 383.35380 206.40614 390.01238 @E
[0.00021304 0.00000000 0.00000000 0.00021304 203.40015788 384.65447113] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
197.95153 405.69732 217.30365 420.16450 @E
/$fm 0 def
197.95153 405.69732 m
197.95153 420.16450 L
217.30365 420.16450 L
217.30365 405.69732 L
197.95153 405.69732 L
@c
N
@rax 203.40000 408.58072 211.75228 416.90409 @E
[0.00021304 0.00000000 0.00000000 0.00021304 203.40015788 410.20656111] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
197.95153 420.16394 404.81121 420.16507 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
197.95153 420.16450 m
404.81121 420.16450 L
S
@rax %Note: Object
197.95153 405.79087 404.81121 405.79200 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
197.95153 405.79143 m
404.81121 405.79143 L
S
@rax %Note: Object
197.95153 380.61439 404.81121 380.61553 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
197.95153 380.61496 m
404.81121 380.61496 L
S
@rax %Note: Object
197.95096 380.61496 197.95209 420.16450 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
197.95153 420.16450 m
197.95153 380.61496 L
S
@rax %Note: Object
404.81065 380.61496 404.81178 420.16450 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
404.81121 420.16450 m
404.81121 380.61496 L
S
@rax %Note: Object
217.20898 380.61496 217.21011 420.16450 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
217.20954 420.16450 m
217.20954 380.61496 L
S
@rax %Note: Object
258.63732 380.61496 258.63846 420.16450 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
258.63789 420.16450 m
258.63789 380.61496 L
S
@rax %Note: Object
238.15814 380.61496 238.15928 420.16450 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
238.15871 420.16450 m
238.15871 380.61496 L
S
@rax %Note: Object
321.29631 380.61496 321.29745 420.16450 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
321.29688 420.16450 m
321.29688 380.61496 L
S
@rax %Note: Object
197.95153 393.20277 404.81121 393.20391 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
197.95153 393.20334 m
404.81121 393.20334 L
S
@rax %Note: Object
184.14227 265.53657 260.89228 285.92192 @E
0 O 0 @g
0.24 0.01 0.12 0.00 k
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
184.14227 265.53657 m
184.14227 285.92192 L
260.89228 285.92192 L
260.89228 265.53657 L
184.14227 265.53657 L
@c
B
@rax 195.32126 268.34372 201.58583 283.07339 @E
[0.00021304 0.00000000 0.00000000 0.00021304 195.32122115 270.98502645] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/Symbol 56443.00000 z
0 0 (f) @t
T
@rax 201.52148 267.42983 234.07909 274.08841 @E
[0.00021304 0.00000000 0.00000000 0.00021304 201.52139979 268.73047414] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 ($a, publisher) @t
T
@rax 236.27962 272.69065 249.63619 279.34894 @E
[0.00021304 0.00000000 0.00000000 0.00021304 236.27980918 273.99116722] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 ($col7) @t
T
@rax %Note: Object
216.17631 425.61326 381.13795 445.99833 @E
0 O 0 @g
0.24 0.01 0.12 0.00 k
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
216.17631 425.61326 m
216.17631 445.99833 L
381.13795 445.99833 L
381.13795 425.61326 L
216.17631 425.61326 L
@c
B
@rax 225.47650 428.74214 233.49657 442.05931 @E
[0.00021304 0.00000000 0.00000000 0.00021304 225.47636432 431.34349502] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 56443.00000 z
0 0 (T) @t
T
@rax 233.46142 427.03682 349.99313 433.69512 @E
[0.00021304 0.00000000 0.00000000 0.00021304 233.46156553 428.33735425] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 ($col1) @t
254948 0 (1$col12) @t
T
@rax 355.30384 433.04910 371.66627 439.70740 @E
[0.00021304 0.00000000 0.00000000 0.00021304 355.30389549 434.34963578] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 ($col13) @t
T
@rax %Note: Object
259.38935 487.05109 383.01647 521.33953 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
259.38935 521.33953 m
259.38935 487.05109 L
383.01647 487.05109 L
383.01647 521.33953 L
259.38935 521.33953 L
@c
F
@rax 264.83783 511.34060 314.80072 518.64718 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.83803992 512.60303118] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax 277.80180 504.10687 329.63669 511.41373 @E
[0.00021304 0.00000000 0.00000000 0.00021304 277.80187551 505.36941842] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t1) @t
T
@rax 277.80180 496.87370 346.31093 504.18028 @E
[0.00021304 0.00000000 0.00000000 0.00021304 277.80187551 498.13601869] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r2) @t
T
@rax 264.83783 489.63997 314.80072 496.94655 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.83803992 490.90240593] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax %Note: Object
232.14643 487.05109 259.38935 521.33953 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
232.14643 521.33953 m
232.14643 487.05109 L
259.38935 487.05109 L
259.38935 521.33953 L
232.14643 521.33953 L
@c
F
@rax 237.59490 511.49027 240.60076 518.14885 @E
[0.00021304 0.00000000 0.00000000 0.00021304 237.59487593 512.79092829] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
207.15789 487.05109 232.14643 521.33953 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
207.15789 521.33953 m
207.15789 487.05109 L
232.14643 487.05109 L
232.14643 521.33953 L
207.15789 521.33953 L
@c
F
@rax 212.60636 511.49027 215.61250 518.14885 @E
[0.00021304 0.00000000 0.00000000 0.00021304 212.60647729 512.79092829] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
259.38935 452.66825 383.11058 487.05109 @E
/$fm 0 def
259.38935 452.66825 m
259.38935 487.05109 L
383.11058 487.05109 L
383.11058 452.66825 L
259.38935 452.66825 L
@c
N
@rax 264.83783 477.05187 314.80072 484.35874 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.83803992 478.31436457] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax 277.80180 469.81843 329.63669 477.12501 @E
[0.00021304 0.00000000 0.00000000 0.00021304 277.80187551 471.08075181] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t2) @t
T
@rax 277.80180 462.58498 346.31093 469.89156 @E
[0.00021304 0.00000000 0.00000000 0.00021304 277.80187551 463.84735209] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r1) @t
T
@rax 264.83783 455.35124 314.80072 462.65811 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.83803992 456.61373933] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax %Note: Object
259.38935 521.24570 383.11058 535.71288 @E
/$fm 0 def
259.38935 521.24570 m
259.38935 535.71288 L
383.11058 535.71288 L
383.11058 521.24570 L
259.38935 521.24570 L
@c
N
@rax 310.96346 524.12882 331.41685 532.45219 @E
[0.00021304 0.00000000 0.00000000 0.00021304 310.96337247 525.75476387] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($co) @t
50933 0 (l13) @t
T
@rax %Note: Object
232.14643 452.66825 259.48346 487.05109 @E
/$fm 0 def
232.14643 452.66825 m
232.14643 487.05109 L
259.48346 487.05109 L
259.48346 452.66825 L
232.14643 452.66825 L
@c
N
@rax 237.59490 477.20183 240.60076 483.86013 @E
[0.00021304 0.00000000 0.00000000 0.00021304 237.59487593 478.50226168] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
232.14643 521.24570 259.48346 535.71288 @E
/$fm 0 def
232.14643 521.24570 m
232.14643 535.71288 L
259.48346 535.71288 L
259.48346 521.24570 L
232.14643 521.24570 L
@c
N
@rax 240.78898 524.12882 250.80661 532.45219 @E
[0.00021304 0.00000000 0.00000000 0.00021304 240.78891381 525.75476387] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (RP) @t
T
@rax %Note: Object
207.15789 452.66825 232.24025 487.05109 @E
/$fm 0 def
207.15789 452.66825 m
207.15789 487.05109 L
232.24025 487.05109 L
232.24025 452.66825 L
207.15789 452.66825 L
@c
N
@rax 212.60636 477.20183 215.61250 483.86013 @E
[0.00021304 0.00000000 0.00000000 0.00021304 212.60647729 478.50226168] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
207.15789 521.24570 232.24025 535.71288 @E
/$fm 0 def
207.15789 521.24570 m
207.15789 535.71288 L
232.24025 535.71288 L
232.24025 521.24570 L
207.15789 521.24570 L
@c
N
@rax 215.42457 524.12882 223.77685 532.45219 @E
[0.00021304 0.00000000 0.00000000 0.00021304 215.42472094 525.75476387] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
207.15789 535.71231 383.01647 535.71345 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 535.71288 m
383.01647 535.71288 L
S
@rax %Note: Object
207.15789 521.33896 383.01647 521.34009 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 521.33953 m
383.01647 521.33953 L
S
@rax %Note: Object
207.15789 452.76180 383.01647 452.76293 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 452.76236 m
383.01647 452.76236 L
S
@rax %Note: Object
207.15732 452.76236 207.15846 535.71288 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 535.71288 m
207.15789 452.76236 L
S
@rax %Note: Object
383.01591 452.76236 383.01704 535.71288 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
383.01647 535.71288 m
383.01647 452.76236 L
S
@rax %Note: Object
232.14586 452.76236 232.14699 535.71288 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
232.14643 535.71288 m
232.14643 452.76236 L
S
@rax %Note: Object
259.38879 452.76236 259.38992 535.71288 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
259.38935 535.71288 m
259.38935 452.76236 L
S
@rax %Note: Object
207.15789 487.05052 383.01647 487.05165 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 487.05109 m
383.01647 487.05109 L
S
@rax %Note: Object
259.38935 487.05109 383.01647 521.33953 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
259.38935 521.33953 m
259.38935 487.05109 L
383.01647 487.05109 L
383.01647 521.33953 L
259.38935 521.33953 L
@c
F
@rax 264.83783 511.34060 314.80072 518.64718 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.83803992 512.60303118] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax 277.80180 504.10687 329.63669 511.41373 @E
[0.00021304 0.00000000 0.00000000 0.00021304 277.80187551 505.36941842] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t1) @t
T
@rax 277.80180 496.87370 346.31093 504.18028 @E
[0.00021304 0.00000000 0.00000000 0.00021304 277.80187551 498.13601869] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r2) @t
T
@rax 264.83783 489.63997 314.80072 496.94655 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.83803992 490.90240593] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax %Note: Object
232.14643 487.05109 259.38935 521.33953 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
232.14643 521.33953 m
232.14643 487.05109 L
259.38935 487.05109 L
259.38935 521.33953 L
232.14643 521.33953 L
@c
F
@rax 237.59490 511.49027 240.60076 518.14885 @E
[0.00021304 0.00000000 0.00000000 0.00021304 237.59487593 512.79092829] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
207.15789 487.05109 232.14643 521.33953 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
207.15789 521.33953 m
207.15789 487.05109 L
232.14643 487.05109 L
232.14643 521.33953 L
207.15789 521.33953 L
@c
F
@rax 212.60636 511.49027 215.61250 518.14885 @E
[0.00021304 0.00000000 0.00000000 0.00021304 212.60647729 512.79092829] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (2) @t
T
@rax %Note: Object
259.38935 452.66825 383.11058 487.05109 @E
/$fm 0 def
259.38935 452.66825 m
259.38935 487.05109 L
383.11058 487.05109 L
383.11058 452.66825 L
259.38935 452.66825 L
@c
N
@rax 264.83783 477.05187 314.80072 484.35874 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.83803992 478.31436457] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax 277.80180 469.81843 329.63669 477.12501 @E
[0.00021304 0.00000000 0.00000000 0.00021304 277.80187551 471.08075181] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t2) @t
T
@rax 277.80180 462.58498 346.31093 469.89156 @E
[0.00021304 0.00000000 0.00000000 0.00021304 277.80187551 463.84735209] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r1) @t
T
@rax 264.83783 455.35124 314.80072 462.65811 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.83803992 456.61373933] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax %Note: Object
259.38935 521.24570 383.11058 535.71288 @E
/$fm 0 def
259.38935 521.24570 m
259.38935 535.71288 L
383.11058 535.71288 L
383.11058 521.24570 L
259.38935 521.24570 L
@c
N
@rax 310.96346 524.12882 331.41685 532.45219 @E
[0.00021304 0.00000000 0.00000000 0.00021304 310.96337247 525.75476387] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($co) @t
50933 0 (l13) @t
T
@rax %Note: Object
232.14643 452.66825 259.48346 487.05109 @E
/$fm 0 def
232.14643 452.66825 m
232.14643 487.05109 L
259.48346 487.05109 L
259.48346 452.66825 L
232.14643 452.66825 L
@c
N
@rax 237.59490 477.20183 240.60076 483.86013 @E
[0.00021304 0.00000000 0.00000000 0.00021304 237.59487593 478.50226168] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
232.14643 521.24570 259.48346 535.71288 @E
/$fm 0 def
232.14643 521.24570 m
232.14643 535.71288 L
259.48346 535.71288 L
259.48346 521.24570 L
232.14643 521.24570 L
@c
N
@rax 240.78898 524.12882 250.80661 532.45219 @E
[0.00021304 0.00000000 0.00000000 0.00021304 240.78891381 525.75476387] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (RP) @t
T
@rax %Note: Object
207.15789 452.66825 232.24025 487.05109 @E
/$fm 0 def
207.15789 452.66825 m
207.15789 487.05109 L
232.24025 487.05109 L
232.24025 452.66825 L
207.15789 452.66825 L
@c
N
@rax 212.60636 477.20183 215.61250 483.86013 @E
[0.00021304 0.00000000 0.00000000 0.00021304 212.60647729 478.50226168] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
207.15789 521.24570 232.24025 535.71288 @E
/$fm 0 def
207.15789 521.24570 m
207.15789 535.71288 L
232.24025 535.71288 L
232.24025 521.24570 L
207.15789 521.24570 L
@c
N
@rax 215.42457 524.12882 223.77685 532.45219 @E
[0.00021304 0.00000000 0.00000000 0.00021304 215.42472094 525.75476387] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
207.15789 535.71231 383.01647 535.71345 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 535.71288 m
383.01647 535.71288 L
S
@rax %Note: Object
207.15789 521.33896 383.01647 521.34009 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 521.33953 m
383.01647 521.33953 L
S
@rax %Note: Object
207.15789 452.76180 383.01647 452.76293 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 452.76236 m
383.01647 452.76236 L
S
@rax %Note: Object
207.15732 452.76236 207.15846 535.71288 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 535.71288 m
207.15789 452.76236 L
S
@rax %Note: Object
383.01591 452.76236 383.01704 535.71288 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
383.01647 535.71288 m
383.01647 452.76236 L
S
@rax %Note: Object
232.14586 452.76236 232.14699 535.71288 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
232.14643 535.71288 m
232.14643 452.76236 L
S
@rax %Note: Object
259.38879 452.76236 259.38992 535.71288 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
259.38935 535.71288 m
259.38935 452.76236 L
S
@rax %Note: Object
207.15789 487.05052 383.01647 487.05165 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 487.05109 m
383.01647 487.05109 L
S
@rax %Note: Object
223.97301 261.12104 223.97414 262.24866 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
223.97357 261.12104 m
223.97357 262.24866 L
S
@rax %Note: Object
221.06126 261.96661 226.97943 267.88507 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
226.97943 261.96661 m
223.97357 267.88507 L
221.06126 261.96661 L
226.97943 261.96661 L
@c
F
@rax %Note: Object
271.03833 540.59783 325.24271 560.98290 @E
0 O 0 @g
0.24 0.01 0.12 0.00 k
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
271.03833 540.59783 m
271.03833 560.98290 L
325.24271 560.98290 L
325.24271 540.59783 L
271.03833 540.59783 L
@c
B
@rax 278.08384 543.72671 301.79764 557.04359 @E
[0.00021304 0.00000000 0.00000000 0.00021304 278.08372118 546.32800644] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 56443.00000 z
0 0 (Agg) @t
T
@rax 301.75710 548.03367 318.11953 554.69197 @E
[0.00021304 0.00000000 0.00000000 0.00021304 301.75705307 549.33414721] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 ($col13) @t
T
@rax %Note: Object
295.83808 560.98290 295.83921 562.11024 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
295.83865 560.98290 m
295.83865 562.11024 L
S
@rax %Note: Object
292.92661 561.82847 298.84507 567.74665 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
298.84507 561.82847 m
295.93276 567.74665 L
292.92661 561.82847 L
298.84507 561.82847 L
@c
F
@rax %Note: Object
259.38935 565.39843 383.11058 635.94850 @E
/$fm 0 def
259.38935 565.39843 m
259.38935 635.94850 L
383.11058 635.94850 L
383.11058 565.39843 L
259.38935 565.39843 L
@c
N
@rax 264.83783 589.78176 316.91424 597.08863 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.83803992 591.04432369] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax 279.96265 582.54831 331.79726 589.85490 @E
[0.00021304 0.00000000 0.00000000 0.00021304 279.96269230 583.81071093] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t2) @t
T
@rax 279.96265 575.31487 348.47178 582.62145 @E
[0.00021304 0.00000000 0.00000000 0.00021304 279.96269230 576.57731120] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r1) @t
T
@rax 264.83783 568.08113 314.80072 575.38800 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.83803992 569.34369844] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax %Note: Object
259.38935 635.85439 383.11058 650.32157 @E
/$fm 0 def
259.38935 635.85439 m
259.38935 650.32157 L
383.11058 650.32157 L
383.11058 635.85439 L
259.38935 635.85439 L
@c
N
@rax 310.96346 638.73780 331.41685 647.06117 @E
[0.00021304 0.00000000 0.00000000 0.00021304 310.96337247 640.36369411] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($co) @t
50933 0 (l13) @t
T
@rax %Note: Object
232.14643 565.39843 259.48346 635.94850 @E
/$fm 0 def
232.14643 565.39843 m
232.14643 635.94850 L
259.48346 635.94850 L
259.48346 565.39843 L
232.14643 565.39843 L
@c
N
@rax 237.59490 626.09896 252.38409 632.75754 @E
[0.00021304 0.00000000 0.00000000 0.00021304 237.59487593 627.39964549] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (\1732, 1\175) @t
T
@rax %Note: Object
232.14643 635.85439 259.48346 650.32157 @E
/$fm 0 def
232.14643 635.85439 m
232.14643 650.32157 L
259.48346 650.32157 L
259.48346 635.85439 L
232.14643 635.85439 L
@c
N
@rax 240.78898 638.73780 250.80661 647.06117 @E
[0.00021304 0.00000000 0.00000000 0.00021304 240.78891381 640.36369411] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (RP) @t
T
@rax %Note: Object
207.15789 565.39843 232.24025 635.94850 @E
/$fm 0 def
207.15789 565.39843 m
207.15789 635.94850 L
232.24025 635.94850 L
232.24025 565.39843 L
207.15789 565.39843 L
@c
N
@rax 212.60636 626.09896 215.61250 632.75754 @E
[0.00021304 0.00000000 0.00000000 0.00021304 212.60647729 627.39964549] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
207.15789 635.85439 232.24025 650.32157 @E
/$fm 0 def
207.15789 635.85439 m
207.15789 650.32157 L
232.24025 650.32157 L
232.24025 635.85439 L
207.15789 635.85439 L
@c
N
@rax 215.42457 638.73780 223.77685 647.06117 @E
[0.00021304 0.00000000 0.00000000 0.00021304 215.42472094 640.36369411] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
207.15789 650.32101 383.01647 650.32214 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 650.32157 m
383.01647 650.32157 L
S
@rax %Note: Object
207.15789 635.94794 383.01647 635.94907 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 635.94850 m
383.01647 635.94850 L
S
@rax %Note: Object
207.15789 565.49169 383.01647 565.49282 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 565.49225 m
383.01647 565.49225 L
S
@rax %Note: Object
207.15732 565.49225 207.15846 650.32157 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 650.32157 m
207.15789 565.49225 L
S
@rax %Note: Object
383.01591 565.49225 383.01704 650.32157 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
383.01647 650.32157 m
383.01647 565.49225 L
S
@rax %Note: Object
232.14586 565.49225 232.14699 650.32157 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
232.14643 650.32157 m
232.14643 565.49225 L
S
@rax %Note: Object
259.38879 565.49225 259.38992 650.32157 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
259.38935 650.32157 m
259.38935 565.49225 L
S
@rax %Note: Object
259.38935 565.39843 383.11058 635.94850 @E
/$fm 0 def
259.38935 565.39843 m
259.38935 635.94850 L
383.11058 635.94850 L
383.11058 565.39843 L
259.38935 565.39843 L
@c
N
@rax 264.83783 589.78176 316.91424 597.08863 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.83803992 591.04432369] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax 279.96265 582.54831 331.79726 589.85490 @E
[0.00021304 0.00000000 0.00000000 0.00021304 279.96269230 583.81071093] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t2) @t
T
@rax 279.96265 575.31487 348.47178 582.62145 @E
[0.00021304 0.00000000 0.00000000 0.00021304 279.96269230 576.57731120] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r1) @t
T
@rax 264.83783 568.08113 314.80072 575.38800 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.83803992 569.34369844] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax %Note: Object
259.38935 635.85439 383.11058 650.32157 @E
/$fm 0 def
259.38935 635.85439 m
259.38935 650.32157 L
383.11058 650.32157 L
383.11058 635.85439 L
259.38935 635.85439 L
@c
N
@rax 310.96346 638.73780 331.41685 647.06117 @E
[0.00021304 0.00000000 0.00000000 0.00021304 310.96337247 640.36369411] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($co) @t
50933 0 (l13) @t
T
@rax %Note: Object
232.14643 565.39843 259.48346 635.94850 @E
/$fm 0 def
232.14643 565.39843 m
232.14643 635.94850 L
259.48346 635.94850 L
259.48346 565.39843 L
232.14643 565.39843 L
@c
N
@rax 237.59490 626.09896 252.38409 632.75754 @E
[0.00021304 0.00000000 0.00000000 0.00021304 237.59487593 627.39964549] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (\1732, 1\175) @t
T
@rax %Note: Object
232.14643 635.85439 259.48346 650.32157 @E
/$fm 0 def
232.14643 635.85439 m
232.14643 650.32157 L
259.48346 650.32157 L
259.48346 635.85439 L
232.14643 635.85439 L
@c
N
@rax 240.78898 638.73780 250.80661 647.06117 @E
[0.00021304 0.00000000 0.00000000 0.00021304 240.78891381 640.36369411] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (RP) @t
T
@rax %Note: Object
207.15789 565.39843 232.24025 635.94850 @E
/$fm 0 def
207.15789 565.39843 m
207.15789 635.94850 L
232.24025 635.94850 L
232.24025 565.39843 L
207.15789 565.39843 L
@c
N
@rax 212.60636 626.09896 215.61250 632.75754 @E
[0.00021304 0.00000000 0.00000000 0.00021304 212.60647729 627.39964549] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
207.15789 635.85439 232.24025 650.32157 @E
/$fm 0 def
207.15789 635.85439 m
207.15789 650.32157 L
232.24025 650.32157 L
232.24025 635.85439 L
207.15789 635.85439 L
@c
N
@rax 215.42457 638.73780 223.77685 647.06117 @E
[0.00021304 0.00000000 0.00000000 0.00021304 215.42472094 640.36369411] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
207.15789 650.32101 383.01647 650.32214 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 650.32157 m
383.01647 650.32157 L
S
@rax %Note: Object
207.15789 635.94794 383.01647 635.94907 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 635.94850 m
383.01647 635.94850 L
S
@rax %Note: Object
207.15789 565.49169 383.01647 565.49282 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 565.49225 m
383.01647 565.49225 L
S
@rax %Note: Object
207.15732 565.49225 207.15846 650.32157 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 650.32157 m
207.15789 565.49225 L
S
@rax %Note: Object
383.01591 565.49225 383.01704 650.32157 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
383.01647 650.32157 m
383.01647 565.49225 L
S
@rax %Note: Object
232.14586 565.49225 232.14699 650.32157 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
232.14643 650.32157 m
232.14643 565.49225 L
S
@rax %Note: Object
259.38879 565.49225 259.38992 650.32157 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
259.38935 650.32157 m
259.38935 565.49225 L
S
@rax %Note: Object
236.74961 656.89739 358.59203 677.28274 @E
0 O 0 @g
0.24 0.01 0.12 0.00 k
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
236.74961 656.89739 m
236.74961 677.28274 L
358.59203 677.28274 L
358.59203 656.89739 L
236.74961 656.89739 L
@c
B
@rax 249.33742 660.02655 257.35776 673.34343 @E
[0.00021304 0.00000000 0.00000000 0.00021304 249.33759332 662.62779766] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 56443.00000 z
0 0 (T) @t
T
@rax 257.32290 658.32123 322.65468 664.97953 @E
[0.00021304 0.00000000 0.00000000 0.00021304 257.32279453 659.62165689] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 ($col13 Result >) @t
T
@rax 327.87269 660.67682 332.38205 670.66469 @E
[0.00021304 0.00000000 0.00000000 0.00021304 327.87283439 662.62779766] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 42332.00000 z
0 0 ($) @t
T
@rax 332.38205 664.33351 345.73861 670.99181 @E
[0.00021304 0.00000000 0.00000000 0.00021304 332.38215205 665.63393842] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (col14) @t
T
@rax %Note: Object
259.38935 682.54356 383.11058 767.56082 @E
/$fm 0 def
259.38935 682.54356 m
259.38935 767.56082 L
383.11058 767.56082 L
383.11058 682.54356 L
259.38935 682.54356 L
@c
N
@rax 264.83783 757.56161 293.24778 764.86847 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.83803992 758.82408909] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax 273.48066 714.16063 323.44328 721.46721 @E
[0.00021304 0.00000000 0.00000000 0.00021304 273.48066799 715.42305163] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax 277.80180 706.92718 331.74992 714.23405 @E
[0.00021304 0.00000000 0.00000000 0.00021304 277.80187551 708.18965191] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t2 ) @t
T
@rax 277.80180 699.69373 348.42444 707.00031 @E
[0.00021304 0.00000000 0.00000000 0.00021304 277.80187551 700.95603915] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r1) @t
T
@rax 264.83783 692.46028 314.80072 699.76687 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.83803992 693.72263942] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax 264.83783 685.22655 295.97839 692.53342 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.83803992 686.48902666] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax %Note: Object
259.38935 767.46671 383.11058 781.93361 @E
/$fm 0 def
259.38935 767.46671 m
259.38935 781.93361 L
383.11058 781.93361 L
383.11058 767.46671 L
259.38935 767.46671 L
@c
N
@rax 310.96346 770.35011 331.41685 778.67348 @E
[0.00021304 0.00000000 0.00000000 0.00021304 310.96337247 771.97603482] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($co) @t
50933 0 (l14) @t
T
@rax %Note: Object
232.14643 682.54356 259.48346 767.56082 @E
/$fm 0 def
232.14643 682.54356 m
232.14643 767.56082 L
259.48346 767.56082 L
259.48346 682.54356 L
232.14643 682.54356 L
@c
N
@rax 237.59490 757.71156 240.60076 764.36986 @E
[0.00021304 0.00000000 0.00000000 0.00021304 237.59487593 759.01198620] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
232.14643 767.46671 259.48346 781.93361 @E
/$fm 0 def
232.14643 767.46671 m
232.14643 781.93361 L
259.48346 781.93361 L
259.48346 767.46671 L
232.14643 767.46671 L
@c
N
@rax 240.78898 770.35011 250.80661 778.67348 @E
[0.00021304 0.00000000 0.00000000 0.00021304 240.78891381 771.97603482] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (RP) @t
T
@rax %Note: Object
207.15789 682.54356 232.24025 767.56082 @E
/$fm 0 def
207.15789 682.54356 m
207.15789 767.56082 L
232.24025 767.56082 L
232.24025 682.54356 L
207.15789 682.54356 L
@c
N
@rax 212.60636 757.71156 215.61250 764.36986 @E
[0.00021304 0.00000000 0.00000000 0.00021304 212.60647729 759.01198620] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
207.15789 767.46671 232.24025 781.93361 @E
/$fm 0 def
207.15789 767.46671 m
207.15789 781.93361 L
232.24025 781.93361 L
232.24025 767.46671 L
207.15789 767.46671 L
@c
N
@rax 215.42457 770.35011 223.77685 778.67348 @E
[0.00021304 0.00000000 0.00000000 0.00021304 215.42472094 771.97603482] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
207.15789 781.93304 383.01647 781.93417 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 781.93361 m
383.01647 781.93361 L
S
@rax %Note: Object
207.15789 767.56025 383.01647 767.56139 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 767.56082 m
383.01647 767.56082 L
S
@rax %Note: Object
207.15789 682.63682 383.01647 682.63795 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 682.63739 m
383.01647 682.63739 L
S
@rax %Note: Object
207.15732 682.63739 207.15846 781.93361 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 781.93361 m
207.15789 682.63739 L
S
@rax %Note: Object
383.01591 682.63739 383.01704 781.93361 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
383.01647 781.93361 m
383.01647 682.63739 L
S
@rax %Note: Object
232.14586 682.63739 232.14699 781.93361 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
232.14643 781.93361 m
232.14643 682.63739 L
S
@rax %Note: Object
259.38879 682.63739 259.38992 781.93361 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
259.38935 781.93361 m
259.38935 682.63739 L
S
@rax %Note: Object
259.38935 682.54356 383.11058 767.56082 @E
/$fm 0 def
259.38935 682.54356 m
259.38935 767.56082 L
383.11058 767.56082 L
383.11058 682.54356 L
259.38935 682.54356 L
@c
N
@rax 264.83783 757.56161 293.24778 764.86847 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.83803992 758.82408909] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax 273.48066 714.16063 323.44328 721.46721 @E
[0.00021304 0.00000000 0.00000000 0.00021304 273.48066799 715.42305163] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax 277.80180 706.92718 331.74992 714.23405 @E
[0.00021304 0.00000000 0.00000000 0.00021304 277.80187551 708.18965191] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t2 ) @t
T
@rax 277.80180 699.69373 348.42444 707.00031 @E
[0.00021304 0.00000000 0.00000000 0.00021304 277.80187551 700.95603915] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r1) @t
T
@rax 264.83783 692.46028 314.80072 699.76687 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.83803992 693.72263942] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax 264.83783 685.22655 295.97839 692.53342 @E
[0.00021304 0.00000000 0.00000000 0.00021304 264.83803992 686.48902666] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax %Note: Object
259.38935 767.46671 383.11058 781.93361 @E
/$fm 0 def
259.38935 767.46671 m
259.38935 781.93361 L
383.11058 781.93361 L
383.11058 767.46671 L
259.38935 767.46671 L
@c
N
@rax 310.96346 770.35011 331.41685 778.67348 @E
[0.00021304 0.00000000 0.00000000 0.00021304 310.96337247 771.97603482] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 ($co) @t
50933 0 (l14) @t
T
@rax %Note: Object
232.14643 682.54356 259.48346 767.56082 @E
/$fm 0 def
232.14643 682.54356 m
232.14643 767.56082 L
259.48346 767.56082 L
259.48346 682.54356 L
232.14643 682.54356 L
@c
N
@rax 237.59490 757.71156 240.60076 764.36986 @E
[0.00021304 0.00000000 0.00000000 0.00021304 237.59487593 759.01198620] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
232.14643 767.46671 259.48346 781.93361 @E
/$fm 0 def
232.14643 767.46671 m
232.14643 781.93361 L
259.48346 781.93361 L
259.48346 767.46671 L
232.14643 767.46671 L
@c
N
@rax 240.78898 770.35011 250.80661 778.67348 @E
[0.00021304 0.00000000 0.00000000 0.00021304 240.78891381 771.97603482] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (RP) @t
T
@rax %Note: Object
207.15789 682.54356 232.24025 767.56082 @E
/$fm 0 def
207.15789 682.54356 m
207.15789 767.56082 L
232.24025 767.56082 L
232.24025 682.54356 L
207.15789 682.54356 L
@c
N
@rax 212.60636 757.71156 215.61250 764.36986 @E
[0.00021304 0.00000000 0.00000000 0.00021304 212.60647729 759.01198620] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
207.15789 767.46671 232.24025 781.93361 @E
/$fm 0 def
207.15789 767.46671 m
207.15789 781.93361 L
232.24025 781.93361 L
232.24025 767.46671 L
207.15789 767.46671 L
@c
N
@rax 215.42457 770.35011 223.77685 778.67348 @E
[0.00021304 0.00000000 0.00000000 0.00021304 215.42472094 771.97603482] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman-Bold 35277.00000 z
0 0 (ID) @t
T
@rax %Note: Object
207.15789 781.93304 383.01647 781.93417 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 781.93361 m
383.01647 781.93361 L
S
@rax %Note: Object
207.15789 767.56025 383.01647 767.56139 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 767.56082 m
383.01647 767.56082 L
S
@rax %Note: Object
207.15789 682.63682 383.01647 682.63795 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 682.63739 m
383.01647 682.63739 L
S
@rax %Note: Object
207.15732 682.63739 207.15846 781.93361 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
207.15789 781.93361 m
207.15789 682.63739 L
S
@rax %Note: Object
383.01591 682.63739 383.01704 781.93361 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
383.01647 781.93361 m
383.01647 682.63739 L
S
@rax %Note: Object
232.14586 682.63739 232.14699 781.93361 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
232.14643 781.93361 m
232.14643 682.63739 L
S
@rax %Note: Object
259.38879 682.63739 259.38992 781.93361 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
259.38935 781.93361 m
259.38935 682.63739 L
S
@rax %Note: Object
297.34129 677.28274 297.34243 678.41008 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
297.34186 677.28274 m
297.34186 678.41008 L
S
@rax %Note: Object
294.42954 678.12831 300.34800 684.04649 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
300.34800 678.12831 m
297.43597 684.04649 L
294.42954 678.12831 L
300.34800 678.12831 L
@c
F
@rax %Note: Object
24.81704 58.86454 169.20539 92.02620 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
24.81704 58.86454 m
24.81704 92.02620 L
169.20539 92.02620 L
169.20539 58.86454 L
24.81704 58.86454 L
@c
S
@rax 30.54756 80.16066 70.76835 88.48375 @E
[0.00021304 0.00000000 0.00000000 0.00021304 30.54759652 81.78648148] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Chan) @t
74463 0 (geT) @t
128065 0 (up) @t
163341 0 (le) @t
T
@rax 71.13033 80.16066 73.63304 88.48375 @E
[0.00021304 0.00000000 0.00000000 0.00021304 71.13039032 81.78648148] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (\050) @t
T
@rax 73.66677 80.16066 106.63710 88.48375 @E
[0.00021304 0.00000000 0.00000000 0.00021304 73.66678830 81.78648148] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Chan) @t
74463 0 (geEle) @t
T
@rax 108.51902 80.16066 149.34643 88.48375 @E
[0.00021304 0.00000000 0.00000000 0.00021304 108.51914624 81.78648148] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (\050) @t
T
@rax 30.54756 71.14224 54.20523 79.46561 @E
[0.00021304 0.00000000 0.00000000 0.00021304 30.54759652 72.76805918] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Mor) @t
60117 0 (gan) @t
T
@rax 56.28756 71.14224 88.00668 79.46561 @E
[0.00021304 0.00000000 0.00000000 0.00021304 56.28758361 72.76805918] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Kaufman) @t
131253 0 (n) @t
T
@rax 89.91865 71.14224 161.64709 79.46561 @E
[0.00021304 0.00000000 0.00000000 0.00021304 89.91861032 72.76805918] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Pub) @t
54896 0 (lishers
) @t
T
@rax 30.54756 62.12409 135.11622 70.44718 @E
[0.00021304 0.00000000 0.00000000 0.00021304 30.54759652 63.74984993] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (, bo) @t
52914 0 (ok) @t
88190 0 (\1331\135.p) @t
155779 0 (ub) @t
191055 0 (lisher\1331) @t
298813 0 (\135:bib) @t
365438 0 (\051, $s1) @t
443828 0 (, 1\051) @t
T
@rax %Note: Object
190.24838 24.10639 190.81191 24.66992 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
190.62397 24.66992 m
190.53043 24.66992 L
190.43631 24.57609 L
190.34220 24.48227 L
190.24838 24.38816 L
190.24838 24.38816 L
190.34220 24.29405 L
190.43631 24.20022 L
190.53043 24.10639 L
190.53043 24.10639 L
190.53043 24.10639 L
190.62397 24.20022 L
190.71780 24.29405 L
190.81191 24.38816 L
190.81191 24.38816 L
190.71780 24.48227 L
190.62397 24.57609 L
190.62397 24.66992 L
@c
F
@rax %Note: Object
191.37543 24.10639 191.93924 24.66992 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
191.65748 24.66992 m
191.56365 24.66992 L
191.46954 24.57609 L
191.37543 24.48227 L
191.37543 24.38816 L
191.37543 24.29405 L
191.37543 24.20022 L
191.46954 24.10639 L
191.56365 24.10639 L
191.65748 24.10639 L
191.65748 24.10639 L
191.75131 24.20022 L
191.84542 24.29405 L
191.93924 24.38816 L
191.93924 24.38816 L
191.84542 24.48227 L
191.75131 24.57609 L
191.75131 24.66992 L
191.65748 24.66992 L
@c
F
@rax %Note: Object
191.84542 21.38202 197.66976 27.30047 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
191.84542 21.38202 m
197.66976 24.38816 L
191.84542 27.30047 L
191.84542 21.38202 L
@c
F
@rax %Note: Object
22.18677 10.76683 190.62397 34.90980 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
22.18677 10.76683 m
22.18677 34.90980 L
190.62397 34.90980 L
190.62397 10.76683 L
22.18677 10.76683 L
@c
S
@rax 27.91729 23.04425 60.88734 31.36734 @E
[0.00021304 0.00000000 0.00000000 0.00021304 27.91724998 24.67001999] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Chan) @t
74463 0 (geEle) @t
T
@rax 62.76954 23.04425 127.25433 31.36734 @E
[0.00021304 0.00000000 0.00000000 0.00021304 62.76960792 24.67001999] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (\050 Mor) @t
251762 0 (gan) @t
T
@rax 129.46819 23.04425 161.18731 31.36734 @E
[0.00021304 0.00000000 0.00000000 0.00021304 129.46818304 24.67001999] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Kaufman) @t
131253 0 (n) @t
T
@rax 27.91729 14.02583 178.12063 22.34891 @E
[0.00021304 0.00000000 0.00000000 0.00021304 27.91724998 15.65159769] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Pub) @t
54896 0 (lishers,) @t
345516 0 (bo) @t
380792 0 (ok) @t
416068 0 (\1331\135.p) @t
483657 0 (ub) @t
518933 0 (lisher\1331) @t
626691 0 (\135:bib) @t
693316 0 (\051) @t
T
@rax %Note: Object
385.17704 62.90447 466.81257 75.58639 @E
/$fm 0 def
385.17704 62.90447 m
385.17704 75.58639 L
466.81257 75.58639 L
466.81257 62.90447 L
385.17704 62.90447 L
@c
N
@rax 390.62608 65.58718 461.57811 72.89405 @E
[0.00021304 0.00000000 0.00000000 0.00021304 390.62599621 66.84972621] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r) @t
T
@rax %Note: Object
385.17704 75.49257 466.81257 89.11417 @E
/$fm 0 def
385.17704 75.49257 m
385.17704 89.11417 L
466.81257 89.11417 L
466.81257 75.49257 L
385.17704 75.49257 L
@c
N
@rax 419.84192 79.11496 431.95805 86.42183 @E
[0.00021304 0.00000000 0.00000000 0.00021304 419.84186685 80.37746617] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana-Bold 28221.00000 z
0 0 ($s2) @t
T
@rax %Note: Object
366.01313 62.90447 385.27115 75.58639 @E
/$fm 0 def
366.01313 62.90447 m
366.01313 75.58639 L
385.27115 75.58639 L
385.27115 62.90447 L
366.01313 62.90447 L
@c
N
@rax 371.46189 65.58718 375.28356 72.89405 @E
[0.00021304 0.00000000 0.00000000 0.00021304 371.46176895 66.84972621] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
366.01313 75.49257 385.27115 89.11417 @E
/$fm 0 def
366.01313 75.49257 m
366.01313 89.11417 L
385.27115 89.11417 L
385.27115 75.49257 L
366.01313 75.49257 L
@c
N
@rax 371.46189 79.11496 379.73339 86.42183 @E
[0.00021304 0.00000000 0.00000000 0.00021304 371.46176895 80.37746617] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana-Bold 28221.00000 z
0 0 (ID) @t
T
@rax %Note: Object
366.01313 89.11361 466.71874 89.11474 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
366.01313 89.11417 m
466.71874 89.11417 L
S
@rax %Note: Object
366.01313 75.58583 466.71874 75.58696 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
366.01313 75.58639 m
466.71874 75.58639 L
S
@rax %Note: Object
366.01313 62.99773 466.71874 62.99887 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
366.01313 62.99830 m
466.71874 62.99830 L
S
@rax %Note: Object
366.01257 62.99830 366.01370 89.11417 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
366.01313 89.11417 m
366.01313 62.99830 L
S
@rax %Note: Object
466.71817 62.99830 466.71931 89.11417 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
466.71874 89.11417 m
466.71874 62.99830 L
S
@rax %Note: Object
385.17647 62.99830 385.17761 89.11417 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
385.17704 89.11417 m
385.17704 62.99830 L
S
@rax %Note: Object
385.17704 62.90447 466.81257 75.58639 @E
/$fm 0 def
385.17704 62.90447 m
385.17704 75.58639 L
466.81257 75.58639 L
466.81257 62.90447 L
385.17704 62.90447 L
@c
N
@rax 390.62608 65.58718 461.57811 72.89405 @E
[0.00021304 0.00000000 0.00000000 0.00021304 390.62599621 66.84972621] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r) @t
T
@rax %Note: Object
385.17704 75.49257 466.81257 89.11417 @E
/$fm 0 def
385.17704 75.49257 m
385.17704 89.11417 L
466.81257 89.11417 L
466.81257 75.49257 L
385.17704 75.49257 L
@c
N
@rax 419.84192 79.11496 431.95805 86.42183 @E
[0.00021304 0.00000000 0.00000000 0.00021304 419.84186685 80.37746617] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana-Bold 28221.00000 z
0 0 ($s2) @t
T
@rax %Note: Object
366.01313 62.90447 385.27115 75.58639 @E
/$fm 0 def
366.01313 62.90447 m
366.01313 75.58639 L
385.27115 75.58639 L
385.27115 62.90447 L
366.01313 62.90447 L
@c
N
@rax 371.46189 65.58718 375.28356 72.89405 @E
[0.00021304 0.00000000 0.00000000 0.00021304 371.46176895 66.84972621] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
366.01313 75.49257 385.27115 89.11417 @E
/$fm 0 def
366.01313 75.49257 m
366.01313 89.11417 L
385.27115 89.11417 L
385.27115 75.49257 L
366.01313 75.49257 L
@c
N
@rax 371.46189 79.11496 379.73339 86.42183 @E
[0.00021304 0.00000000 0.00000000 0.00021304 371.46176895 80.37746617] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana-Bold 28221.00000 z
0 0 (ID) @t
T
@rax %Note: Object
366.01313 89.11361 466.71874 89.11474 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
366.01313 89.11417 m
466.71874 89.11417 L
S
@rax %Note: Object
366.01313 75.58583 466.71874 75.58696 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
366.01313 75.58639 m
466.71874 75.58639 L
S
@rax %Note: Object
366.01313 62.99773 466.71874 62.99887 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
366.01313 62.99830 m
466.71874 62.99830 L
S
@rax %Note: Object
366.01257 62.99830 366.01370 89.11417 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
366.01313 89.11417 m
366.01313 62.99830 L
S
@rax %Note: Object
466.71817 62.99830 466.71931 89.11417 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
466.71874 89.11417 m
466.71874 62.99830 L
S
@rax %Note: Object
385.17647 62.99830 385.17761 89.11417 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
385.17704 89.11417 m
385.17704 62.99830 L
S
@rax %Note: Object
205.09087 62.99830 260.42258 75.58639 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
205.09087 75.58639 m
205.09087 62.99830 L
260.42258 62.99830 L
260.42258 75.58639 L
205.09087 75.58639 L
@c
F
@rax 210.53962 65.58718 254.97609 72.89405 @E
[0.00021304 0.00000000 0.00000000 0.00021304 210.53982209 66.84972621] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (b) @t
T
@rax %Note: Object
205.09087 75.49257 260.51669 89.11417 @E
/$fm 0 def
205.09087 75.49257 m
205.09087 89.11417 L
260.51669 89.11417 L
260.51669 75.49257 L
205.09087 75.49257 L
@c
N
@rax 226.60384 79.11496 238.71997 86.42183 @E
[0.00021304 0.00000000 0.00000000 0.00021304 226.60374699 80.37746617] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana-Bold 28221.00000 z
0 0 ($s1) @t
T
@rax %Note: Object
185.92696 62.90447 205.18498 75.58639 @E
/$fm 0 def
185.92696 62.90447 m
185.92696 75.58639 L
205.18498 75.58639 L
205.18498 62.90447 L
185.92696 62.90447 L
@c
N
@rax 191.37543 65.58718 195.19710 72.89405 @E
[0.00021304 0.00000000 0.00000000 0.00021304 191.37559483 66.84972621] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
185.92696 75.49257 205.18498 89.11417 @E
/$fm 0 def
185.92696 75.49257 m
185.92696 89.11417 L
205.18498 89.11417 L
205.18498 75.49257 L
185.92696 75.49257 L
@c
N
@rax 191.37543 79.11496 199.64721 86.42183 @E
[0.00021304 0.00000000 0.00000000 0.00021304 191.37559483 80.37746617] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana-Bold 28221.00000 z
0 0 (ID) @t
T
@rax %Note: Object
185.92696 89.11361 260.42258 89.11474 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
185.92696 89.11417 m
260.42258 89.11417 L
S
@rax %Note: Object
185.92696 75.58583 260.42258 75.58696 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
185.92696 75.58639 m
260.42258 75.58639 L
S
@rax %Note: Object
185.92696 62.99773 260.42258 62.99887 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
185.92696 62.99830 m
260.42258 62.99830 L
S
@rax %Note: Object
185.92639 62.99830 185.92753 89.11417 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
185.92696 89.11417 m
185.92696 62.99830 L
S
@rax %Note: Object
260.42202 62.99830 260.42315 89.11417 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
260.42258 89.11417 m
260.42258 62.99830 L
S
@rax %Note: Object
205.09030 62.99830 205.09143 89.11417 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
205.09087 89.11417 m
205.09087 62.99830 L
S
@rax %Note: Object
205.09087 62.99830 260.42258 75.58639 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
205.09087 75.58639 m
205.09087 62.99830 L
260.42258 62.99830 L
260.42258 75.58639 L
205.09087 75.58639 L
@c
F
@rax 210.53962 65.58718 254.97609 72.89405 @E
[0.00021304 0.00000000 0.00000000 0.00021304 210.53982209 66.84972621] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (b) @t
T
@rax %Note: Object
205.09087 75.49257 260.51669 89.11417 @E
/$fm 0 def
205.09087 75.49257 m
205.09087 89.11417 L
260.51669 89.11417 L
260.51669 75.49257 L
205.09087 75.49257 L
@c
N
@rax 226.60384 79.11496 238.71997 86.42183 @E
[0.00021304 0.00000000 0.00000000 0.00021304 226.60374699 80.37746617] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana-Bold 28221.00000 z
0 0 ($s1) @t
T
@rax %Note: Object
185.92696 62.90447 205.18498 75.58639 @E
/$fm 0 def
185.92696 62.90447 m
185.92696 75.58639 L
205.18498 75.58639 L
205.18498 62.90447 L
185.92696 62.90447 L
@c
N
@rax 191.37543 65.58718 195.19710 72.89405 @E
[0.00021304 0.00000000 0.00000000 0.00021304 191.37559483 66.84972621] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (1) @t
T
@rax %Note: Object
185.92696 75.49257 205.18498 89.11417 @E
/$fm 0 def
185.92696 75.49257 m
185.92696 89.11417 L
205.18498 89.11417 L
205.18498 75.49257 L
185.92696 75.49257 L
@c
N
@rax 191.37543 79.11496 199.64721 86.42183 @E
[0.00021304 0.00000000 0.00000000 0.00021304 191.37559483 80.37746617] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana-Bold 28221.00000 z
0 0 (ID) @t
T
@rax %Note: Object
185.92696 89.11361 260.42258 89.11474 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
185.92696 89.11417 m
260.42258 89.11417 L
S
@rax %Note: Object
185.92696 75.58583 260.42258 75.58696 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
185.92696 75.58639 m
260.42258 75.58639 L
S
@rax %Note: Object
185.92696 62.99773 260.42258 62.99887 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
185.92696 62.99830 m
260.42258 62.99830 L
S
@rax %Note: Object
185.92639 62.99830 185.92753 89.11417 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
185.92696 89.11417 m
185.92696 62.99830 L
S
@rax %Note: Object
260.42202 62.99830 260.42315 89.11417 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
260.42258 89.11417 m
260.42258 62.99830 L
S
@rax %Note: Object
205.09030 62.99830 205.09143 89.11417 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.99978 0.99978 0.00000 @w
/$fm 0 def
205.09087 89.11417 m
205.09087 62.99830 L
S
@rax %Note: Object
168.82951 69.19852 169.39332 69.76176 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
169.20539 69.76176 m
169.11156 69.76176 L
169.01773 69.66794 L
168.92362 69.57439 L
168.82951 69.48028 L
168.82951 69.48028 L
168.92362 69.38646 L
169.01773 69.29235 L
169.11156 69.19852 L
169.11156 69.19852 L
169.11156 69.19852 L
169.20539 69.29235 L
169.29950 69.38646 L
169.39332 69.48028 L
169.39332 69.48028 L
169.29950 69.57439 L
169.20539 69.66794 L
169.20539 69.76176 L
@c
F
@rax %Note: Object
169.95685 69.19852 170.52038 69.76176 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
170.23861 69.76176 m
170.14507 69.76176 L
170.05096 69.66794 L
169.95685 69.57439 L
169.95685 69.48028 L
169.95685 69.38646 L
169.95685 69.29235 L
170.05096 69.19852 L
170.14507 69.19852 L
170.23861 69.19852 L
170.23861 69.19852 L
170.33272 69.29235 L
170.42655 69.38646 L
170.52038 69.48028 L
170.52038 69.48028 L
170.42655 69.57439 L
170.33272 69.66794 L
170.33272 69.76176 L
170.23861 69.76176 L
@c
F
@rax %Note: Object
171.08419 69.19852 171.64772 69.76176 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
171.36624 69.76176 m
171.27213 69.76176 L
171.17802 69.66794 L
171.08419 69.57439 L
171.08419 69.48028 L
171.08419 69.38646 L
171.08419 69.29235 L
171.17802 69.19852 L
171.27213 69.19852 L
171.36624 69.19852 L
171.36624 69.19852 L
171.46006 69.29235 L
171.55389 69.38646 L
171.64772 69.48028 L
171.64772 69.48028 L
171.55389 69.57439 L
171.46006 69.66794 L
171.46006 69.76176 L
171.36624 69.76176 L
@c
F
@rax %Note: Object
172.21153 69.19852 172.77506 69.76176 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
172.49357 69.76176 m
172.39946 69.76176 L
172.30564 69.66794 L
172.21153 69.57439 L
172.21153 69.48028 L
172.21153 69.38646 L
172.21153 69.29235 L
172.30564 69.19852 L
172.39946 69.19852 L
172.49357 69.19852 L
172.49357 69.19852 L
172.58740 69.29235 L
172.68123 69.38646 L
172.77506 69.48028 L
172.77506 69.48028 L
172.68123 69.57439 L
172.58740 69.66794 L
172.58740 69.76176 L
172.49357 69.76176 L
@c
F
@rax %Note: Object
173.33858 69.19852 173.90239 69.76176 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
173.62063 69.76176 m
173.52680 69.76176 L
173.43269 69.66794 L
173.33858 69.57439 L
173.33858 69.48028 L
173.33858 69.38646 L
173.33858 69.29235 L
173.43269 69.19852 L
173.52680 69.19852 L
173.62063 69.19852 L
173.62063 69.19852 L
173.71446 69.29235 L
173.80828 69.38646 L
173.90239 69.48028 L
173.90239 69.48028 L
173.80828 69.57439 L
173.71446 69.66794 L
173.71446 69.76176 L
173.62063 69.76176 L
@c
F
@rax %Note: Object
174.46620 69.19852 175.03002 69.76176 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
174.74797 69.76176 m
174.65414 69.76176 L
174.56031 69.66794 L
174.46620 69.57439 L
174.46620 69.48028 L
174.46620 69.38646 L
174.46620 69.29235 L
174.56031 69.19852 L
174.65414 69.19852 L
174.74797 69.19852 L
174.74797 69.19852 L
174.84180 69.29235 L
174.93591 69.38646 L
175.03002 69.48028 L
175.03002 69.48028 L
174.93591 69.57439 L
174.84180 69.66794 L
174.84180 69.76176 L
174.74797 69.76176 L
@c
F
@rax %Note: Object
175.59354 69.19852 176.15707 69.76176 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
175.87531 69.76176 m
175.78148 69.76176 L
175.68765 69.66794 L
175.59354 69.57439 L
175.59354 69.48028 L
175.59354 69.38646 L
175.59354 69.29235 L
175.68765 69.19852 L
175.78148 69.19852 L
175.87531 69.19852 L
175.87531 69.19852 L
175.96913 69.29235 L
176.06296 69.38646 L
176.15707 69.48028 L
176.15707 69.48028 L
176.06296 69.57439 L
175.96913 69.66794 L
175.96913 69.76176 L
175.87531 69.76176 L
@c
F
@rax %Note: Object
176.72088 69.19852 177.28441 69.76176 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
177.00236 69.76176 m
176.90854 69.76176 L
176.81471 69.66794 L
176.72088 69.57439 L
176.72088 69.48028 L
176.72088 69.38646 L
176.72088 69.29235 L
176.81471 69.19852 L
176.90854 69.19852 L
177.00236 69.19852 L
177.00236 69.19852 L
177.09647 69.29235 L
177.19030 69.38646 L
177.28441 69.48028 L
177.28441 69.48028 L
177.19030 69.57439 L
177.09647 69.66794 L
177.09647 69.76176 L
177.00236 69.76176 L
@c
F
@rax %Note: Object
177.84822 69.19852 178.41175 69.76176 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
178.12998 69.76176 m
178.03587 69.76176 L
177.94205 69.66794 L
177.84822 69.57439 L
177.84822 69.48028 L
177.84822 69.38646 L
177.84822 69.29235 L
177.94205 69.19852 L
178.03587 69.19852 L
178.12998 69.19852 L
178.12998 69.19852 L
178.22381 69.29235 L
178.31792 69.38646 L
178.41175 69.48028 L
178.41175 69.48028 L
178.31792 69.57439 L
178.22381 69.66794 L
178.22381 69.76176 L
178.12998 69.76176 L
@c
F
@rax %Note: Object
178.97528 69.19852 179.53909 69.76176 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
179.25704 69.76176 m
179.16321 69.76176 L
179.06910 69.66794 L
178.97528 69.57439 L
178.97528 69.48028 L
178.97528 69.38646 L
178.97528 69.29235 L
179.06910 69.19852 L
179.16321 69.19852 L
179.25704 69.19852 L
179.25704 69.19852 L
179.35087 69.29235 L
179.44498 69.38646 L
179.53909 69.48028 L
179.53909 69.48028 L
179.44498 69.57439 L
179.35087 69.66794 L
179.35087 69.76176 L
179.25704 69.76176 L
@c
F
@rax %Note: Object
180.10261 69.19852 180.66643 69.76176 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
180.38438 69.76176 m
180.29055 69.76176 L
180.19672 69.66794 L
180.10261 69.57439 L
180.10261 69.48028 L
180.10261 69.38646 L
180.10261 69.29235 L
180.19672 69.19852 L
180.29055 69.19852 L
180.38438 69.19852 L
180.38438 69.19852 L
180.47820 69.29235 L
180.57260 69.38646 L
180.66643 69.48028 L
180.66643 69.48028 L
180.57260 69.57439 L
180.47820 69.66794 L
180.47820 69.76176 L
180.38438 69.76176 L
@c
F
@rax %Note: Object
181.32406 66.47414 187.14841 72.39260 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
181.32406 66.47414 m
187.14841 69.48028 L
181.32406 72.39260 L
181.32406 66.47414 L
@c
F
@rax %Note: Object
20.30769 135.52129 164.69631 168.68268 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
20.30769 135.52129 m
20.30769 168.68268 L
164.69631 168.68268 L
164.69631 135.52129 L
20.30769 135.52129 L
@c
S
@rax 26.03820 156.81713 66.25899 165.14050 @E
[0.00021304 0.00000000 0.00000000 0.00021304 26.03827885 158.44296445] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Chan) @t
74463 0 (geT) @t
128065 0 (up) @t
163341 0 (le) @t
T
@rax 66.62098 156.81713 69.12369 165.14050 @E
[0.00021304 0.00000000 0.00000000 0.00021304 66.62107265 158.44296445] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (\050) @t
T
@rax 69.15742 156.81713 102.12775 165.14050 @E
[0.00021304 0.00000000 0.00000000 0.00021304 69.15747064 158.44296445] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Chan) @t
74463 0 (geEle) @t
T
@rax 104.00995 156.81713 144.83707 165.14050 @E
[0.00021304 0.00000000 0.00000000 0.00021304 104.00982858 158.44296445] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (\050) @t
T
@rax 26.03820 147.79871 49.69587 156.12208 @E
[0.00021304 0.00000000 0.00000000 0.00021304 26.03827885 149.42454216] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Mor) @t
60117 0 (gan) @t
T
@rax 51.77820 147.79871 83.49732 156.12208 @E
[0.00021304 0.00000000 0.00000000 0.00021304 51.77826595 149.42454216] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Kaufman) @t
131253 0 (n) @t
T
@rax 85.40957 147.79871 157.13773 156.12208 @E
[0.00021304 0.00000000 0.00000000 0.00021304 85.40950569 149.42454216] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Pub) @t
54896 0 (lishers) @t
T
@rax 26.03820 138.78028 105.13701 147.10365 @E
[0.00021304 0.00000000 0.00000000 0.00021304 26.03827885 140.40611987] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (,pu) @t
44095 0 (blish) @t
112702 0 (er\1331\135:b) @t
208677 0 (oo) @t
243953 0 (k\051,) @t
290976 0 ($a,) @t
341909 0 (1\051) @t
T
@rax %Note: Object
18.05329 203.15934 127.49528 254.35729 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
18.05329 203.15934 m
18.05329 254.35729 L
127.49528 254.35729 L
127.49528 203.15934 L
18.05329 203.15934 L
@c
S
@rax 23.78353 242.49175 64.00460 250.81512 @E
[0.00021304 0.00000000 0.00000000 0.00021304 23.78372654 244.11765669] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Chan) @t
74463 0 (geT) @t
128065 0 (up) @t
163341 0 (le) @t
T
@rax 64.36658 242.49175 66.86901 250.81512 @E
[0.00021304 0.00000000 0.00000000 0.00021304 64.36652034 244.11765669] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (\050) @t
T
@rax 66.90274 242.49175 99.87307 250.81512 @E
[0.00021304 0.00000000 0.00000000 0.00021304 66.90291832 244.11765669] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Chan) @t
74463 0 (geEle) @t
T
@rax 23.78353 233.47361 88.26831 241.79698 @E
[0.00021304 0.00000000 0.00000000 0.00021304 23.78372654 235.09944743] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (\050 Mor) @t
251762 0 (gan) @t
T
@rax 23.78353 224.45518 55.50265 232.77855 @E
[0.00021304 0.00000000 0.00000000 0.00021304 23.78372654 226.08102513] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Kaufman) @t
131253 0 (n) @t
T
@rax 23.78353 215.43676 97.39077 223.76013 @E
[0.00021304 0.00000000 0.00000000 0.00021304 23.78372654 217.06260284] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Pub) @t
54896 0 (lishers,) @t
T
@rax 23.75745 206.41833 101.00381 214.74170 @E
[0.00021304 0.00000000 0.00000000 0.00021304 23.78372654 208.04418055] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (pu) @t
35276 0 (blish) @t
103883 0 (er\1331\135:b) @t
199858 0 (oo) @t
235134 0 (k\051,) @t
282157 0 ($a,) @t
333090 0 (1\051) @t
T
@rax %Note: Object
18.05329 293.34302 104.94935 344.54154 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
18.05329 293.34302 m
18.05329 344.54154 L
104.94935 344.54154 L
104.94935 293.34302 L
18.05329 293.34302 L
@c
S
@rax 23.78353 332.67572 64.00460 340.99909 @E
[0.00021304 0.00000000 0.00000000 0.00021304 23.78372654 334.30166658] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Chan) @t
74463 0 (geT) @t
128065 0 (up) @t
163341 0 (le) @t
T
@rax 64.36658 332.67572 66.86901 340.99909 @E
[0.00021304 0.00000000 0.00000000 0.00021304 64.36652034 334.30166658] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (\050) @t
T
@rax 23.78353 323.65729 56.75386 331.98066 @E
[0.00021304 0.00000000 0.00000000 0.00021304 23.78372654 325.28324429] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Chan) @t
74463 0 (geEle) @t
T
@rax 58.63606 323.65729 99.46318 331.98066 @E
[0.00021304 0.00000000 0.00000000 0.00021304 58.63608448 325.28324429] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (\050) @t
T
@rax 23.78353 314.63915 47.44120 322.96252 @E
[0.00021304 0.00000000 0.00000000 0.00021304 23.78372654 316.26503503] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Mor) @t
60117 0 (gan) @t
T
@rax 49.52353 314.63915 81.24265 322.96252 @E
[0.00021304 0.00000000 0.00000000 0.00021304 49.52371363 316.26503503] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Kaufman) @t
131253 0 (n) @t
T
@rax 23.78353 305.62072 97.39077 313.94409 @E
[0.00021304 0.00000000 0.00000000 0.00021304 23.78372654 307.24661274] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Pub) @t
54896 0 (lishers) @t
155817 0 () @t
T
@rax 23.78353 296.60230 88.48375 304.92567 @E
[0.00021304 0.00000000 0.00000000 0.00021304 23.78372654 298.22819045] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (,pu) @t
44095 0 (blish) @t
112702 0 (er\051, $co) @t
229243 0 (l7,) @t
274320 0 (1\051) @t
T
@rax %Note: Object
20.30769 382.96375 178.22381 405.32173 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
20.30769 382.96375 m
20.30769 405.32173 L
178.22381 405.32173 L
178.22381 382.96375 L
20.30769 382.96375 L
@c
S
@rax 26.03820 393.45591 60.41367 401.77928 @E
[0.00021304 0.00000000 0.00000000 0.00021304 26.03827885 395.08190873] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (InsertT) @t
100626 0 (up) @t
135902 0 (le) @t
T
@rax 60.79663 393.45591 66.90643 401.77928 @E
[0.00021304 0.00000000 0.00000000 0.00021304 60.79668824 395.08190873] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (\050\173) @t
T
@rax 66.90274 393.45591 76.52494 401.77928 @E
[0.00021304 0.00000000 0.00000000 0.00021304 66.90291832 395.08190873] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (nid) @t
T
@rax 78.36378 393.45591 95.27272 401.77928 @E
[0.00021304 0.00000000 0.00000000 0.00021304 78.36379004 395.08190873] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (,1,) @t
44095 0 (2,) @t
T
@rax 95.27329 393.81959 151.40863 401.12617 @E
[0.00021304 0.00000000 0.00000000 0.00021304 95.27325196 395.08190873] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t1,) @t
T
@rax 26.03820 386.11644 113.24608 393.42302 @E
[0.00021304 0.00000000 0.00000000 0.00021304 26.03827885 387.37876622] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t2 review >\175, 1\051) @t
T
@rax %Note: Object
56.38167 579.77121 175.68765 625.61480 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
56.38167 579.77121 m
56.38167 625.61480 L
175.68765 625.61480 L
175.68765 579.77121 L
56.38167 579.77121 L
@c
S
@rax 62.11191 613.74954 102.33269 622.07263 @E
[0.00021304 0.00000000 0.00000000 0.00021304 62.11196803 615.37529547] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Chan) @t
74463 0 (geT) @t
128065 0 (up) @t
163341 0 (le) @t
T
@rax 102.69468 613.74954 105.19739 622.07263 @E
[0.00021304 0.00000000 0.00000000 0.00021304 102.69476183 615.37529547] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (\050) @t
T
@rax 105.23112 613.74954 130.27550 622.07263 @E
[0.00021304 0.00000000 0.00000000 0.00021304 105.23115981 615.37529547] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Add) @t
60752 0 (tEle) @t
T
@rax 130.31348 613.74954 134.69471 622.07263 @E
[0.00021304 0.00000000 0.00000000 0.00021304 130.31350701 615.37529547] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (\050) @t
T
@rax 62.11191 606.31569 114.18803 613.62227 @E
[0.00021304 0.00000000 0.00000000 0.00021304 62.11196803 607.57799137] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax 62.11191 599.08224 113.94652 606.38882 @E
[0.00021304 0.00000000 0.00000000 0.00021304 62.11196803 600.34459165] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t1) @t
T
@rax 62.11191 591.84850 151.75417 599.15537 @E
[0.00021304 0.00000000 0.00000000 0.00021304 62.11196803 593.11097889] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r2) @t
T
@rax 62.11191 583.39389 114.80513 590.70047 @E
[0.00021304 0.00000000 0.00000000 0.00021304 62.11196803 584.65624793] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax 115.00129 583.03049 161.12608 591.35357 @E
[0.00021304 0.00000000 0.00000000 0.00021304 115.00117055 584.65624793] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (, 1\051,) @t
73480 0 ($co) @t
124413 0 (l13) @t
169490 0 (, 1\051) @t
T
@rax %Note: Object
22.28060 474.55654 180.19672 511.38170 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
22.28060 474.55654 m
22.28060 511.38170 L
180.19672 511.38170 L
180.19672 474.55654 L
22.28060 474.55654 L
@c
S
@rax 28.01083 499.51616 62.38630 507.83953 @E
[0.00021304 0.00000000 0.00000000 0.00021304 28.01098550 501.14215946] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (InsertT) @t
100626 0 (up) @t
135902 0 (le) @t
T
@rax 62.76954 499.51616 88.08180 507.83953 @E
[0.00021304 0.00000000 0.00000000 0.00021304 62.76960792 501.14215946] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (\050\173ID ,2,) @t
T
@rax 88.03984 499.87984 140.11597 507.18643 @E
[0.00021304 0.00000000 0.00000000 0.00021304 88.03985223 501.14215946] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax 92.92479 492.08258 144.75940 499.38945 @E
[0.00021304 0.00000000 0.00000000 0.00021304 92.92475108 493.34506839] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t1) @t
T
@rax 92.92479 484.84913 161.43392 492.15572 @E
[0.00021304 0.00000000 0.00000000 0.00021304 92.92475108 486.11145563] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r2) @t
T
@rax 88.60365 477.61569 158.07969 484.92227 @E
[0.00021304 0.00000000 0.00000000 0.00021304 88.60354357 478.87805591] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (\175, 1\051) @t
T
@rax %Note: Object
262.01962 597.90217 379.25915 632.28472 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
262.01962 632.28472 m
262.01962 597.90217 L
379.25915 597.90217 L
379.25915 632.28472 L
262.01962 632.28472 L
@c
F
@rax 267.46838 622.28580 319.54450 629.59238 @E
[0.00021304 0.00000000 0.00000000 0.00021304 267.46838646 623.54818076] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax 282.59291 615.05206 334.42781 622.35893 @E
[0.00021304 0.00000000 0.00000000 0.00021304 282.59303884 616.31456800] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t1) @t
T
@rax 282.59291 607.81861 351.10233 615.12548 @E
[0.00021304 0.00000000 0.00000000 0.00021304 282.59303884 609.08116827] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r2) @t
T
@rax 267.46838 600.58517 317.43128 607.89175 @E
[0.00021304 0.00000000 0.00000000 0.00021304 267.46838646 601.84755551] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax %Note: Object
265.77751 723.31398 383.01647 757.69710 @E
0 O 0 @g
0.05 0.04 0.04 0.00 k
/$fm 0 def
265.77751 757.69710 m
265.77751 723.31398 L
383.01647 723.31398 L
383.01647 757.69710 L
265.77751 757.69710 L
@c
F
@rax 275.54740 747.69789 327.62324 755.00447 @E
[0.00021304 0.00000000 0.00000000 0.00021304 275.54732319 748.96034282] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax 286.35080 740.46444 338.18542 747.77102 @E
[0.00021304 0.00000000 0.00000000 0.00021304 286.35076806 741.72673006] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (t1) @t
T
@rax 286.35080 733.23099 354.85994 740.53757 @E
[0.00021304 0.00000000 0.00000000 0.00021304 286.35076806 734.49333034] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (r2) @t
T
@rax 277.70797 725.99726 327.67058 733.30384 @E
[0.00021304 0.00000000 0.00000000 0.00021304 277.70792695 727.25971758] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 () @t
T
@rax %Note: Object
56.38167 705.46535 178.22381 745.86019 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
56.38167 705.46535 m
56.38167 745.86019 L
178.22381 745.86019 L
178.22381 705.46535 L
56.38167 705.46535 L
@c
S
@rax 62.11191 733.99465 102.33269 742.31802 @E
[0.00021304 0.00000000 0.00000000 0.00021304 62.11196803 735.62049998] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Chan) @t
74463 0 (geT) @t
128065 0 (up) @t
163341 0 (le) @t
T
@rax 102.69468 733.99465 105.19739 742.31802 @E
[0.00021304 0.00000000 0.00000000 0.00021304 102.69476183 735.62049998] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (\050) @t
T
@rax 105.23112 733.99465 130.27550 742.31802 @E
[0.00021304 0.00000000 0.00000000 0.00021304 105.23115981 735.62049998] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Add) @t
60752 0 (tEle) @t
T
@rax 132.19228 733.99465 164.25723 742.31802 @E
[0.00021304 0.00000000 0.00000000 0.00021304 132.19247814 735.62049998] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (\050) @t
T
@rax 62.11191 726.56107 120.67625 733.86765 @E
[0.00021304 0.00000000 0.00000000 0.00021304 62.11196803 727.82340891] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 (..) @t
T
@rax 62.11191 718.10617 145.32831 725.41304 @E
[0.00021304 0.00000000 0.00000000 0.00021304 62.11196803 719.36867796] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R17-Verdana 28221.00000 z
0 0 ( ) @t
T
@rax 145.72006 717.74277 166.59553 726.06614 @E
[0.00021304 0.00000000 0.00000000 0.00021304 145.72000506 719.36867796] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (, 1:) @t
T
@rax 62.11191 708.72435 118.04939 717.04772 @E
[0.00021304 0.00000000 0.00000000 0.00021304 62.11196803 710.35025566] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (Result\051,) @t
119541 0 ($co) @t
170474 0 (l14) @t
215551 0 (, 1\051) @t
T
@rax %Note: Object
412.60762 173.19175 412.60876 174.31909 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
412.60819 173.19175 m
412.60819 174.31909 L
S
@rax %Note: Object
409.69616 174.03732 415.61461 179.95550 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
415.61461 174.03732 m
412.60819 179.95550 L
409.69616 174.03732 L
415.61461 174.03732 L
@c
F
@rax %Note: Object
411.57411 200.24702 411.57524 201.37408 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
411.57468 200.24702 m
411.57468 201.37408 L
S
@rax %Note: Object
408.66265 201.09231 414.58110 207.01077 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
414.58110 201.09231 m
411.66879 207.01077 L
408.66265 201.09231 L
414.58110 201.09231 L
@c
F
@rax %Note: Object
412.60762 258.86636 412.60876 259.99370 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
412.60819 258.86636 m
412.60819 259.99370 L
S
@rax %Note: Object
409.69616 259.71222 415.61461 265.63039 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
415.61461 259.71222 m
412.60819 265.63039 L
409.69616 259.71222 L
415.61461 259.71222 L
@c
F
@rax %Note: Object
412.60762 285.92192 412.60876 287.04926 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
412.60819 285.92192 m
412.60819 287.04926 L
S
@rax %Note: Object
409.69616 286.76721 415.61461 292.68567 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
415.61461 286.76721 m
412.60819 292.68567 L
409.69616 286.76721 L
415.61461 286.76721 L
@c
F
@rax %Note: Object
224.72447 285.92192 224.72561 287.04926 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
224.72504 285.92192 m
224.72504 287.04926 L
S
@rax %Note: Object
221.81272 286.76721 227.73118 292.68567 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
227.73118 286.76721 m
224.72504 292.68567 L
221.81272 286.76721 L
227.73118 286.76721 L
@c
F
@rax %Note: Object
297.34129 373.85121 297.34243 374.97827 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
297.34186 373.85121 m
297.34186 374.97827 L
S
@rax %Note: Object
294.42954 374.69650 300.34800 380.61496 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
300.34800 374.69650 m
297.43597 380.61496 L
294.42954 374.69650 L
300.34800 374.69650 L
@c
F
@rax %Note: Object
297.34129 418.94334 297.34243 420.07068 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
297.34186 418.94334 m
297.34186 420.07068 L
S
@rax %Note: Object
294.42954 419.78863 300.34800 425.70709 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
300.34800 419.78863 m
297.43597 425.70709 L
294.42954 419.78863 L
300.34800 419.78863 L
@c
F
@rax %Note: Object
297.34129 445.99833 297.34243 447.12595 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
297.34186 445.99833 m
297.34186 447.12595 L
S
@rax %Note: Object
294.42954 446.84391 300.34800 452.76236 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
300.34800 446.84391 m
297.43597 452.76236 L
294.42954 446.84391 L
300.34800 446.84391 L
@c
F
@rax %Note: Object
297.34129 536.18258 297.34243 537.30964 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
297.34186 536.18258 m
297.34186 537.30964 L
S
@rax %Note: Object
294.42954 537.02787 300.34800 542.94633 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
300.34800 537.02787 m
297.43597 542.94633 L
294.42954 537.02787 L
300.34800 537.02787 L
@c
F
@rax %Note: Object
298.09276 651.16687 298.09389 652.29420 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
298.09332 651.16687 m
298.09332 652.29420 L
S
@rax %Note: Object
295.18101 652.01244 301.09946 657.93090 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
301.09946 652.01244 m
298.18715 657.93090 L
295.18101 652.01244 L
301.09946 652.01244 L
@c
F
@rax %Note: Object
197.66976 15.36973 247.27096 28.89751 @E
0 O 0 @g
0.68 0.00 0.64 0.00 k
/$fm 0 def
222.47036 28.89751 m
217.49131 28.89751 L
215.04898 28.80340 L
212.79430 28.80340 L
210.63373 28.70957 L
208.56699 28.61575 L
206.68819 28.52164 L
204.90321 28.42781 L
203.30617 28.23987 L
201.89735 28.14576 L
200.67591 28.05194 L
199.64239 27.86400 L
198.79710 27.67606 L
198.13946 27.58224 L
197.76359 27.39430 L
197.66976 27.20665 L
197.66976 17.06088 L
197.76359 16.87294 L
198.13946 16.68501 L
198.79710 16.59118 L
199.64239 16.40324 L
200.67591 16.21502 L
201.89735 16.12120 L
203.30617 15.93354 L
204.90321 15.83943 L
206.68819 15.74561 L
208.56699 15.65150 L
210.63373 15.55767 L
212.79430 15.46356 L
215.04898 15.46356 L
217.49131 15.36973 L
222.47036 15.36973 L
227.44913 15.36973 L
229.89175 15.46356 L
232.14643 15.46356 L
234.30699 15.55767 L
236.37373 15.65150 L
238.25254 15.74561 L
240.03723 15.83943 L
241.63455 15.93354 L
243.04365 16.12120 L
244.26482 16.21502 L
245.29833 16.40324 L
246.14334 16.59118 L
246.80126 16.68501 L
247.17685 16.87294 L
247.27096 17.06088 L
247.27096 27.20665 L
247.17685 27.39430 L
246.80126 27.58224 L
246.14334 27.67606 L
245.29833 27.86400 L
244.26482 28.05194 L
243.04365 28.14576 L
241.63455 28.23987 L
240.03723 28.42781 L
238.25254 28.52164 L
236.37373 28.61575 L
234.30699 28.70957 L
232.14643 28.80340 L
229.89175 28.80340 L
227.44913 28.89751 L
222.47036 28.89751 L
@c
F
@rax %Note: Object
197.66976 25.51550 247.27096 28.89751 @E
0 O 0 @g
0.64 0.00 0.55 0.00 k
/$fm 0 def
197.66976 27.20665 m
197.76359 27.01843 L
198.13946 26.83077 L
198.79710 26.73666 L
199.64239 26.54872 L
200.67591 26.36079 L
201.89735 26.26696 L
203.30617 26.07902 L
204.90321 25.98520 L
206.68819 25.89137 L
208.56699 25.79754 L
210.63373 25.70343 L
212.79430 25.60961 L
215.04898 25.60961 L
217.49131 25.51550 L
222.47036 25.51550 L
227.44913 25.51550 L
229.89175 25.60961 L
232.14643 25.60961 L
234.30699 25.70343 L
236.37373 25.79754 L
238.25254 25.89137 L
240.03723 25.98520 L
241.63455 26.07902 L
243.04365 26.26696 L
244.26482 26.36079 L
245.29833 26.54872 L
246.14334 26.73666 L
246.80126 26.83077 L
247.17685 27.01843 L
247.27096 27.20665 L
247.17685 27.39430 L
246.80126 27.58224 L
246.14334 27.67606 L
245.29833 27.86400 L
244.26482 28.05194 L
243.04365 28.14576 L
241.63455 28.23987 L
240.03723 28.42781 L
238.25254 28.52164 L
236.37373 28.61575 L
234.30699 28.70957 L
232.14643 28.80340 L
229.89175 28.80340 L
227.44913 28.89751 L
222.47036 28.89751 L
217.49131 28.89751 L
215.04898 28.80340 L
212.79430 28.80340 L
210.63373 28.70957 L
208.56699 28.61575 L
206.68819 28.52164 L
204.90321 28.42781 L
203.30617 28.23987 L
201.89735 28.14576 L
200.67591 28.05194 L
199.64239 27.86400 L
198.79710 27.67606 L
198.13946 27.58224 L
197.76359 27.39430 L
197.66976 27.20665 L
@c
F
@rax %Note: Object
197.66976 15.36973 247.27096 28.89751 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
222.47036 28.89751 m
217.49131 28.89751 L
215.04898 28.80340 L
212.79430 28.80340 L
210.63373 28.70957 L
208.56699 28.61575 L
206.68819 28.52164 L
204.90321 28.42781 L
203.30617 28.23987 L
201.89735 28.14576 L
200.67591 28.05194 L
199.64239 27.86400 L
198.79710 27.67606 L
198.13946 27.58224 L
197.76359 27.39430 L
197.66976 27.20665 L
197.66976 17.06088 L
197.76359 16.87294 L
198.13946 16.68501 L
198.79710 16.59118 L
199.64239 16.40324 L
200.67591 16.21502 L
201.89735 16.12120 L
203.30617 15.93354 L
204.90321 15.83943 L
206.68819 15.74561 L
208.56699 15.65150 L
210.63373 15.55767 L
212.79430 15.46356 L
215.04898 15.46356 L
217.49131 15.36973 L
222.47036 15.36973 L
227.44913 15.36973 L
229.89175 15.46356 L
232.14643 15.46356 L
234.30699 15.55767 L
236.37373 15.65150 L
238.25254 15.74561 L
240.03723 15.83943 L
241.63455 15.93354 L
243.04365 16.12120 L
244.26482 16.21502 L
245.29833 16.40324 L
246.14334 16.59118 L
246.80126 16.68501 L
247.17685 16.87294 L
247.27096 17.06088 L
247.27096 27.20665 L
247.17685 27.39430 L
246.80126 27.58224 L
246.14334 27.67606 L
245.29833 27.86400 L
244.26482 28.05194 L
243.04365 28.14576 L
241.63455 28.23987 L
240.03723 28.42781 L
238.25254 28.52164 L
236.37373 28.61575 L
234.30699 28.70957 L
232.14643 28.80340 L
229.89175 28.80340 L
227.44913 28.89751 L
222.47036 28.89751 L
@c
S
@rax %Note: Object
197.66976 25.51550 247.27096 27.20665 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
197.66976 27.20665 m
197.76359 27.01843 L
198.13946 26.83077 L
198.79710 26.73666 L
199.64239 26.54872 L
200.67591 26.36079 L
201.89735 26.26696 L
203.30617 26.07902 L
204.90321 25.98520 L
206.68819 25.89137 L
208.56699 25.79754 L
210.63373 25.70343 L
212.79430 25.60961 L
215.04898 25.60961 L
217.49131 25.51550 L
222.47036 25.51550 L
227.44913 25.51550 L
229.89175 25.60961 L
232.14643 25.60961 L
234.30699 25.70343 L
236.37373 25.79754 L
238.25254 25.89137 L
240.03723 25.98520 L
241.63455 26.07902 L
243.04365 26.26696 L
244.26482 26.36079 L
245.29833 26.54872 L
246.14334 26.73666 L
246.80126 26.83077 L
247.17685 27.01843 L
247.27096 27.20665 L
S
@rax 210.89679 17.31373 222.39723 25.63710 @E
[0.00021304 0.00000000 0.00000000 0.00021304 210.91540328 18.93958413] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (bib) @t
45077 0 (.) @t
T
@rax 222.37654 17.31373 234.06775 25.63710 @E
[0.00021304 0.00000000 0.00000000 0.00021304 222.37648803 18.93958413] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (xml) @t
T
@rax %Note: Object
224.72447 28.89751 224.72561 30.02485 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
224.72504 28.89751 m
224.72504 30.02485 L
S
@rax %Note: Object
221.81272 29.74280 227.73118 35.66126 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
227.73118 29.74280 m
224.72504 35.66126 L
221.81272 29.74280 L
227.73118 29.74280 L
@c
F
@rax %Note: Object
390.06227 15.36973 439.66375 28.89751 @E
0 O 0 @g
0.68 0.00 0.64 0.00 k
/$fm 0 def
414.86287 28.89751 m
409.88381 28.89751 L
407.44148 28.80340 L
405.18709 28.80340 L
403.02624 28.70957 L
400.95950 28.61575 L
399.08069 28.52164 L
397.29572 28.42781 L
395.69868 28.23987 L
394.28957 28.14576 L
393.06841 28.05194 L
392.03518 27.86400 L
391.18961 27.67606 L
390.53197 27.58224 L
390.15609 27.39430 L
390.06227 27.20665 L
390.06227 17.06088 L
390.15609 16.87294 L
390.53197 16.68501 L
391.18961 16.59118 L
392.03518 16.40324 L
393.06841 16.21502 L
394.28957 16.12120 L
395.69868 15.93354 L
397.29572 15.83943 L
399.08069 15.74561 L
400.95950 15.65150 L
403.02624 15.55767 L
405.18709 15.46356 L
407.44148 15.46356 L
409.88381 15.36973 L
414.86287 15.36973 L
419.84192 15.36973 L
422.28425 15.46356 L
424.53893 15.46356 L
426.69950 15.55767 L
428.76624 15.65150 L
430.64504 15.74561 L
432.42973 15.83943 L
434.02706 15.93354 L
435.43616 16.12120 L
436.65732 16.21502 L
437.69055 16.40324 L
438.53613 16.59118 L
439.19376 16.68501 L
439.56935 16.87294 L
439.66375 17.06088 L
439.66375 27.20665 L
439.56935 27.39430 L
439.19376 27.58224 L
438.53613 27.67606 L
437.69055 27.86400 L
436.65732 28.05194 L
435.43616 28.14576 L
434.02706 28.23987 L
432.42973 28.42781 L
430.64504 28.52164 L
428.76624 28.61575 L
426.69950 28.70957 L
424.53893 28.80340 L
422.28425 28.80340 L
419.84192 28.89751 L
414.86287 28.89751 L
@c
F
@rax %Note: Object
390.06227 25.51550 439.66375 28.89751 @E
0 O 0 @g
0.64 0.00 0.55 0.00 k
/$fm 0 def
390.06227 27.20665 m
390.15609 27.01843 L
390.53197 26.83077 L
391.18961 26.73666 L
392.03518 26.54872 L
393.06841 26.36079 L
394.28957 26.26696 L
395.69868 26.07902 L
397.29572 25.98520 L
399.08069 25.89137 L
400.95950 25.79754 L
403.02624 25.70343 L
405.18709 25.60961 L
407.44148 25.60961 L
409.88381 25.51550 L
414.86287 25.51550 L
419.84192 25.51550 L
422.28425 25.60961 L
424.53893 25.60961 L
426.69950 25.70343 L
428.76624 25.79754 L
430.64504 25.89137 L
432.42973 25.98520 L
434.02706 26.07902 L
435.43616 26.26696 L
436.65732 26.36079 L
437.69055 26.54872 L
438.53613 26.73666 L
439.19376 26.83077 L
439.56935 27.01843 L
439.66375 27.20665 L
439.56935 27.39430 L
439.19376 27.58224 L
438.53613 27.67606 L
437.69055 27.86400 L
436.65732 28.05194 L
435.43616 28.14576 L
434.02706 28.23987 L
432.42973 28.42781 L
430.64504 28.52164 L
428.76624 28.61575 L
426.69950 28.70957 L
424.53893 28.80340 L
422.28425 28.80340 L
419.84192 28.89751 L
414.86287 28.89751 L
409.88381 28.89751 L
407.44148 28.80340 L
405.18709 28.80340 L
403.02624 28.70957 L
400.95950 28.61575 L
399.08069 28.52164 L
397.29572 28.42781 L
395.69868 28.23987 L
394.28957 28.14576 L
393.06841 28.05194 L
392.03518 27.86400 L
391.18961 27.67606 L
390.53197 27.58224 L
390.15609 27.39430 L
390.06227 27.20665 L
@c
F
@rax %Note: Object
390.06227 15.36973 439.66375 28.89751 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
414.86287 28.89751 m
409.88381 28.89751 L
407.44148 28.80340 L
405.18709 28.80340 L
403.02624 28.70957 L
400.95950 28.61575 L
399.08069 28.52164 L
397.29572 28.42781 L
395.69868 28.23987 L
394.28957 28.14576 L
393.06841 28.05194 L
392.03518 27.86400 L
391.18961 27.67606 L
390.53197 27.58224 L
390.15609 27.39430 L
390.06227 27.20665 L
390.06227 17.06088 L
390.15609 16.87294 L
390.53197 16.68501 L
391.18961 16.59118 L
392.03518 16.40324 L
393.06841 16.21502 L
394.28957 16.12120 L
395.69868 15.93354 L
397.29572 15.83943 L
399.08069 15.74561 L
400.95950 15.65150 L
403.02624 15.55767 L
405.18709 15.46356 L
407.44148 15.46356 L
409.88381 15.36973 L
414.86287 15.36973 L
419.84192 15.36973 L
422.28425 15.46356 L
424.53893 15.46356 L
426.69950 15.55767 L
428.76624 15.65150 L
430.64504 15.74561 L
432.42973 15.83943 L
434.02706 15.93354 L
435.43616 16.12120 L
436.65732 16.21502 L
437.69055 16.40324 L
438.53613 16.59118 L
439.19376 16.68501 L
439.56935 16.87294 L
439.66375 17.06088 L
439.66375 27.20665 L
439.56935 27.39430 L
439.19376 27.58224 L
438.53613 27.67606 L
437.69055 27.86400 L
436.65732 28.05194 L
435.43616 28.14576 L
434.02706 28.23987 L
432.42973 28.42781 L
430.64504 28.52164 L
428.76624 28.61575 L
426.69950 28.70957 L
424.53893 28.80340 L
422.28425 28.80340 L
419.84192 28.89751 L
414.86287 28.89751 L
@c
S
@rax %Note: Object
390.06227 25.51550 439.66375 27.20665 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
390.06227 27.20665 m
390.15609 27.01843 L
390.53197 26.83077 L
391.18961 26.73666 L
392.03518 26.54872 L
393.06841 26.36079 L
394.28957 26.26696 L
395.69868 26.07902 L
397.29572 25.98520 L
399.08069 25.89137 L
400.95950 25.79754 L
403.02624 25.70343 L
405.18709 25.60961 L
407.44148 25.60961 L
409.88381 25.51550 L
414.86287 25.51550 L
419.84192 25.51550 L
422.28425 25.60961 L
424.53893 25.60961 L
426.69950 25.70343 L
428.76624 25.79754 L
430.64504 25.89137 L
432.42973 25.98520 L
434.02706 26.07902 L
435.43616 26.26696 L
436.65732 26.36079 L
437.69055 26.54872 L
438.53613 26.73666 L
439.19376 26.83077 L
439.56935 27.01843 L
439.66375 27.20665 L
S
@rax 396.35631 17.31373 421.60620 25.63710 @E
[0.00021304 0.00000000 0.00000000 0.00021304 396.35643207 18.93958413] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (reviews.) @t
T
@rax 421.62661 17.31373 433.31783 25.63710 @E
[0.00021304 0.00000000 0.00000000 0.00021304 421.62667639 18.93958413] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 35277.00000 z
0 0 (xml) @t
T
@rax %Note: Object
417.11669 28.89751 417.11783 30.02485 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
417.11726 28.89751 m
417.11726 30.02485 L
S
@rax %Note: Object
414.20523 29.74280 420.12369 35.66126 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
420.12369 29.74280 m
417.11726 35.66126 L
414.20523 29.74280 L
420.12369 29.74280 L
@c
F
@rax %Note: Object
164.32044 154.87313 164.88397 155.43694 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
164.69631 155.43694 m
164.60220 155.43694 L
164.50809 155.34283 L
164.41455 155.24872 L
164.32044 155.15490 L
164.32044 155.15490 L
164.41455 155.06107 L
164.50809 154.96724 L
164.60220 154.87313 L
164.60220 154.87313 L
164.60220 154.87313 L
164.69631 154.96724 L
164.79014 155.06107 L
164.88397 155.15490 L
164.88397 155.15490 L
164.79014 155.24872 L
164.69631 155.34283 L
164.69631 155.43694 L
@c
F
@rax %Note: Object
165.44778 154.87313 166.01131 155.43694 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
165.72983 155.43694 m
165.63543 155.43694 L
165.54161 155.34283 L
165.44778 155.24872 L
165.44778 155.15490 L
165.44778 155.06107 L
165.44778 154.96724 L
165.54161 154.87313 L
165.63543 154.87313 L
165.72983 154.87313 L
165.72983 154.87313 L
165.82365 154.96724 L
165.91748 155.06107 L
166.01131 155.15490 L
166.01131 155.15490 L
165.91748 155.24872 L
165.82365 155.34283 L
165.82365 155.43694 L
165.72983 155.43694 L
@c
F
@rax %Note: Object
166.57512 154.87313 167.13865 155.43694 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
166.85717 155.43694 m
166.76277 155.43694 L
166.66894 155.34283 L
166.57512 155.24872 L
166.57512 155.15490 L
166.57512 155.06107 L
166.57512 154.96724 L
166.66894 154.87313 L
166.76277 154.87313 L
166.85717 154.87313 L
166.85717 154.87313 L
166.95099 154.96724 L
167.04482 155.06107 L
167.13865 155.15490 L
167.13865 155.15490 L
167.04482 155.24872 L
166.95099 155.34283 L
166.95099 155.43694 L
166.85717 155.43694 L
@c
F
@rax %Note: Object
167.70217 154.87313 168.26598 155.43694 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
167.98422 155.43694 m
167.89011 155.43694 L
167.79600 155.34283 L
167.70217 155.24872 L
167.70217 155.15490 L
167.70217 155.06107 L
167.70217 154.96724 L
167.79600 154.87313 L
167.89011 154.87313 L
167.98422 154.87313 L
167.98422 154.87313 L
168.07805 154.96724 L
168.17187 155.06107 L
168.26598 155.15490 L
168.26598 155.15490 L
168.17187 155.24872 L
168.07805 155.34283 L
168.07805 155.43694 L
167.98422 155.43694 L
@c
F
@rax %Note: Object
168.82951 154.87313 169.39332 155.43694 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
169.11156 155.43694 m
169.01773 155.43694 L
168.92362 155.34283 L
168.82951 155.24872 L
168.82951 155.15490 L
168.82951 155.06107 L
168.82951 154.96724 L
168.92362 154.87313 L
169.01773 154.87313 L
169.11156 154.87313 L
169.11156 154.87313 L
169.20539 154.96724 L
169.29950 155.06107 L
169.39332 155.15490 L
169.39332 155.15490 L
169.29950 155.24872 L
169.20539 155.34283 L
169.20539 155.43694 L
169.11156 155.43694 L
@c
F
@rax %Note: Object
169.95685 154.87313 170.52038 155.43694 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
170.23861 155.43694 m
170.14507 155.43694 L
170.05096 155.34283 L
169.95685 155.24872 L
169.95685 155.15490 L
169.95685 155.06107 L
169.95685 154.96724 L
170.05096 154.87313 L
170.14507 154.87313 L
170.23861 154.87313 L
170.23861 154.87313 L
170.33272 154.96724 L
170.42655 155.06107 L
170.52038 155.15490 L
170.52038 155.15490 L
170.42655 155.24872 L
170.33272 155.34283 L
170.33272 155.43694 L
170.23861 155.43694 L
@c
F
@rax %Note: Object
171.08419 154.87313 171.64772 155.43694 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
171.36624 155.43694 m
171.27213 155.43694 L
171.17802 155.34283 L
171.08419 155.24872 L
171.08419 155.15490 L
171.08419 155.06107 L
171.08419 154.96724 L
171.17802 154.87313 L
171.27213 154.87313 L
171.36624 154.87313 L
171.36624 154.87313 L
171.46006 154.96724 L
171.55389 155.06107 L
171.64772 155.15490 L
171.64772 155.15490 L
171.55389 155.24872 L
171.46006 155.34283 L
171.46006 155.43694 L
171.36624 155.43694 L
@c
F
@rax %Note: Object
172.30564 152.14904 178.12998 158.06693 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
172.30564 152.14904 m
178.12998 155.15490 L
172.30564 158.06693 L
172.30564 152.14904 L
@c
F
@rax %Note: Object
132.75581 240.54803 133.31962 241.11156 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
133.13169 241.11156 m
133.03786 241.11156 L
132.94403 241.01773 L
132.84992 240.92391 L
132.75581 240.82980 L
132.75581 240.82980 L
132.84992 240.73597 L
132.94403 240.64186 L
133.03786 240.54803 L
133.03786 240.54803 L
133.03786 240.54803 L
133.13169 240.64186 L
133.22551 240.73597 L
133.31962 240.82980 L
133.31962 240.82980 L
133.22551 240.92391 L
133.13169 241.01773 L
133.13169 241.11156 L
@c
F
@rax %Note: Object
127.21323 237.82365 133.03786 243.74211 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
127.21323 237.82365 m
133.03786 240.82980 L
127.21323 243.74211 L
127.21323 237.82365 L
@c
F
@rax %Note: Object
104.57348 321.71357 105.13729 322.27739 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
104.94935 322.27739 m
104.85524 322.27739 L
104.76142 322.18328 L
104.66731 322.08945 L
104.57348 321.99562 L
104.57348 321.99562 L
104.66731 321.90151 L
104.76142 321.80740 L
104.85524 321.71357 L
104.85524 321.71357 L
104.85524 321.71357 L
104.94935 321.80740 L
105.04346 321.90151 L
105.13729 321.99562 L
105.13729 321.99562 L
105.04346 322.08945 L
104.94935 322.18328 L
104.94935 322.27739 L
@c
F
@rax %Note: Object
105.70082 321.71357 106.26463 322.27739 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
105.98258 322.27739 m
105.88876 322.27739 L
105.79493 322.18328 L
105.70082 322.08945 L
105.70082 321.99562 L
105.70082 321.90151 L
105.70082 321.80740 L
105.79493 321.71357 L
105.88876 321.71357 L
105.98258 321.71357 L
105.98258 321.71357 L
106.07669 321.80740 L
106.17080 321.90151 L
106.26463 321.99562 L
106.26463 321.99562 L
106.17080 322.08945 L
106.07669 322.18328 L
106.07669 322.27739 L
105.98258 322.27739 L
@c
F
@rax %Note: Object
106.82816 321.71357 107.39169 322.27739 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
107.10992 322.27739 m
107.01581 322.27739 L
106.92198 322.18328 L
106.82816 322.08945 L
106.82816 321.99562 L
106.82816 321.90151 L
106.82816 321.80740 L
106.92198 321.71357 L
107.01581 321.71357 L
107.10992 321.71357 L
107.10992 321.71357 L
107.20403 321.80740 L
107.29786 321.90151 L
107.39169 321.99562 L
107.39169 321.99562 L
107.29786 322.08945 L
107.20403 322.18328 L
107.20403 322.27739 L
107.10992 322.27739 L
@c
F
@rax %Note: Object
108.04932 318.98920 113.87395 324.90765 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
108.04932 318.98920 m
113.87395 321.99562 L
108.04932 324.90765 L
108.04932 318.98920 L
@c
F
@rax %Note: Object
177.84822 398.37005 178.41175 398.93357 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
178.22381 398.93357 m
178.12998 398.93357 L
178.03587 398.83975 L
177.94205 398.74592 L
177.84822 398.65181 L
177.84822 398.65181 L
177.94205 398.55770 L
178.03587 398.46387 L
178.12998 398.37005 L
178.12998 398.37005 L
178.12998 398.37005 L
178.22381 398.46387 L
178.31792 398.55770 L
178.41175 398.65181 L
178.41175 398.65181 L
178.31792 398.74592 L
178.22381 398.83975 L
178.22381 398.93357 L
@c
F
@rax %Note: Object
178.97528 398.37005 179.53909 398.93357 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
179.25704 398.93357 m
179.16321 398.93357 L
179.06910 398.83975 L
178.97528 398.74592 L
178.97528 398.65181 L
178.97528 398.55770 L
178.97528 398.46387 L
179.06910 398.37005 L
179.16321 398.37005 L
179.25704 398.37005 L
179.25704 398.37005 L
179.35087 398.46387 L
179.44498 398.55770 L
179.53909 398.65181 L
179.53909 398.65181 L
179.44498 398.74592 L
179.35087 398.83975 L
179.35087 398.93357 L
179.25704 398.93357 L
@c
F
@rax %Note: Object
180.10261 398.37005 180.66643 398.93357 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
180.38438 398.93357 m
180.29055 398.93357 L
180.19672 398.83975 L
180.10261 398.74592 L
180.10261 398.65181 L
180.10261 398.55770 L
180.10261 398.46387 L
180.19672 398.37005 L
180.29055 398.37005 L
180.38438 398.37005 L
180.38438 398.37005 L
180.47820 398.46387 L
180.57260 398.55770 L
180.66643 398.65181 L
180.66643 398.65181 L
180.57260 398.74592 L
180.47820 398.83975 L
180.47820 398.93357 L
180.38438 398.93357 L
@c
F
@rax %Note: Object
181.22995 398.37005 181.79376 398.93357 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
181.51172 398.93357 m
181.41789 398.93357 L
181.32406 398.83975 L
181.22995 398.74592 L
181.22995 398.65181 L
181.22995 398.55770 L
181.22995 398.46387 L
181.32406 398.37005 L
181.41789 398.37005 L
181.51172 398.37005 L
181.51172 398.37005 L
181.60583 398.46387 L
181.69994 398.55770 L
181.79376 398.65181 L
181.79376 398.65181 L
181.69994 398.74592 L
181.60583 398.83975 L
181.60583 398.93357 L
181.51172 398.93357 L
@c
F
@rax %Note: Object
182.35729 398.37005 182.92082 398.93357 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
182.63877 398.93357 m
182.54494 398.93357 L
182.45112 398.83975 L
182.35729 398.74592 L
182.35729 398.65181 L
182.35729 398.55770 L
182.35729 398.46387 L
182.45112 398.37005 L
182.54494 398.37005 L
182.63877 398.37005 L
182.63877 398.37005 L
182.73317 398.46387 L
182.82699 398.55770 L
182.92082 398.65181 L
182.92082 398.65181 L
182.82699 398.74592 L
182.73317 398.83975 L
182.73317 398.93357 L
182.63877 398.93357 L
@c
F
@rax %Note: Object
183.48463 398.37005 184.04816 398.93357 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
183.76639 398.93357 m
183.67228 398.93357 L
183.57846 398.83975 L
183.48463 398.74592 L
183.48463 398.65181 L
183.48463 398.55770 L
183.48463 398.46387 L
183.57846 398.37005 L
183.67228 398.37005 L
183.76639 398.37005 L
183.76639 398.37005 L
183.86050 398.46387 L
183.95433 398.55770 L
184.04816 398.65181 L
184.04816 398.65181 L
183.95433 398.74592 L
183.86050 398.83975 L
183.86050 398.93357 L
183.76639 398.93357 L
@c
F
@rax %Note: Object
184.61197 398.37005 185.17550 398.93357 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
184.89373 398.93357 m
184.79962 398.93357 L
184.70580 398.83975 L
184.61197 398.74592 L
184.61197 398.65181 L
184.61197 398.55770 L
184.61197 398.46387 L
184.70580 398.37005 L
184.79962 398.37005 L
184.89373 398.37005 L
184.89373 398.37005 L
184.98756 398.46387 L
185.08139 398.55770 L
185.17550 398.65181 L
185.17550 398.65181 L
185.08139 398.74592 L
184.98756 398.83975 L
184.98756 398.93357 L
184.89373 398.93357 L
@c
F
@rax %Note: Object
185.73902 398.37005 186.30283 398.93357 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
186.02107 398.93357 m
185.92696 398.93357 L
185.83313 398.83975 L
185.73902 398.74592 L
185.73902 398.65181 L
185.73902 398.55770 L
185.73902 398.46387 L
185.83313 398.37005 L
185.92696 398.37005 L
186.02107 398.37005 L
186.02107 398.37005 L
186.11490 398.46387 L
186.20901 398.55770 L
186.30283 398.65181 L
186.30283 398.65181 L
186.20901 398.74592 L
186.11490 398.83975 L
186.11490 398.93357 L
186.02107 398.93357 L
@c
F
@rax %Note: Object
186.86636 398.37005 187.43017 398.93357 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
187.14841 398.93357 m
187.05430 398.93357 L
186.96047 398.83975 L
186.86636 398.74592 L
186.86636 398.65181 L
186.86636 398.55770 L
186.86636 398.46387 L
186.96047 398.37005 L
187.05430 398.37005 L
187.14841 398.37005 L
187.14841 398.37005 L
187.24224 398.46387 L
187.33635 398.55770 L
187.43017 398.65181 L
187.43017 398.65181 L
187.33635 398.74592 L
187.24224 398.83975 L
187.24224 398.93357 L
187.14841 398.93357 L
@c
F
@rax %Note: Object
187.99370 398.37005 188.55723 398.93357 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
188.27546 398.93357 m
188.18164 398.93357 L
188.08753 398.83975 L
187.99370 398.74592 L
187.99370 398.65181 L
187.99370 398.55770 L
187.99370 398.46387 L
188.08753 398.37005 L
188.18164 398.37005 L
188.27546 398.37005 L
188.27546 398.37005 L
188.36957 398.46387 L
188.46340 398.55770 L
188.55723 398.65181 L
188.55723 398.65181 L
188.46340 398.74592 L
188.36957 398.83975 L
188.36957 398.93357 L
188.27546 398.93357 L
@c
F
@rax %Note: Object
189.12104 398.37005 189.68457 398.93357 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
189.40309 398.93357 m
189.30898 398.93357 L
189.21487 398.83975 L
189.12104 398.74592 L
189.12104 398.65181 L
189.12104 398.55770 L
189.12104 398.46387 L
189.21487 398.37005 L
189.30898 398.37005 L
189.40309 398.37005 L
189.40309 398.37005 L
189.49691 398.46387 L
189.59074 398.55770 L
189.68457 398.65181 L
189.68457 398.65181 L
189.59074 398.74592 L
189.49691 398.83975 L
189.49691 398.93357 L
189.40309 398.93357 L
@c
F
@rax %Note: Object
190.34220 395.64567 196.16683 401.56413 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
190.34220 395.64567 m
196.16683 398.65181 L
190.34220 401.56413 L
190.34220 395.64567 L
@c
F
@rax %Note: Object
179.82057 502.08151 180.38438 502.64504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
180.19672 502.64504 m
180.10261 502.64504 L
180.00879 502.55121 L
179.91468 502.45739 L
179.82057 502.36328 L
179.82057 502.36328 L
179.91468 502.26973 L
180.00879 502.17562 L
180.10261 502.08151 L
180.10261 502.08151 L
180.10261 502.08151 L
180.19672 502.17562 L
180.29055 502.26973 L
180.38438 502.36328 L
180.38438 502.36328 L
180.29055 502.45739 L
180.19672 502.55121 L
180.19672 502.64504 L
@c
F
@rax %Note: Object
180.94819 502.08151 181.51172 502.64504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
181.22995 502.64504 m
181.13613 502.64504 L
181.04202 502.55121 L
180.94819 502.45739 L
180.94819 502.36328 L
180.94819 502.26973 L
180.94819 502.17562 L
181.04202 502.08151 L
181.13613 502.08151 L
181.22995 502.08151 L
181.22995 502.08151 L
181.32406 502.17562 L
181.41789 502.26973 L
181.51172 502.36328 L
181.51172 502.36328 L
181.41789 502.45739 L
181.32406 502.55121 L
181.32406 502.64504 L
181.22995 502.64504 L
@c
F
@rax %Note: Object
182.07524 502.08151 182.63877 502.64504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
182.35729 502.64504 m
182.26318 502.64504 L
182.16935 502.55121 L
182.07524 502.45739 L
182.07524 502.36328 L
182.07524 502.26973 L
182.07524 502.17562 L
182.16935 502.08151 L
182.26318 502.08151 L
182.35729 502.08151 L
182.35729 502.08151 L
182.45112 502.17562 L
182.54494 502.26973 L
182.63877 502.36328 L
182.63877 502.36328 L
182.54494 502.45739 L
182.45112 502.55121 L
182.45112 502.64504 L
182.35729 502.64504 L
@c
F
@rax %Note: Object
183.20258 502.08151 183.76639 502.64504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
183.48463 502.64504 m
183.39080 502.64504 L
183.29669 502.55121 L
183.20258 502.45739 L
183.20258 502.36328 L
183.20258 502.26973 L
183.20258 502.17562 L
183.29669 502.08151 L
183.39080 502.08151 L
183.48463 502.08151 L
183.48463 502.08151 L
183.57846 502.17562 L
183.67228 502.26973 L
183.76639 502.36328 L
183.76639 502.36328 L
183.67228 502.45739 L
183.57846 502.55121 L
183.57846 502.64504 L
183.48463 502.64504 L
@c
F
@rax %Note: Object
184.32992 502.08151 184.89373 502.64504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
184.61197 502.64504 m
184.51814 502.64504 L
184.42403 502.55121 L
184.32992 502.45739 L
184.32992 502.36328 L
184.32992 502.26973 L
184.32992 502.17562 L
184.42403 502.08151 L
184.51814 502.08151 L
184.61197 502.08151 L
184.61197 502.08151 L
184.70580 502.17562 L
184.79962 502.26973 L
184.89373 502.36328 L
184.89373 502.36328 L
184.79962 502.45739 L
184.70580 502.55121 L
184.70580 502.64504 L
184.61197 502.64504 L
@c
F
@rax %Note: Object
185.45726 502.08151 186.02107 502.64504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
185.73902 502.64504 m
185.64520 502.64504 L
185.55137 502.55121 L
185.45726 502.45739 L
185.45726 502.36328 L
185.45726 502.26973 L
185.45726 502.17562 L
185.55137 502.08151 L
185.64520 502.08151 L
185.73902 502.08151 L
185.73902 502.08151 L
185.83313 502.17562 L
185.92696 502.26973 L
186.02107 502.36328 L
186.02107 502.36328 L
185.92696 502.45739 L
185.83313 502.55121 L
185.83313 502.64504 L
185.73902 502.64504 L
@c
F
@rax %Note: Object
186.58488 502.08151 187.14841 502.64504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
186.86636 502.64504 m
186.77254 502.64504 L
186.67871 502.55121 L
186.58488 502.45739 L
186.58488 502.36328 L
186.58488 502.26973 L
186.58488 502.17562 L
186.67871 502.08151 L
186.77254 502.08151 L
186.86636 502.08151 L
186.86636 502.08151 L
186.96047 502.17562 L
187.05430 502.26973 L
187.14841 502.36328 L
187.14841 502.36328 L
187.05430 502.45739 L
186.96047 502.55121 L
186.96047 502.64504 L
186.86636 502.64504 L
@c
F
@rax %Note: Object
187.71194 502.08151 188.27546 502.64504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
187.99370 502.64504 m
187.89959 502.64504 L
187.80576 502.55121 L
187.71194 502.45739 L
187.71194 502.36328 L
187.71194 502.26973 L
187.71194 502.17562 L
187.80576 502.08151 L
187.89959 502.08151 L
187.99370 502.08151 L
187.99370 502.08151 L
188.08753 502.17562 L
188.18164 502.26973 L
188.27546 502.36328 L
188.27546 502.36328 L
188.18164 502.45739 L
188.08753 502.55121 L
188.08753 502.64504 L
187.99370 502.64504 L
@c
F
@rax %Note: Object
188.83928 502.08151 189.40309 502.64504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
189.12104 502.64504 m
189.02721 502.64504 L
188.93310 502.55121 L
188.83928 502.45739 L
188.83928 502.36328 L
188.83928 502.26973 L
188.83928 502.17562 L
188.93310 502.08151 L
189.02721 502.08151 L
189.12104 502.08151 L
189.12104 502.08151 L
189.21487 502.17562 L
189.30898 502.26973 L
189.40309 502.36328 L
189.40309 502.36328 L
189.30898 502.45739 L
189.21487 502.55121 L
189.21487 502.64504 L
189.12104 502.64504 L
@c
F
@rax %Note: Object
189.96661 502.08151 190.53043 502.64504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
190.24838 502.64504 m
190.15455 502.64504 L
190.06044 502.55121 L
189.96661 502.45739 L
189.96661 502.36328 L
189.96661 502.26973 L
189.96661 502.17562 L
190.06044 502.08151 L
190.15455 502.08151 L
190.24838 502.08151 L
190.24838 502.08151 L
190.34220 502.17562 L
190.43631 502.26973 L
190.53043 502.36328 L
190.53043 502.36328 L
190.43631 502.45739 L
190.34220 502.55121 L
190.34220 502.64504 L
190.24838 502.64504 L
@c
F
@rax %Note: Object
191.09367 502.08151 191.65748 502.64504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
191.37543 502.64504 m
191.28161 502.64504 L
191.18778 502.55121 L
191.09367 502.45739 L
191.09367 502.36328 L
191.09367 502.26973 L
191.09367 502.17562 L
191.18778 502.08151 L
191.28161 502.08151 L
191.37543 502.08151 L
191.37543 502.08151 L
191.46954 502.17562 L
191.56365 502.26973 L
191.65748 502.36328 L
191.65748 502.36328 L
191.56365 502.45739 L
191.46954 502.55121 L
191.46954 502.64504 L
191.37543 502.64504 L
@c
F
@rax %Note: Object
192.22129 502.08151 192.78482 502.64504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
192.50277 502.64504 m
192.40894 502.64504 L
192.31512 502.55121 L
192.22129 502.45739 L
192.22129 502.36328 L
192.22129 502.26973 L
192.22129 502.17562 L
192.31512 502.08151 L
192.40894 502.08151 L
192.50277 502.08151 L
192.50277 502.08151 L
192.59717 502.17562 L
192.69099 502.26973 L
192.78482 502.36328 L
192.78482 502.36328 L
192.69099 502.45739 L
192.59717 502.55121 L
192.59717 502.64504 L
192.50277 502.64504 L
@c
F
@rax %Note: Object
193.34863 502.08151 193.91187 502.64504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
193.63011 502.64504 m
193.53600 502.64504 L
193.44246 502.55121 L
193.34863 502.45739 L
193.34863 502.36328 L
193.34863 502.26973 L
193.34863 502.17562 L
193.44246 502.08151 L
193.53600 502.08151 L
193.63011 502.08151 L
193.63011 502.08151 L
193.72422 502.17562 L
193.81805 502.26973 L
193.91187 502.36328 L
193.91187 502.36328 L
193.81805 502.45739 L
193.72422 502.55121 L
193.72422 502.64504 L
193.63011 502.64504 L
@c
F
@rax %Note: Object
194.47569 502.08151 195.03950 502.64504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
194.75773 502.64504 m
194.66362 502.64504 L
194.56951 502.55121 L
194.47569 502.45739 L
194.47569 502.36328 L
194.47569 502.26973 L
194.47569 502.17562 L
194.56951 502.08151 L
194.66362 502.08151 L
194.75773 502.08151 L
194.75773 502.08151 L
194.85156 502.17562 L
194.94539 502.26973 L
195.03950 502.36328 L
195.03950 502.36328 L
194.94539 502.45739 L
194.85156 502.55121 L
194.85156 502.64504 L
194.75773 502.64504 L
@c
F
@rax %Note: Object
195.60302 502.08151 196.16683 502.64504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
195.88507 502.64504 m
195.79096 502.64504 L
195.69685 502.55121 L
195.60302 502.45739 L
195.60302 502.36328 L
195.60302 502.26973 L
195.60302 502.17562 L
195.69685 502.08151 L
195.79096 502.08151 L
195.88507 502.08151 L
195.88507 502.08151 L
195.97890 502.17562 L
196.07272 502.26973 L
196.16683 502.36328 L
196.16683 502.36328 L
196.07272 502.45739 L
195.97890 502.55121 L
195.97890 502.64504 L
195.88507 502.64504 L
@c
F
@rax %Note: Object
196.73008 502.08151 197.29389 502.64504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
197.01213 502.64504 m
196.91802 502.64504 L
196.82419 502.55121 L
196.73008 502.45739 L
196.73008 502.36328 L
196.73008 502.26973 L
196.73008 502.17562 L
196.82419 502.08151 L
196.91802 502.08151 L
197.01213 502.08151 L
197.01213 502.08151 L
197.10595 502.17562 L
197.20006 502.26973 L
197.29389 502.36328 L
197.29389 502.36328 L
197.20006 502.45739 L
197.10595 502.55121 L
197.10595 502.64504 L
197.01213 502.64504 L
@c
F
@rax %Note: Object
197.85770 502.08151 198.42123 502.64504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
198.13946 502.64504 m
198.04564 502.64504 L
197.95153 502.55121 L
197.85770 502.45739 L
197.85770 502.36328 L
197.85770 502.26973 L
197.85770 502.17562 L
197.95153 502.08151 L
198.04564 502.08151 L
198.13946 502.08151 L
198.13946 502.08151 L
198.23357 502.17562 L
198.32740 502.26973 L
198.42123 502.36328 L
198.42123 502.36328 L
198.32740 502.45739 L
198.23357 502.55121 L
198.23357 502.64504 L
198.13946 502.64504 L
@c
F
@rax %Note: Object
198.98504 502.08151 199.54828 502.64504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
199.26680 502.64504 m
199.17298 502.64504 L
199.07887 502.55121 L
198.98504 502.45739 L
198.98504 502.36328 L
198.98504 502.26973 L
198.98504 502.17562 L
199.07887 502.08151 L
199.17298 502.08151 L
199.26680 502.08151 L
199.26680 502.08151 L
199.36063 502.17562 L
199.45446 502.26973 L
199.54828 502.36328 L
199.54828 502.36328 L
199.45446 502.45739 L
199.36063 502.55121 L
199.36063 502.64504 L
199.26680 502.64504 L
@c
F
@rax %Note: Object
200.11209 502.08151 200.67591 502.64504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
200.39414 502.64504 m
200.30031 502.64504 L
200.20592 502.55121 L
200.11209 502.45739 L
200.11209 502.36328 L
200.11209 502.26973 L
200.11209 502.17562 L
200.20592 502.08151 L
200.30031 502.08151 L
200.39414 502.08151 L
200.39414 502.08151 L
200.48797 502.17562 L
200.58180 502.26973 L
200.67591 502.36328 L
200.67591 502.36328 L
200.58180 502.45739 L
200.48797 502.55121 L
200.48797 502.64504 L
200.39414 502.64504 L
@c
F
@rax %Note: Object
201.33354 499.35742 207.25172 505.27559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
201.33354 499.35742 m
207.25172 502.36328 L
201.33354 505.27559 L
201.33354 499.35742 L
@c
F
@rax %Note: Object
177.84822 614.81169 178.41175 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
178.22381 615.37521 m
178.12998 615.37521 L
178.03587 615.28139 L
177.94205 615.18756 L
177.84822 615.09373 L
177.84822 615.09373 L
177.94205 614.99934 L
178.03587 614.90551 L
178.12998 614.81169 L
178.12998 614.81169 L
178.12998 614.81169 L
178.22381 614.90551 L
178.31792 614.99934 L
178.41175 615.09373 L
178.41175 615.09373 L
178.31792 615.18756 L
178.22381 615.28139 L
178.22381 615.37521 L
@c
F
@rax %Note: Object
178.97528 614.81169 179.53909 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
179.25704 615.37521 m
179.16321 615.37521 L
179.06910 615.28139 L
178.97528 615.18756 L
178.97528 615.09373 L
178.97528 614.99934 L
178.97528 614.90551 L
179.06910 614.81169 L
179.16321 614.81169 L
179.25704 614.81169 L
179.25704 614.81169 L
179.35087 614.90551 L
179.44498 614.99934 L
179.53909 615.09373 L
179.53909 615.09373 L
179.44498 615.18756 L
179.35087 615.28139 L
179.35087 615.37521 L
179.25704 615.37521 L
@c
F
@rax %Note: Object
180.10261 614.81169 180.66643 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
180.38438 615.37521 m
180.29055 615.37521 L
180.19672 615.28139 L
180.10261 615.18756 L
180.10261 615.09373 L
180.10261 614.99934 L
180.10261 614.90551 L
180.19672 614.81169 L
180.29055 614.81169 L
180.38438 614.81169 L
180.38438 614.81169 L
180.47820 614.90551 L
180.57260 614.99934 L
180.66643 615.09373 L
180.66643 615.09373 L
180.57260 615.18756 L
180.47820 615.28139 L
180.47820 615.37521 L
180.38438 615.37521 L
@c
F
@rax %Note: Object
181.22995 614.81169 181.79376 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
181.51172 615.37521 m
181.41789 615.37521 L
181.32406 615.28139 L
181.22995 615.18756 L
181.22995 615.09373 L
181.22995 614.99934 L
181.22995 614.90551 L
181.32406 614.81169 L
181.41789 614.81169 L
181.51172 614.81169 L
181.51172 614.81169 L
181.60583 614.90551 L
181.69994 614.99934 L
181.79376 615.09373 L
181.79376 615.09373 L
181.69994 615.18756 L
181.60583 615.28139 L
181.60583 615.37521 L
181.51172 615.37521 L
@c
F
@rax %Note: Object
182.35729 614.81169 182.92082 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
182.63877 615.37521 m
182.54494 615.37521 L
182.45112 615.28139 L
182.35729 615.18756 L
182.35729 615.09373 L
182.35729 614.99934 L
182.35729 614.90551 L
182.45112 614.81169 L
182.54494 614.81169 L
182.63877 614.81169 L
182.63877 614.81169 L
182.73317 614.90551 L
182.82699 614.99934 L
182.92082 615.09373 L
182.92082 615.09373 L
182.82699 615.18756 L
182.73317 615.28139 L
182.73317 615.37521 L
182.63877 615.37521 L
@c
F
@rax %Note: Object
183.48463 614.81169 184.04816 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
183.76639 615.37521 m
183.67228 615.37521 L
183.57846 615.28139 L
183.48463 615.18756 L
183.48463 615.09373 L
183.48463 614.99934 L
183.48463 614.90551 L
183.57846 614.81169 L
183.67228 614.81169 L
183.76639 614.81169 L
183.76639 614.81169 L
183.86050 614.90551 L
183.95433 614.99934 L
184.04816 615.09373 L
184.04816 615.09373 L
183.95433 615.18756 L
183.86050 615.28139 L
183.86050 615.37521 L
183.76639 615.37521 L
@c
F
@rax %Note: Object
184.61197 614.81169 185.17550 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
184.89373 615.37521 m
184.79962 615.37521 L
184.70580 615.28139 L
184.61197 615.18756 L
184.61197 615.09373 L
184.61197 614.99934 L
184.61197 614.90551 L
184.70580 614.81169 L
184.79962 614.81169 L
184.89373 614.81169 L
184.89373 614.81169 L
184.98756 614.90551 L
185.08139 614.99934 L
185.17550 615.09373 L
185.17550 615.09373 L
185.08139 615.18756 L
184.98756 615.28139 L
184.98756 615.37521 L
184.89373 615.37521 L
@c
F
@rax %Note: Object
185.73902 614.81169 186.30283 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
186.02107 615.37521 m
185.92696 615.37521 L
185.83313 615.28139 L
185.73902 615.18756 L
185.73902 615.09373 L
185.73902 614.99934 L
185.73902 614.90551 L
185.83313 614.81169 L
185.92696 614.81169 L
186.02107 614.81169 L
186.02107 614.81169 L
186.11490 614.90551 L
186.20901 614.99934 L
186.30283 615.09373 L
186.30283 615.09373 L
186.20901 615.18756 L
186.11490 615.28139 L
186.11490 615.37521 L
186.02107 615.37521 L
@c
F
@rax %Note: Object
186.86636 614.81169 187.43017 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
187.14841 615.37521 m
187.05430 615.37521 L
186.96047 615.28139 L
186.86636 615.18756 L
186.86636 615.09373 L
186.86636 614.99934 L
186.86636 614.90551 L
186.96047 614.81169 L
187.05430 614.81169 L
187.14841 614.81169 L
187.14841 614.81169 L
187.24224 614.90551 L
187.33635 614.99934 L
187.43017 615.09373 L
187.43017 615.09373 L
187.33635 615.18756 L
187.24224 615.28139 L
187.24224 615.37521 L
187.14841 615.37521 L
@c
F
@rax %Note: Object
187.99370 614.81169 188.55723 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
188.27546 615.37521 m
188.18164 615.37521 L
188.08753 615.28139 L
187.99370 615.18756 L
187.99370 615.09373 L
187.99370 614.99934 L
187.99370 614.90551 L
188.08753 614.81169 L
188.18164 614.81169 L
188.27546 614.81169 L
188.27546 614.81169 L
188.36957 614.90551 L
188.46340 614.99934 L
188.55723 615.09373 L
188.55723 615.09373 L
188.46340 615.18756 L
188.36957 615.28139 L
188.36957 615.37521 L
188.27546 615.37521 L
@c
F
@rax %Note: Object
189.12104 614.81169 189.68457 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
189.40309 615.37521 m
189.30898 615.37521 L
189.21487 615.28139 L
189.12104 615.18756 L
189.12104 615.09373 L
189.12104 614.99934 L
189.12104 614.90551 L
189.21487 614.81169 L
189.30898 614.81169 L
189.40309 614.81169 L
189.40309 614.81169 L
189.49691 614.90551 L
189.59074 614.99934 L
189.68457 615.09373 L
189.68457 615.09373 L
189.59074 615.18756 L
189.49691 615.28139 L
189.49691 615.37521 L
189.40309 615.37521 L
@c
F
@rax %Note: Object
190.24838 614.81169 190.81191 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
190.53043 615.37521 m
190.43631 615.37521 L
190.34220 615.28139 L
190.24838 615.18756 L
190.24838 615.09373 L
190.24838 614.99934 L
190.24838 614.90551 L
190.34220 614.81169 L
190.43631 614.81169 L
190.53043 614.81169 L
190.53043 614.81169 L
190.62397 614.90551 L
190.71780 614.99934 L
190.81191 615.09373 L
190.81191 615.09373 L
190.71780 615.18756 L
190.62397 615.28139 L
190.62397 615.37521 L
190.53043 615.37521 L
@c
F
@rax %Note: Object
191.37543 614.81169 191.93924 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
191.65748 615.37521 m
191.56365 615.37521 L
191.46954 615.28139 L
191.37543 615.18756 L
191.37543 615.09373 L
191.37543 614.99934 L
191.37543 614.90551 L
191.46954 614.81169 L
191.56365 614.81169 L
191.65748 614.81169 L
191.65748 614.81169 L
191.75131 614.90551 L
191.84542 614.99934 L
191.93924 615.09373 L
191.93924 615.09373 L
191.84542 615.18756 L
191.75131 615.28139 L
191.75131 615.37521 L
191.65748 615.37521 L
@c
F
@rax %Note: Object
192.50277 614.81169 193.06658 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
192.78482 615.37521 m
192.69099 615.37521 L
192.59717 615.28139 L
192.50277 615.18756 L
192.50277 615.09373 L
192.50277 614.99934 L
192.50277 614.90551 L
192.59717 614.81169 L
192.69099 614.81169 L
192.78482 614.81169 L
192.78482 614.81169 L
192.87865 614.90551 L
192.97276 614.99934 L
193.06658 615.09373 L
193.06658 615.09373 L
192.97276 615.18756 L
192.87865 615.28139 L
192.87865 615.37521 L
192.78482 615.37521 L
@c
F
@rax %Note: Object
193.63011 614.81169 194.19392 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
193.91187 615.37521 m
193.81805 615.37521 L
193.72422 615.28139 L
193.63011 615.18756 L
193.63011 615.09373 L
193.63011 614.99934 L
193.63011 614.90551 L
193.72422 614.81169 L
193.81805 614.81169 L
193.91187 614.81169 L
193.91187 614.81169 L
194.00598 614.90551 L
194.09981 614.99934 L
194.19392 615.09373 L
194.19392 615.09373 L
194.09981 615.18756 L
194.00598 615.28139 L
194.00598 615.37521 L
193.91187 615.37521 L
@c
F
@rax %Note: Object
194.75773 614.81169 195.32126 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
195.03950 615.37521 m
194.94539 615.37521 L
194.85156 615.28139 L
194.75773 615.18756 L
194.75773 615.09373 L
194.75773 614.99934 L
194.75773 614.90551 L
194.85156 614.81169 L
194.94539 614.81169 L
195.03950 614.81169 L
195.03950 614.81169 L
195.13332 614.90551 L
195.22715 614.99934 L
195.32126 615.09373 L
195.32126 615.09373 L
195.22715 615.18756 L
195.13332 615.28139 L
195.13332 615.37521 L
195.03950 615.37521 L
@c
F
@rax %Note: Object
195.88507 614.81169 196.44860 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
196.16683 615.37521 m
196.07272 615.37521 L
195.97890 615.28139 L
195.88507 615.18756 L
195.88507 615.09373 L
195.88507 614.99934 L
195.88507 614.90551 L
195.97890 614.81169 L
196.07272 614.81169 L
196.16683 614.81169 L
196.16683 614.81169 L
196.26066 614.90551 L
196.35449 614.99934 L
196.44860 615.09373 L
196.44860 615.09373 L
196.35449 615.18756 L
196.26066 615.28139 L
196.26066 615.37521 L
196.16683 615.37521 L
@c
F
@rax %Note: Object
197.01213 614.81169 197.57594 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
197.29389 615.37521 m
197.20006 615.37521 L
197.10595 615.28139 L
197.01213 615.18756 L
197.01213 615.09373 L
197.01213 614.99934 L
197.01213 614.90551 L
197.10595 614.81169 L
197.20006 614.81169 L
197.29389 614.81169 L
197.29389 614.81169 L
197.38772 614.90551 L
197.48183 614.99934 L
197.57594 615.09373 L
197.57594 615.09373 L
197.48183 615.18756 L
197.38772 615.28139 L
197.38772 615.37521 L
197.29389 615.37521 L
@c
F
@rax %Note: Object
198.13946 614.81169 198.70328 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
198.42123 615.37521 m
198.32740 615.37521 L
198.23357 615.28139 L
198.13946 615.18756 L
198.13946 615.09373 L
198.13946 614.99934 L
198.13946 614.90551 L
198.23357 614.81169 L
198.32740 614.81169 L
198.42123 614.81169 L
198.42123 614.81169 L
198.51506 614.90551 L
198.60945 614.99934 L
198.70328 615.09373 L
198.70328 615.09373 L
198.60945 615.18756 L
198.51506 615.28139 L
198.51506 615.37521 L
198.42123 615.37521 L
@c
F
@rax %Note: Object
199.26680 614.81169 199.83033 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
199.54828 615.37521 m
199.45446 615.37521 L
199.36063 615.28139 L
199.26680 615.18756 L
199.26680 615.09373 L
199.26680 614.99934 L
199.26680 614.90551 L
199.36063 614.81169 L
199.45446 614.81169 L
199.54828 614.81169 L
199.54828 614.81169 L
199.64239 614.90551 L
199.73650 614.99934 L
199.83033 615.09373 L
199.83033 615.09373 L
199.73650 615.18756 L
199.64239 615.28139 L
199.64239 615.37521 L
199.54828 615.37521 L
@c
F
@rax %Note: Object
200.39414 614.81169 200.95767 615.37521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
200.67591 615.37521 m
200.58180 615.37521 L
200.48797 615.28139 L
200.39414 615.18756 L
200.39414 615.09373 L
200.39414 614.99934 L
200.39414 614.90551 L
200.48797 614.81169 L
200.58180 614.81169 L
200.67591 614.81169 L
200.67591 614.81169 L
200.76973 614.90551 L
200.86384 614.99934 L
200.95767 615.09373 L
200.95767 615.09373 L
200.86384 615.18756 L
200.76973 615.28139 L
200.76973 615.37521 L
200.67591 615.37521 L
@c
F
@rax %Note: Object
201.33354 612.08731 207.25172 618.00576 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
201.33354 612.08731 m
207.25172 615.09373 L
201.33354 618.00576 L
201.33354 612.08731 L
@c
F
@rax %Note: Object
179.82057 736.56000 180.38438 737.12353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
180.19672 737.12353 m
180.10261 737.12353 L
180.00879 737.02970 L
179.91468 736.93587 L
179.82057 736.84205 L
179.82057 736.84205 L
179.91468 736.74794 L
180.00879 736.65383 L
180.10261 736.56000 L
180.10261 736.56000 L
180.10261 736.56000 L
180.19672 736.65383 L
180.29055 736.74794 L
180.38438 736.84205 L
180.38438 736.84205 L
180.29055 736.93587 L
180.19672 737.02970 L
180.19672 737.12353 L
@c
F
@rax %Note: Object
180.94819 736.56000 181.51172 737.12353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
181.22995 737.12353 m
181.13613 737.12353 L
181.04202 737.02970 L
180.94819 736.93587 L
180.94819 736.84205 L
180.94819 736.74794 L
180.94819 736.65383 L
181.04202 736.56000 L
181.13613 736.56000 L
181.22995 736.56000 L
181.22995 736.56000 L
181.32406 736.65383 L
181.41789 736.74794 L
181.51172 736.84205 L
181.51172 736.84205 L
181.41789 736.93587 L
181.32406 737.02970 L
181.32406 737.12353 L
181.22995 737.12353 L
@c
F
@rax %Note: Object
182.07524 736.56000 182.63877 737.12353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
182.35729 737.12353 m
182.26318 737.12353 L
182.16935 737.02970 L
182.07524 736.93587 L
182.07524 736.84205 L
182.07524 736.74794 L
182.07524 736.65383 L
182.16935 736.56000 L
182.26318 736.56000 L
182.35729 736.56000 L
182.35729 736.56000 L
182.45112 736.65383 L
182.54494 736.74794 L
182.63877 736.84205 L
182.63877 736.84205 L
182.54494 736.93587 L
182.45112 737.02970 L
182.45112 737.12353 L
182.35729 737.12353 L
@c
F
@rax %Note: Object
183.20258 736.56000 183.76639 737.12353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
183.48463 737.12353 m
183.39080 737.12353 L
183.29669 737.02970 L
183.20258 736.93587 L
183.20258 736.84205 L
183.20258 736.74794 L
183.20258 736.65383 L
183.29669 736.56000 L
183.39080 736.56000 L
183.48463 736.56000 L
183.48463 736.56000 L
183.57846 736.65383 L
183.67228 736.74794 L
183.76639 736.84205 L
183.76639 736.84205 L
183.67228 736.93587 L
183.57846 737.02970 L
183.57846 737.12353 L
183.48463 737.12353 L
@c
F
@rax %Note: Object
184.32992 736.56000 184.89373 737.12353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
184.61197 737.12353 m
184.51814 737.12353 L
184.42403 737.02970 L
184.32992 736.93587 L
184.32992 736.84205 L
184.32992 736.74794 L
184.32992 736.65383 L
184.42403 736.56000 L
184.51814 736.56000 L
184.61197 736.56000 L
184.61197 736.56000 L
184.70580 736.65383 L
184.79962 736.74794 L
184.89373 736.84205 L
184.89373 736.84205 L
184.79962 736.93587 L
184.70580 737.02970 L
184.70580 737.12353 L
184.61197 737.12353 L
@c
F
@rax %Note: Object
185.45726 736.56000 186.02107 737.12353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
185.73902 737.12353 m
185.64520 737.12353 L
185.55137 737.02970 L
185.45726 736.93587 L
185.45726 736.84205 L
185.45726 736.74794 L
185.45726 736.65383 L
185.55137 736.56000 L
185.64520 736.56000 L
185.73902 736.56000 L
185.73902 736.56000 L
185.83313 736.65383 L
185.92696 736.74794 L
186.02107 736.84205 L
186.02107 736.84205 L
185.92696 736.93587 L
185.83313 737.02970 L
185.83313 737.12353 L
185.73902 737.12353 L
@c
F
@rax %Note: Object
186.58488 736.56000 187.14841 737.12353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
186.86636 737.12353 m
186.77254 737.12353 L
186.67871 737.02970 L
186.58488 736.93587 L
186.58488 736.84205 L
186.58488 736.74794 L
186.58488 736.65383 L
186.67871 736.56000 L
186.77254 736.56000 L
186.86636 736.56000 L
186.86636 736.56000 L
186.96047 736.65383 L
187.05430 736.74794 L
187.14841 736.84205 L
187.14841 736.84205 L
187.05430 736.93587 L
186.96047 737.02970 L
186.96047 737.12353 L
186.86636 737.12353 L
@c
F
@rax %Note: Object
187.71194 736.56000 188.27546 737.12353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
187.99370 737.12353 m
187.89959 737.12353 L
187.80576 737.02970 L
187.71194 736.93587 L
187.71194 736.84205 L
187.71194 736.74794 L
187.71194 736.65383 L
187.80576 736.56000 L
187.89959 736.56000 L
187.99370 736.56000 L
187.99370 736.56000 L
188.08753 736.65383 L
188.18164 736.74794 L
188.27546 736.84205 L
188.27546 736.84205 L
188.18164 736.93587 L
188.08753 737.02970 L
188.08753 737.12353 L
187.99370 737.12353 L
@c
F
@rax %Note: Object
188.83928 736.56000 189.40309 737.12353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
189.12104 737.12353 m
189.02721 737.12353 L
188.93310 737.02970 L
188.83928 736.93587 L
188.83928 736.84205 L
188.83928 736.74794 L
188.83928 736.65383 L
188.93310 736.56000 L
189.02721 736.56000 L
189.12104 736.56000 L
189.12104 736.56000 L
189.21487 736.65383 L
189.30898 736.74794 L
189.40309 736.84205 L
189.40309 736.84205 L
189.30898 736.93587 L
189.21487 737.02970 L
189.21487 737.12353 L
189.12104 737.12353 L
@c
F
@rax %Note: Object
189.96661 736.56000 190.53043 737.12353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
190.24838 737.12353 m
190.15455 737.12353 L
190.06044 737.02970 L
189.96661 736.93587 L
189.96661 736.84205 L
189.96661 736.74794 L
189.96661 736.65383 L
190.06044 736.56000 L
190.15455 736.56000 L
190.24838 736.56000 L
190.24838 736.56000 L
190.34220 736.65383 L
190.43631 736.74794 L
190.53043 736.84205 L
190.53043 736.84205 L
190.43631 736.93587 L
190.34220 737.02970 L
190.34220 737.12353 L
190.24838 737.12353 L
@c
F
@rax %Note: Object
191.09367 736.56000 191.65748 737.12353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
191.37543 737.12353 m
191.28161 737.12353 L
191.18778 737.02970 L
191.09367 736.93587 L
191.09367 736.84205 L
191.09367 736.74794 L
191.09367 736.65383 L
191.18778 736.56000 L
191.28161 736.56000 L
191.37543 736.56000 L
191.37543 736.56000 L
191.46954 736.65383 L
191.56365 736.74794 L
191.65748 736.84205 L
191.65748 736.84205 L
191.56365 736.93587 L
191.46954 737.02970 L
191.46954 737.12353 L
191.37543 737.12353 L
@c
F
@rax %Note: Object
192.22129 736.56000 192.78482 737.12353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
192.50277 737.12353 m
192.40894 737.12353 L
192.31512 737.02970 L
192.22129 736.93587 L
192.22129 736.84205 L
192.22129 736.74794 L
192.22129 736.65383 L
192.31512 736.56000 L
192.40894 736.56000 L
192.50277 736.56000 L
192.50277 736.56000 L
192.59717 736.65383 L
192.69099 736.74794 L
192.78482 736.84205 L
192.78482 736.84205 L
192.69099 736.93587 L
192.59717 737.02970 L
192.59717 737.12353 L
192.50277 737.12353 L
@c
F
@rax %Note: Object
193.34863 736.56000 193.91187 737.12353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
193.63011 737.12353 m
193.53600 737.12353 L
193.44246 737.02970 L
193.34863 736.93587 L
193.34863 736.84205 L
193.34863 736.74794 L
193.34863 736.65383 L
193.44246 736.56000 L
193.53600 736.56000 L
193.63011 736.56000 L
193.63011 736.56000 L
193.72422 736.65383 L
193.81805 736.74794 L
193.91187 736.84205 L
193.91187 736.84205 L
193.81805 736.93587 L
193.72422 737.02970 L
193.72422 737.12353 L
193.63011 737.12353 L
@c
F
@rax %Note: Object
194.47569 736.56000 195.03950 737.12353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
194.75773 737.12353 m
194.66362 737.12353 L
194.56951 737.02970 L
194.47569 736.93587 L
194.47569 736.84205 L
194.47569 736.74794 L
194.47569 736.65383 L
194.56951 736.56000 L
194.66362 736.56000 L
194.75773 736.56000 L
194.75773 736.56000 L
194.85156 736.65383 L
194.94539 736.74794 L
195.03950 736.84205 L
195.03950 736.84205 L
194.94539 736.93587 L
194.85156 737.02970 L
194.85156 737.12353 L
194.75773 737.12353 L
@c
F
@rax %Note: Object
195.60302 736.56000 196.16683 737.12353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
195.88507 737.12353 m
195.79096 737.12353 L
195.69685 737.02970 L
195.60302 736.93587 L
195.60302 736.84205 L
195.60302 736.74794 L
195.60302 736.65383 L
195.69685 736.56000 L
195.79096 736.56000 L
195.88507 736.56000 L
195.88507 736.56000 L
195.97890 736.65383 L
196.07272 736.74794 L
196.16683 736.84205 L
196.16683 736.84205 L
196.07272 736.93587 L
195.97890 737.02970 L
195.97890 737.12353 L
195.88507 737.12353 L
@c
F
@rax %Note: Object
196.73008 736.56000 197.29389 737.12353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
197.01213 737.12353 m
196.91802 737.12353 L
196.82419 737.02970 L
196.73008 736.93587 L
196.73008 736.84205 L
196.73008 736.74794 L
196.73008 736.65383 L
196.82419 736.56000 L
196.91802 736.56000 L
197.01213 736.56000 L
197.01213 736.56000 L
197.10595 736.65383 L
197.20006 736.74794 L
197.29389 736.84205 L
197.29389 736.84205 L
197.20006 736.93587 L
197.10595 737.02970 L
197.10595 737.12353 L
197.01213 737.12353 L
@c
F
@rax %Note: Object
197.85770 736.56000 198.42123 737.12353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
198.13946 737.12353 m
198.04564 737.12353 L
197.95153 737.02970 L
197.85770 736.93587 L
197.85770 736.84205 L
197.85770 736.74794 L
197.85770 736.65383 L
197.95153 736.56000 L
198.04564 736.56000 L
198.13946 736.56000 L
198.13946 736.56000 L
198.23357 736.65383 L
198.32740 736.74794 L
198.42123 736.84205 L
198.42123 736.84205 L
198.32740 736.93587 L
198.23357 737.02970 L
198.23357 737.12353 L
198.13946 737.12353 L
@c
F
@rax %Note: Object
198.98504 736.56000 199.54828 737.12353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
199.26680 737.12353 m
199.17298 737.12353 L
199.07887 737.02970 L
198.98504 736.93587 L
198.98504 736.84205 L
198.98504 736.74794 L
198.98504 736.65383 L
199.07887 736.56000 L
199.17298 736.56000 L
199.26680 736.56000 L
199.26680 736.56000 L
199.36063 736.65383 L
199.45446 736.74794 L
199.54828 736.84205 L
199.54828 736.84205 L
199.45446 736.93587 L
199.36063 737.02970 L
199.36063 737.12353 L
199.26680 737.12353 L
@c
F
@rax %Note: Object
200.11209 736.56000 200.67591 737.12353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
200.39414 737.12353 m
200.30031 737.12353 L
200.20592 737.02970 L
200.11209 736.93587 L
200.11209 736.84205 L
200.11209 736.74794 L
200.11209 736.65383 L
200.20592 736.56000 L
200.30031 736.56000 L
200.39414 736.56000 L
200.39414 736.56000 L
200.48797 736.65383 L
200.58180 736.74794 L
200.67591 736.84205 L
200.67591 736.84205 L
200.58180 736.93587 L
200.48797 737.02970 L
200.48797 737.12353 L
200.39414 737.12353 L
@c
F
@rax %Note: Object
201.33354 733.83562 207.25172 739.75408 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
201.33354 733.83562 m
207.25172 736.84205 L
201.33354 739.75408 L
201.33354 733.83562 L
@c
F
@rax %Note: Object
227.73061 202.50142 227.73175 203.62904 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
227.73118 202.50142 m
227.73118 203.62904 L
S
@rax %Note: Object
224.81887 203.34699 230.73732 209.26545 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
230.73732 203.34699 m
227.73118 209.26545 L
224.81887 203.34699 L
230.73732 203.34699 L
@c
F
@rax %Note: Object
191.37543 109.78129 191.93924 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
191.75131 109.78129 m
191.75131 109.87512 L
191.84542 109.96923 L
191.93924 110.06306 L
191.93924 110.06306 L
191.84542 110.15717 L
191.75131 110.25099 L
191.65748 110.34454 L
191.65748 110.34454 L
191.56365 110.34454 L
191.46954 110.25099 L
191.37543 110.15717 L
191.37543 110.06306 L
191.37543 109.96923 L
191.37543 109.87512 L
191.46954 109.78129 L
191.56365 109.78129 L
191.65748 109.78129 L
191.75131 109.78129 L
@c
F
@rax %Note: Object
190.24838 109.78129 190.81191 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
190.62397 109.78129 m
190.62397 109.87512 L
190.71780 109.96923 L
190.81191 110.06306 L
190.81191 110.06306 L
190.71780 110.15717 L
190.62397 110.25099 L
190.53043 110.34454 L
190.53043 110.34454 L
190.43631 110.34454 L
190.34220 110.25099 L
190.24838 110.15717 L
190.24838 110.06306 L
190.24838 109.96923 L
190.24838 109.87512 L
190.34220 109.78129 L
190.43631 109.78129 L
190.53043 109.78129 L
190.62397 109.78129 L
@c
F
@rax %Note: Object
189.12104 109.78129 189.68457 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
189.49691 109.78129 m
189.49691 109.87512 L
189.59074 109.96923 L
189.68457 110.06306 L
189.68457 110.06306 L
189.59074 110.15717 L
189.49691 110.25099 L
189.40309 110.34454 L
189.40309 110.34454 L
189.30898 110.34454 L
189.21487 110.25099 L
189.12104 110.15717 L
189.12104 110.06306 L
189.12104 109.96923 L
189.12104 109.87512 L
189.21487 109.78129 L
189.30898 109.78129 L
189.40309 109.78129 L
189.49691 109.78129 L
@c
F
@rax %Note: Object
187.99370 109.78129 188.55723 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
188.36957 109.78129 m
188.36957 109.87512 L
188.46340 109.96923 L
188.55723 110.06306 L
188.55723 110.06306 L
188.46340 110.15717 L
188.36957 110.25099 L
188.27546 110.34454 L
188.27546 110.34454 L
188.18164 110.34454 L
188.08753 110.25099 L
187.99370 110.15717 L
187.99370 110.06306 L
187.99370 109.96923 L
187.99370 109.87512 L
188.08753 109.78129 L
188.18164 109.78129 L
188.27546 109.78129 L
188.36957 109.78129 L
@c
F
@rax %Note: Object
186.86636 109.78129 187.43017 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
187.24224 109.78129 m
187.24224 109.87512 L
187.33635 109.96923 L
187.43017 110.06306 L
187.43017 110.06306 L
187.33635 110.15717 L
187.24224 110.25099 L
187.14841 110.34454 L
187.14841 110.34454 L
187.05430 110.34454 L
186.96047 110.25099 L
186.86636 110.15717 L
186.86636 110.06306 L
186.86636 109.96923 L
186.86636 109.87512 L
186.96047 109.78129 L
187.05430 109.78129 L
187.14841 109.78129 L
187.24224 109.78129 L
@c
F
@rax %Note: Object
185.73902 109.78129 186.30283 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
186.11490 109.78129 m
186.11490 109.87512 L
186.20901 109.96923 L
186.30283 110.06306 L
186.30283 110.06306 L
186.20901 110.15717 L
186.11490 110.25099 L
186.02107 110.34454 L
186.02107 110.34454 L
185.92696 110.34454 L
185.83313 110.25099 L
185.73902 110.15717 L
185.73902 110.06306 L
185.73902 109.96923 L
185.73902 109.87512 L
185.83313 109.78129 L
185.92696 109.78129 L
186.02107 109.78129 L
186.11490 109.78129 L
@c
F
@rax %Note: Object
184.61197 109.78129 185.17550 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
184.98756 109.78129 m
184.98756 109.87512 L
185.08139 109.96923 L
185.17550 110.06306 L
185.17550 110.06306 L
185.08139 110.15717 L
184.98756 110.25099 L
184.89373 110.34454 L
184.89373 110.34454 L
184.79962 110.34454 L
184.70580 110.25099 L
184.61197 110.15717 L
184.61197 110.06306 L
184.61197 109.96923 L
184.61197 109.87512 L
184.70580 109.78129 L
184.79962 109.78129 L
184.89373 109.78129 L
184.98756 109.78129 L
@c
F
@rax %Note: Object
183.48463 109.78129 184.04816 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
183.86050 109.78129 m
183.86050 109.87512 L
183.95433 109.96923 L
184.04816 110.06306 L
184.04816 110.06306 L
183.95433 110.15717 L
183.86050 110.25099 L
183.76639 110.34454 L
183.76639 110.34454 L
183.67228 110.34454 L
183.57846 110.25099 L
183.48463 110.15717 L
183.48463 110.06306 L
183.48463 109.96923 L
183.48463 109.87512 L
183.57846 109.78129 L
183.67228 109.78129 L
183.76639 109.78129 L
183.86050 109.78129 L
@c
F
@rax %Note: Object
182.35729 109.78129 182.92082 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
182.73317 109.78129 m
182.73317 109.87512 L
182.82699 109.96923 L
182.92082 110.06306 L
182.92082 110.06306 L
182.82699 110.15717 L
182.73317 110.25099 L
182.63877 110.34454 L
182.63877 110.34454 L
182.54494 110.34454 L
182.45112 110.25099 L
182.35729 110.15717 L
182.35729 110.06306 L
182.35729 109.96923 L
182.35729 109.87512 L
182.45112 109.78129 L
182.54494 109.78129 L
182.63877 109.78129 L
182.73317 109.78129 L
@c
F
@rax %Note: Object
181.22995 109.78129 181.79376 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
181.60583 109.78129 m
181.60583 109.87512 L
181.69994 109.96923 L
181.79376 110.06306 L
181.79376 110.06306 L
181.69994 110.15717 L
181.60583 110.25099 L
181.51172 110.34454 L
181.51172 110.34454 L
181.41789 110.34454 L
181.32406 110.25099 L
181.22995 110.15717 L
181.22995 110.06306 L
181.22995 109.96923 L
181.22995 109.87512 L
181.32406 109.78129 L
181.41789 109.78129 L
181.51172 109.78129 L
181.60583 109.78129 L
@c
F
@rax %Note: Object
180.10261 109.78129 180.66643 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
180.47820 109.78129 m
180.47820 109.87512 L
180.57260 109.96923 L
180.66643 110.06306 L
180.66643 110.06306 L
180.57260 110.15717 L
180.47820 110.25099 L
180.38438 110.34454 L
180.38438 110.34454 L
180.29055 110.34454 L
180.19672 110.25099 L
180.10261 110.15717 L
180.10261 110.06306 L
180.10261 109.96923 L
180.10261 109.87512 L
180.19672 109.78129 L
180.29055 109.78129 L
180.38438 109.78129 L
180.47820 109.78129 L
@c
F
@rax %Note: Object
178.97528 109.78129 179.53909 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
179.35087 109.78129 m
179.35087 109.87512 L
179.44498 109.96923 L
179.53909 110.06306 L
179.53909 110.06306 L
179.44498 110.15717 L
179.35087 110.25099 L
179.25704 110.34454 L
179.25704 110.34454 L
179.16321 110.34454 L
179.06910 110.25099 L
178.97528 110.15717 L
178.97528 110.06306 L
178.97528 109.96923 L
178.97528 109.87512 L
179.06910 109.78129 L
179.16321 109.78129 L
179.25704 109.78129 L
179.35087 109.78129 L
@c
F
@rax %Note: Object
177.84822 109.78129 178.41175 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
178.22381 109.78129 m
178.22381 109.87512 L
178.31792 109.96923 L
178.41175 110.06306 L
178.41175 110.06306 L
178.31792 110.15717 L
178.22381 110.25099 L
178.12998 110.34454 L
178.12998 110.34454 L
178.03587 110.34454 L
177.94205 110.25099 L
177.84822 110.15717 L
177.84822 110.06306 L
177.84822 109.96923 L
177.84822 109.87512 L
177.94205 109.78129 L
178.03587 109.78129 L
178.12998 109.78129 L
178.22381 109.78129 L
@c
F
@rax %Note: Object
176.72088 109.78129 177.28441 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
177.09647 109.78129 m
177.09647 109.87512 L
177.19030 109.96923 L
177.28441 110.06306 L
177.28441 110.06306 L
177.19030 110.15717 L
177.09647 110.25099 L
177.00236 110.34454 L
177.00236 110.34454 L
176.90854 110.34454 L
176.81471 110.25099 L
176.72088 110.15717 L
176.72088 110.06306 L
176.72088 109.96923 L
176.72088 109.87512 L
176.81471 109.78129 L
176.90854 109.78129 L
177.00236 109.78129 L
177.09647 109.78129 L
@c
F
@rax %Note: Object
175.59354 109.78129 176.15707 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
175.96913 109.78129 m
175.96913 109.87512 L
176.06296 109.96923 L
176.15707 110.06306 L
176.15707 110.06306 L
176.06296 110.15717 L
175.96913 110.25099 L
175.87531 110.34454 L
175.87531 110.34454 L
175.78148 110.34454 L
175.68765 110.25099 L
175.59354 110.15717 L
175.59354 110.06306 L
175.59354 109.96923 L
175.59354 109.87512 L
175.68765 109.78129 L
175.78148 109.78129 L
175.87531 109.78129 L
175.96913 109.78129 L
@c
F
@rax %Note: Object
174.46620 109.78129 175.03002 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
174.84180 109.78129 m
174.84180 109.87512 L
174.93591 109.96923 L
175.03002 110.06306 L
175.03002 110.06306 L
174.93591 110.15717 L
174.84180 110.25099 L
174.74797 110.34454 L
174.74797 110.34454 L
174.65414 110.34454 L
174.56031 110.25099 L
174.46620 110.15717 L
174.46620 110.06306 L
174.46620 109.96923 L
174.46620 109.87512 L
174.56031 109.78129 L
174.65414 109.78129 L
174.74797 109.78129 L
174.84180 109.78129 L
@c
F
@rax %Note: Object
173.33858 109.78129 173.90239 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
173.71446 109.78129 m
173.71446 109.87512 L
173.80828 109.96923 L
173.90239 110.06306 L
173.90239 110.06306 L
173.80828 110.15717 L
173.71446 110.25099 L
173.62063 110.34454 L
173.62063 110.34454 L
173.52680 110.34454 L
173.43269 110.25099 L
173.33858 110.15717 L
173.33858 110.06306 L
173.33858 109.96923 L
173.33858 109.87512 L
173.43269 109.78129 L
173.52680 109.78129 L
173.62063 109.78129 L
173.71446 109.78129 L
@c
F
@rax %Note: Object
172.21153 109.78129 172.77506 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
172.58740 109.78129 m
172.58740 109.87512 L
172.68123 109.96923 L
172.77506 110.06306 L
172.77506 110.06306 L
172.68123 110.15717 L
172.58740 110.25099 L
172.49357 110.34454 L
172.49357 110.34454 L
172.39946 110.34454 L
172.30564 110.25099 L
172.21153 110.15717 L
172.21153 110.06306 L
172.21153 109.96923 L
172.21153 109.87512 L
172.30564 109.78129 L
172.39946 109.78129 L
172.49357 109.78129 L
172.58740 109.78129 L
@c
F
@rax %Note: Object
171.08419 109.78129 171.64772 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
171.46006 109.78129 m
171.46006 109.87512 L
171.55389 109.96923 L
171.64772 110.06306 L
171.64772 110.06306 L
171.55389 110.15717 L
171.46006 110.25099 L
171.36624 110.34454 L
171.36624 110.34454 L
171.27213 110.34454 L
171.17802 110.25099 L
171.08419 110.15717 L
171.08419 110.06306 L
171.08419 109.96923 L
171.08419 109.87512 L
171.17802 109.78129 L
171.27213 109.78129 L
171.36624 109.78129 L
171.46006 109.78129 L
@c
F
@rax %Note: Object
169.95685 109.78129 170.52038 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
170.33272 109.78129 m
170.33272 109.87512 L
170.42655 109.96923 L
170.52038 110.06306 L
170.52038 110.06306 L
170.42655 110.15717 L
170.33272 110.25099 L
170.23861 110.34454 L
170.23861 110.34454 L
170.14507 110.34454 L
170.05096 110.25099 L
169.95685 110.15717 L
169.95685 110.06306 L
169.95685 109.96923 L
169.95685 109.87512 L
170.05096 109.78129 L
170.14507 109.78129 L
170.23861 109.78129 L
170.33272 109.78129 L
@c
F
@rax %Note: Object
168.82951 109.78129 169.39332 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
169.20539 109.78129 m
169.20539 109.87512 L
169.29950 109.96923 L
169.39332 110.06306 L
169.39332 110.06306 L
169.29950 110.15717 L
169.20539 110.25099 L
169.11156 110.34454 L
169.11156 110.34454 L
169.01773 110.34454 L
168.92362 110.25099 L
168.82951 110.15717 L
168.82951 110.06306 L
168.82951 109.96923 L
168.82951 109.87512 L
168.92362 109.78129 L
169.01773 109.78129 L
169.11156 109.78129 L
169.20539 109.78129 L
@c
F
@rax %Note: Object
167.70217 109.78129 168.26598 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
168.07805 109.78129 m
168.07805 109.87512 L
168.17187 109.96923 L
168.26598 110.06306 L
168.26598 110.06306 L
168.17187 110.15717 L
168.07805 110.25099 L
167.98422 110.34454 L
167.98422 110.34454 L
167.89011 110.34454 L
167.79600 110.25099 L
167.70217 110.15717 L
167.70217 110.06306 L
167.70217 109.96923 L
167.70217 109.87512 L
167.79600 109.78129 L
167.89011 109.78129 L
167.98422 109.78129 L
168.07805 109.78129 L
@c
F
@rax %Note: Object
166.57512 109.78129 167.13865 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
166.95099 109.78129 m
166.95099 109.87512 L
167.04482 109.96923 L
167.13865 110.06306 L
167.13865 110.06306 L
167.04482 110.15717 L
166.95099 110.25099 L
166.85717 110.34454 L
166.85717 110.34454 L
166.76277 110.34454 L
166.66894 110.25099 L
166.57512 110.15717 L
166.57512 110.06306 L
166.57512 109.96923 L
166.57512 109.87512 L
166.66894 109.78129 L
166.76277 109.78129 L
166.85717 109.78129 L
166.95099 109.78129 L
@c
F
@rax %Note: Object
165.44778 109.78129 166.01131 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
165.82365 109.78129 m
165.82365 109.87512 L
165.91748 109.96923 L
166.01131 110.06306 L
166.01131 110.06306 L
165.91748 110.15717 L
165.82365 110.25099 L
165.72983 110.34454 L
165.72983 110.34454 L
165.63543 110.34454 L
165.54161 110.25099 L
165.44778 110.15717 L
165.44778 110.06306 L
165.44778 109.96923 L
165.44778 109.87512 L
165.54161 109.78129 L
165.63543 109.78129 L
165.72983 109.78129 L
165.82365 109.78129 L
@c
F
@rax %Note: Object
164.32044 109.78129 164.88397 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
164.69631 109.78129 m
164.69631 109.87512 L
164.79014 109.96923 L
164.88397 110.06306 L
164.88397 110.06306 L
164.79014 110.15717 L
164.69631 110.25099 L
164.60220 110.34454 L
164.60220 110.34454 L
164.50809 110.34454 L
164.41455 110.25099 L
164.32044 110.15717 L
164.32044 110.06306 L
164.32044 109.96923 L
164.32044 109.87512 L
164.41455 109.78129 L
164.50809 109.78129 L
164.60220 109.78129 L
164.69631 109.78129 L
@c
F
@rax %Note: Object
163.19310 109.78129 163.75691 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
163.56898 109.78129 m
163.56898 109.87512 L
163.66309 109.96923 L
163.75691 110.06306 L
163.75691 110.06306 L
163.66309 110.15717 L
163.56898 110.25099 L
163.47487 110.34454 L
163.47487 110.34454 L
163.38104 110.34454 L
163.28721 110.25099 L
163.19310 110.15717 L
163.19310 110.06306 L
163.19310 109.96923 L
163.19310 109.87512 L
163.28721 109.78129 L
163.38104 109.78129 L
163.47487 109.78129 L
163.56898 109.78129 L
@c
F
@rax %Note: Object
162.06576 109.78129 162.62957 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
162.44164 109.78129 m
162.44164 109.87512 L
162.53546 109.96923 L
162.62957 110.06306 L
162.62957 110.06306 L
162.53546 110.15717 L
162.44164 110.25099 L
162.34753 110.34454 L
162.34753 110.34454 L
162.25370 110.34454 L
162.15959 110.25099 L
162.06576 110.15717 L
162.06576 110.06306 L
162.06576 109.96923 L
162.06576 109.87512 L
162.15959 109.78129 L
162.25370 109.78129 L
162.34753 109.78129 L
162.44164 109.78129 L
@c
F
@rax %Note: Object
160.93871 109.78129 161.50224 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
161.31430 109.78129 m
161.31430 109.87512 L
161.40841 109.96923 L
161.50224 110.06306 L
161.50224 110.06306 L
161.40841 110.15717 L
161.31430 110.25099 L
161.22047 110.34454 L
161.22047 110.34454 L
161.12636 110.34454 L
161.03254 110.25099 L
160.93871 110.15717 L
160.93871 110.06306 L
160.93871 109.96923 L
160.93871 109.87512 L
161.03254 109.78129 L
161.12636 109.78129 L
161.22047 109.78129 L
161.31430 109.78129 L
@c
F
@rax %Note: Object
159.81137 109.78129 160.37490 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
160.18696 109.78129 m
160.18696 109.87512 L
160.28107 109.96923 L
160.37490 110.06306 L
160.37490 110.06306 L
160.28107 110.15717 L
160.18696 110.25099 L
160.09313 110.34454 L
160.09313 110.34454 L
159.99902 110.34454 L
159.90520 110.25099 L
159.81137 110.15717 L
159.81137 110.06306 L
159.81137 109.96923 L
159.81137 109.87512 L
159.90520 109.78129 L
159.99902 109.78129 L
160.09313 109.78129 L
160.18696 109.78129 L
@c
F
@rax %Note: Object
158.68403 109.78129 159.24756 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
159.05962 109.78129 m
159.05962 109.87512 L
159.15373 109.96923 L
159.24756 110.06306 L
159.24756 110.06306 L
159.15373 110.15717 L
159.05962 110.25099 L
158.96551 110.34454 L
158.96551 110.34454 L
158.87169 110.34454 L
158.77786 110.25099 L
158.68403 110.15717 L
158.68403 110.06306 L
158.68403 109.96923 L
158.68403 109.87512 L
158.77786 109.78129 L
158.87169 109.78129 L
158.96551 109.78129 L
159.05962 109.78129 L
@c
F
@rax %Note: Object
157.55669 109.78129 158.12050 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
157.93228 109.78129 m
157.93228 109.87512 L
158.02639 109.96923 L
158.12050 110.06306 L
158.12050 110.06306 L
158.02639 110.15717 L
157.93228 110.25099 L
157.83846 110.34454 L
157.83846 110.34454 L
157.74463 110.34454 L
157.65080 110.25099 L
157.55669 110.15717 L
157.55669 110.06306 L
157.55669 109.96923 L
157.55669 109.87512 L
157.65080 109.78129 L
157.74463 109.78129 L
157.83846 109.78129 L
157.93228 109.78129 L
@c
F
@rax %Note: Object
156.42935 109.78129 156.99317 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
156.80494 109.78129 m
156.80494 109.87512 L
156.89906 109.96923 L
156.99317 110.06306 L
156.99317 110.06306 L
156.89906 110.15717 L
156.80494 110.25099 L
156.71112 110.34454 L
156.71112 110.34454 L
156.61729 110.34454 L
156.52318 110.25099 L
156.42935 110.15717 L
156.42935 110.06306 L
156.42935 109.96923 L
156.42935 109.87512 L
156.52318 109.78129 L
156.61729 109.78129 L
156.71112 109.78129 L
156.80494 109.78129 L
@c
F
@rax %Note: Object
155.30202 109.78129 155.86583 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
155.67789 109.78129 m
155.67789 109.87512 L
155.77143 109.96923 L
155.86583 110.06306 L
155.86583 110.06306 L
155.77143 110.15717 L
155.67789 110.25099 L
155.58406 110.34454 L
155.58406 110.34454 L
155.48995 110.34454 L
155.39613 110.25099 L
155.30202 110.15717 L
155.30202 110.06306 L
155.30202 109.96923 L
155.30202 109.87512 L
155.39613 109.78129 L
155.48995 109.78129 L
155.58406 109.78129 L
155.67789 109.78129 L
@c
F
@rax %Note: Object
154.17468 109.78129 154.73820 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
154.55055 109.78129 m
154.55055 109.87512 L
154.64438 109.96923 L
154.73820 110.06306 L
154.73820 110.06306 L
154.64438 110.15717 L
154.55055 110.25099 L
154.45672 110.34454 L
154.45672 110.34454 L
154.36261 110.34454 L
154.26879 110.25099 L
154.17468 110.15717 L
154.17468 110.06306 L
154.17468 109.96923 L
154.17468 109.87512 L
154.26879 109.78129 L
154.36261 109.78129 L
154.45672 109.78129 L
154.55055 109.78129 L
@c
F
@rax %Note: Object
153.04734 109.78129 153.61087 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
153.42321 109.78129 m
153.42321 109.87512 L
153.51704 109.96923 L
153.61087 110.06306 L
153.61087 110.06306 L
153.51704 110.15717 L
153.42321 110.25099 L
153.32910 110.34454 L
153.32910 110.34454 L
153.23528 110.34454 L
153.14145 110.25099 L
153.04734 110.15717 L
153.04734 110.06306 L
153.04734 109.96923 L
153.04734 109.87512 L
153.14145 109.78129 L
153.23528 109.78129 L
153.32910 109.78129 L
153.42321 109.78129 L
@c
F
@rax %Note: Object
151.92000 109.78129 152.48381 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
152.29587 109.78129 m
152.29587 109.87512 L
152.38998 109.96923 L
152.48381 110.06306 L
152.48381 110.06306 L
152.38998 110.15717 L
152.29587 110.25099 L
152.20205 110.34454 L
152.20205 110.34454 L
152.10822 110.34454 L
152.01411 110.25099 L
151.92000 110.15717 L
151.92000 110.06306 L
151.92000 109.96923 L
151.92000 109.87512 L
152.01411 109.78129 L
152.10822 109.78129 L
152.20205 109.78129 L
152.29587 109.78129 L
@c
F
@rax %Note: Object
150.79266 109.78129 151.35647 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
151.16854 109.78129 m
151.16854 109.87512 L
151.26265 109.96923 L
151.35647 110.06306 L
151.35647 110.06306 L
151.26265 110.15717 L
151.16854 110.25099 L
151.07471 110.34454 L
151.07471 110.34454 L
150.98088 110.34454 L
150.88649 110.25099 L
150.79266 110.15717 L
150.79266 110.06306 L
150.79266 109.96923 L
150.79266 109.87512 L
150.88649 109.78129 L
150.98088 109.78129 L
151.07471 109.78129 L
151.16854 109.78129 L
@c
F
@rax %Note: Object
149.66561 109.78129 150.22913 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
150.04120 109.78129 m
150.04120 109.87512 L
150.13502 109.96923 L
150.22913 110.06306 L
150.22913 110.06306 L
150.13502 110.15717 L
150.04120 110.25099 L
149.94737 110.34454 L
149.94737 110.34454 L
149.85354 110.34454 L
149.75943 110.25099 L
149.66561 110.15717 L
149.66561 110.06306 L
149.66561 109.96923 L
149.66561 109.87512 L
149.75943 109.78129 L
149.85354 109.78129 L
149.94737 109.78129 L
150.04120 109.78129 L
@c
F
@rax %Note: Object
148.53827 109.78129 149.10180 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
148.91414 109.78129 m
148.91414 109.87512 L
149.00797 109.96923 L
149.10180 110.06306 L
149.10180 110.06306 L
149.00797 110.15717 L
148.91414 110.25099 L
148.82031 110.34454 L
148.82031 110.34454 L
148.72620 110.34454 L
148.63209 110.25099 L
148.53827 110.15717 L
148.53827 110.06306 L
148.53827 109.96923 L
148.53827 109.87512 L
148.63209 109.78129 L
148.72620 109.78129 L
148.82031 109.78129 L
148.91414 109.78129 L
@c
F
@rax %Note: Object
147.41093 109.78129 147.97446 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
147.78680 109.78129 m
147.78680 109.87512 L
147.88063 109.96923 L
147.97446 110.06306 L
147.97446 110.06306 L
147.88063 110.15717 L
147.78680 110.25099 L
147.69269 110.34454 L
147.69269 110.34454 L
147.59858 110.34454 L
147.50476 110.25099 L
147.41093 110.15717 L
147.41093 110.06306 L
147.41093 109.96923 L
147.41093 109.87512 L
147.50476 109.78129 L
147.59858 109.78129 L
147.69269 109.78129 L
147.78680 109.78129 L
@c
F
@rax %Note: Object
146.28359 109.78129 146.84740 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
146.65946 109.78129 m
146.65946 109.87512 L
146.75357 109.96923 L
146.84740 110.06306 L
146.84740 110.06306 L
146.75357 110.15717 L
146.65946 110.25099 L
146.56564 110.34454 L
146.56564 110.34454 L
146.47153 110.34454 L
146.37770 110.25099 L
146.28359 110.15717 L
146.28359 110.06306 L
146.28359 109.96923 L
146.28359 109.87512 L
146.37770 109.78129 L
146.47153 109.78129 L
146.56564 109.78129 L
146.65946 109.78129 L
@c
F
@rax %Note: Object
145.15625 109.78129 145.72006 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
145.53213 109.78129 m
145.53213 109.87512 L
145.62624 109.96923 L
145.72006 110.06306 L
145.72006 110.06306 L
145.62624 110.15717 L
145.53213 110.25099 L
145.43830 110.34454 L
145.43830 110.34454 L
145.34419 110.34454 L
145.25008 110.25099 L
145.15625 110.15717 L
145.15625 110.06306 L
145.15625 109.96923 L
145.15625 109.87512 L
145.25008 109.78129 L
145.34419 109.78129 L
145.43830 109.78129 L
145.53213 109.78129 L
@c
F
@rax %Note: Object
144.02920 109.78129 144.59272 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
144.40479 109.78129 m
144.40479 109.87512 L
144.49861 109.96923 L
144.59272 110.06306 L
144.59272 110.06306 L
144.49861 110.15717 L
144.40479 110.25099 L
144.31068 110.34454 L
144.31068 110.34454 L
144.21685 110.34454 L
144.12274 110.25099 L
144.02920 110.15717 L
144.02920 110.06306 L
144.02920 109.96923 L
144.02920 109.87512 L
144.12274 109.78129 L
144.21685 109.78129 L
144.31068 109.78129 L
144.40479 109.78129 L
@c
F
@rax %Note: Object
142.90186 109.78129 143.46539 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
143.27773 109.78129 m
143.27773 109.87512 L
143.37156 109.96923 L
143.46539 110.06306 L
143.46539 110.06306 L
143.37156 110.15717 L
143.27773 110.25099 L
143.18362 110.34454 L
143.18362 110.34454 L
143.08951 110.34454 L
142.99569 110.25099 L
142.90186 110.15717 L
142.90186 110.06306 L
142.90186 109.96923 L
142.90186 109.87512 L
142.99569 109.78129 L
143.08951 109.78129 L
143.18362 109.78129 L
143.27773 109.78129 L
@c
F
@rax %Note: Object
141.77452 109.78129 142.33805 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
142.15011 109.78129 m
142.15011 109.87512 L
142.24422 109.96923 L
142.33805 110.06306 L
142.33805 110.06306 L
142.24422 110.15717 L
142.15011 110.25099 L
142.05600 110.34454 L
142.05600 110.34454 L
141.96217 110.34454 L
141.86835 110.25099 L
141.77452 110.15717 L
141.77452 110.06306 L
141.77452 109.96923 L
141.77452 109.87512 L
141.86835 109.78129 L
141.96217 109.78129 L
142.05600 109.78129 L
142.15011 109.78129 L
@c
F
@rax %Note: Object
140.64718 109.78129 141.21071 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
141.02277 109.78129 m
141.02277 109.87512 L
141.11717 109.96923 L
141.21071 110.06306 L
141.21071 110.06306 L
141.11717 110.15717 L
141.02277 110.25099 L
140.92894 110.34454 L
140.92894 110.34454 L
140.83512 110.34454 L
140.74129 110.25099 L
140.64718 110.15717 L
140.64718 110.06306 L
140.64718 109.96923 L
140.64718 109.87512 L
140.74129 109.78129 L
140.83512 109.78129 L
140.92894 109.78129 L
141.02277 109.78129 L
@c
F
@rax %Note: Object
139.51984 109.78129 140.08365 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
139.89543 109.78129 m
139.89543 109.87512 L
139.98983 109.96923 L
140.08365 110.06306 L
140.08365 110.06306 L
139.98983 110.15717 L
139.89543 110.25099 L
139.80161 110.34454 L
139.80161 110.34454 L
139.70778 110.34454 L
139.61395 110.25099 L
139.51984 110.15717 L
139.51984 110.06306 L
139.51984 109.96923 L
139.51984 109.87512 L
139.61395 109.78129 L
139.70778 109.78129 L
139.80161 109.78129 L
139.89543 109.78129 L
@c
F
@rax %Note: Object
138.39250 109.78129 138.95631 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
138.76809 109.78129 m
138.76809 109.87512 L
138.86220 109.96923 L
138.95631 110.06306 L
138.95631 110.06306 L
138.86220 110.15717 L
138.76809 110.25099 L
138.67427 110.34454 L
138.67427 110.34454 L
138.58044 110.34454 L
138.48633 110.25099 L
138.39250 110.15717 L
138.39250 110.06306 L
138.39250 109.96923 L
138.39250 109.87512 L
138.48633 109.78129 L
138.58044 109.78129 L
138.67427 109.78129 L
138.76809 109.78129 L
@c
F
@rax %Note: Object
137.26545 109.78129 137.82898 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
137.64104 109.78129 m
137.64104 109.87512 L
137.73487 109.96923 L
137.82898 110.06306 L
137.82898 110.06306 L
137.73487 110.15717 L
137.64104 110.25099 L
137.54721 110.34454 L
137.54721 110.34454 L
137.45310 110.34454 L
137.35928 110.25099 L
137.26545 110.15717 L
137.26545 110.06306 L
137.26545 109.96923 L
137.26545 109.87512 L
137.35928 109.78129 L
137.45310 109.78129 L
137.54721 109.78129 L
137.64104 109.78129 L
@c
F
@rax %Note: Object
136.13811 109.78129 136.70164 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
136.51370 109.78129 m
136.51370 109.87512 L
136.60753 109.96923 L
136.70164 110.06306 L
136.70164 110.06306 L
136.60753 110.15717 L
136.51370 110.25099 L
136.41959 110.34454 L
136.41959 110.34454 L
136.32576 110.34454 L
136.23194 110.25099 L
136.13811 110.15717 L
136.13811 110.06306 L
136.13811 109.96923 L
136.13811 109.87512 L
136.23194 109.78129 L
136.32576 109.78129 L
136.41959 109.78129 L
136.51370 109.78129 L
@c
F
@rax %Note: Object
135.01049 109.78129 135.57430 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
135.38636 109.78129 m
135.38636 109.87512 L
135.48019 109.96923 L
135.57430 110.06306 L
135.57430 110.06306 L
135.48019 110.15717 L
135.38636 110.25099 L
135.29254 110.34454 L
135.29254 110.34454 L
135.19871 110.34454 L
135.10488 110.25099 L
135.01049 110.15717 L
135.01049 110.06306 L
135.01049 109.96923 L
135.01049 109.87512 L
135.10488 109.78129 L
135.19871 109.78129 L
135.29254 109.78129 L
135.38636 109.78129 L
@c
F
@rax %Note: Object
133.88315 109.78129 134.44696 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
134.25902 109.78129 m
134.25902 109.87512 L
134.35313 109.96923 L
134.44696 110.06306 L
134.44696 110.06306 L
134.35313 110.15717 L
134.25902 110.25099 L
134.16520 110.34454 L
134.16520 110.34454 L
134.07137 110.34454 L
133.97754 110.25099 L
133.88315 110.15717 L
133.88315 110.06306 L
133.88315 109.96923 L
133.88315 109.87512 L
133.97754 109.78129 L
134.07137 109.78129 L
134.16520 109.78129 L
134.25902 109.78129 L
@c
F
@rax %Note: Object
132.75581 109.78129 133.31962 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
133.13169 109.78129 m
133.13169 109.87512 L
133.22551 109.96923 L
133.31962 110.06306 L
133.31962 110.06306 L
133.22551 110.15717 L
133.13169 110.25099 L
133.03786 110.34454 L
133.03786 110.34454 L
132.94403 110.34454 L
132.84992 110.25099 L
132.75581 110.15717 L
132.75581 110.06306 L
132.75581 109.96923 L
132.75581 109.87512 L
132.84992 109.78129 L
132.94403 109.78129 L
133.03786 109.78129 L
133.13169 109.78129 L
@c
F
@rax %Note: Object
131.62876 109.78129 132.19228 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
132.00463 109.78129 m
132.00463 109.87512 L
132.09846 109.96923 L
132.19228 110.06306 L
132.19228 110.06306 L
132.09846 110.15717 L
132.00463 110.25099 L
131.91080 110.34454 L
131.91080 110.34454 L
131.81669 110.34454 L
131.72258 110.25099 L
131.62876 110.15717 L
131.62876 110.06306 L
131.62876 109.96923 L
131.62876 109.87512 L
131.72258 109.78129 L
131.81669 109.78129 L
131.91080 109.78129 L
132.00463 109.78129 L
@c
F
@rax %Note: Object
130.50142 109.78129 131.06494 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
130.87729 109.78129 m
130.87729 109.87512 L
130.97112 109.96923 L
131.06494 110.06306 L
131.06494 110.06306 L
130.97112 110.15717 L
130.87729 110.25099 L
130.78318 110.34454 L
130.78318 110.34454 L
130.68935 110.34454 L
130.59524 110.25099 L
130.50142 110.15717 L
130.50142 110.06306 L
130.50142 109.96923 L
130.50142 109.87512 L
130.59524 109.78129 L
130.68935 109.78129 L
130.78318 109.78129 L
130.87729 109.78129 L
@c
F
@rax %Note: Object
129.37408 109.78129 129.93761 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
129.74995 109.78129 m
129.74995 109.87512 L
129.84378 109.96923 L
129.93761 110.06306 L
129.93761 110.06306 L
129.84378 110.15717 L
129.74995 110.25099 L
129.65584 110.34454 L
129.65584 110.34454 L
129.56230 110.34454 L
129.46819 110.25099 L
129.37408 110.15717 L
129.37408 110.06306 L
129.37408 109.96923 L
129.37408 109.87512 L
129.46819 109.78129 L
129.56230 109.78129 L
129.65584 109.78129 L
129.74995 109.78129 L
@c
F
@rax %Note: Object
128.24674 109.78129 128.81055 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.62261 109.78129 m
128.62261 109.87512 L
128.71672 109.96923 L
128.81055 110.06306 L
128.81055 110.06306 L
128.71672 110.15717 L
128.62261 110.25099 L
128.52879 110.34454 L
128.52879 110.34454 L
128.43468 110.34454 L
128.34085 110.25099 L
128.24674 110.15717 L
128.24674 110.06306 L
128.24674 109.96923 L
128.24674 109.87512 L
128.34085 109.78129 L
128.43468 109.78129 L
128.52879 109.78129 L
128.62261 109.78129 L
@c
F
@rax %Note: Object
127.11940 109.78129 127.68321 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
127.49528 109.78129 m
127.49528 109.87512 L
127.58910 109.96923 L
127.68321 110.06306 L
127.68321 110.06306 L
127.58910 110.15717 L
127.49528 110.25099 L
127.40145 110.34454 L
127.40145 110.34454 L
127.30734 110.34454 L
127.21323 110.25099 L
127.11940 110.15717 L
127.11940 110.06306 L
127.11940 109.96923 L
127.11940 109.87512 L
127.21323 109.78129 L
127.30734 109.78129 L
127.40145 109.78129 L
127.49528 109.78129 L
@c
F
@rax %Note: Object
125.99235 109.78129 126.55587 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
126.36822 109.78129 m
126.36822 109.87512 L
126.46205 109.96923 L
126.55587 110.06306 L
126.55587 110.06306 L
126.46205 110.15717 L
126.36822 110.25099 L
126.27411 110.34454 L
126.27411 110.34454 L
126.18000 110.34454 L
126.08617 110.25099 L
125.99235 110.15717 L
125.99235 110.06306 L
125.99235 109.96923 L
125.99235 109.87512 L
126.08617 109.78129 L
126.18000 109.78129 L
126.27411 109.78129 L
126.36822 109.78129 L
@c
F
@rax %Note: Object
124.86501 109.78129 125.42854 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
125.24088 109.78129 m
125.24088 109.87512 L
125.33471 109.96923 L
125.42854 110.06306 L
125.42854 110.06306 L
125.33471 110.15717 L
125.24088 110.25099 L
125.14677 110.34454 L
125.14677 110.34454 L
125.05266 110.34454 L
124.95883 110.25099 L
124.86501 110.15717 L
124.86501 110.06306 L
124.86501 109.96923 L
124.86501 109.87512 L
124.95883 109.78129 L
125.05266 109.78129 L
125.14677 109.78129 L
125.24088 109.78129 L
@c
F
@rax %Note: Object
123.73767 109.78129 124.30120 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.11354 109.78129 m
124.11354 109.87512 L
124.20737 109.96923 L
124.30120 110.06306 L
124.30120 110.06306 L
124.20737 110.15717 L
124.11354 110.25099 L
124.01915 110.34454 L
124.01915 110.34454 L
123.92532 110.34454 L
123.83150 110.25099 L
123.73767 110.15717 L
123.73767 110.06306 L
123.73767 109.96923 L
123.73767 109.87512 L
123.83150 109.78129 L
123.92532 109.78129 L
124.01915 109.78129 L
124.11354 109.78129 L
@c
F
@rax %Note: Object
122.61033 109.78129 123.17414 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
122.98620 109.78129 m
122.98620 109.87512 L
123.08031 109.96923 L
123.17414 110.06306 L
123.17414 110.06306 L
123.08031 110.15717 L
122.98620 110.25099 L
122.89209 110.34454 L
122.89209 110.34454 L
122.79827 110.34454 L
122.70444 110.25099 L
122.61033 110.15717 L
122.61033 110.06306 L
122.61033 109.96923 L
122.61033 109.87512 L
122.70444 109.78129 L
122.79827 109.78129 L
122.89209 109.78129 L
122.98620 109.78129 L
@c
F
@rax %Note: Object
121.48299 109.78129 122.04680 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
121.85858 109.78129 m
121.85858 109.87512 L
121.95269 109.96923 L
122.04680 110.06306 L
122.04680 110.06306 L
121.95269 110.15717 L
121.85858 110.25099 L
121.76476 110.34454 L
121.76476 110.34454 L
121.67093 110.34454 L
121.57682 110.25099 L
121.48299 110.15717 L
121.48299 110.06306 L
121.48299 109.96923 L
121.48299 109.87512 L
121.57682 109.78129 L
121.67093 109.78129 L
121.76476 109.78129 L
121.85858 109.78129 L
@c
F
@rax %Note: Object
120.35594 109.78129 120.91946 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
120.73153 109.78129 m
120.73153 109.87512 L
120.82564 109.96923 L
120.91946 110.06306 L
120.91946 110.06306 L
120.82564 110.15717 L
120.73153 110.25099 L
120.63770 110.34454 L
120.63770 110.34454 L
120.54359 110.34454 L
120.44976 110.25099 L
120.35594 110.15717 L
120.35594 110.06306 L
120.35594 109.96923 L
120.35594 109.87512 L
120.44976 109.78129 L
120.54359 109.78129 L
120.63770 109.78129 L
120.73153 109.78129 L
@c
F
@rax %Note: Object
119.22860 109.78129 119.79213 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
119.60419 109.78129 m
119.60419 109.87512 L
119.69830 109.96923 L
119.79213 110.06306 L
119.79213 110.06306 L
119.69830 110.15717 L
119.60419 110.25099 L
119.51036 110.34454 L
119.51036 110.34454 L
119.41625 110.34454 L
119.32243 110.25099 L
119.22860 110.15717 L
119.22860 110.06306 L
119.22860 109.96923 L
119.22860 109.87512 L
119.32243 109.78129 L
119.41625 109.78129 L
119.51036 109.78129 L
119.60419 109.78129 L
@c
F
@rax %Note: Object
118.10126 109.78129 118.66479 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
118.47685 109.78129 m
118.47685 109.87512 L
118.57068 109.96923 L
118.66479 110.06306 L
118.66479 110.06306 L
118.57068 110.15717 L
118.47685 110.25099 L
118.38274 110.34454 L
118.38274 110.34454 L
118.28891 110.34454 L
118.19509 110.25099 L
118.10126 110.15717 L
118.10126 110.06306 L
118.10126 109.96923 L
118.10126 109.87512 L
118.19509 109.78129 L
118.28891 109.78129 L
118.38274 109.78129 L
118.47685 109.78129 L
@c
F
@rax %Note: Object
116.97392 109.78129 117.53773 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
117.34951 109.78129 m
117.34951 109.87512 L
117.44362 109.96923 L
117.53773 110.06306 L
117.53773 110.06306 L
117.44362 110.15717 L
117.34951 110.25099 L
117.25569 110.34454 L
117.25569 110.34454 L
117.16186 110.34454 L
117.06803 110.25099 L
116.97392 110.15717 L
116.97392 110.06306 L
116.97392 109.96923 L
116.97392 109.87512 L
117.06803 109.78129 L
117.16186 109.78129 L
117.25569 109.78129 L
117.34951 109.78129 L
@c
F
@rax %Note: Object
115.84658 109.78129 116.41039 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
116.22217 109.78129 m
116.22217 109.87512 L
116.31600 109.96923 L
116.41039 110.06306 L
116.41039 110.06306 L
116.31600 110.15717 L
116.22217 110.25099 L
116.12835 110.34454 L
116.12835 110.34454 L
116.03452 110.34454 L
115.94041 110.25099 L
115.84658 110.15717 L
115.84658 110.06306 L
115.84658 109.96923 L
115.84658 109.87512 L
115.94041 109.78129 L
116.03452 109.78129 L
116.12835 109.78129 L
116.22217 109.78129 L
@c
F
@rax %Note: Object
114.71924 109.78129 115.28277 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.09483 109.78129 m
115.09483 109.87512 L
115.18866 109.96923 L
115.28277 110.06306 L
115.28277 110.06306 L
115.18866 110.15717 L
115.09483 110.25099 L
115.00129 110.34454 L
115.00129 110.34454 L
114.90718 110.34454 L
114.81335 110.25099 L
114.71924 110.15717 L
114.71924 110.06306 L
114.71924 109.96923 L
114.71924 109.87512 L
114.81335 109.78129 L
114.90718 109.78129 L
115.00129 109.78129 L
115.09483 109.78129 L
@c
F
@rax %Note: Object
113.59191 109.78129 114.15543 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
113.96778 109.78129 m
113.96778 109.87512 L
114.06161 109.96923 L
114.15543 110.06306 L
114.15543 110.06306 L
114.06161 110.15717 L
113.96778 110.25099 L
113.87395 110.34454 L
113.87395 110.34454 L
113.77984 110.34454 L
113.68602 110.25099 L
113.59191 110.15717 L
113.59191 110.06306 L
113.59191 109.96923 L
113.59191 109.87512 L
113.68602 109.78129 L
113.77984 109.78129 L
113.87395 109.78129 L
113.96778 109.78129 L
@c
F
@rax %Note: Object
112.46457 109.78129 113.02809 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
112.84044 109.78129 m
112.84044 109.87512 L
112.93427 109.96923 L
113.02809 110.06306 L
113.02809 110.06306 L
112.93427 110.15717 L
112.84044 110.25099 L
112.74633 110.34454 L
112.74633 110.34454 L
112.65250 110.34454 L
112.55868 110.25099 L
112.46457 110.15717 L
112.46457 110.06306 L
112.46457 109.96923 L
112.46457 109.87512 L
112.55868 109.78129 L
112.65250 109.78129 L
112.74633 109.78129 L
112.84044 109.78129 L
@c
F
@rax %Note: Object
111.33723 109.78129 111.90104 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
111.71310 109.78129 m
111.71310 109.87512 L
111.80721 109.96923 L
111.90104 110.06306 L
111.90104 110.06306 L
111.80721 110.15717 L
111.71310 110.25099 L
111.61928 110.34454 L
111.61928 110.34454 L
111.52545 110.34454 L
111.43134 110.25099 L
111.33723 110.15717 L
111.33723 110.06306 L
111.33723 109.96923 L
111.33723 109.87512 L
111.43134 109.78129 L
111.52545 109.78129 L
111.61928 109.78129 L
111.71310 109.78129 L
@c
F
@rax %Note: Object
110.20989 109.78129 110.77370 110.34454 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 110.06306 m
110.30372 109.96923 L
110.39811 109.87512 L
110.49194 109.78129 L
110.58576 109.78129 L
110.67987 109.87512 L
110.77370 109.96923 L
110.77370 110.06306 L
110.77370 110.15717 L
110.77370 110.15717 L
110.77370 110.25099 L
110.67987 110.34454 L
110.58576 110.34454 L
110.49194 110.34454 L
110.39811 110.34454 L
110.30372 110.25099 L
110.20989 110.15717 L
110.20989 110.06306 L
@c
F
@rax %Note: Object
110.20989 110.90835 110.77370 111.47187 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 111.19039 m
110.30372 111.09628 L
110.39811 111.00246 L
110.49194 110.90835 L
110.58576 110.90835 L
110.67987 111.00246 L
110.77370 111.09628 L
110.77370 111.19039 L
110.77370 111.28422 L
110.77370 111.28422 L
110.77370 111.37805 L
110.67987 111.47187 L
110.58576 111.47187 L
110.49194 111.47187 L
110.39811 111.47187 L
110.30372 111.37805 L
110.20989 111.28422 L
110.20989 111.19039 L
@c
F
@rax %Note: Object
110.20989 112.03569 110.77370 112.59950 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 112.31773 m
110.30372 112.22391 L
110.39811 112.12980 L
110.49194 112.03569 L
110.58576 112.03569 L
110.67987 112.12980 L
110.77370 112.22391 L
110.77370 112.31773 L
110.77370 112.41156 L
110.77370 112.41156 L
110.77370 112.50539 L
110.67987 112.59950 L
110.58576 112.59950 L
110.49194 112.59950 L
110.39811 112.59950 L
110.30372 112.50539 L
110.20989 112.41156 L
110.20989 112.31773 L
@c
F
@rax %Note: Object
110.20989 113.16302 110.77370 113.72655 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 113.44479 m
110.30372 113.35096 L
110.39811 113.25713 L
110.49194 113.16302 L
110.58576 113.16302 L
110.67987 113.25713 L
110.77370 113.35096 L
110.77370 113.44479 L
110.77370 113.53861 L
110.77370 113.53861 L
110.77370 113.63272 L
110.67987 113.72655 L
110.58576 113.72655 L
110.49194 113.72655 L
110.39811 113.72655 L
110.30372 113.63272 L
110.20989 113.53861 L
110.20989 113.44479 L
@c
F
@rax %Note: Object
110.20989 114.29036 110.77370 114.85417 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 114.57213 m
110.30372 114.47830 L
110.39811 114.38447 L
110.49194 114.29036 L
110.58576 114.29036 L
110.67987 114.38447 L
110.77370 114.47830 L
110.77370 114.57213 L
110.77370 114.66595 L
110.77370 114.66595 L
110.77370 114.76006 L
110.67987 114.85417 L
110.58576 114.85417 L
110.49194 114.85417 L
110.39811 114.85417 L
110.30372 114.76006 L
110.20989 114.66595 L
110.20989 114.57213 L
@c
F
@rax %Note: Object
110.20989 115.41798 110.77370 115.98151 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 115.69946 m
110.30372 115.60564 L
110.39811 115.51181 L
110.49194 115.41798 L
110.58576 115.41798 L
110.67987 115.51181 L
110.77370 115.60564 L
110.77370 115.69946 L
110.77370 115.79357 L
110.77370 115.79357 L
110.77370 115.88740 L
110.67987 115.98151 L
110.58576 115.98151 L
110.49194 115.98151 L
110.39811 115.98151 L
110.30372 115.88740 L
110.20989 115.79357 L
110.20989 115.69946 L
@c
F
@rax %Note: Object
110.20989 116.54504 110.77370 117.10857 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 116.82680 m
110.30372 116.73269 L
110.39811 116.63887 L
110.49194 116.54504 L
110.58576 116.54504 L
110.67987 116.63887 L
110.77370 116.73269 L
110.77370 116.82680 L
110.77370 116.92063 L
110.77370 116.92063 L
110.77370 117.01446 L
110.67987 117.10857 L
110.58576 117.10857 L
110.49194 117.10857 L
110.39811 117.10857 L
110.30372 117.01446 L
110.20989 116.92063 L
110.20989 116.82680 L
@c
F
@rax %Note: Object
110.20989 117.67238 110.77370 118.23619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 117.95414 m
110.30372 117.86031 L
110.39811 117.76620 L
110.49194 117.67238 L
110.58576 117.67238 L
110.67987 117.76620 L
110.77370 117.86031 L
110.77370 117.95414 L
110.77370 118.04797 L
110.77370 118.04797 L
110.77370 118.14208 L
110.67987 118.23619 L
110.58576 118.23619 L
110.49194 118.23619 L
110.39811 118.23619 L
110.30372 118.14208 L
110.20989 118.04797 L
110.20989 117.95414 L
@c
F
@rax %Note: Object
110.20989 118.79972 110.77370 119.36324 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 119.08120 m
110.30372 118.98765 L
110.39811 118.89354 L
110.49194 118.79972 L
110.58576 118.79972 L
110.67987 118.89354 L
110.77370 118.98765 L
110.77370 119.08120 L
110.77370 119.17502 L
110.77370 119.17502 L
110.77370 119.26942 L
110.67987 119.36324 L
110.58576 119.36324 L
110.49194 119.36324 L
110.39811 119.36324 L
110.30372 119.26942 L
110.20989 119.17502 L
110.20989 119.08120 L
@c
F
@rax %Note: Object
110.20989 119.92677 110.77370 120.49058 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 120.20854 m
110.30372 120.11471 L
110.39811 120.02088 L
110.49194 119.92677 L
110.58576 119.92677 L
110.67987 120.02088 L
110.77370 120.11471 L
110.77370 120.20854 L
110.77370 120.30236 L
110.77370 120.30236 L
110.77370 120.39676 L
110.67987 120.49058 L
110.58576 120.49058 L
110.49194 120.49058 L
110.39811 120.49058 L
110.30372 120.39676 L
110.20989 120.30236 L
110.20989 120.20854 L
@c
F
@rax %Note: Object
110.20989 121.05439 110.77370 121.61792 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 121.33587 m
110.30372 121.24205 L
110.39811 121.14822 L
110.49194 121.05439 L
110.58576 121.05439 L
110.67987 121.14822 L
110.77370 121.24205 L
110.77370 121.33587 L
110.77370 121.42998 L
110.77370 121.42998 L
110.77370 121.52409 L
110.67987 121.61792 L
110.58576 121.61792 L
110.49194 121.61792 L
110.39811 121.61792 L
110.30372 121.52409 L
110.20989 121.42998 L
110.20989 121.33587 L
@c
F
@rax %Note: Object
110.20989 122.18145 110.77370 122.74498 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 122.46321 m
110.30372 122.36910 L
110.39811 122.27528 L
110.49194 122.18145 L
110.58576 122.18145 L
110.67987 122.27528 L
110.77370 122.36910 L
110.77370 122.46321 L
110.77370 122.55732 L
110.77370 122.55732 L
110.77370 122.65115 L
110.67987 122.74498 L
110.58576 122.74498 L
110.49194 122.74498 L
110.39811 122.74498 L
110.30372 122.65115 L
110.20989 122.55732 L
110.20989 122.46321 L
@c
F
@rax %Note: Object
110.20989 123.30879 110.77370 123.87260 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 123.59055 m
110.30372 123.49644 L
110.39811 123.40261 L
110.49194 123.30879 L
110.58576 123.30879 L
110.67987 123.40261 L
110.77370 123.49644 L
110.77370 123.59055 L
110.77370 123.68466 L
110.77370 123.68466 L
110.77370 123.77849 L
110.67987 123.87260 L
110.58576 123.87260 L
110.49194 123.87260 L
110.39811 123.87260 L
110.30372 123.77849 L
110.20989 123.68466 L
110.20989 123.59055 L
@c
F
@rax %Note: Object
110.20989 124.43613 110.77370 124.99965 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 124.71789 m
110.30372 124.62406 L
110.39811 124.52995 L
110.49194 124.43613 L
110.58576 124.43613 L
110.67987 124.52995 L
110.77370 124.62406 L
110.77370 124.71789 L
110.77370 124.81200 L
110.77370 124.81200 L
110.77370 124.90583 L
110.67987 124.99965 L
110.58576 124.99965 L
110.49194 124.99965 L
110.39811 124.99965 L
110.30372 124.90583 L
110.20989 124.81200 L
110.20989 124.71789 L
@c
F
@rax %Note: Object
110.20989 125.56318 110.77370 126.12699 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 125.84523 m
110.30372 125.75112 L
110.39811 125.65729 L
110.49194 125.56318 L
110.58576 125.56318 L
110.67987 125.65729 L
110.77370 125.75112 L
110.77370 125.84523 L
110.77370 125.93906 L
110.77370 125.93906 L
110.77370 126.03317 L
110.67987 126.12699 L
110.58576 126.12699 L
110.49194 126.12699 L
110.39811 126.12699 L
110.30372 126.03317 L
110.20989 125.93906 L
110.20989 125.84523 L
@c
F
@rax %Note: Object
110.20989 126.69080 110.77370 127.25433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 126.97257 m
110.30372 126.87846 L
110.39811 126.78463 L
110.49194 126.69080 L
110.58576 126.69080 L
110.67987 126.78463 L
110.77370 126.87846 L
110.77370 126.97257 L
110.77370 127.06668 L
110.77370 127.06668 L
110.77370 127.16050 L
110.67987 127.25433 L
110.58576 127.25433 L
110.49194 127.25433 L
110.39811 127.25433 L
110.30372 127.16050 L
110.20989 127.06668 L
110.20989 126.97257 L
@c
F
@rax %Note: Object
110.20989 127.81786 110.77370 128.38139 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 128.09991 m
110.30372 128.00580 L
110.39811 127.91169 L
110.49194 127.81786 L
110.58576 127.81786 L
110.67987 127.91169 L
110.77370 128.00580 L
110.77370 128.09991 L
110.77370 128.19373 L
110.77370 128.19373 L
110.77370 128.28756 L
110.67987 128.38139 L
110.58576 128.38139 L
110.49194 128.38139 L
110.39811 128.38139 L
110.30372 128.28756 L
110.20989 128.19373 L
110.20989 128.09991 L
@c
F
@rax %Note: Object
110.20989 128.94520 110.77370 129.50901 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 129.22724 m
110.30372 129.13313 L
110.39811 129.03902 L
110.49194 128.94520 L
110.58576 128.94520 L
110.67987 129.03902 L
110.77370 129.13313 L
110.77370 129.22724 L
110.77370 129.32107 L
110.77370 129.32107 L
110.77370 129.41490 L
110.67987 129.50901 L
110.58576 129.50901 L
110.49194 129.50901 L
110.39811 129.50901 L
110.30372 129.41490 L
110.20989 129.32107 L
110.20989 129.22724 L
@c
F
@rax %Note: Object
110.20989 130.07254 110.77370 130.63606 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 130.35458 m
110.30372 130.26076 L
110.39811 130.16636 L
110.49194 130.07254 L
110.58576 130.07254 L
110.67987 130.16636 L
110.77370 130.26076 L
110.77370 130.35458 L
110.77370 130.44841 L
110.77370 130.44841 L
110.77370 130.54224 L
110.67987 130.63606 L
110.58576 130.63606 L
110.49194 130.63606 L
110.39811 130.63606 L
110.30372 130.54224 L
110.20989 130.44841 L
110.20989 130.35458 L
@c
F
@rax %Note: Object
107.57962 131.19959 113.49808 137.11805 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
113.49808 131.19959 m
110.49194 137.11805 L
107.57962 131.19959 L
113.49808 131.19959 L
@c
F
@rax %Note: Object
185.73902 100.76287 186.30283 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
186.11490 100.76287 m
186.11490 100.85669 L
186.20901 100.95080 L
186.30283 101.04463 L
186.30283 101.04463 L
186.20901 101.13846 L
186.11490 101.23257 L
186.02107 101.32668 L
186.02107 101.32668 L
185.92696 101.32668 L
185.83313 101.23257 L
185.73902 101.13846 L
185.73902 101.04463 L
185.73902 100.95080 L
185.73902 100.85669 L
185.83313 100.76287 L
185.92696 100.76287 L
186.02107 100.76287 L
186.11490 100.76287 L
@c
F
@rax %Note: Object
184.61197 100.76287 185.17550 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
184.98756 100.76287 m
184.98756 100.85669 L
185.08139 100.95080 L
185.17550 101.04463 L
185.17550 101.04463 L
185.08139 101.13846 L
184.98756 101.23257 L
184.89373 101.32668 L
184.89373 101.32668 L
184.79962 101.32668 L
184.70580 101.23257 L
184.61197 101.13846 L
184.61197 101.04463 L
184.61197 100.95080 L
184.61197 100.85669 L
184.70580 100.76287 L
184.79962 100.76287 L
184.89373 100.76287 L
184.98756 100.76287 L
@c
F
@rax %Note: Object
183.48463 100.76287 184.04816 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
183.86050 100.76287 m
183.86050 100.85669 L
183.95433 100.95080 L
184.04816 101.04463 L
184.04816 101.04463 L
183.95433 101.13846 L
183.86050 101.23257 L
183.76639 101.32668 L
183.76639 101.32668 L
183.67228 101.32668 L
183.57846 101.23257 L
183.48463 101.13846 L
183.48463 101.04463 L
183.48463 100.95080 L
183.48463 100.85669 L
183.57846 100.76287 L
183.67228 100.76287 L
183.76639 100.76287 L
183.86050 100.76287 L
@c
F
@rax %Note: Object
182.35729 100.76287 182.92082 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
182.73317 100.76287 m
182.73317 100.85669 L
182.82699 100.95080 L
182.92082 101.04463 L
182.92082 101.04463 L
182.82699 101.13846 L
182.73317 101.23257 L
182.63877 101.32668 L
182.63877 101.32668 L
182.54494 101.32668 L
182.45112 101.23257 L
182.35729 101.13846 L
182.35729 101.04463 L
182.35729 100.95080 L
182.35729 100.85669 L
182.45112 100.76287 L
182.54494 100.76287 L
182.63877 100.76287 L
182.73317 100.76287 L
@c
F
@rax %Note: Object
181.22995 100.76287 181.79376 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
181.60583 100.76287 m
181.60583 100.85669 L
181.69994 100.95080 L
181.79376 101.04463 L
181.79376 101.04463 L
181.69994 101.13846 L
181.60583 101.23257 L
181.51172 101.32668 L
181.51172 101.32668 L
181.41789 101.32668 L
181.32406 101.23257 L
181.22995 101.13846 L
181.22995 101.04463 L
181.22995 100.95080 L
181.22995 100.85669 L
181.32406 100.76287 L
181.41789 100.76287 L
181.51172 100.76287 L
181.60583 100.76287 L
@c
F
@rax %Note: Object
180.10261 100.76287 180.66643 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
180.47820 100.76287 m
180.47820 100.85669 L
180.57260 100.95080 L
180.66643 101.04463 L
180.66643 101.04463 L
180.57260 101.13846 L
180.47820 101.23257 L
180.38438 101.32668 L
180.38438 101.32668 L
180.29055 101.32668 L
180.19672 101.23257 L
180.10261 101.13846 L
180.10261 101.04463 L
180.10261 100.95080 L
180.10261 100.85669 L
180.19672 100.76287 L
180.29055 100.76287 L
180.38438 100.76287 L
180.47820 100.76287 L
@c
F
@rax %Note: Object
178.97528 100.76287 179.53909 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
179.35087 100.76287 m
179.35087 100.85669 L
179.44498 100.95080 L
179.53909 101.04463 L
179.53909 101.04463 L
179.44498 101.13846 L
179.35087 101.23257 L
179.25704 101.32668 L
179.25704 101.32668 L
179.16321 101.32668 L
179.06910 101.23257 L
178.97528 101.13846 L
178.97528 101.04463 L
178.97528 100.95080 L
178.97528 100.85669 L
179.06910 100.76287 L
179.16321 100.76287 L
179.25704 100.76287 L
179.35087 100.76287 L
@c
F
@rax %Note: Object
177.84822 100.76287 178.41175 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
178.22381 100.76287 m
178.22381 100.85669 L
178.31792 100.95080 L
178.41175 101.04463 L
178.41175 101.04463 L
178.31792 101.13846 L
178.22381 101.23257 L
178.12998 101.32668 L
178.12998 101.32668 L
178.03587 101.32668 L
177.94205 101.23257 L
177.84822 101.13846 L
177.84822 101.04463 L
177.84822 100.95080 L
177.84822 100.85669 L
177.94205 100.76287 L
178.03587 100.76287 L
178.12998 100.76287 L
178.22381 100.76287 L
@c
F
@rax %Note: Object
176.72088 100.76287 177.28441 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
177.09647 100.76287 m
177.09647 100.85669 L
177.19030 100.95080 L
177.28441 101.04463 L
177.28441 101.04463 L
177.19030 101.13846 L
177.09647 101.23257 L
177.00236 101.32668 L
177.00236 101.32668 L
176.90854 101.32668 L
176.81471 101.23257 L
176.72088 101.13846 L
176.72088 101.04463 L
176.72088 100.95080 L
176.72088 100.85669 L
176.81471 100.76287 L
176.90854 100.76287 L
177.00236 100.76287 L
177.09647 100.76287 L
@c
F
@rax %Note: Object
175.59354 100.76287 176.15707 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
175.96913 100.76287 m
175.96913 100.85669 L
176.06296 100.95080 L
176.15707 101.04463 L
176.15707 101.04463 L
176.06296 101.13846 L
175.96913 101.23257 L
175.87531 101.32668 L
175.87531 101.32668 L
175.78148 101.32668 L
175.68765 101.23257 L
175.59354 101.13846 L
175.59354 101.04463 L
175.59354 100.95080 L
175.59354 100.85669 L
175.68765 100.76287 L
175.78148 100.76287 L
175.87531 100.76287 L
175.96913 100.76287 L
@c
F
@rax %Note: Object
174.46620 100.76287 175.03002 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
174.84180 100.76287 m
174.84180 100.85669 L
174.93591 100.95080 L
175.03002 101.04463 L
175.03002 101.04463 L
174.93591 101.13846 L
174.84180 101.23257 L
174.74797 101.32668 L
174.74797 101.32668 L
174.65414 101.32668 L
174.56031 101.23257 L
174.46620 101.13846 L
174.46620 101.04463 L
174.46620 100.95080 L
174.46620 100.85669 L
174.56031 100.76287 L
174.65414 100.76287 L
174.74797 100.76287 L
174.84180 100.76287 L
@c
F
@rax %Note: Object
173.33858 100.76287 173.90239 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
173.71446 100.76287 m
173.71446 100.85669 L
173.80828 100.95080 L
173.90239 101.04463 L
173.90239 101.04463 L
173.80828 101.13846 L
173.71446 101.23257 L
173.62063 101.32668 L
173.62063 101.32668 L
173.52680 101.32668 L
173.43269 101.23257 L
173.33858 101.13846 L
173.33858 101.04463 L
173.33858 100.95080 L
173.33858 100.85669 L
173.43269 100.76287 L
173.52680 100.76287 L
173.62063 100.76287 L
173.71446 100.76287 L
@c
F
@rax %Note: Object
172.21153 100.76287 172.77506 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
172.58740 100.76287 m
172.58740 100.85669 L
172.68123 100.95080 L
172.77506 101.04463 L
172.77506 101.04463 L
172.68123 101.13846 L
172.58740 101.23257 L
172.49357 101.32668 L
172.49357 101.32668 L
172.39946 101.32668 L
172.30564 101.23257 L
172.21153 101.13846 L
172.21153 101.04463 L
172.21153 100.95080 L
172.21153 100.85669 L
172.30564 100.76287 L
172.39946 100.76287 L
172.49357 100.76287 L
172.58740 100.76287 L
@c
F
@rax %Note: Object
171.08419 100.76287 171.64772 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
171.46006 100.76287 m
171.46006 100.85669 L
171.55389 100.95080 L
171.64772 101.04463 L
171.64772 101.04463 L
171.55389 101.13846 L
171.46006 101.23257 L
171.36624 101.32668 L
171.36624 101.32668 L
171.27213 101.32668 L
171.17802 101.23257 L
171.08419 101.13846 L
171.08419 101.04463 L
171.08419 100.95080 L
171.08419 100.85669 L
171.17802 100.76287 L
171.27213 100.76287 L
171.36624 100.76287 L
171.46006 100.76287 L
@c
F
@rax %Note: Object
169.95685 100.76287 170.52038 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
170.33272 100.76287 m
170.33272 100.85669 L
170.42655 100.95080 L
170.52038 101.04463 L
170.52038 101.04463 L
170.42655 101.13846 L
170.33272 101.23257 L
170.23861 101.32668 L
170.23861 101.32668 L
170.14507 101.32668 L
170.05096 101.23257 L
169.95685 101.13846 L
169.95685 101.04463 L
169.95685 100.95080 L
169.95685 100.85669 L
170.05096 100.76287 L
170.14507 100.76287 L
170.23861 100.76287 L
170.33272 100.76287 L
@c
F
@rax %Note: Object
168.82951 100.76287 169.39332 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
169.20539 100.76287 m
169.20539 100.85669 L
169.29950 100.95080 L
169.39332 101.04463 L
169.39332 101.04463 L
169.29950 101.13846 L
169.20539 101.23257 L
169.11156 101.32668 L
169.11156 101.32668 L
169.01773 101.32668 L
168.92362 101.23257 L
168.82951 101.13846 L
168.82951 101.04463 L
168.82951 100.95080 L
168.82951 100.85669 L
168.92362 100.76287 L
169.01773 100.76287 L
169.11156 100.76287 L
169.20539 100.76287 L
@c
F
@rax %Note: Object
167.70217 100.76287 168.26598 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
168.07805 100.76287 m
168.07805 100.85669 L
168.17187 100.95080 L
168.26598 101.04463 L
168.26598 101.04463 L
168.17187 101.13846 L
168.07805 101.23257 L
167.98422 101.32668 L
167.98422 101.32668 L
167.89011 101.32668 L
167.79600 101.23257 L
167.70217 101.13846 L
167.70217 101.04463 L
167.70217 100.95080 L
167.70217 100.85669 L
167.79600 100.76287 L
167.89011 100.76287 L
167.98422 100.76287 L
168.07805 100.76287 L
@c
F
@rax %Note: Object
166.57512 100.76287 167.13865 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
166.95099 100.76287 m
166.95099 100.85669 L
167.04482 100.95080 L
167.13865 101.04463 L
167.13865 101.04463 L
167.04482 101.13846 L
166.95099 101.23257 L
166.85717 101.32668 L
166.85717 101.32668 L
166.76277 101.32668 L
166.66894 101.23257 L
166.57512 101.13846 L
166.57512 101.04463 L
166.57512 100.95080 L
166.57512 100.85669 L
166.66894 100.76287 L
166.76277 100.76287 L
166.85717 100.76287 L
166.95099 100.76287 L
@c
F
@rax %Note: Object
165.44778 100.76287 166.01131 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
165.82365 100.76287 m
165.82365 100.85669 L
165.91748 100.95080 L
166.01131 101.04463 L
166.01131 101.04463 L
165.91748 101.13846 L
165.82365 101.23257 L
165.72983 101.32668 L
165.72983 101.32668 L
165.63543 101.32668 L
165.54161 101.23257 L
165.44778 101.13846 L
165.44778 101.04463 L
165.44778 100.95080 L
165.44778 100.85669 L
165.54161 100.76287 L
165.63543 100.76287 L
165.72983 100.76287 L
165.82365 100.76287 L
@c
F
@rax %Note: Object
164.32044 100.76287 164.88397 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
164.69631 100.76287 m
164.69631 100.85669 L
164.79014 100.95080 L
164.88397 101.04463 L
164.88397 101.04463 L
164.79014 101.13846 L
164.69631 101.23257 L
164.60220 101.32668 L
164.60220 101.32668 L
164.50809 101.32668 L
164.41455 101.23257 L
164.32044 101.13846 L
164.32044 101.04463 L
164.32044 100.95080 L
164.32044 100.85669 L
164.41455 100.76287 L
164.50809 100.76287 L
164.60220 100.76287 L
164.69631 100.76287 L
@c
F
@rax %Note: Object
163.19310 100.76287 163.75691 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
163.56898 100.76287 m
163.56898 100.85669 L
163.66309 100.95080 L
163.75691 101.04463 L
163.75691 101.04463 L
163.66309 101.13846 L
163.56898 101.23257 L
163.47487 101.32668 L
163.47487 101.32668 L
163.38104 101.32668 L
163.28721 101.23257 L
163.19310 101.13846 L
163.19310 101.04463 L
163.19310 100.95080 L
163.19310 100.85669 L
163.28721 100.76287 L
163.38104 100.76287 L
163.47487 100.76287 L
163.56898 100.76287 L
@c
F
@rax %Note: Object
162.06576 100.76287 162.62957 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
162.44164 100.76287 m
162.44164 100.85669 L
162.53546 100.95080 L
162.62957 101.04463 L
162.62957 101.04463 L
162.53546 101.13846 L
162.44164 101.23257 L
162.34753 101.32668 L
162.34753 101.32668 L
162.25370 101.32668 L
162.15959 101.23257 L
162.06576 101.13846 L
162.06576 101.04463 L
162.06576 100.95080 L
162.06576 100.85669 L
162.15959 100.76287 L
162.25370 100.76287 L
162.34753 100.76287 L
162.44164 100.76287 L
@c
F
@rax %Note: Object
160.93871 100.76287 161.50224 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
161.31430 100.76287 m
161.31430 100.85669 L
161.40841 100.95080 L
161.50224 101.04463 L
161.50224 101.04463 L
161.40841 101.13846 L
161.31430 101.23257 L
161.22047 101.32668 L
161.22047 101.32668 L
161.12636 101.32668 L
161.03254 101.23257 L
160.93871 101.13846 L
160.93871 101.04463 L
160.93871 100.95080 L
160.93871 100.85669 L
161.03254 100.76287 L
161.12636 100.76287 L
161.22047 100.76287 L
161.31430 100.76287 L
@c
F
@rax %Note: Object
159.81137 100.76287 160.37490 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
160.18696 100.76287 m
160.18696 100.85669 L
160.28107 100.95080 L
160.37490 101.04463 L
160.37490 101.04463 L
160.28107 101.13846 L
160.18696 101.23257 L
160.09313 101.32668 L
160.09313 101.32668 L
159.99902 101.32668 L
159.90520 101.23257 L
159.81137 101.13846 L
159.81137 101.04463 L
159.81137 100.95080 L
159.81137 100.85669 L
159.90520 100.76287 L
159.99902 100.76287 L
160.09313 100.76287 L
160.18696 100.76287 L
@c
F
@rax %Note: Object
158.68403 100.76287 159.24756 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
159.05962 100.76287 m
159.05962 100.85669 L
159.15373 100.95080 L
159.24756 101.04463 L
159.24756 101.04463 L
159.15373 101.13846 L
159.05962 101.23257 L
158.96551 101.32668 L
158.96551 101.32668 L
158.87169 101.32668 L
158.77786 101.23257 L
158.68403 101.13846 L
158.68403 101.04463 L
158.68403 100.95080 L
158.68403 100.85669 L
158.77786 100.76287 L
158.87169 100.76287 L
158.96551 100.76287 L
159.05962 100.76287 L
@c
F
@rax %Note: Object
157.55669 100.76287 158.12050 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
157.93228 100.76287 m
157.93228 100.85669 L
158.02639 100.95080 L
158.12050 101.04463 L
158.12050 101.04463 L
158.02639 101.13846 L
157.93228 101.23257 L
157.83846 101.32668 L
157.83846 101.32668 L
157.74463 101.32668 L
157.65080 101.23257 L
157.55669 101.13846 L
157.55669 101.04463 L
157.55669 100.95080 L
157.55669 100.85669 L
157.65080 100.76287 L
157.74463 100.76287 L
157.83846 100.76287 L
157.93228 100.76287 L
@c
F
@rax %Note: Object
156.42935 100.76287 156.99317 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
156.80494 100.76287 m
156.80494 100.85669 L
156.89906 100.95080 L
156.99317 101.04463 L
156.99317 101.04463 L
156.89906 101.13846 L
156.80494 101.23257 L
156.71112 101.32668 L
156.71112 101.32668 L
156.61729 101.32668 L
156.52318 101.23257 L
156.42935 101.13846 L
156.42935 101.04463 L
156.42935 100.95080 L
156.42935 100.85669 L
156.52318 100.76287 L
156.61729 100.76287 L
156.71112 100.76287 L
156.80494 100.76287 L
@c
F
@rax %Note: Object
155.30202 100.76287 155.86583 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
155.67789 100.76287 m
155.67789 100.85669 L
155.77143 100.95080 L
155.86583 101.04463 L
155.86583 101.04463 L
155.77143 101.13846 L
155.67789 101.23257 L
155.58406 101.32668 L
155.58406 101.32668 L
155.48995 101.32668 L
155.39613 101.23257 L
155.30202 101.13846 L
155.30202 101.04463 L
155.30202 100.95080 L
155.30202 100.85669 L
155.39613 100.76287 L
155.48995 100.76287 L
155.58406 100.76287 L
155.67789 100.76287 L
@c
F
@rax %Note: Object
154.17468 100.76287 154.73820 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
154.55055 100.76287 m
154.55055 100.85669 L
154.64438 100.95080 L
154.73820 101.04463 L
154.73820 101.04463 L
154.64438 101.13846 L
154.55055 101.23257 L
154.45672 101.32668 L
154.45672 101.32668 L
154.36261 101.32668 L
154.26879 101.23257 L
154.17468 101.13846 L
154.17468 101.04463 L
154.17468 100.95080 L
154.17468 100.85669 L
154.26879 100.76287 L
154.36261 100.76287 L
154.45672 100.76287 L
154.55055 100.76287 L
@c
F
@rax %Note: Object
153.04734 100.76287 153.61087 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
153.42321 100.76287 m
153.42321 100.85669 L
153.51704 100.95080 L
153.61087 101.04463 L
153.61087 101.04463 L
153.51704 101.13846 L
153.42321 101.23257 L
153.32910 101.32668 L
153.32910 101.32668 L
153.23528 101.32668 L
153.14145 101.23257 L
153.04734 101.13846 L
153.04734 101.04463 L
153.04734 100.95080 L
153.04734 100.85669 L
153.14145 100.76287 L
153.23528 100.76287 L
153.32910 100.76287 L
153.42321 100.76287 L
@c
F
@rax %Note: Object
151.92000 100.76287 152.48381 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
152.29587 100.76287 m
152.29587 100.85669 L
152.38998 100.95080 L
152.48381 101.04463 L
152.48381 101.04463 L
152.38998 101.13846 L
152.29587 101.23257 L
152.20205 101.32668 L
152.20205 101.32668 L
152.10822 101.32668 L
152.01411 101.23257 L
151.92000 101.13846 L
151.92000 101.04463 L
151.92000 100.95080 L
151.92000 100.85669 L
152.01411 100.76287 L
152.10822 100.76287 L
152.20205 100.76287 L
152.29587 100.76287 L
@c
F
@rax %Note: Object
150.79266 100.76287 151.35647 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
151.16854 100.76287 m
151.16854 100.85669 L
151.26265 100.95080 L
151.35647 101.04463 L
151.35647 101.04463 L
151.26265 101.13846 L
151.16854 101.23257 L
151.07471 101.32668 L
151.07471 101.32668 L
150.98088 101.32668 L
150.88649 101.23257 L
150.79266 101.13846 L
150.79266 101.04463 L
150.79266 100.95080 L
150.79266 100.85669 L
150.88649 100.76287 L
150.98088 100.76287 L
151.07471 100.76287 L
151.16854 100.76287 L
@c
F
@rax %Note: Object
149.66561 100.76287 150.22913 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
150.04120 100.76287 m
150.04120 100.85669 L
150.13502 100.95080 L
150.22913 101.04463 L
150.22913 101.04463 L
150.13502 101.13846 L
150.04120 101.23257 L
149.94737 101.32668 L
149.94737 101.32668 L
149.85354 101.32668 L
149.75943 101.23257 L
149.66561 101.13846 L
149.66561 101.04463 L
149.66561 100.95080 L
149.66561 100.85669 L
149.75943 100.76287 L
149.85354 100.76287 L
149.94737 100.76287 L
150.04120 100.76287 L
@c
F
@rax %Note: Object
148.53827 100.76287 149.10180 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
148.91414 100.76287 m
148.91414 100.85669 L
149.00797 100.95080 L
149.10180 101.04463 L
149.10180 101.04463 L
149.00797 101.13846 L
148.91414 101.23257 L
148.82031 101.32668 L
148.82031 101.32668 L
148.72620 101.32668 L
148.63209 101.23257 L
148.53827 101.13846 L
148.53827 101.04463 L
148.53827 100.95080 L
148.53827 100.85669 L
148.63209 100.76287 L
148.72620 100.76287 L
148.82031 100.76287 L
148.91414 100.76287 L
@c
F
@rax %Note: Object
147.41093 100.76287 147.97446 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
147.78680 100.76287 m
147.78680 100.85669 L
147.88063 100.95080 L
147.97446 101.04463 L
147.97446 101.04463 L
147.88063 101.13846 L
147.78680 101.23257 L
147.69269 101.32668 L
147.69269 101.32668 L
147.59858 101.32668 L
147.50476 101.23257 L
147.41093 101.13846 L
147.41093 101.04463 L
147.41093 100.95080 L
147.41093 100.85669 L
147.50476 100.76287 L
147.59858 100.76287 L
147.69269 100.76287 L
147.78680 100.76287 L
@c
F
@rax %Note: Object
146.28359 100.76287 146.84740 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
146.65946 100.76287 m
146.65946 100.85669 L
146.75357 100.95080 L
146.84740 101.04463 L
146.84740 101.04463 L
146.75357 101.13846 L
146.65946 101.23257 L
146.56564 101.32668 L
146.56564 101.32668 L
146.47153 101.32668 L
146.37770 101.23257 L
146.28359 101.13846 L
146.28359 101.04463 L
146.28359 100.95080 L
146.28359 100.85669 L
146.37770 100.76287 L
146.47153 100.76287 L
146.56564 100.76287 L
146.65946 100.76287 L
@c
F
@rax %Note: Object
145.15625 100.76287 145.72006 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
145.53213 100.76287 m
145.53213 100.85669 L
145.62624 100.95080 L
145.72006 101.04463 L
145.72006 101.04463 L
145.62624 101.13846 L
145.53213 101.23257 L
145.43830 101.32668 L
145.43830 101.32668 L
145.34419 101.32668 L
145.25008 101.23257 L
145.15625 101.13846 L
145.15625 101.04463 L
145.15625 100.95080 L
145.15625 100.85669 L
145.25008 100.76287 L
145.34419 100.76287 L
145.43830 100.76287 L
145.53213 100.76287 L
@c
F
@rax %Note: Object
144.02920 100.76287 144.59272 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
144.40479 100.76287 m
144.40479 100.85669 L
144.49861 100.95080 L
144.59272 101.04463 L
144.59272 101.04463 L
144.49861 101.13846 L
144.40479 101.23257 L
144.31068 101.32668 L
144.31068 101.32668 L
144.21685 101.32668 L
144.12274 101.23257 L
144.02920 101.13846 L
144.02920 101.04463 L
144.02920 100.95080 L
144.02920 100.85669 L
144.12274 100.76287 L
144.21685 100.76287 L
144.31068 100.76287 L
144.40479 100.76287 L
@c
F
@rax %Note: Object
142.90186 100.76287 143.46539 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
143.27773 100.76287 m
143.27773 100.85669 L
143.37156 100.95080 L
143.46539 101.04463 L
143.46539 101.04463 L
143.37156 101.13846 L
143.27773 101.23257 L
143.18362 101.32668 L
143.18362 101.32668 L
143.08951 101.32668 L
142.99569 101.23257 L
142.90186 101.13846 L
142.90186 101.04463 L
142.90186 100.95080 L
142.90186 100.85669 L
142.99569 100.76287 L
143.08951 100.76287 L
143.18362 100.76287 L
143.27773 100.76287 L
@c
F
@rax %Note: Object
141.77452 100.76287 142.33805 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
142.15011 100.76287 m
142.15011 100.85669 L
142.24422 100.95080 L
142.33805 101.04463 L
142.33805 101.04463 L
142.24422 101.13846 L
142.15011 101.23257 L
142.05600 101.32668 L
142.05600 101.32668 L
141.96217 101.32668 L
141.86835 101.23257 L
141.77452 101.13846 L
141.77452 101.04463 L
141.77452 100.95080 L
141.77452 100.85669 L
141.86835 100.76287 L
141.96217 100.76287 L
142.05600 100.76287 L
142.15011 100.76287 L
@c
F
@rax %Note: Object
140.64718 100.76287 141.21071 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
141.02277 100.76287 m
141.02277 100.85669 L
141.11717 100.95080 L
141.21071 101.04463 L
141.21071 101.04463 L
141.11717 101.13846 L
141.02277 101.23257 L
140.92894 101.32668 L
140.92894 101.32668 L
140.83512 101.32668 L
140.74129 101.23257 L
140.64718 101.13846 L
140.64718 101.04463 L
140.64718 100.95080 L
140.64718 100.85669 L
140.74129 100.76287 L
140.83512 100.76287 L
140.92894 100.76287 L
141.02277 100.76287 L
@c
F
@rax %Note: Object
139.51984 100.76287 140.08365 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
139.89543 100.76287 m
139.89543 100.85669 L
139.98983 100.95080 L
140.08365 101.04463 L
140.08365 101.04463 L
139.98983 101.13846 L
139.89543 101.23257 L
139.80161 101.32668 L
139.80161 101.32668 L
139.70778 101.32668 L
139.61395 101.23257 L
139.51984 101.13846 L
139.51984 101.04463 L
139.51984 100.95080 L
139.51984 100.85669 L
139.61395 100.76287 L
139.70778 100.76287 L
139.80161 100.76287 L
139.89543 100.76287 L
@c
F
@rax %Note: Object
138.39250 100.76287 138.95631 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
138.76809 100.76287 m
138.76809 100.85669 L
138.86220 100.95080 L
138.95631 101.04463 L
138.95631 101.04463 L
138.86220 101.13846 L
138.76809 101.23257 L
138.67427 101.32668 L
138.67427 101.32668 L
138.58044 101.32668 L
138.48633 101.23257 L
138.39250 101.13846 L
138.39250 101.04463 L
138.39250 100.95080 L
138.39250 100.85669 L
138.48633 100.76287 L
138.58044 100.76287 L
138.67427 100.76287 L
138.76809 100.76287 L
@c
F
@rax %Note: Object
137.26545 100.76287 137.82898 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
137.64104 100.76287 m
137.64104 100.85669 L
137.73487 100.95080 L
137.82898 101.04463 L
137.82898 101.04463 L
137.73487 101.13846 L
137.64104 101.23257 L
137.54721 101.32668 L
137.54721 101.32668 L
137.45310 101.32668 L
137.35928 101.23257 L
137.26545 101.13846 L
137.26545 101.04463 L
137.26545 100.95080 L
137.26545 100.85669 L
137.35928 100.76287 L
137.45310 100.76287 L
137.54721 100.76287 L
137.64104 100.76287 L
@c
F
@rax %Note: Object
136.13811 100.76287 136.70164 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
136.51370 100.76287 m
136.51370 100.85669 L
136.60753 100.95080 L
136.70164 101.04463 L
136.70164 101.04463 L
136.60753 101.13846 L
136.51370 101.23257 L
136.41959 101.32668 L
136.41959 101.32668 L
136.32576 101.32668 L
136.23194 101.23257 L
136.13811 101.13846 L
136.13811 101.04463 L
136.13811 100.95080 L
136.13811 100.85669 L
136.23194 100.76287 L
136.32576 100.76287 L
136.41959 100.76287 L
136.51370 100.76287 L
@c
F
@rax %Note: Object
135.01049 100.76287 135.57430 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
135.38636 100.76287 m
135.38636 100.85669 L
135.48019 100.95080 L
135.57430 101.04463 L
135.57430 101.04463 L
135.48019 101.13846 L
135.38636 101.23257 L
135.29254 101.32668 L
135.29254 101.32668 L
135.19871 101.32668 L
135.10488 101.23257 L
135.01049 101.13846 L
135.01049 101.04463 L
135.01049 100.95080 L
135.01049 100.85669 L
135.10488 100.76287 L
135.19871 100.76287 L
135.29254 100.76287 L
135.38636 100.76287 L
@c
F
@rax %Note: Object
133.88315 100.76287 134.44696 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
134.25902 100.76287 m
134.25902 100.85669 L
134.35313 100.95080 L
134.44696 101.04463 L
134.44696 101.04463 L
134.35313 101.13846 L
134.25902 101.23257 L
134.16520 101.32668 L
134.16520 101.32668 L
134.07137 101.32668 L
133.97754 101.23257 L
133.88315 101.13846 L
133.88315 101.04463 L
133.88315 100.95080 L
133.88315 100.85669 L
133.97754 100.76287 L
134.07137 100.76287 L
134.16520 100.76287 L
134.25902 100.76287 L
@c
F
@rax %Note: Object
132.75581 100.76287 133.31962 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
133.13169 100.76287 m
133.13169 100.85669 L
133.22551 100.95080 L
133.31962 101.04463 L
133.31962 101.04463 L
133.22551 101.13846 L
133.13169 101.23257 L
133.03786 101.32668 L
133.03786 101.32668 L
132.94403 101.32668 L
132.84992 101.23257 L
132.75581 101.13846 L
132.75581 101.04463 L
132.75581 100.95080 L
132.75581 100.85669 L
132.84992 100.76287 L
132.94403 100.76287 L
133.03786 100.76287 L
133.13169 100.76287 L
@c
F
@rax %Note: Object
131.62876 100.76287 132.19228 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
132.00463 100.76287 m
132.00463 100.85669 L
132.09846 100.95080 L
132.19228 101.04463 L
132.19228 101.04463 L
132.09846 101.13846 L
132.00463 101.23257 L
131.91080 101.32668 L
131.91080 101.32668 L
131.81669 101.32668 L
131.72258 101.23257 L
131.62876 101.13846 L
131.62876 101.04463 L
131.62876 100.95080 L
131.62876 100.85669 L
131.72258 100.76287 L
131.81669 100.76287 L
131.91080 100.76287 L
132.00463 100.76287 L
@c
F
@rax %Note: Object
130.50142 100.76287 131.06494 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
130.87729 100.76287 m
130.87729 100.85669 L
130.97112 100.95080 L
131.06494 101.04463 L
131.06494 101.04463 L
130.97112 101.13846 L
130.87729 101.23257 L
130.78318 101.32668 L
130.78318 101.32668 L
130.68935 101.32668 L
130.59524 101.23257 L
130.50142 101.13846 L
130.50142 101.04463 L
130.50142 100.95080 L
130.50142 100.85669 L
130.59524 100.76287 L
130.68935 100.76287 L
130.78318 100.76287 L
130.87729 100.76287 L
@c
F
@rax %Note: Object
129.37408 100.76287 129.93761 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
129.74995 100.76287 m
129.74995 100.85669 L
129.84378 100.95080 L
129.93761 101.04463 L
129.93761 101.04463 L
129.84378 101.13846 L
129.74995 101.23257 L
129.65584 101.32668 L
129.65584 101.32668 L
129.56230 101.32668 L
129.46819 101.23257 L
129.37408 101.13846 L
129.37408 101.04463 L
129.37408 100.95080 L
129.37408 100.85669 L
129.46819 100.76287 L
129.56230 100.76287 L
129.65584 100.76287 L
129.74995 100.76287 L
@c
F
@rax %Note: Object
128.24674 100.76287 128.81055 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.62261 100.76287 m
128.62261 100.85669 L
128.71672 100.95080 L
128.81055 101.04463 L
128.81055 101.04463 L
128.71672 101.13846 L
128.62261 101.23257 L
128.52879 101.32668 L
128.52879 101.32668 L
128.43468 101.32668 L
128.34085 101.23257 L
128.24674 101.13846 L
128.24674 101.04463 L
128.24674 100.95080 L
128.24674 100.85669 L
128.34085 100.76287 L
128.43468 100.76287 L
128.52879 100.76287 L
128.62261 100.76287 L
@c
F
@rax %Note: Object
127.11940 100.76287 127.68321 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
127.49528 100.76287 m
127.49528 100.85669 L
127.58910 100.95080 L
127.68321 101.04463 L
127.68321 101.04463 L
127.58910 101.13846 L
127.49528 101.23257 L
127.40145 101.32668 L
127.40145 101.32668 L
127.30734 101.32668 L
127.21323 101.23257 L
127.11940 101.13846 L
127.11940 101.04463 L
127.11940 100.95080 L
127.11940 100.85669 L
127.21323 100.76287 L
127.30734 100.76287 L
127.40145 100.76287 L
127.49528 100.76287 L
@c
F
@rax %Note: Object
125.99235 100.76287 126.55587 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
126.36822 100.76287 m
126.36822 100.85669 L
126.46205 100.95080 L
126.55587 101.04463 L
126.55587 101.04463 L
126.46205 101.13846 L
126.36822 101.23257 L
126.27411 101.32668 L
126.27411 101.32668 L
126.18000 101.32668 L
126.08617 101.23257 L
125.99235 101.13846 L
125.99235 101.04463 L
125.99235 100.95080 L
125.99235 100.85669 L
126.08617 100.76287 L
126.18000 100.76287 L
126.27411 100.76287 L
126.36822 100.76287 L
@c
F
@rax %Note: Object
124.86501 100.76287 125.42854 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
125.24088 100.76287 m
125.24088 100.85669 L
125.33471 100.95080 L
125.42854 101.04463 L
125.42854 101.04463 L
125.33471 101.13846 L
125.24088 101.23257 L
125.14677 101.32668 L
125.14677 101.32668 L
125.05266 101.32668 L
124.95883 101.23257 L
124.86501 101.13846 L
124.86501 101.04463 L
124.86501 100.95080 L
124.86501 100.85669 L
124.95883 100.76287 L
125.05266 100.76287 L
125.14677 100.76287 L
125.24088 100.76287 L
@c
F
@rax %Note: Object
123.73767 100.76287 124.30120 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.11354 100.76287 m
124.11354 100.85669 L
124.20737 100.95080 L
124.30120 101.04463 L
124.30120 101.04463 L
124.20737 101.13846 L
124.11354 101.23257 L
124.01915 101.32668 L
124.01915 101.32668 L
123.92532 101.32668 L
123.83150 101.23257 L
123.73767 101.13846 L
123.73767 101.04463 L
123.73767 100.95080 L
123.73767 100.85669 L
123.83150 100.76287 L
123.92532 100.76287 L
124.01915 100.76287 L
124.11354 100.76287 L
@c
F
@rax %Note: Object
122.61033 100.76287 123.17414 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
122.98620 100.76287 m
122.98620 100.85669 L
123.08031 100.95080 L
123.17414 101.04463 L
123.17414 101.04463 L
123.08031 101.13846 L
122.98620 101.23257 L
122.89209 101.32668 L
122.89209 101.32668 L
122.79827 101.32668 L
122.70444 101.23257 L
122.61033 101.13846 L
122.61033 101.04463 L
122.61033 100.95080 L
122.61033 100.85669 L
122.70444 100.76287 L
122.79827 100.76287 L
122.89209 100.76287 L
122.98620 100.76287 L
@c
F
@rax %Note: Object
121.48299 100.76287 122.04680 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
121.85858 100.76287 m
121.85858 100.85669 L
121.95269 100.95080 L
122.04680 101.04463 L
122.04680 101.04463 L
121.95269 101.13846 L
121.85858 101.23257 L
121.76476 101.32668 L
121.76476 101.32668 L
121.67093 101.32668 L
121.57682 101.23257 L
121.48299 101.13846 L
121.48299 101.04463 L
121.48299 100.95080 L
121.48299 100.85669 L
121.57682 100.76287 L
121.67093 100.76287 L
121.76476 100.76287 L
121.85858 100.76287 L
@c
F
@rax %Note: Object
120.35594 100.76287 120.91946 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
120.73153 100.76287 m
120.73153 100.85669 L
120.82564 100.95080 L
120.91946 101.04463 L
120.91946 101.04463 L
120.82564 101.13846 L
120.73153 101.23257 L
120.63770 101.32668 L
120.63770 101.32668 L
120.54359 101.32668 L
120.44976 101.23257 L
120.35594 101.13846 L
120.35594 101.04463 L
120.35594 100.95080 L
120.35594 100.85669 L
120.44976 100.76287 L
120.54359 100.76287 L
120.63770 100.76287 L
120.73153 100.76287 L
@c
F
@rax %Note: Object
119.22860 100.76287 119.79213 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
119.60419 100.76287 m
119.60419 100.85669 L
119.69830 100.95080 L
119.79213 101.04463 L
119.79213 101.04463 L
119.69830 101.13846 L
119.60419 101.23257 L
119.51036 101.32668 L
119.51036 101.32668 L
119.41625 101.32668 L
119.32243 101.23257 L
119.22860 101.13846 L
119.22860 101.04463 L
119.22860 100.95080 L
119.22860 100.85669 L
119.32243 100.76287 L
119.41625 100.76287 L
119.51036 100.76287 L
119.60419 100.76287 L
@c
F
@rax %Note: Object
118.10126 100.76287 118.66479 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
118.47685 100.76287 m
118.47685 100.85669 L
118.57068 100.95080 L
118.66479 101.04463 L
118.66479 101.04463 L
118.57068 101.13846 L
118.47685 101.23257 L
118.38274 101.32668 L
118.38274 101.32668 L
118.28891 101.32668 L
118.19509 101.23257 L
118.10126 101.13846 L
118.10126 101.04463 L
118.10126 100.95080 L
118.10126 100.85669 L
118.19509 100.76287 L
118.28891 100.76287 L
118.38274 100.76287 L
118.47685 100.76287 L
@c
F
@rax %Note: Object
116.97392 100.76287 117.53773 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
117.34951 100.76287 m
117.34951 100.85669 L
117.44362 100.95080 L
117.53773 101.04463 L
117.53773 101.04463 L
117.44362 101.13846 L
117.34951 101.23257 L
117.25569 101.32668 L
117.25569 101.32668 L
117.16186 101.32668 L
117.06803 101.23257 L
116.97392 101.13846 L
116.97392 101.04463 L
116.97392 100.95080 L
116.97392 100.85669 L
117.06803 100.76287 L
117.16186 100.76287 L
117.25569 100.76287 L
117.34951 100.76287 L
@c
F
@rax %Note: Object
115.84658 100.76287 116.41039 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
116.22217 100.76287 m
116.22217 100.85669 L
116.31600 100.95080 L
116.41039 101.04463 L
116.41039 101.04463 L
116.31600 101.13846 L
116.22217 101.23257 L
116.12835 101.32668 L
116.12835 101.32668 L
116.03452 101.32668 L
115.94041 101.23257 L
115.84658 101.13846 L
115.84658 101.04463 L
115.84658 100.95080 L
115.84658 100.85669 L
115.94041 100.76287 L
116.03452 100.76287 L
116.12835 100.76287 L
116.22217 100.76287 L
@c
F
@rax %Note: Object
114.71924 100.76287 115.28277 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.09483 100.76287 m
115.09483 100.85669 L
115.18866 100.95080 L
115.28277 101.04463 L
115.28277 101.04463 L
115.18866 101.13846 L
115.09483 101.23257 L
115.00129 101.32668 L
115.00129 101.32668 L
114.90718 101.32668 L
114.81335 101.23257 L
114.71924 101.13846 L
114.71924 101.04463 L
114.71924 100.95080 L
114.71924 100.85669 L
114.81335 100.76287 L
114.90718 100.76287 L
115.00129 100.76287 L
115.09483 100.76287 L
@c
F
@rax %Note: Object
113.59191 100.76287 114.15543 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
113.96778 100.76287 m
113.96778 100.85669 L
114.06161 100.95080 L
114.15543 101.04463 L
114.15543 101.04463 L
114.06161 101.13846 L
113.96778 101.23257 L
113.87395 101.32668 L
113.87395 101.32668 L
113.77984 101.32668 L
113.68602 101.23257 L
113.59191 101.13846 L
113.59191 101.04463 L
113.59191 100.95080 L
113.59191 100.85669 L
113.68602 100.76287 L
113.77984 100.76287 L
113.87395 100.76287 L
113.96778 100.76287 L
@c
F
@rax %Note: Object
112.46457 100.76287 113.02809 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
112.84044 100.76287 m
112.84044 100.85669 L
112.93427 100.95080 L
113.02809 101.04463 L
113.02809 101.04463 L
112.93427 101.13846 L
112.84044 101.23257 L
112.74633 101.32668 L
112.74633 101.32668 L
112.65250 101.32668 L
112.55868 101.23257 L
112.46457 101.13846 L
112.46457 101.04463 L
112.46457 100.95080 L
112.46457 100.85669 L
112.55868 100.76287 L
112.65250 100.76287 L
112.74633 100.76287 L
112.84044 100.76287 L
@c
F
@rax %Note: Object
111.33723 100.76287 111.90104 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
111.71310 100.76287 m
111.71310 100.85669 L
111.80721 100.95080 L
111.90104 101.04463 L
111.90104 101.04463 L
111.80721 101.13846 L
111.71310 101.23257 L
111.61928 101.32668 L
111.61928 101.32668 L
111.52545 101.32668 L
111.43134 101.23257 L
111.33723 101.13846 L
111.33723 101.04463 L
111.33723 100.95080 L
111.33723 100.85669 L
111.43134 100.76287 L
111.52545 100.76287 L
111.61928 100.76287 L
111.71310 100.76287 L
@c
F
@rax %Note: Object
110.20989 100.76287 110.77370 101.32668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.77370 100.95080 m
110.77370 101.04463 L
110.67987 101.13846 L
110.58576 101.23257 L
110.49194 101.32668 L
110.49194 101.32668 L
110.39811 101.23257 L
110.30372 101.13846 L
110.20989 101.04463 L
110.20989 101.04463 L
110.20989 101.04463 L
110.30372 100.95080 L
110.39811 100.85669 L
110.49194 100.76287 L
110.49194 100.76287 L
110.58576 100.85669 L
110.67987 100.95080 L
110.77370 100.95080 L
@c
F
@rax %Note: Object
110.20989 99.63553 110.77370 100.19906 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.77370 99.82318 m
110.77370 99.91729 L
110.67987 100.01112 L
110.58576 100.10523 L
110.49194 100.19906 L
110.49194 100.19906 L
110.39811 100.10523 L
110.30372 100.01112 L
110.20989 99.91729 L
110.20989 99.91729 L
110.20989 99.91729 L
110.30372 99.82318 L
110.39811 99.72935 L
110.49194 99.63553 L
110.49194 99.63553 L
110.58576 99.72935 L
110.67987 99.82318 L
110.77370 99.82318 L
@c
F
@rax %Note: Object
110.20989 98.50847 110.77370 99.07172 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.77370 98.69584 m
110.77370 98.78995 L
110.67987 98.88378 L
110.58576 98.97789 L
110.49194 99.07172 L
110.49194 99.07172 L
110.39811 98.97789 L
110.30372 98.88378 L
110.20989 98.78995 L
110.20989 98.78995 L
110.20989 98.78995 L
110.30372 98.69584 L
110.39811 98.60230 L
110.49194 98.50847 L
110.49194 98.50847 L
110.58576 98.60230 L
110.67987 98.69584 L
110.77370 98.69584 L
@c
F
@rax %Note: Object
110.20989 97.38085 110.77370 97.94466 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.77370 97.56879 m
110.77370 97.66261 L
110.67987 97.75672 L
110.58576 97.85055 L
110.49194 97.94466 L
110.49194 97.94466 L
110.39811 97.85055 L
110.30372 97.75672 L
110.20989 97.66261 L
110.20989 97.66261 L
110.20989 97.66261 L
110.30372 97.56879 L
110.39811 97.47496 L
110.49194 97.38085 L
110.49194 97.38085 L
110.58576 97.47496 L
110.67987 97.56879 L
110.77370 97.56879 L
@c
F
@rax %Note: Object
110.20989 96.25351 110.77370 96.81732 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.77370 96.44145 m
110.77370 96.53528 L
110.67987 96.62910 L
110.58576 96.72321 L
110.49194 96.81732 L
110.49194 96.81732 L
110.39811 96.72321 L
110.30372 96.62910 L
110.20989 96.53528 L
110.20989 96.53528 L
110.20989 96.53528 L
110.30372 96.44145 L
110.39811 96.34762 L
110.49194 96.25351 L
110.49194 96.25351 L
110.58576 96.34762 L
110.67987 96.44145 L
110.77370 96.44145 L
@c
F
@rax %Note: Object
110.20989 95.12617 110.77370 95.68998 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.77370 95.31439 m
110.77370 95.40822 L
110.67987 95.50205 L
110.58576 95.59587 L
110.49194 95.68998 L
110.49194 95.68998 L
110.39811 95.59587 L
110.30372 95.50205 L
110.20989 95.40822 L
110.20989 95.40822 L
110.20989 95.40822 L
110.30372 95.31439 L
110.39811 95.22028 L
110.49194 95.12617 L
110.49194 95.12617 L
110.58576 95.22028 L
110.67987 95.31439 L
110.77370 95.31439 L
@c
F
@rax %Note: Object
110.20989 93.99883 110.77370 94.56236 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.77370 94.18677 m
110.77370 94.28088 L
110.67987 94.37471 L
110.58576 94.46854 L
110.49194 94.56236 L
110.49194 94.56236 L
110.39811 94.46854 L
110.30372 94.37471 L
110.20989 94.28088 L
110.20989 94.28088 L
110.20989 94.28088 L
110.30372 94.18677 L
110.39811 94.09294 L
110.49194 93.99883 L
110.49194 93.99883 L
110.58576 94.09294 L
110.67987 94.18677 L
110.77370 94.18677 L
@c
F
@rax %Note: Object
110.20989 92.87178 110.77370 93.43502 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.77370 93.05943 m
110.77370 93.15354 L
110.67987 93.24737 L
110.58576 93.34120 L
110.49194 93.43502 L
110.49194 93.43502 L
110.39811 93.34120 L
110.30372 93.24737 L
110.20989 93.15354 L
110.20989 93.15354 L
110.20989 93.15354 L
110.30372 93.05943 L
110.39811 92.96561 L
110.49194 92.87178 L
110.49194 92.87178 L
110.58576 92.96561 L
110.67987 93.05943 L
110.77370 93.05943 L
@c
F
@rax %Note: Object
185.83313 98.03849 191.65748 103.95694 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
185.83313 98.03849 m
191.65748 101.04463 L
185.83313 103.95694 L
185.83313 98.03849 L
@c
F
@rax %Note: Object
191.37543 51.16139 191.93924 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
191.75131 51.16139 m
191.75131 51.25550 L
191.84542 51.34961 L
191.93924 51.44343 L
191.93924 51.44343 L
191.84542 51.53754 L
191.75131 51.63137 L
191.65748 51.72520 L
191.65748 51.72520 L
191.56365 51.72520 L
191.46954 51.63137 L
191.37543 51.53754 L
191.37543 51.44343 L
191.37543 51.34961 L
191.37543 51.25550 L
191.46954 51.16139 L
191.56365 51.16139 L
191.65748 51.16139 L
191.75131 51.16139 L
@c
F
@rax %Note: Object
190.24838 51.16139 190.81191 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
190.62397 51.16139 m
190.62397 51.25550 L
190.71780 51.34961 L
190.81191 51.44343 L
190.81191 51.44343 L
190.71780 51.53754 L
190.62397 51.63137 L
190.53043 51.72520 L
190.53043 51.72520 L
190.43631 51.72520 L
190.34220 51.63137 L
190.24838 51.53754 L
190.24838 51.44343 L
190.24838 51.34961 L
190.24838 51.25550 L
190.34220 51.16139 L
190.43631 51.16139 L
190.53043 51.16139 L
190.62397 51.16139 L
@c
F
@rax %Note: Object
189.12104 51.16139 189.68457 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
189.49691 51.16139 m
189.49691 51.25550 L
189.59074 51.34961 L
189.68457 51.44343 L
189.68457 51.44343 L
189.59074 51.53754 L
189.49691 51.63137 L
189.40309 51.72520 L
189.40309 51.72520 L
189.30898 51.72520 L
189.21487 51.63137 L
189.12104 51.53754 L
189.12104 51.44343 L
189.12104 51.34961 L
189.12104 51.25550 L
189.21487 51.16139 L
189.30898 51.16139 L
189.40309 51.16139 L
189.49691 51.16139 L
@c
F
@rax %Note: Object
187.99370 51.16139 188.55723 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
188.36957 51.16139 m
188.36957 51.25550 L
188.46340 51.34961 L
188.55723 51.44343 L
188.55723 51.44343 L
188.46340 51.53754 L
188.36957 51.63137 L
188.27546 51.72520 L
188.27546 51.72520 L
188.18164 51.72520 L
188.08753 51.63137 L
187.99370 51.53754 L
187.99370 51.44343 L
187.99370 51.34961 L
187.99370 51.25550 L
188.08753 51.16139 L
188.18164 51.16139 L
188.27546 51.16139 L
188.36957 51.16139 L
@c
F
@rax %Note: Object
186.86636 51.16139 187.43017 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
187.24224 51.16139 m
187.24224 51.25550 L
187.33635 51.34961 L
187.43017 51.44343 L
187.43017 51.44343 L
187.33635 51.53754 L
187.24224 51.63137 L
187.14841 51.72520 L
187.14841 51.72520 L
187.05430 51.72520 L
186.96047 51.63137 L
186.86636 51.53754 L
186.86636 51.44343 L
186.86636 51.34961 L
186.86636 51.25550 L
186.96047 51.16139 L
187.05430 51.16139 L
187.14841 51.16139 L
187.24224 51.16139 L
@c
F
@rax %Note: Object
185.73902 51.16139 186.30283 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
186.11490 51.16139 m
186.11490 51.25550 L
186.20901 51.34961 L
186.30283 51.44343 L
186.30283 51.44343 L
186.20901 51.53754 L
186.11490 51.63137 L
186.02107 51.72520 L
186.02107 51.72520 L
185.92696 51.72520 L
185.83313 51.63137 L
185.73902 51.53754 L
185.73902 51.44343 L
185.73902 51.34961 L
185.73902 51.25550 L
185.83313 51.16139 L
185.92696 51.16139 L
186.02107 51.16139 L
186.11490 51.16139 L
@c
F
@rax %Note: Object
184.61197 51.16139 185.17550 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
184.98756 51.16139 m
184.98756 51.25550 L
185.08139 51.34961 L
185.17550 51.44343 L
185.17550 51.44343 L
185.08139 51.53754 L
184.98756 51.63137 L
184.89373 51.72520 L
184.89373 51.72520 L
184.79962 51.72520 L
184.70580 51.63137 L
184.61197 51.53754 L
184.61197 51.44343 L
184.61197 51.34961 L
184.61197 51.25550 L
184.70580 51.16139 L
184.79962 51.16139 L
184.89373 51.16139 L
184.98756 51.16139 L
@c
F
@rax %Note: Object
183.48463 51.16139 184.04816 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
183.86050 51.16139 m
183.86050 51.25550 L
183.95433 51.34961 L
184.04816 51.44343 L
184.04816 51.44343 L
183.95433 51.53754 L
183.86050 51.63137 L
183.76639 51.72520 L
183.76639 51.72520 L
183.67228 51.72520 L
183.57846 51.63137 L
183.48463 51.53754 L
183.48463 51.44343 L
183.48463 51.34961 L
183.48463 51.25550 L
183.57846 51.16139 L
183.67228 51.16139 L
183.76639 51.16139 L
183.86050 51.16139 L
@c
F
@rax %Note: Object
182.35729 51.16139 182.92082 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
182.73317 51.16139 m
182.73317 51.25550 L
182.82699 51.34961 L
182.92082 51.44343 L
182.92082 51.44343 L
182.82699 51.53754 L
182.73317 51.63137 L
182.63877 51.72520 L
182.63877 51.72520 L
182.54494 51.72520 L
182.45112 51.63137 L
182.35729 51.53754 L
182.35729 51.44343 L
182.35729 51.34961 L
182.35729 51.25550 L
182.45112 51.16139 L
182.54494 51.16139 L
182.63877 51.16139 L
182.73317 51.16139 L
@c
F
@rax %Note: Object
181.22995 51.16139 181.79376 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
181.60583 51.16139 m
181.60583 51.25550 L
181.69994 51.34961 L
181.79376 51.44343 L
181.79376 51.44343 L
181.69994 51.53754 L
181.60583 51.63137 L
181.51172 51.72520 L
181.51172 51.72520 L
181.41789 51.72520 L
181.32406 51.63137 L
181.22995 51.53754 L
181.22995 51.44343 L
181.22995 51.34961 L
181.22995 51.25550 L
181.32406 51.16139 L
181.41789 51.16139 L
181.51172 51.16139 L
181.60583 51.16139 L
@c
F
@rax %Note: Object
180.10261 51.16139 180.66643 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
180.47820 51.16139 m
180.47820 51.25550 L
180.57260 51.34961 L
180.66643 51.44343 L
180.66643 51.44343 L
180.57260 51.53754 L
180.47820 51.63137 L
180.38438 51.72520 L
180.38438 51.72520 L
180.29055 51.72520 L
180.19672 51.63137 L
180.10261 51.53754 L
180.10261 51.44343 L
180.10261 51.34961 L
180.10261 51.25550 L
180.19672 51.16139 L
180.29055 51.16139 L
180.38438 51.16139 L
180.47820 51.16139 L
@c
F
@rax %Note: Object
178.97528 51.16139 179.53909 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
179.35087 51.16139 m
179.35087 51.25550 L
179.44498 51.34961 L
179.53909 51.44343 L
179.53909 51.44343 L
179.44498 51.53754 L
179.35087 51.63137 L
179.25704 51.72520 L
179.25704 51.72520 L
179.16321 51.72520 L
179.06910 51.63137 L
178.97528 51.53754 L
178.97528 51.44343 L
178.97528 51.34961 L
178.97528 51.25550 L
179.06910 51.16139 L
179.16321 51.16139 L
179.25704 51.16139 L
179.35087 51.16139 L
@c
F
@rax %Note: Object
177.84822 51.16139 178.41175 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
178.22381 51.16139 m
178.22381 51.25550 L
178.31792 51.34961 L
178.41175 51.44343 L
178.41175 51.44343 L
178.31792 51.53754 L
178.22381 51.63137 L
178.12998 51.72520 L
178.12998 51.72520 L
178.03587 51.72520 L
177.94205 51.63137 L
177.84822 51.53754 L
177.84822 51.44343 L
177.84822 51.34961 L
177.84822 51.25550 L
177.94205 51.16139 L
178.03587 51.16139 L
178.12998 51.16139 L
178.22381 51.16139 L
@c
F
@rax %Note: Object
176.72088 51.16139 177.28441 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
177.09647 51.16139 m
177.09647 51.25550 L
177.19030 51.34961 L
177.28441 51.44343 L
177.28441 51.44343 L
177.19030 51.53754 L
177.09647 51.63137 L
177.00236 51.72520 L
177.00236 51.72520 L
176.90854 51.72520 L
176.81471 51.63137 L
176.72088 51.53754 L
176.72088 51.44343 L
176.72088 51.34961 L
176.72088 51.25550 L
176.81471 51.16139 L
176.90854 51.16139 L
177.00236 51.16139 L
177.09647 51.16139 L
@c
F
@rax %Note: Object
175.59354 51.16139 176.15707 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
175.96913 51.16139 m
175.96913 51.25550 L
176.06296 51.34961 L
176.15707 51.44343 L
176.15707 51.44343 L
176.06296 51.53754 L
175.96913 51.63137 L
175.87531 51.72520 L
175.87531 51.72520 L
175.78148 51.72520 L
175.68765 51.63137 L
175.59354 51.53754 L
175.59354 51.44343 L
175.59354 51.34961 L
175.59354 51.25550 L
175.68765 51.16139 L
175.78148 51.16139 L
175.87531 51.16139 L
175.96913 51.16139 L
@c
F
@rax %Note: Object
174.46620 51.16139 175.03002 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
174.84180 51.16139 m
174.84180 51.25550 L
174.93591 51.34961 L
175.03002 51.44343 L
175.03002 51.44343 L
174.93591 51.53754 L
174.84180 51.63137 L
174.74797 51.72520 L
174.74797 51.72520 L
174.65414 51.72520 L
174.56031 51.63137 L
174.46620 51.53754 L
174.46620 51.44343 L
174.46620 51.34961 L
174.46620 51.25550 L
174.56031 51.16139 L
174.65414 51.16139 L
174.74797 51.16139 L
174.84180 51.16139 L
@c
F
@rax %Note: Object
173.33858 51.16139 173.90239 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
173.71446 51.16139 m
173.71446 51.25550 L
173.80828 51.34961 L
173.90239 51.44343 L
173.90239 51.44343 L
173.80828 51.53754 L
173.71446 51.63137 L
173.62063 51.72520 L
173.62063 51.72520 L
173.52680 51.72520 L
173.43269 51.63137 L
173.33858 51.53754 L
173.33858 51.44343 L
173.33858 51.34961 L
173.33858 51.25550 L
173.43269 51.16139 L
173.52680 51.16139 L
173.62063 51.16139 L
173.71446 51.16139 L
@c
F
@rax %Note: Object
172.21153 51.16139 172.77506 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
172.58740 51.16139 m
172.58740 51.25550 L
172.68123 51.34961 L
172.77506 51.44343 L
172.77506 51.44343 L
172.68123 51.53754 L
172.58740 51.63137 L
172.49357 51.72520 L
172.49357 51.72520 L
172.39946 51.72520 L
172.30564 51.63137 L
172.21153 51.53754 L
172.21153 51.44343 L
172.21153 51.34961 L
172.21153 51.25550 L
172.30564 51.16139 L
172.39946 51.16139 L
172.49357 51.16139 L
172.58740 51.16139 L
@c
F
@rax %Note: Object
171.08419 51.16139 171.64772 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
171.46006 51.16139 m
171.46006 51.25550 L
171.55389 51.34961 L
171.64772 51.44343 L
171.64772 51.44343 L
171.55389 51.53754 L
171.46006 51.63137 L
171.36624 51.72520 L
171.36624 51.72520 L
171.27213 51.72520 L
171.17802 51.63137 L
171.08419 51.53754 L
171.08419 51.44343 L
171.08419 51.34961 L
171.08419 51.25550 L
171.17802 51.16139 L
171.27213 51.16139 L
171.36624 51.16139 L
171.46006 51.16139 L
@c
F
@rax %Note: Object
169.95685 51.16139 170.52038 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
170.33272 51.16139 m
170.33272 51.25550 L
170.42655 51.34961 L
170.52038 51.44343 L
170.52038 51.44343 L
170.42655 51.53754 L
170.33272 51.63137 L
170.23861 51.72520 L
170.23861 51.72520 L
170.14507 51.72520 L
170.05096 51.63137 L
169.95685 51.53754 L
169.95685 51.44343 L
169.95685 51.34961 L
169.95685 51.25550 L
170.05096 51.16139 L
170.14507 51.16139 L
170.23861 51.16139 L
170.33272 51.16139 L
@c
F
@rax %Note: Object
168.82951 51.16139 169.39332 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
169.20539 51.16139 m
169.20539 51.25550 L
169.29950 51.34961 L
169.39332 51.44343 L
169.39332 51.44343 L
169.29950 51.53754 L
169.20539 51.63137 L
169.11156 51.72520 L
169.11156 51.72520 L
169.01773 51.72520 L
168.92362 51.63137 L
168.82951 51.53754 L
168.82951 51.44343 L
168.82951 51.34961 L
168.82951 51.25550 L
168.92362 51.16139 L
169.01773 51.16139 L
169.11156 51.16139 L
169.20539 51.16139 L
@c
F
@rax %Note: Object
167.70217 51.16139 168.26598 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
168.07805 51.16139 m
168.07805 51.25550 L
168.17187 51.34961 L
168.26598 51.44343 L
168.26598 51.44343 L
168.17187 51.53754 L
168.07805 51.63137 L
167.98422 51.72520 L
167.98422 51.72520 L
167.89011 51.72520 L
167.79600 51.63137 L
167.70217 51.53754 L
167.70217 51.44343 L
167.70217 51.34961 L
167.70217 51.25550 L
167.79600 51.16139 L
167.89011 51.16139 L
167.98422 51.16139 L
168.07805 51.16139 L
@c
F
@rax %Note: Object
166.57512 51.16139 167.13865 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
166.95099 51.16139 m
166.95099 51.25550 L
167.04482 51.34961 L
167.13865 51.44343 L
167.13865 51.44343 L
167.04482 51.53754 L
166.95099 51.63137 L
166.85717 51.72520 L
166.85717 51.72520 L
166.76277 51.72520 L
166.66894 51.63137 L
166.57512 51.53754 L
166.57512 51.44343 L
166.57512 51.34961 L
166.57512 51.25550 L
166.66894 51.16139 L
166.76277 51.16139 L
166.85717 51.16139 L
166.95099 51.16139 L
@c
F
@rax %Note: Object
165.44778 51.16139 166.01131 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
165.82365 51.16139 m
165.82365 51.25550 L
165.91748 51.34961 L
166.01131 51.44343 L
166.01131 51.44343 L
165.91748 51.53754 L
165.82365 51.63137 L
165.72983 51.72520 L
165.72983 51.72520 L
165.63543 51.72520 L
165.54161 51.63137 L
165.44778 51.53754 L
165.44778 51.44343 L
165.44778 51.34961 L
165.44778 51.25550 L
165.54161 51.16139 L
165.63543 51.16139 L
165.72983 51.16139 L
165.82365 51.16139 L
@c
F
@rax %Note: Object
164.32044 51.16139 164.88397 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
164.69631 51.16139 m
164.69631 51.25550 L
164.79014 51.34961 L
164.88397 51.44343 L
164.88397 51.44343 L
164.79014 51.53754 L
164.69631 51.63137 L
164.60220 51.72520 L
164.60220 51.72520 L
164.50809 51.72520 L
164.41455 51.63137 L
164.32044 51.53754 L
164.32044 51.44343 L
164.32044 51.34961 L
164.32044 51.25550 L
164.41455 51.16139 L
164.50809 51.16139 L
164.60220 51.16139 L
164.69631 51.16139 L
@c
F
@rax %Note: Object
163.19310 51.16139 163.75691 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
163.56898 51.16139 m
163.56898 51.25550 L
163.66309 51.34961 L
163.75691 51.44343 L
163.75691 51.44343 L
163.66309 51.53754 L
163.56898 51.63137 L
163.47487 51.72520 L
163.47487 51.72520 L
163.38104 51.72520 L
163.28721 51.63137 L
163.19310 51.53754 L
163.19310 51.44343 L
163.19310 51.34961 L
163.19310 51.25550 L
163.28721 51.16139 L
163.38104 51.16139 L
163.47487 51.16139 L
163.56898 51.16139 L
@c
F
@rax %Note: Object
162.06576 51.16139 162.62957 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
162.44164 51.16139 m
162.44164 51.25550 L
162.53546 51.34961 L
162.62957 51.44343 L
162.62957 51.44343 L
162.53546 51.53754 L
162.44164 51.63137 L
162.34753 51.72520 L
162.34753 51.72520 L
162.25370 51.72520 L
162.15959 51.63137 L
162.06576 51.53754 L
162.06576 51.44343 L
162.06576 51.34961 L
162.06576 51.25550 L
162.15959 51.16139 L
162.25370 51.16139 L
162.34753 51.16139 L
162.44164 51.16139 L
@c
F
@rax %Note: Object
160.93871 51.16139 161.50224 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
161.31430 51.16139 m
161.31430 51.25550 L
161.40841 51.34961 L
161.50224 51.44343 L
161.50224 51.44343 L
161.40841 51.53754 L
161.31430 51.63137 L
161.22047 51.72520 L
161.22047 51.72520 L
161.12636 51.72520 L
161.03254 51.63137 L
160.93871 51.53754 L
160.93871 51.44343 L
160.93871 51.34961 L
160.93871 51.25550 L
161.03254 51.16139 L
161.12636 51.16139 L
161.22047 51.16139 L
161.31430 51.16139 L
@c
F
@rax %Note: Object
159.81137 51.16139 160.37490 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
160.18696 51.16139 m
160.18696 51.25550 L
160.28107 51.34961 L
160.37490 51.44343 L
160.37490 51.44343 L
160.28107 51.53754 L
160.18696 51.63137 L
160.09313 51.72520 L
160.09313 51.72520 L
159.99902 51.72520 L
159.90520 51.63137 L
159.81137 51.53754 L
159.81137 51.44343 L
159.81137 51.34961 L
159.81137 51.25550 L
159.90520 51.16139 L
159.99902 51.16139 L
160.09313 51.16139 L
160.18696 51.16139 L
@c
F
@rax %Note: Object
158.68403 51.16139 159.24756 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
159.05962 51.16139 m
159.05962 51.25550 L
159.15373 51.34961 L
159.24756 51.44343 L
159.24756 51.44343 L
159.15373 51.53754 L
159.05962 51.63137 L
158.96551 51.72520 L
158.96551 51.72520 L
158.87169 51.72520 L
158.77786 51.63137 L
158.68403 51.53754 L
158.68403 51.44343 L
158.68403 51.34961 L
158.68403 51.25550 L
158.77786 51.16139 L
158.87169 51.16139 L
158.96551 51.16139 L
159.05962 51.16139 L
@c
F
@rax %Note: Object
157.55669 51.16139 158.12050 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
157.93228 51.16139 m
157.93228 51.25550 L
158.02639 51.34961 L
158.12050 51.44343 L
158.12050 51.44343 L
158.02639 51.53754 L
157.93228 51.63137 L
157.83846 51.72520 L
157.83846 51.72520 L
157.74463 51.72520 L
157.65080 51.63137 L
157.55669 51.53754 L
157.55669 51.44343 L
157.55669 51.34961 L
157.55669 51.25550 L
157.65080 51.16139 L
157.74463 51.16139 L
157.83846 51.16139 L
157.93228 51.16139 L
@c
F
@rax %Note: Object
156.42935 51.16139 156.99317 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
156.80494 51.16139 m
156.80494 51.25550 L
156.89906 51.34961 L
156.99317 51.44343 L
156.99317 51.44343 L
156.89906 51.53754 L
156.80494 51.63137 L
156.71112 51.72520 L
156.71112 51.72520 L
156.61729 51.72520 L
156.52318 51.63137 L
156.42935 51.53754 L
156.42935 51.44343 L
156.42935 51.34961 L
156.42935 51.25550 L
156.52318 51.16139 L
156.61729 51.16139 L
156.71112 51.16139 L
156.80494 51.16139 L
@c
F
@rax %Note: Object
155.30202 51.16139 155.86583 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
155.67789 51.16139 m
155.67789 51.25550 L
155.77143 51.34961 L
155.86583 51.44343 L
155.86583 51.44343 L
155.77143 51.53754 L
155.67789 51.63137 L
155.58406 51.72520 L
155.58406 51.72520 L
155.48995 51.72520 L
155.39613 51.63137 L
155.30202 51.53754 L
155.30202 51.44343 L
155.30202 51.34961 L
155.30202 51.25550 L
155.39613 51.16139 L
155.48995 51.16139 L
155.58406 51.16139 L
155.67789 51.16139 L
@c
F
@rax %Note: Object
154.17468 51.16139 154.73820 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
154.55055 51.16139 m
154.55055 51.25550 L
154.64438 51.34961 L
154.73820 51.44343 L
154.73820 51.44343 L
154.64438 51.53754 L
154.55055 51.63137 L
154.45672 51.72520 L
154.45672 51.72520 L
154.36261 51.72520 L
154.26879 51.63137 L
154.17468 51.53754 L
154.17468 51.44343 L
154.17468 51.34961 L
154.17468 51.25550 L
154.26879 51.16139 L
154.36261 51.16139 L
154.45672 51.16139 L
154.55055 51.16139 L
@c
F
@rax %Note: Object
153.04734 51.16139 153.61087 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
153.42321 51.16139 m
153.42321 51.25550 L
153.51704 51.34961 L
153.61087 51.44343 L
153.61087 51.44343 L
153.51704 51.53754 L
153.42321 51.63137 L
153.32910 51.72520 L
153.32910 51.72520 L
153.23528 51.72520 L
153.14145 51.63137 L
153.04734 51.53754 L
153.04734 51.44343 L
153.04734 51.34961 L
153.04734 51.25550 L
153.14145 51.16139 L
153.23528 51.16139 L
153.32910 51.16139 L
153.42321 51.16139 L
@c
F
@rax %Note: Object
151.92000 51.16139 152.48381 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
152.29587 51.16139 m
152.29587 51.25550 L
152.38998 51.34961 L
152.48381 51.44343 L
152.48381 51.44343 L
152.38998 51.53754 L
152.29587 51.63137 L
152.20205 51.72520 L
152.20205 51.72520 L
152.10822 51.72520 L
152.01411 51.63137 L
151.92000 51.53754 L
151.92000 51.44343 L
151.92000 51.34961 L
151.92000 51.25550 L
152.01411 51.16139 L
152.10822 51.16139 L
152.20205 51.16139 L
152.29587 51.16139 L
@c
F
@rax %Note: Object
150.79266 51.16139 151.35647 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
151.16854 51.16139 m
151.16854 51.25550 L
151.26265 51.34961 L
151.35647 51.44343 L
151.35647 51.44343 L
151.26265 51.53754 L
151.16854 51.63137 L
151.07471 51.72520 L
151.07471 51.72520 L
150.98088 51.72520 L
150.88649 51.63137 L
150.79266 51.53754 L
150.79266 51.44343 L
150.79266 51.34961 L
150.79266 51.25550 L
150.88649 51.16139 L
150.98088 51.16139 L
151.07471 51.16139 L
151.16854 51.16139 L
@c
F
@rax %Note: Object
149.66561 51.16139 150.22913 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
150.04120 51.16139 m
150.04120 51.25550 L
150.13502 51.34961 L
150.22913 51.44343 L
150.22913 51.44343 L
150.13502 51.53754 L
150.04120 51.63137 L
149.94737 51.72520 L
149.94737 51.72520 L
149.85354 51.72520 L
149.75943 51.63137 L
149.66561 51.53754 L
149.66561 51.44343 L
149.66561 51.34961 L
149.66561 51.25550 L
149.75943 51.16139 L
149.85354 51.16139 L
149.94737 51.16139 L
150.04120 51.16139 L
@c
F
@rax %Note: Object
148.53827 51.16139 149.10180 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
148.91414 51.16139 m
148.91414 51.25550 L
149.00797 51.34961 L
149.10180 51.44343 L
149.10180 51.44343 L
149.00797 51.53754 L
148.91414 51.63137 L
148.82031 51.72520 L
148.82031 51.72520 L
148.72620 51.72520 L
148.63209 51.63137 L
148.53827 51.53754 L
148.53827 51.44343 L
148.53827 51.34961 L
148.53827 51.25550 L
148.63209 51.16139 L
148.72620 51.16139 L
148.82031 51.16139 L
148.91414 51.16139 L
@c
F
@rax %Note: Object
147.41093 51.16139 147.97446 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
147.78680 51.16139 m
147.78680 51.25550 L
147.88063 51.34961 L
147.97446 51.44343 L
147.97446 51.44343 L
147.88063 51.53754 L
147.78680 51.63137 L
147.69269 51.72520 L
147.69269 51.72520 L
147.59858 51.72520 L
147.50476 51.63137 L
147.41093 51.53754 L
147.41093 51.44343 L
147.41093 51.34961 L
147.41093 51.25550 L
147.50476 51.16139 L
147.59858 51.16139 L
147.69269 51.16139 L
147.78680 51.16139 L
@c
F
@rax %Note: Object
146.28359 51.16139 146.84740 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
146.65946 51.16139 m
146.65946 51.25550 L
146.75357 51.34961 L
146.84740 51.44343 L
146.84740 51.44343 L
146.75357 51.53754 L
146.65946 51.63137 L
146.56564 51.72520 L
146.56564 51.72520 L
146.47153 51.72520 L
146.37770 51.63137 L
146.28359 51.53754 L
146.28359 51.44343 L
146.28359 51.34961 L
146.28359 51.25550 L
146.37770 51.16139 L
146.47153 51.16139 L
146.56564 51.16139 L
146.65946 51.16139 L
@c
F
@rax %Note: Object
145.15625 51.16139 145.72006 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
145.53213 51.16139 m
145.53213 51.25550 L
145.62624 51.34961 L
145.72006 51.44343 L
145.72006 51.44343 L
145.62624 51.53754 L
145.53213 51.63137 L
145.43830 51.72520 L
145.43830 51.72520 L
145.34419 51.72520 L
145.25008 51.63137 L
145.15625 51.53754 L
145.15625 51.44343 L
145.15625 51.34961 L
145.15625 51.25550 L
145.25008 51.16139 L
145.34419 51.16139 L
145.43830 51.16139 L
145.53213 51.16139 L
@c
F
@rax %Note: Object
144.02920 51.16139 144.59272 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
144.40479 51.16139 m
144.40479 51.25550 L
144.49861 51.34961 L
144.59272 51.44343 L
144.59272 51.44343 L
144.49861 51.53754 L
144.40479 51.63137 L
144.31068 51.72520 L
144.31068 51.72520 L
144.21685 51.72520 L
144.12274 51.63137 L
144.02920 51.53754 L
144.02920 51.44343 L
144.02920 51.34961 L
144.02920 51.25550 L
144.12274 51.16139 L
144.21685 51.16139 L
144.31068 51.16139 L
144.40479 51.16139 L
@c
F
@rax %Note: Object
142.90186 51.16139 143.46539 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
143.27773 51.16139 m
143.27773 51.25550 L
143.37156 51.34961 L
143.46539 51.44343 L
143.46539 51.44343 L
143.37156 51.53754 L
143.27773 51.63137 L
143.18362 51.72520 L
143.18362 51.72520 L
143.08951 51.72520 L
142.99569 51.63137 L
142.90186 51.53754 L
142.90186 51.44343 L
142.90186 51.34961 L
142.90186 51.25550 L
142.99569 51.16139 L
143.08951 51.16139 L
143.18362 51.16139 L
143.27773 51.16139 L
@c
F
@rax %Note: Object
141.77452 51.16139 142.33805 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
142.15011 51.16139 m
142.15011 51.25550 L
142.24422 51.34961 L
142.33805 51.44343 L
142.33805 51.44343 L
142.24422 51.53754 L
142.15011 51.63137 L
142.05600 51.72520 L
142.05600 51.72520 L
141.96217 51.72520 L
141.86835 51.63137 L
141.77452 51.53754 L
141.77452 51.44343 L
141.77452 51.34961 L
141.77452 51.25550 L
141.86835 51.16139 L
141.96217 51.16139 L
142.05600 51.16139 L
142.15011 51.16139 L
@c
F
@rax %Note: Object
140.64718 51.16139 141.21071 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
141.02277 51.16139 m
141.02277 51.25550 L
141.11717 51.34961 L
141.21071 51.44343 L
141.21071 51.44343 L
141.11717 51.53754 L
141.02277 51.63137 L
140.92894 51.72520 L
140.92894 51.72520 L
140.83512 51.72520 L
140.74129 51.63137 L
140.64718 51.53754 L
140.64718 51.44343 L
140.64718 51.34961 L
140.64718 51.25550 L
140.74129 51.16139 L
140.83512 51.16139 L
140.92894 51.16139 L
141.02277 51.16139 L
@c
F
@rax %Note: Object
139.51984 51.16139 140.08365 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
139.89543 51.16139 m
139.89543 51.25550 L
139.98983 51.34961 L
140.08365 51.44343 L
140.08365 51.44343 L
139.98983 51.53754 L
139.89543 51.63137 L
139.80161 51.72520 L
139.80161 51.72520 L
139.70778 51.72520 L
139.61395 51.63137 L
139.51984 51.53754 L
139.51984 51.44343 L
139.51984 51.34961 L
139.51984 51.25550 L
139.61395 51.16139 L
139.70778 51.16139 L
139.80161 51.16139 L
139.89543 51.16139 L
@c
F
@rax %Note: Object
138.39250 51.16139 138.95631 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
138.76809 51.16139 m
138.76809 51.25550 L
138.86220 51.34961 L
138.95631 51.44343 L
138.95631 51.44343 L
138.86220 51.53754 L
138.76809 51.63137 L
138.67427 51.72520 L
138.67427 51.72520 L
138.58044 51.72520 L
138.48633 51.63137 L
138.39250 51.53754 L
138.39250 51.44343 L
138.39250 51.34961 L
138.39250 51.25550 L
138.48633 51.16139 L
138.58044 51.16139 L
138.67427 51.16139 L
138.76809 51.16139 L
@c
F
@rax %Note: Object
137.26545 51.16139 137.82898 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
137.64104 51.16139 m
137.64104 51.25550 L
137.73487 51.34961 L
137.82898 51.44343 L
137.82898 51.44343 L
137.73487 51.53754 L
137.64104 51.63137 L
137.54721 51.72520 L
137.54721 51.72520 L
137.45310 51.72520 L
137.35928 51.63137 L
137.26545 51.53754 L
137.26545 51.44343 L
137.26545 51.34961 L
137.26545 51.25550 L
137.35928 51.16139 L
137.45310 51.16139 L
137.54721 51.16139 L
137.64104 51.16139 L
@c
F
@rax %Note: Object
136.13811 51.16139 136.70164 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
136.51370 51.16139 m
136.51370 51.25550 L
136.60753 51.34961 L
136.70164 51.44343 L
136.70164 51.44343 L
136.60753 51.53754 L
136.51370 51.63137 L
136.41959 51.72520 L
136.41959 51.72520 L
136.32576 51.72520 L
136.23194 51.63137 L
136.13811 51.53754 L
136.13811 51.44343 L
136.13811 51.34961 L
136.13811 51.25550 L
136.23194 51.16139 L
136.32576 51.16139 L
136.41959 51.16139 L
136.51370 51.16139 L
@c
F
@rax %Note: Object
135.01049 51.16139 135.57430 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
135.38636 51.16139 m
135.38636 51.25550 L
135.48019 51.34961 L
135.57430 51.44343 L
135.57430 51.44343 L
135.48019 51.53754 L
135.38636 51.63137 L
135.29254 51.72520 L
135.29254 51.72520 L
135.19871 51.72520 L
135.10488 51.63137 L
135.01049 51.53754 L
135.01049 51.44343 L
135.01049 51.34961 L
135.01049 51.25550 L
135.10488 51.16139 L
135.19871 51.16139 L
135.29254 51.16139 L
135.38636 51.16139 L
@c
F
@rax %Note: Object
133.88315 51.16139 134.44696 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
134.25902 51.16139 m
134.25902 51.25550 L
134.35313 51.34961 L
134.44696 51.44343 L
134.44696 51.44343 L
134.35313 51.53754 L
134.25902 51.63137 L
134.16520 51.72520 L
134.16520 51.72520 L
134.07137 51.72520 L
133.97754 51.63137 L
133.88315 51.53754 L
133.88315 51.44343 L
133.88315 51.34961 L
133.88315 51.25550 L
133.97754 51.16139 L
134.07137 51.16139 L
134.16520 51.16139 L
134.25902 51.16139 L
@c
F
@rax %Note: Object
132.75581 51.16139 133.31962 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
133.13169 51.16139 m
133.13169 51.25550 L
133.22551 51.34961 L
133.31962 51.44343 L
133.31962 51.44343 L
133.22551 51.53754 L
133.13169 51.63137 L
133.03786 51.72520 L
133.03786 51.72520 L
132.94403 51.72520 L
132.84992 51.63137 L
132.75581 51.53754 L
132.75581 51.44343 L
132.75581 51.34961 L
132.75581 51.25550 L
132.84992 51.16139 L
132.94403 51.16139 L
133.03786 51.16139 L
133.13169 51.16139 L
@c
F
@rax %Note: Object
131.62876 51.16139 132.19228 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
132.00463 51.16139 m
132.00463 51.25550 L
132.09846 51.34961 L
132.19228 51.44343 L
132.19228 51.44343 L
132.09846 51.53754 L
132.00463 51.63137 L
131.91080 51.72520 L
131.91080 51.72520 L
131.81669 51.72520 L
131.72258 51.63137 L
131.62876 51.53754 L
131.62876 51.44343 L
131.62876 51.34961 L
131.62876 51.25550 L
131.72258 51.16139 L
131.81669 51.16139 L
131.91080 51.16139 L
132.00463 51.16139 L
@c
F
@rax %Note: Object
130.50142 51.16139 131.06494 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
130.87729 51.16139 m
130.87729 51.25550 L
130.97112 51.34961 L
131.06494 51.44343 L
131.06494 51.44343 L
130.97112 51.53754 L
130.87729 51.63137 L
130.78318 51.72520 L
130.78318 51.72520 L
130.68935 51.72520 L
130.59524 51.63137 L
130.50142 51.53754 L
130.50142 51.44343 L
130.50142 51.34961 L
130.50142 51.25550 L
130.59524 51.16139 L
130.68935 51.16139 L
130.78318 51.16139 L
130.87729 51.16139 L
@c
F
@rax %Note: Object
129.37408 51.16139 129.93761 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
129.74995 51.16139 m
129.74995 51.25550 L
129.84378 51.34961 L
129.93761 51.44343 L
129.93761 51.44343 L
129.84378 51.53754 L
129.74995 51.63137 L
129.65584 51.72520 L
129.65584 51.72520 L
129.56230 51.72520 L
129.46819 51.63137 L
129.37408 51.53754 L
129.37408 51.44343 L
129.37408 51.34961 L
129.37408 51.25550 L
129.46819 51.16139 L
129.56230 51.16139 L
129.65584 51.16139 L
129.74995 51.16139 L
@c
F
@rax %Note: Object
128.24674 51.16139 128.81055 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.62261 51.16139 m
128.62261 51.25550 L
128.71672 51.34961 L
128.81055 51.44343 L
128.81055 51.44343 L
128.71672 51.53754 L
128.62261 51.63137 L
128.52879 51.72520 L
128.52879 51.72520 L
128.43468 51.72520 L
128.34085 51.63137 L
128.24674 51.53754 L
128.24674 51.44343 L
128.24674 51.34961 L
128.24674 51.25550 L
128.34085 51.16139 L
128.43468 51.16139 L
128.52879 51.16139 L
128.62261 51.16139 L
@c
F
@rax %Note: Object
127.11940 51.16139 127.68321 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
127.49528 51.16139 m
127.49528 51.25550 L
127.58910 51.34961 L
127.68321 51.44343 L
127.68321 51.44343 L
127.58910 51.53754 L
127.49528 51.63137 L
127.40145 51.72520 L
127.40145 51.72520 L
127.30734 51.72520 L
127.21323 51.63137 L
127.11940 51.53754 L
127.11940 51.44343 L
127.11940 51.34961 L
127.11940 51.25550 L
127.21323 51.16139 L
127.30734 51.16139 L
127.40145 51.16139 L
127.49528 51.16139 L
@c
F
@rax %Note: Object
125.99235 51.16139 126.55587 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
126.36822 51.16139 m
126.36822 51.25550 L
126.46205 51.34961 L
126.55587 51.44343 L
126.55587 51.44343 L
126.46205 51.53754 L
126.36822 51.63137 L
126.27411 51.72520 L
126.27411 51.72520 L
126.18000 51.72520 L
126.08617 51.63137 L
125.99235 51.53754 L
125.99235 51.44343 L
125.99235 51.34961 L
125.99235 51.25550 L
126.08617 51.16139 L
126.18000 51.16139 L
126.27411 51.16139 L
126.36822 51.16139 L
@c
F
@rax %Note: Object
124.86501 51.16139 125.42854 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
125.24088 51.16139 m
125.24088 51.25550 L
125.33471 51.34961 L
125.42854 51.44343 L
125.42854 51.44343 L
125.33471 51.53754 L
125.24088 51.63137 L
125.14677 51.72520 L
125.14677 51.72520 L
125.05266 51.72520 L
124.95883 51.63137 L
124.86501 51.53754 L
124.86501 51.44343 L
124.86501 51.34961 L
124.86501 51.25550 L
124.95883 51.16139 L
125.05266 51.16139 L
125.14677 51.16139 L
125.24088 51.16139 L
@c
F
@rax %Note: Object
123.73767 51.16139 124.30120 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.11354 51.16139 m
124.11354 51.25550 L
124.20737 51.34961 L
124.30120 51.44343 L
124.30120 51.44343 L
124.20737 51.53754 L
124.11354 51.63137 L
124.01915 51.72520 L
124.01915 51.72520 L
123.92532 51.72520 L
123.83150 51.63137 L
123.73767 51.53754 L
123.73767 51.44343 L
123.73767 51.34961 L
123.73767 51.25550 L
123.83150 51.16139 L
123.92532 51.16139 L
124.01915 51.16139 L
124.11354 51.16139 L
@c
F
@rax %Note: Object
122.61033 51.16139 123.17414 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
122.98620 51.16139 m
122.98620 51.25550 L
123.08031 51.34961 L
123.17414 51.44343 L
123.17414 51.44343 L
123.08031 51.53754 L
122.98620 51.63137 L
122.89209 51.72520 L
122.89209 51.72520 L
122.79827 51.72520 L
122.70444 51.63137 L
122.61033 51.53754 L
122.61033 51.44343 L
122.61033 51.34961 L
122.61033 51.25550 L
122.70444 51.16139 L
122.79827 51.16139 L
122.89209 51.16139 L
122.98620 51.16139 L
@c
F
@rax %Note: Object
121.48299 51.16139 122.04680 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
121.85858 51.16139 m
121.85858 51.25550 L
121.95269 51.34961 L
122.04680 51.44343 L
122.04680 51.44343 L
121.95269 51.53754 L
121.85858 51.63137 L
121.76476 51.72520 L
121.76476 51.72520 L
121.67093 51.72520 L
121.57682 51.63137 L
121.48299 51.53754 L
121.48299 51.44343 L
121.48299 51.34961 L
121.48299 51.25550 L
121.57682 51.16139 L
121.67093 51.16139 L
121.76476 51.16139 L
121.85858 51.16139 L
@c
F
@rax %Note: Object
120.35594 51.16139 120.91946 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
120.73153 51.16139 m
120.73153 51.25550 L
120.82564 51.34961 L
120.91946 51.44343 L
120.91946 51.44343 L
120.82564 51.53754 L
120.73153 51.63137 L
120.63770 51.72520 L
120.63770 51.72520 L
120.54359 51.72520 L
120.44976 51.63137 L
120.35594 51.53754 L
120.35594 51.44343 L
120.35594 51.34961 L
120.35594 51.25550 L
120.44976 51.16139 L
120.54359 51.16139 L
120.63770 51.16139 L
120.73153 51.16139 L
@c
F
@rax %Note: Object
119.22860 51.16139 119.79213 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
119.60419 51.16139 m
119.60419 51.25550 L
119.69830 51.34961 L
119.79213 51.44343 L
119.79213 51.44343 L
119.69830 51.53754 L
119.60419 51.63137 L
119.51036 51.72520 L
119.51036 51.72520 L
119.41625 51.72520 L
119.32243 51.63137 L
119.22860 51.53754 L
119.22860 51.44343 L
119.22860 51.34961 L
119.22860 51.25550 L
119.32243 51.16139 L
119.41625 51.16139 L
119.51036 51.16139 L
119.60419 51.16139 L
@c
F
@rax %Note: Object
118.10126 51.16139 118.66479 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
118.47685 51.16139 m
118.47685 51.25550 L
118.57068 51.34961 L
118.66479 51.44343 L
118.66479 51.44343 L
118.57068 51.53754 L
118.47685 51.63137 L
118.38274 51.72520 L
118.38274 51.72520 L
118.28891 51.72520 L
118.19509 51.63137 L
118.10126 51.53754 L
118.10126 51.44343 L
118.10126 51.34961 L
118.10126 51.25550 L
118.19509 51.16139 L
118.28891 51.16139 L
118.38274 51.16139 L
118.47685 51.16139 L
@c
F
@rax %Note: Object
116.97392 51.16139 117.53773 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
117.34951 51.16139 m
117.34951 51.25550 L
117.44362 51.34961 L
117.53773 51.44343 L
117.53773 51.44343 L
117.44362 51.53754 L
117.34951 51.63137 L
117.25569 51.72520 L
117.25569 51.72520 L
117.16186 51.72520 L
117.06803 51.63137 L
116.97392 51.53754 L
116.97392 51.44343 L
116.97392 51.34961 L
116.97392 51.25550 L
117.06803 51.16139 L
117.16186 51.16139 L
117.25569 51.16139 L
117.34951 51.16139 L
@c
F
@rax %Note: Object
115.84658 51.16139 116.41039 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
116.22217 51.16139 m
116.22217 51.25550 L
116.31600 51.34961 L
116.41039 51.44343 L
116.41039 51.44343 L
116.31600 51.53754 L
116.22217 51.63137 L
116.12835 51.72520 L
116.12835 51.72520 L
116.03452 51.72520 L
115.94041 51.63137 L
115.84658 51.53754 L
115.84658 51.44343 L
115.84658 51.34961 L
115.84658 51.25550 L
115.94041 51.16139 L
116.03452 51.16139 L
116.12835 51.16139 L
116.22217 51.16139 L
@c
F
@rax %Note: Object
114.71924 51.16139 115.28277 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.09483 51.16139 m
115.09483 51.25550 L
115.18866 51.34961 L
115.28277 51.44343 L
115.28277 51.44343 L
115.18866 51.53754 L
115.09483 51.63137 L
115.00129 51.72520 L
115.00129 51.72520 L
114.90718 51.72520 L
114.81335 51.63137 L
114.71924 51.53754 L
114.71924 51.44343 L
114.71924 51.34961 L
114.71924 51.25550 L
114.81335 51.16139 L
114.90718 51.16139 L
115.00129 51.16139 L
115.09483 51.16139 L
@c
F
@rax %Note: Object
113.59191 51.16139 114.15543 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
113.96778 51.16139 m
113.96778 51.25550 L
114.06161 51.34961 L
114.15543 51.44343 L
114.15543 51.44343 L
114.06161 51.53754 L
113.96778 51.63137 L
113.87395 51.72520 L
113.87395 51.72520 L
113.77984 51.72520 L
113.68602 51.63137 L
113.59191 51.53754 L
113.59191 51.44343 L
113.59191 51.34961 L
113.59191 51.25550 L
113.68602 51.16139 L
113.77984 51.16139 L
113.87395 51.16139 L
113.96778 51.16139 L
@c
F
@rax %Note: Object
112.46457 51.16139 113.02809 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
112.84044 51.16139 m
112.84044 51.25550 L
112.93427 51.34961 L
113.02809 51.44343 L
113.02809 51.44343 L
112.93427 51.53754 L
112.84044 51.63137 L
112.74633 51.72520 L
112.74633 51.72520 L
112.65250 51.72520 L
112.55868 51.63137 L
112.46457 51.53754 L
112.46457 51.44343 L
112.46457 51.34961 L
112.46457 51.25550 L
112.55868 51.16139 L
112.65250 51.16139 L
112.74633 51.16139 L
112.84044 51.16139 L
@c
F
@rax %Note: Object
111.33723 51.16139 111.90104 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
111.71310 51.16139 m
111.71310 51.25550 L
111.80721 51.34961 L
111.90104 51.44343 L
111.90104 51.44343 L
111.80721 51.53754 L
111.71310 51.63137 L
111.61928 51.72520 L
111.61928 51.72520 L
111.52545 51.72520 L
111.43134 51.63137 L
111.33723 51.53754 L
111.33723 51.44343 L
111.33723 51.34961 L
111.33723 51.25550 L
111.43134 51.16139 L
111.52545 51.16139 L
111.61928 51.16139 L
111.71310 51.16139 L
@c
F
@rax %Note: Object
110.20989 51.16139 110.77370 51.72520 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 51.44343 m
110.30372 51.34961 L
110.39811 51.25550 L
110.49194 51.16139 L
110.58576 51.16139 L
110.67987 51.25550 L
110.77370 51.34961 L
110.77370 51.44343 L
110.77370 51.53754 L
110.77370 51.53754 L
110.77370 51.63137 L
110.67987 51.72520 L
110.58576 51.72520 L
110.49194 51.72520 L
110.39811 51.72520 L
110.30372 51.63137 L
110.20989 51.53754 L
110.20989 51.44343 L
@c
F
@rax %Note: Object
110.20989 52.28872 110.77370 52.85225 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 52.57077 m
110.30372 52.47666 L
110.39811 52.38283 L
110.49194 52.28872 L
110.58576 52.28872 L
110.67987 52.38283 L
110.77370 52.47666 L
110.77370 52.57077 L
110.77370 52.66460 L
110.77370 52.66460 L
110.77370 52.75843 L
110.67987 52.85225 L
110.58576 52.85225 L
110.49194 52.85225 L
110.39811 52.85225 L
110.30372 52.75843 L
110.20989 52.66460 L
110.20989 52.57077 L
@c
F
@rax %Note: Object
110.20989 53.41606 110.77370 53.97959 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.20989 53.69811 m
110.30372 53.60400 L
110.39811 53.51017 L
110.49194 53.41606 L
110.58576 53.41606 L
110.67987 53.51017 L
110.77370 53.60400 L
110.77370 53.69811 L
110.77370 53.79194 L
110.77370 53.79194 L
110.77370 53.88576 L
110.67987 53.97959 L
110.58576 53.97959 L
110.49194 53.97959 L
110.39811 53.97959 L
110.30372 53.88576 L
110.20989 53.79194 L
110.20989 53.69811 L
@c
F
@rax %Note: Object
107.57962 54.54340 113.49808 60.46186 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
113.49808 54.54340 m
110.49194 60.46186 L
107.57962 54.54340 L
113.49808 54.54340 L
@c
F
@rax %Note: Object
195.88507 195.45591 196.44860 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
196.26066 195.45591 m
196.26066 195.55002 L
196.35449 195.64384 L
196.44860 195.73767 L
196.44860 195.73767 L
196.35449 195.83178 L
196.26066 195.92561 L
196.16683 196.01972 L
196.16683 196.01972 L
196.07272 196.01972 L
195.97890 195.92561 L
195.88507 195.83178 L
195.88507 195.73767 L
195.88507 195.64384 L
195.88507 195.55002 L
195.97890 195.45591 L
196.07272 195.45591 L
196.16683 195.45591 L
196.26066 195.45591 L
@c
F
@rax %Note: Object
194.75773 195.45591 195.32126 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
195.13332 195.45591 m
195.13332 195.55002 L
195.22715 195.64384 L
195.32126 195.73767 L
195.32126 195.73767 L
195.22715 195.83178 L
195.13332 195.92561 L
195.03950 196.01972 L
195.03950 196.01972 L
194.94539 196.01972 L
194.85156 195.92561 L
194.75773 195.83178 L
194.75773 195.73767 L
194.75773 195.64384 L
194.75773 195.55002 L
194.85156 195.45591 L
194.94539 195.45591 L
195.03950 195.45591 L
195.13332 195.45591 L
@c
F
@rax %Note: Object
193.63011 195.45591 194.19392 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
194.00598 195.45591 m
194.00598 195.55002 L
194.09981 195.64384 L
194.19392 195.73767 L
194.19392 195.73767 L
194.09981 195.83178 L
194.00598 195.92561 L
193.91187 196.01972 L
193.91187 196.01972 L
193.81805 196.01972 L
193.72422 195.92561 L
193.63011 195.83178 L
193.63011 195.73767 L
193.63011 195.64384 L
193.63011 195.55002 L
193.72422 195.45591 L
193.81805 195.45591 L
193.91187 195.45591 L
194.00598 195.45591 L
@c
F
@rax %Note: Object
192.50277 195.45591 193.06658 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
192.87865 195.45591 m
192.87865 195.55002 L
192.97276 195.64384 L
193.06658 195.73767 L
193.06658 195.73767 L
192.97276 195.83178 L
192.87865 195.92561 L
192.78482 196.01972 L
192.78482 196.01972 L
192.69099 196.01972 L
192.59717 195.92561 L
192.50277 195.83178 L
192.50277 195.73767 L
192.50277 195.64384 L
192.50277 195.55002 L
192.59717 195.45591 L
192.69099 195.45591 L
192.78482 195.45591 L
192.87865 195.45591 L
@c
F
@rax %Note: Object
191.37543 195.45591 191.93924 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
191.75131 195.45591 m
191.75131 195.55002 L
191.84542 195.64384 L
191.93924 195.73767 L
191.93924 195.73767 L
191.84542 195.83178 L
191.75131 195.92561 L
191.65748 196.01972 L
191.65748 196.01972 L
191.56365 196.01972 L
191.46954 195.92561 L
191.37543 195.83178 L
191.37543 195.73767 L
191.37543 195.64384 L
191.37543 195.55002 L
191.46954 195.45591 L
191.56365 195.45591 L
191.65748 195.45591 L
191.75131 195.45591 L
@c
F
@rax %Note: Object
190.24838 195.45591 190.81191 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
190.62397 195.45591 m
190.62397 195.55002 L
190.71780 195.64384 L
190.81191 195.73767 L
190.81191 195.73767 L
190.71780 195.83178 L
190.62397 195.92561 L
190.53043 196.01972 L
190.53043 196.01972 L
190.43631 196.01972 L
190.34220 195.92561 L
190.24838 195.83178 L
190.24838 195.73767 L
190.24838 195.64384 L
190.24838 195.55002 L
190.34220 195.45591 L
190.43631 195.45591 L
190.53043 195.45591 L
190.62397 195.45591 L
@c
F
@rax %Note: Object
189.12104 195.45591 189.68457 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
189.49691 195.45591 m
189.49691 195.55002 L
189.59074 195.64384 L
189.68457 195.73767 L
189.68457 195.73767 L
189.59074 195.83178 L
189.49691 195.92561 L
189.40309 196.01972 L
189.40309 196.01972 L
189.30898 196.01972 L
189.21487 195.92561 L
189.12104 195.83178 L
189.12104 195.73767 L
189.12104 195.64384 L
189.12104 195.55002 L
189.21487 195.45591 L
189.30898 195.45591 L
189.40309 195.45591 L
189.49691 195.45591 L
@c
F
@rax %Note: Object
187.99370 195.45591 188.55723 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
188.36957 195.45591 m
188.36957 195.55002 L
188.46340 195.64384 L
188.55723 195.73767 L
188.55723 195.73767 L
188.46340 195.83178 L
188.36957 195.92561 L
188.27546 196.01972 L
188.27546 196.01972 L
188.18164 196.01972 L
188.08753 195.92561 L
187.99370 195.83178 L
187.99370 195.73767 L
187.99370 195.64384 L
187.99370 195.55002 L
188.08753 195.45591 L
188.18164 195.45591 L
188.27546 195.45591 L
188.36957 195.45591 L
@c
F
@rax %Note: Object
186.86636 195.45591 187.43017 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
187.24224 195.45591 m
187.24224 195.55002 L
187.33635 195.64384 L
187.43017 195.73767 L
187.43017 195.73767 L
187.33635 195.83178 L
187.24224 195.92561 L
187.14841 196.01972 L
187.14841 196.01972 L
187.05430 196.01972 L
186.96047 195.92561 L
186.86636 195.83178 L
186.86636 195.73767 L
186.86636 195.64384 L
186.86636 195.55002 L
186.96047 195.45591 L
187.05430 195.45591 L
187.14841 195.45591 L
187.24224 195.45591 L
@c
F
@rax %Note: Object
185.73902 195.45591 186.30283 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
186.11490 195.45591 m
186.11490 195.55002 L
186.20901 195.64384 L
186.30283 195.73767 L
186.30283 195.73767 L
186.20901 195.83178 L
186.11490 195.92561 L
186.02107 196.01972 L
186.02107 196.01972 L
185.92696 196.01972 L
185.83313 195.92561 L
185.73902 195.83178 L
185.73902 195.73767 L
185.73902 195.64384 L
185.73902 195.55002 L
185.83313 195.45591 L
185.92696 195.45591 L
186.02107 195.45591 L
186.11490 195.45591 L
@c
F
@rax %Note: Object
184.61197 195.45591 185.17550 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
184.98756 195.45591 m
184.98756 195.55002 L
185.08139 195.64384 L
185.17550 195.73767 L
185.17550 195.73767 L
185.08139 195.83178 L
184.98756 195.92561 L
184.89373 196.01972 L
184.89373 196.01972 L
184.79962 196.01972 L
184.70580 195.92561 L
184.61197 195.83178 L
184.61197 195.73767 L
184.61197 195.64384 L
184.61197 195.55002 L
184.70580 195.45591 L
184.79962 195.45591 L
184.89373 195.45591 L
184.98756 195.45591 L
@c
F
@rax %Note: Object
183.48463 195.45591 184.04816 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
183.86050 195.45591 m
183.86050 195.55002 L
183.95433 195.64384 L
184.04816 195.73767 L
184.04816 195.73767 L
183.95433 195.83178 L
183.86050 195.92561 L
183.76639 196.01972 L
183.76639 196.01972 L
183.67228 196.01972 L
183.57846 195.92561 L
183.48463 195.83178 L
183.48463 195.73767 L
183.48463 195.64384 L
183.48463 195.55002 L
183.57846 195.45591 L
183.67228 195.45591 L
183.76639 195.45591 L
183.86050 195.45591 L
@c
F
@rax %Note: Object
182.35729 195.45591 182.92082 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
182.73317 195.45591 m
182.73317 195.55002 L
182.82699 195.64384 L
182.92082 195.73767 L
182.92082 195.73767 L
182.82699 195.83178 L
182.73317 195.92561 L
182.63877 196.01972 L
182.63877 196.01972 L
182.54494 196.01972 L
182.45112 195.92561 L
182.35729 195.83178 L
182.35729 195.73767 L
182.35729 195.64384 L
182.35729 195.55002 L
182.45112 195.45591 L
182.54494 195.45591 L
182.63877 195.45591 L
182.73317 195.45591 L
@c
F
@rax %Note: Object
181.22995 195.45591 181.79376 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
181.60583 195.45591 m
181.60583 195.55002 L
181.69994 195.64384 L
181.79376 195.73767 L
181.79376 195.73767 L
181.69994 195.83178 L
181.60583 195.92561 L
181.51172 196.01972 L
181.51172 196.01972 L
181.41789 196.01972 L
181.32406 195.92561 L
181.22995 195.83178 L
181.22995 195.73767 L
181.22995 195.64384 L
181.22995 195.55002 L
181.32406 195.45591 L
181.41789 195.45591 L
181.51172 195.45591 L
181.60583 195.45591 L
@c
F
@rax %Note: Object
180.10261 195.45591 180.66643 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
180.47820 195.45591 m
180.47820 195.55002 L
180.57260 195.64384 L
180.66643 195.73767 L
180.66643 195.73767 L
180.57260 195.83178 L
180.47820 195.92561 L
180.38438 196.01972 L
180.38438 196.01972 L
180.29055 196.01972 L
180.19672 195.92561 L
180.10261 195.83178 L
180.10261 195.73767 L
180.10261 195.64384 L
180.10261 195.55002 L
180.19672 195.45591 L
180.29055 195.45591 L
180.38438 195.45591 L
180.47820 195.45591 L
@c
F
@rax %Note: Object
178.97528 195.45591 179.53909 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
179.35087 195.45591 m
179.35087 195.55002 L
179.44498 195.64384 L
179.53909 195.73767 L
179.53909 195.73767 L
179.44498 195.83178 L
179.35087 195.92561 L
179.25704 196.01972 L
179.25704 196.01972 L
179.16321 196.01972 L
179.06910 195.92561 L
178.97528 195.83178 L
178.97528 195.73767 L
178.97528 195.64384 L
178.97528 195.55002 L
179.06910 195.45591 L
179.16321 195.45591 L
179.25704 195.45591 L
179.35087 195.45591 L
@c
F
@rax %Note: Object
177.84822 195.45591 178.41175 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
178.22381 195.45591 m
178.22381 195.55002 L
178.31792 195.64384 L
178.41175 195.73767 L
178.41175 195.73767 L
178.31792 195.83178 L
178.22381 195.92561 L
178.12998 196.01972 L
178.12998 196.01972 L
178.03587 196.01972 L
177.94205 195.92561 L
177.84822 195.83178 L
177.84822 195.73767 L
177.84822 195.64384 L
177.84822 195.55002 L
177.94205 195.45591 L
178.03587 195.45591 L
178.12998 195.45591 L
178.22381 195.45591 L
@c
F
@rax %Note: Object
176.72088 195.45591 177.28441 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
177.09647 195.45591 m
177.09647 195.55002 L
177.19030 195.64384 L
177.28441 195.73767 L
177.28441 195.73767 L
177.19030 195.83178 L
177.09647 195.92561 L
177.00236 196.01972 L
177.00236 196.01972 L
176.90854 196.01972 L
176.81471 195.92561 L
176.72088 195.83178 L
176.72088 195.73767 L
176.72088 195.64384 L
176.72088 195.55002 L
176.81471 195.45591 L
176.90854 195.45591 L
177.00236 195.45591 L
177.09647 195.45591 L
@c
F
@rax %Note: Object
175.59354 195.45591 176.15707 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
175.96913 195.45591 m
175.96913 195.55002 L
176.06296 195.64384 L
176.15707 195.73767 L
176.15707 195.73767 L
176.06296 195.83178 L
175.96913 195.92561 L
175.87531 196.01972 L
175.87531 196.01972 L
175.78148 196.01972 L
175.68765 195.92561 L
175.59354 195.83178 L
175.59354 195.73767 L
175.59354 195.64384 L
175.59354 195.55002 L
175.68765 195.45591 L
175.78148 195.45591 L
175.87531 195.45591 L
175.96913 195.45591 L
@c
F
@rax %Note: Object
174.46620 195.45591 175.03002 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
174.84180 195.45591 m
174.84180 195.55002 L
174.93591 195.64384 L
175.03002 195.73767 L
175.03002 195.73767 L
174.93591 195.83178 L
174.84180 195.92561 L
174.74797 196.01972 L
174.74797 196.01972 L
174.65414 196.01972 L
174.56031 195.92561 L
174.46620 195.83178 L
174.46620 195.73767 L
174.46620 195.64384 L
174.46620 195.55002 L
174.56031 195.45591 L
174.65414 195.45591 L
174.74797 195.45591 L
174.84180 195.45591 L
@c
F
@rax %Note: Object
173.33858 195.45591 173.90239 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
173.71446 195.45591 m
173.71446 195.55002 L
173.80828 195.64384 L
173.90239 195.73767 L
173.90239 195.73767 L
173.80828 195.83178 L
173.71446 195.92561 L
173.62063 196.01972 L
173.62063 196.01972 L
173.52680 196.01972 L
173.43269 195.92561 L
173.33858 195.83178 L
173.33858 195.73767 L
173.33858 195.64384 L
173.33858 195.55002 L
173.43269 195.45591 L
173.52680 195.45591 L
173.62063 195.45591 L
173.71446 195.45591 L
@c
F
@rax %Note: Object
172.21153 195.45591 172.77506 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
172.58740 195.45591 m
172.58740 195.55002 L
172.68123 195.64384 L
172.77506 195.73767 L
172.77506 195.73767 L
172.68123 195.83178 L
172.58740 195.92561 L
172.49357 196.01972 L
172.49357 196.01972 L
172.39946 196.01972 L
172.30564 195.92561 L
172.21153 195.83178 L
172.21153 195.73767 L
172.21153 195.64384 L
172.21153 195.55002 L
172.30564 195.45591 L
172.39946 195.45591 L
172.49357 195.45591 L
172.58740 195.45591 L
@c
F
@rax %Note: Object
171.08419 195.45591 171.64772 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
171.46006 195.45591 m
171.46006 195.55002 L
171.55389 195.64384 L
171.64772 195.73767 L
171.64772 195.73767 L
171.55389 195.83178 L
171.46006 195.92561 L
171.36624 196.01972 L
171.36624 196.01972 L
171.27213 196.01972 L
171.17802 195.92561 L
171.08419 195.83178 L
171.08419 195.73767 L
171.08419 195.64384 L
171.08419 195.55002 L
171.17802 195.45591 L
171.27213 195.45591 L
171.36624 195.45591 L
171.46006 195.45591 L
@c
F
@rax %Note: Object
169.95685 195.45591 170.52038 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
170.33272 195.45591 m
170.33272 195.55002 L
170.42655 195.64384 L
170.52038 195.73767 L
170.52038 195.73767 L
170.42655 195.83178 L
170.33272 195.92561 L
170.23861 196.01972 L
170.23861 196.01972 L
170.14507 196.01972 L
170.05096 195.92561 L
169.95685 195.83178 L
169.95685 195.73767 L
169.95685 195.64384 L
169.95685 195.55002 L
170.05096 195.45591 L
170.14507 195.45591 L
170.23861 195.45591 L
170.33272 195.45591 L
@c
F
@rax %Note: Object
168.82951 195.45591 169.39332 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
169.20539 195.45591 m
169.20539 195.55002 L
169.29950 195.64384 L
169.39332 195.73767 L
169.39332 195.73767 L
169.29950 195.83178 L
169.20539 195.92561 L
169.11156 196.01972 L
169.11156 196.01972 L
169.01773 196.01972 L
168.92362 195.92561 L
168.82951 195.83178 L
168.82951 195.73767 L
168.82951 195.64384 L
168.82951 195.55002 L
168.92362 195.45591 L
169.01773 195.45591 L
169.11156 195.45591 L
169.20539 195.45591 L
@c
F
@rax %Note: Object
167.70217 195.45591 168.26598 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
168.07805 195.45591 m
168.07805 195.55002 L
168.17187 195.64384 L
168.26598 195.73767 L
168.26598 195.73767 L
168.17187 195.83178 L
168.07805 195.92561 L
167.98422 196.01972 L
167.98422 196.01972 L
167.89011 196.01972 L
167.79600 195.92561 L
167.70217 195.83178 L
167.70217 195.73767 L
167.70217 195.64384 L
167.70217 195.55002 L
167.79600 195.45591 L
167.89011 195.45591 L
167.98422 195.45591 L
168.07805 195.45591 L
@c
F
@rax %Note: Object
166.57512 195.45591 167.13865 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
166.95099 195.45591 m
166.95099 195.55002 L
167.04482 195.64384 L
167.13865 195.73767 L
167.13865 195.73767 L
167.04482 195.83178 L
166.95099 195.92561 L
166.85717 196.01972 L
166.85717 196.01972 L
166.76277 196.01972 L
166.66894 195.92561 L
166.57512 195.83178 L
166.57512 195.73767 L
166.57512 195.64384 L
166.57512 195.55002 L
166.66894 195.45591 L
166.76277 195.45591 L
166.85717 195.45591 L
166.95099 195.45591 L
@c
F
@rax %Note: Object
165.44778 195.45591 166.01131 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
165.82365 195.45591 m
165.82365 195.55002 L
165.91748 195.64384 L
166.01131 195.73767 L
166.01131 195.73767 L
165.91748 195.83178 L
165.82365 195.92561 L
165.72983 196.01972 L
165.72983 196.01972 L
165.63543 196.01972 L
165.54161 195.92561 L
165.44778 195.83178 L
165.44778 195.73767 L
165.44778 195.64384 L
165.44778 195.55002 L
165.54161 195.45591 L
165.63543 195.45591 L
165.72983 195.45591 L
165.82365 195.45591 L
@c
F
@rax %Note: Object
164.32044 195.45591 164.88397 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
164.69631 195.45591 m
164.69631 195.55002 L
164.79014 195.64384 L
164.88397 195.73767 L
164.88397 195.73767 L
164.79014 195.83178 L
164.69631 195.92561 L
164.60220 196.01972 L
164.60220 196.01972 L
164.50809 196.01972 L
164.41455 195.92561 L
164.32044 195.83178 L
164.32044 195.73767 L
164.32044 195.64384 L
164.32044 195.55002 L
164.41455 195.45591 L
164.50809 195.45591 L
164.60220 195.45591 L
164.69631 195.45591 L
@c
F
@rax %Note: Object
163.19310 195.45591 163.75691 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
163.56898 195.45591 m
163.56898 195.55002 L
163.66309 195.64384 L
163.75691 195.73767 L
163.75691 195.73767 L
163.66309 195.83178 L
163.56898 195.92561 L
163.47487 196.01972 L
163.47487 196.01972 L
163.38104 196.01972 L
163.28721 195.92561 L
163.19310 195.83178 L
163.19310 195.73767 L
163.19310 195.64384 L
163.19310 195.55002 L
163.28721 195.45591 L
163.38104 195.45591 L
163.47487 195.45591 L
163.56898 195.45591 L
@c
F
@rax %Note: Object
162.06576 195.45591 162.62957 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
162.44164 195.45591 m
162.44164 195.55002 L
162.53546 195.64384 L
162.62957 195.73767 L
162.62957 195.73767 L
162.53546 195.83178 L
162.44164 195.92561 L
162.34753 196.01972 L
162.34753 196.01972 L
162.25370 196.01972 L
162.15959 195.92561 L
162.06576 195.83178 L
162.06576 195.73767 L
162.06576 195.64384 L
162.06576 195.55002 L
162.15959 195.45591 L
162.25370 195.45591 L
162.34753 195.45591 L
162.44164 195.45591 L
@c
F
@rax %Note: Object
160.93871 195.45591 161.50224 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
161.31430 195.45591 m
161.31430 195.55002 L
161.40841 195.64384 L
161.50224 195.73767 L
161.50224 195.73767 L
161.40841 195.83178 L
161.31430 195.92561 L
161.22047 196.01972 L
161.22047 196.01972 L
161.12636 196.01972 L
161.03254 195.92561 L
160.93871 195.83178 L
160.93871 195.73767 L
160.93871 195.64384 L
160.93871 195.55002 L
161.03254 195.45591 L
161.12636 195.45591 L
161.22047 195.45591 L
161.31430 195.45591 L
@c
F
@rax %Note: Object
159.81137 195.45591 160.37490 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
160.18696 195.45591 m
160.18696 195.55002 L
160.28107 195.64384 L
160.37490 195.73767 L
160.37490 195.73767 L
160.28107 195.83178 L
160.18696 195.92561 L
160.09313 196.01972 L
160.09313 196.01972 L
159.99902 196.01972 L
159.90520 195.92561 L
159.81137 195.83178 L
159.81137 195.73767 L
159.81137 195.64384 L
159.81137 195.55002 L
159.90520 195.45591 L
159.99902 195.45591 L
160.09313 195.45591 L
160.18696 195.45591 L
@c
F
@rax %Note: Object
158.68403 195.45591 159.24756 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
159.05962 195.45591 m
159.05962 195.55002 L
159.15373 195.64384 L
159.24756 195.73767 L
159.24756 195.73767 L
159.15373 195.83178 L
159.05962 195.92561 L
158.96551 196.01972 L
158.96551 196.01972 L
158.87169 196.01972 L
158.77786 195.92561 L
158.68403 195.83178 L
158.68403 195.73767 L
158.68403 195.64384 L
158.68403 195.55002 L
158.77786 195.45591 L
158.87169 195.45591 L
158.96551 195.45591 L
159.05962 195.45591 L
@c
F
@rax %Note: Object
157.55669 195.45591 158.12050 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
157.93228 195.45591 m
157.93228 195.55002 L
158.02639 195.64384 L
158.12050 195.73767 L
158.12050 195.73767 L
158.02639 195.83178 L
157.93228 195.92561 L
157.83846 196.01972 L
157.83846 196.01972 L
157.74463 196.01972 L
157.65080 195.92561 L
157.55669 195.83178 L
157.55669 195.73767 L
157.55669 195.64384 L
157.55669 195.55002 L
157.65080 195.45591 L
157.74463 195.45591 L
157.83846 195.45591 L
157.93228 195.45591 L
@c
F
@rax %Note: Object
156.42935 195.45591 156.99317 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
156.80494 195.45591 m
156.80494 195.55002 L
156.89906 195.64384 L
156.99317 195.73767 L
156.99317 195.73767 L
156.89906 195.83178 L
156.80494 195.92561 L
156.71112 196.01972 L
156.71112 196.01972 L
156.61729 196.01972 L
156.52318 195.92561 L
156.42935 195.83178 L
156.42935 195.73767 L
156.42935 195.64384 L
156.42935 195.55002 L
156.52318 195.45591 L
156.61729 195.45591 L
156.71112 195.45591 L
156.80494 195.45591 L
@c
F
@rax %Note: Object
155.30202 195.45591 155.86583 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
155.67789 195.45591 m
155.67789 195.55002 L
155.77143 195.64384 L
155.86583 195.73767 L
155.86583 195.73767 L
155.77143 195.83178 L
155.67789 195.92561 L
155.58406 196.01972 L
155.58406 196.01972 L
155.48995 196.01972 L
155.39613 195.92561 L
155.30202 195.83178 L
155.30202 195.73767 L
155.30202 195.64384 L
155.30202 195.55002 L
155.39613 195.45591 L
155.48995 195.45591 L
155.58406 195.45591 L
155.67789 195.45591 L
@c
F
@rax %Note: Object
154.17468 195.45591 154.73820 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
154.55055 195.45591 m
154.55055 195.55002 L
154.64438 195.64384 L
154.73820 195.73767 L
154.73820 195.73767 L
154.64438 195.83178 L
154.55055 195.92561 L
154.45672 196.01972 L
154.45672 196.01972 L
154.36261 196.01972 L
154.26879 195.92561 L
154.17468 195.83178 L
154.17468 195.73767 L
154.17468 195.64384 L
154.17468 195.55002 L
154.26879 195.45591 L
154.36261 195.45591 L
154.45672 195.45591 L
154.55055 195.45591 L
@c
F
@rax %Note: Object
153.04734 195.45591 153.61087 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
153.42321 195.45591 m
153.42321 195.55002 L
153.51704 195.64384 L
153.61087 195.73767 L
153.61087 195.73767 L
153.51704 195.83178 L
153.42321 195.92561 L
153.32910 196.01972 L
153.32910 196.01972 L
153.23528 196.01972 L
153.14145 195.92561 L
153.04734 195.83178 L
153.04734 195.73767 L
153.04734 195.64384 L
153.04734 195.55002 L
153.14145 195.45591 L
153.23528 195.45591 L
153.32910 195.45591 L
153.42321 195.45591 L
@c
F
@rax %Note: Object
151.92000 195.45591 152.48381 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
152.29587 195.45591 m
152.29587 195.55002 L
152.38998 195.64384 L
152.48381 195.73767 L
152.48381 195.73767 L
152.38998 195.83178 L
152.29587 195.92561 L
152.20205 196.01972 L
152.20205 196.01972 L
152.10822 196.01972 L
152.01411 195.92561 L
151.92000 195.83178 L
151.92000 195.73767 L
151.92000 195.64384 L
151.92000 195.55002 L
152.01411 195.45591 L
152.10822 195.45591 L
152.20205 195.45591 L
152.29587 195.45591 L
@c
F
@rax %Note: Object
150.79266 195.45591 151.35647 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
151.16854 195.45591 m
151.16854 195.55002 L
151.26265 195.64384 L
151.35647 195.73767 L
151.35647 195.73767 L
151.26265 195.83178 L
151.16854 195.92561 L
151.07471 196.01972 L
151.07471 196.01972 L
150.98088 196.01972 L
150.88649 195.92561 L
150.79266 195.83178 L
150.79266 195.73767 L
150.79266 195.64384 L
150.79266 195.55002 L
150.88649 195.45591 L
150.98088 195.45591 L
151.07471 195.45591 L
151.16854 195.45591 L
@c
F
@rax %Note: Object
149.66561 195.45591 150.22913 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
150.04120 195.45591 m
150.04120 195.55002 L
150.13502 195.64384 L
150.22913 195.73767 L
150.22913 195.73767 L
150.13502 195.83178 L
150.04120 195.92561 L
149.94737 196.01972 L
149.94737 196.01972 L
149.85354 196.01972 L
149.75943 195.92561 L
149.66561 195.83178 L
149.66561 195.73767 L
149.66561 195.64384 L
149.66561 195.55002 L
149.75943 195.45591 L
149.85354 195.45591 L
149.94737 195.45591 L
150.04120 195.45591 L
@c
F
@rax %Note: Object
148.53827 195.45591 149.10180 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
148.91414 195.45591 m
148.91414 195.55002 L
149.00797 195.64384 L
149.10180 195.73767 L
149.10180 195.73767 L
149.00797 195.83178 L
148.91414 195.92561 L
148.82031 196.01972 L
148.82031 196.01972 L
148.72620 196.01972 L
148.63209 195.92561 L
148.53827 195.83178 L
148.53827 195.73767 L
148.53827 195.64384 L
148.53827 195.55002 L
148.63209 195.45591 L
148.72620 195.45591 L
148.82031 195.45591 L
148.91414 195.45591 L
@c
F
@rax %Note: Object
147.41093 195.45591 147.97446 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
147.78680 195.45591 m
147.78680 195.55002 L
147.88063 195.64384 L
147.97446 195.73767 L
147.97446 195.73767 L
147.88063 195.83178 L
147.78680 195.92561 L
147.69269 196.01972 L
147.69269 196.01972 L
147.59858 196.01972 L
147.50476 195.92561 L
147.41093 195.83178 L
147.41093 195.73767 L
147.41093 195.64384 L
147.41093 195.55002 L
147.50476 195.45591 L
147.59858 195.45591 L
147.69269 195.45591 L
147.78680 195.45591 L
@c
F
@rax %Note: Object
146.28359 195.45591 146.84740 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
146.65946 195.45591 m
146.65946 195.55002 L
146.75357 195.64384 L
146.84740 195.73767 L
146.84740 195.73767 L
146.75357 195.83178 L
146.65946 195.92561 L
146.56564 196.01972 L
146.56564 196.01972 L
146.47153 196.01972 L
146.37770 195.92561 L
146.28359 195.83178 L
146.28359 195.73767 L
146.28359 195.64384 L
146.28359 195.55002 L
146.37770 195.45591 L
146.47153 195.45591 L
146.56564 195.45591 L
146.65946 195.45591 L
@c
F
@rax %Note: Object
145.15625 195.45591 145.72006 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
145.53213 195.45591 m
145.53213 195.55002 L
145.62624 195.64384 L
145.72006 195.73767 L
145.72006 195.73767 L
145.62624 195.83178 L
145.53213 195.92561 L
145.43830 196.01972 L
145.43830 196.01972 L
145.34419 196.01972 L
145.25008 195.92561 L
145.15625 195.83178 L
145.15625 195.73767 L
145.15625 195.64384 L
145.15625 195.55002 L
145.25008 195.45591 L
145.34419 195.45591 L
145.43830 195.45591 L
145.53213 195.45591 L
@c
F
@rax %Note: Object
144.02920 195.45591 144.59272 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
144.40479 195.45591 m
144.40479 195.55002 L
144.49861 195.64384 L
144.59272 195.73767 L
144.59272 195.73767 L
144.49861 195.83178 L
144.40479 195.92561 L
144.31068 196.01972 L
144.31068 196.01972 L
144.21685 196.01972 L
144.12274 195.92561 L
144.02920 195.83178 L
144.02920 195.73767 L
144.02920 195.64384 L
144.02920 195.55002 L
144.12274 195.45591 L
144.21685 195.45591 L
144.31068 195.45591 L
144.40479 195.45591 L
@c
F
@rax %Note: Object
142.90186 195.45591 143.46539 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
143.27773 195.45591 m
143.27773 195.55002 L
143.37156 195.64384 L
143.46539 195.73767 L
143.46539 195.73767 L
143.37156 195.83178 L
143.27773 195.92561 L
143.18362 196.01972 L
143.18362 196.01972 L
143.08951 196.01972 L
142.99569 195.92561 L
142.90186 195.83178 L
142.90186 195.73767 L
142.90186 195.64384 L
142.90186 195.55002 L
142.99569 195.45591 L
143.08951 195.45591 L
143.18362 195.45591 L
143.27773 195.45591 L
@c
F
@rax %Note: Object
141.77452 195.45591 142.33805 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
142.15011 195.45591 m
142.15011 195.55002 L
142.24422 195.64384 L
142.33805 195.73767 L
142.33805 195.73767 L
142.24422 195.83178 L
142.15011 195.92561 L
142.05600 196.01972 L
142.05600 196.01972 L
141.96217 196.01972 L
141.86835 195.92561 L
141.77452 195.83178 L
141.77452 195.73767 L
141.77452 195.64384 L
141.77452 195.55002 L
141.86835 195.45591 L
141.96217 195.45591 L
142.05600 195.45591 L
142.15011 195.45591 L
@c
F
@rax %Note: Object
140.64718 195.45591 141.21071 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
141.02277 195.45591 m
141.02277 195.55002 L
141.11717 195.64384 L
141.21071 195.73767 L
141.21071 195.73767 L
141.11717 195.83178 L
141.02277 195.92561 L
140.92894 196.01972 L
140.92894 196.01972 L
140.83512 196.01972 L
140.74129 195.92561 L
140.64718 195.83178 L
140.64718 195.73767 L
140.64718 195.64384 L
140.64718 195.55002 L
140.74129 195.45591 L
140.83512 195.45591 L
140.92894 195.45591 L
141.02277 195.45591 L
@c
F
@rax %Note: Object
139.51984 195.45591 140.08365 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
139.89543 195.45591 m
139.89543 195.55002 L
139.98983 195.64384 L
140.08365 195.73767 L
140.08365 195.73767 L
139.98983 195.83178 L
139.89543 195.92561 L
139.80161 196.01972 L
139.80161 196.01972 L
139.70778 196.01972 L
139.61395 195.92561 L
139.51984 195.83178 L
139.51984 195.73767 L
139.51984 195.64384 L
139.51984 195.55002 L
139.61395 195.45591 L
139.70778 195.45591 L
139.80161 195.45591 L
139.89543 195.45591 L
@c
F
@rax %Note: Object
138.39250 195.45591 138.95631 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
138.76809 195.45591 m
138.76809 195.55002 L
138.86220 195.64384 L
138.95631 195.73767 L
138.95631 195.73767 L
138.86220 195.83178 L
138.76809 195.92561 L
138.67427 196.01972 L
138.67427 196.01972 L
138.58044 196.01972 L
138.48633 195.92561 L
138.39250 195.83178 L
138.39250 195.73767 L
138.39250 195.64384 L
138.39250 195.55002 L
138.48633 195.45591 L
138.58044 195.45591 L
138.67427 195.45591 L
138.76809 195.45591 L
@c
F
@rax %Note: Object
137.26545 195.45591 137.82898 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
137.64104 195.45591 m
137.64104 195.55002 L
137.73487 195.64384 L
137.82898 195.73767 L
137.82898 195.73767 L
137.73487 195.83178 L
137.64104 195.92561 L
137.54721 196.01972 L
137.54721 196.01972 L
137.45310 196.01972 L
137.35928 195.92561 L
137.26545 195.83178 L
137.26545 195.73767 L
137.26545 195.64384 L
137.26545 195.55002 L
137.35928 195.45591 L
137.45310 195.45591 L
137.54721 195.45591 L
137.64104 195.45591 L
@c
F
@rax %Note: Object
136.13811 195.45591 136.70164 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
136.51370 195.45591 m
136.51370 195.55002 L
136.60753 195.64384 L
136.70164 195.73767 L
136.70164 195.73767 L
136.60753 195.83178 L
136.51370 195.92561 L
136.41959 196.01972 L
136.41959 196.01972 L
136.32576 196.01972 L
136.23194 195.92561 L
136.13811 195.83178 L
136.13811 195.73767 L
136.13811 195.64384 L
136.13811 195.55002 L
136.23194 195.45591 L
136.32576 195.45591 L
136.41959 195.45591 L
136.51370 195.45591 L
@c
F
@rax %Note: Object
135.01049 195.45591 135.57430 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
135.38636 195.45591 m
135.38636 195.55002 L
135.48019 195.64384 L
135.57430 195.73767 L
135.57430 195.73767 L
135.48019 195.83178 L
135.38636 195.92561 L
135.29254 196.01972 L
135.29254 196.01972 L
135.19871 196.01972 L
135.10488 195.92561 L
135.01049 195.83178 L
135.01049 195.73767 L
135.01049 195.64384 L
135.01049 195.55002 L
135.10488 195.45591 L
135.19871 195.45591 L
135.29254 195.45591 L
135.38636 195.45591 L
@c
F
@rax %Note: Object
133.88315 195.45591 134.44696 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
134.25902 195.45591 m
134.25902 195.55002 L
134.35313 195.64384 L
134.44696 195.73767 L
134.44696 195.73767 L
134.35313 195.83178 L
134.25902 195.92561 L
134.16520 196.01972 L
134.16520 196.01972 L
134.07137 196.01972 L
133.97754 195.92561 L
133.88315 195.83178 L
133.88315 195.73767 L
133.88315 195.64384 L
133.88315 195.55002 L
133.97754 195.45591 L
134.07137 195.45591 L
134.16520 195.45591 L
134.25902 195.45591 L
@c
F
@rax %Note: Object
132.75581 195.45591 133.31962 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
133.13169 195.45591 m
133.13169 195.55002 L
133.22551 195.64384 L
133.31962 195.73767 L
133.31962 195.73767 L
133.22551 195.83178 L
133.13169 195.92561 L
133.03786 196.01972 L
133.03786 196.01972 L
132.94403 196.01972 L
132.84992 195.92561 L
132.75581 195.83178 L
132.75581 195.73767 L
132.75581 195.64384 L
132.75581 195.55002 L
132.84992 195.45591 L
132.94403 195.45591 L
133.03786 195.45591 L
133.13169 195.45591 L
@c
F
@rax %Note: Object
131.62876 195.45591 132.19228 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
132.00463 195.45591 m
132.00463 195.55002 L
132.09846 195.64384 L
132.19228 195.73767 L
132.19228 195.73767 L
132.09846 195.83178 L
132.00463 195.92561 L
131.91080 196.01972 L
131.91080 196.01972 L
131.81669 196.01972 L
131.72258 195.92561 L
131.62876 195.83178 L
131.62876 195.73767 L
131.62876 195.64384 L
131.62876 195.55002 L
131.72258 195.45591 L
131.81669 195.45591 L
131.91080 195.45591 L
132.00463 195.45591 L
@c
F
@rax %Note: Object
130.50142 195.45591 131.06494 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
130.87729 195.45591 m
130.87729 195.55002 L
130.97112 195.64384 L
131.06494 195.73767 L
131.06494 195.73767 L
130.97112 195.83178 L
130.87729 195.92561 L
130.78318 196.01972 L
130.78318 196.01972 L
130.68935 196.01972 L
130.59524 195.92561 L
130.50142 195.83178 L
130.50142 195.73767 L
130.50142 195.64384 L
130.50142 195.55002 L
130.59524 195.45591 L
130.68935 195.45591 L
130.78318 195.45591 L
130.87729 195.45591 L
@c
F
@rax %Note: Object
129.37408 195.45591 129.93761 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
129.74995 195.45591 m
129.74995 195.55002 L
129.84378 195.64384 L
129.93761 195.73767 L
129.93761 195.73767 L
129.84378 195.83178 L
129.74995 195.92561 L
129.65584 196.01972 L
129.65584 196.01972 L
129.56230 196.01972 L
129.46819 195.92561 L
129.37408 195.83178 L
129.37408 195.73767 L
129.37408 195.64384 L
129.37408 195.55002 L
129.46819 195.45591 L
129.56230 195.45591 L
129.65584 195.45591 L
129.74995 195.45591 L
@c
F
@rax %Note: Object
128.24674 195.45591 128.81055 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.62261 195.45591 m
128.62261 195.55002 L
128.71672 195.64384 L
128.81055 195.73767 L
128.81055 195.73767 L
128.71672 195.83178 L
128.62261 195.92561 L
128.52879 196.01972 L
128.52879 196.01972 L
128.43468 196.01972 L
128.34085 195.92561 L
128.24674 195.83178 L
128.24674 195.73767 L
128.24674 195.64384 L
128.24674 195.55002 L
128.34085 195.45591 L
128.43468 195.45591 L
128.52879 195.45591 L
128.62261 195.45591 L
@c
F
@rax %Note: Object
127.11940 195.45591 127.68321 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
127.49528 195.45591 m
127.49528 195.55002 L
127.58910 195.64384 L
127.68321 195.73767 L
127.68321 195.73767 L
127.58910 195.83178 L
127.49528 195.92561 L
127.40145 196.01972 L
127.40145 196.01972 L
127.30734 196.01972 L
127.21323 195.92561 L
127.11940 195.83178 L
127.11940 195.73767 L
127.11940 195.64384 L
127.11940 195.55002 L
127.21323 195.45591 L
127.30734 195.45591 L
127.40145 195.45591 L
127.49528 195.45591 L
@c
F
@rax %Note: Object
125.99235 195.45591 126.55587 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
126.36822 195.45591 m
126.36822 195.55002 L
126.46205 195.64384 L
126.55587 195.73767 L
126.55587 195.73767 L
126.46205 195.83178 L
126.36822 195.92561 L
126.27411 196.01972 L
126.27411 196.01972 L
126.18000 196.01972 L
126.08617 195.92561 L
125.99235 195.83178 L
125.99235 195.73767 L
125.99235 195.64384 L
125.99235 195.55002 L
126.08617 195.45591 L
126.18000 195.45591 L
126.27411 195.45591 L
126.36822 195.45591 L
@c
F
@rax %Note: Object
124.86501 195.45591 125.42854 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
125.24088 195.45591 m
125.24088 195.55002 L
125.33471 195.64384 L
125.42854 195.73767 L
125.42854 195.73767 L
125.33471 195.83178 L
125.24088 195.92561 L
125.14677 196.01972 L
125.14677 196.01972 L
125.05266 196.01972 L
124.95883 195.92561 L
124.86501 195.83178 L
124.86501 195.73767 L
124.86501 195.64384 L
124.86501 195.55002 L
124.95883 195.45591 L
125.05266 195.45591 L
125.14677 195.45591 L
125.24088 195.45591 L
@c
F
@rax %Note: Object
123.73767 195.45591 124.30120 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.11354 195.45591 m
124.11354 195.55002 L
124.20737 195.64384 L
124.30120 195.73767 L
124.30120 195.73767 L
124.20737 195.83178 L
124.11354 195.92561 L
124.01915 196.01972 L
124.01915 196.01972 L
123.92532 196.01972 L
123.83150 195.92561 L
123.73767 195.83178 L
123.73767 195.73767 L
123.73767 195.64384 L
123.73767 195.55002 L
123.83150 195.45591 L
123.92532 195.45591 L
124.01915 195.45591 L
124.11354 195.45591 L
@c
F
@rax %Note: Object
122.61033 195.45591 123.17414 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
122.98620 195.45591 m
122.98620 195.55002 L
123.08031 195.64384 L
123.17414 195.73767 L
123.17414 195.73767 L
123.08031 195.83178 L
122.98620 195.92561 L
122.89209 196.01972 L
122.89209 196.01972 L
122.79827 196.01972 L
122.70444 195.92561 L
122.61033 195.83178 L
122.61033 195.73767 L
122.61033 195.64384 L
122.61033 195.55002 L
122.70444 195.45591 L
122.79827 195.45591 L
122.89209 195.45591 L
122.98620 195.45591 L
@c
F
@rax %Note: Object
121.48299 195.45591 122.04680 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
121.85858 195.45591 m
121.85858 195.55002 L
121.95269 195.64384 L
122.04680 195.73767 L
122.04680 195.73767 L
121.95269 195.83178 L
121.85858 195.92561 L
121.76476 196.01972 L
121.76476 196.01972 L
121.67093 196.01972 L
121.57682 195.92561 L
121.48299 195.83178 L
121.48299 195.73767 L
121.48299 195.64384 L
121.48299 195.55002 L
121.57682 195.45591 L
121.67093 195.45591 L
121.76476 195.45591 L
121.85858 195.45591 L
@c
F
@rax %Note: Object
120.35594 195.45591 120.91946 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
120.73153 195.45591 m
120.73153 195.55002 L
120.82564 195.64384 L
120.91946 195.73767 L
120.91946 195.73767 L
120.82564 195.83178 L
120.73153 195.92561 L
120.63770 196.01972 L
120.63770 196.01972 L
120.54359 196.01972 L
120.44976 195.92561 L
120.35594 195.83178 L
120.35594 195.73767 L
120.35594 195.64384 L
120.35594 195.55002 L
120.44976 195.45591 L
120.54359 195.45591 L
120.63770 195.45591 L
120.73153 195.45591 L
@c
F
@rax %Note: Object
119.22860 195.45591 119.79213 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
119.60419 195.45591 m
119.60419 195.55002 L
119.69830 195.64384 L
119.79213 195.73767 L
119.79213 195.73767 L
119.69830 195.83178 L
119.60419 195.92561 L
119.51036 196.01972 L
119.51036 196.01972 L
119.41625 196.01972 L
119.32243 195.92561 L
119.22860 195.83178 L
119.22860 195.73767 L
119.22860 195.64384 L
119.22860 195.55002 L
119.32243 195.45591 L
119.41625 195.45591 L
119.51036 195.45591 L
119.60419 195.45591 L
@c
F
@rax %Note: Object
118.10126 195.45591 118.66479 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
118.47685 195.45591 m
118.47685 195.55002 L
118.57068 195.64384 L
118.66479 195.73767 L
118.66479 195.73767 L
118.57068 195.83178 L
118.47685 195.92561 L
118.38274 196.01972 L
118.38274 196.01972 L
118.28891 196.01972 L
118.19509 195.92561 L
118.10126 195.83178 L
118.10126 195.73767 L
118.10126 195.64384 L
118.10126 195.55002 L
118.19509 195.45591 L
118.28891 195.45591 L
118.38274 195.45591 L
118.47685 195.45591 L
@c
F
@rax %Note: Object
116.97392 195.45591 117.53773 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
117.34951 195.45591 m
117.34951 195.55002 L
117.44362 195.64384 L
117.53773 195.73767 L
117.53773 195.73767 L
117.44362 195.83178 L
117.34951 195.92561 L
117.25569 196.01972 L
117.25569 196.01972 L
117.16186 196.01972 L
117.06803 195.92561 L
116.97392 195.83178 L
116.97392 195.73767 L
116.97392 195.64384 L
116.97392 195.55002 L
117.06803 195.45591 L
117.16186 195.45591 L
117.25569 195.45591 L
117.34951 195.45591 L
@c
F
@rax %Note: Object
115.84658 195.45591 116.41039 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
116.22217 195.45591 m
116.22217 195.55002 L
116.31600 195.64384 L
116.41039 195.73767 L
116.41039 195.73767 L
116.31600 195.83178 L
116.22217 195.92561 L
116.12835 196.01972 L
116.12835 196.01972 L
116.03452 196.01972 L
115.94041 195.92561 L
115.84658 195.83178 L
115.84658 195.73767 L
115.84658 195.64384 L
115.84658 195.55002 L
115.94041 195.45591 L
116.03452 195.45591 L
116.12835 195.45591 L
116.22217 195.45591 L
@c
F
@rax %Note: Object
114.71924 195.45591 115.28277 196.01972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
114.71924 195.73767 m
114.81335 195.64384 L
114.90718 195.55002 L
115.00129 195.45591 L
115.09483 195.45591 L
115.18866 195.55002 L
115.28277 195.64384 L
115.28277 195.73767 L
115.28277 195.83178 L
115.28277 195.83178 L
115.28277 195.92561 L
115.18866 196.01972 L
115.09483 196.01972 L
115.00129 196.01972 L
114.90718 196.01972 L
114.81335 195.92561 L
114.71924 195.83178 L
114.71924 195.73767 L
@c
F
@rax %Note: Object
114.71924 196.58353 115.28277 197.14706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
114.71924 196.86501 m
114.81335 196.77118 L
114.90718 196.67735 L
115.00129 196.58353 L
115.09483 196.58353 L
115.18866 196.67735 L
115.28277 196.77118 L
115.28277 196.86501 L
115.28277 196.95912 L
115.28277 196.95912 L
115.28277 197.05323 L
115.18866 197.14706 L
115.09483 197.14706 L
115.00129 197.14706 L
114.90718 197.14706 L
114.81335 197.05323 L
114.71924 196.95912 L
114.71924 196.86501 L
@c
F
@rax %Note: Object
114.71924 197.71058 115.28277 198.27411 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
114.71924 197.99235 m
114.81335 197.89824 L
114.90718 197.80441 L
115.00129 197.71058 L
115.09483 197.71058 L
115.18866 197.80441 L
115.28277 197.89824 L
115.28277 197.99235 L
115.28277 198.08617 L
115.28277 198.08617 L
115.28277 198.18028 L
115.18866 198.27411 L
115.09483 198.27411 L
115.00129 198.27411 L
114.90718 198.27411 L
114.81335 198.18028 L
114.71924 198.08617 L
114.71924 197.99235 L
@c
F
@rax %Note: Object
112.08898 198.83792 118.00687 204.75638 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
118.00687 198.83792 m
115.00129 204.75638 L
112.08898 198.83792 L
118.00687 198.83792 L
@c
F
@rax %Note: Object
190.24838 186.43748 190.81191 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
190.62397 186.43748 m
190.62397 186.53131 L
190.71780 186.62542 L
190.81191 186.71953 L
190.81191 186.71953 L
190.71780 186.81335 L
190.62397 186.90718 L
190.53043 187.00101 L
190.53043 187.00101 L
190.43631 187.00101 L
190.34220 186.90718 L
190.24838 186.81335 L
190.24838 186.71953 L
190.24838 186.62542 L
190.24838 186.53131 L
190.34220 186.43748 L
190.43631 186.43748 L
190.53043 186.43748 L
190.62397 186.43748 L
@c
F
@rax %Note: Object
189.12104 186.43748 189.68457 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
189.49691 186.43748 m
189.49691 186.53131 L
189.59074 186.62542 L
189.68457 186.71953 L
189.68457 186.71953 L
189.59074 186.81335 L
189.49691 186.90718 L
189.40309 187.00101 L
189.40309 187.00101 L
189.30898 187.00101 L
189.21487 186.90718 L
189.12104 186.81335 L
189.12104 186.71953 L
189.12104 186.62542 L
189.12104 186.53131 L
189.21487 186.43748 L
189.30898 186.43748 L
189.40309 186.43748 L
189.49691 186.43748 L
@c
F
@rax %Note: Object
187.99370 186.43748 188.55723 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
188.36957 186.43748 m
188.36957 186.53131 L
188.46340 186.62542 L
188.55723 186.71953 L
188.55723 186.71953 L
188.46340 186.81335 L
188.36957 186.90718 L
188.27546 187.00101 L
188.27546 187.00101 L
188.18164 187.00101 L
188.08753 186.90718 L
187.99370 186.81335 L
187.99370 186.71953 L
187.99370 186.62542 L
187.99370 186.53131 L
188.08753 186.43748 L
188.18164 186.43748 L
188.27546 186.43748 L
188.36957 186.43748 L
@c
F
@rax %Note: Object
186.86636 186.43748 187.43017 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
187.24224 186.43748 m
187.24224 186.53131 L
187.33635 186.62542 L
187.43017 186.71953 L
187.43017 186.71953 L
187.33635 186.81335 L
187.24224 186.90718 L
187.14841 187.00101 L
187.14841 187.00101 L
187.05430 187.00101 L
186.96047 186.90718 L
186.86636 186.81335 L
186.86636 186.71953 L
186.86636 186.62542 L
186.86636 186.53131 L
186.96047 186.43748 L
187.05430 186.43748 L
187.14841 186.43748 L
187.24224 186.43748 L
@c
F
@rax %Note: Object
185.73902 186.43748 186.30283 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
186.11490 186.43748 m
186.11490 186.53131 L
186.20901 186.62542 L
186.30283 186.71953 L
186.30283 186.71953 L
186.20901 186.81335 L
186.11490 186.90718 L
186.02107 187.00101 L
186.02107 187.00101 L
185.92696 187.00101 L
185.83313 186.90718 L
185.73902 186.81335 L
185.73902 186.71953 L
185.73902 186.62542 L
185.73902 186.53131 L
185.83313 186.43748 L
185.92696 186.43748 L
186.02107 186.43748 L
186.11490 186.43748 L
@c
F
@rax %Note: Object
184.61197 186.43748 185.17550 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
184.98756 186.43748 m
184.98756 186.53131 L
185.08139 186.62542 L
185.17550 186.71953 L
185.17550 186.71953 L
185.08139 186.81335 L
184.98756 186.90718 L
184.89373 187.00101 L
184.89373 187.00101 L
184.79962 187.00101 L
184.70580 186.90718 L
184.61197 186.81335 L
184.61197 186.71953 L
184.61197 186.62542 L
184.61197 186.53131 L
184.70580 186.43748 L
184.79962 186.43748 L
184.89373 186.43748 L
184.98756 186.43748 L
@c
F
@rax %Note: Object
183.48463 186.43748 184.04816 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
183.86050 186.43748 m
183.86050 186.53131 L
183.95433 186.62542 L
184.04816 186.71953 L
184.04816 186.71953 L
183.95433 186.81335 L
183.86050 186.90718 L
183.76639 187.00101 L
183.76639 187.00101 L
183.67228 187.00101 L
183.57846 186.90718 L
183.48463 186.81335 L
183.48463 186.71953 L
183.48463 186.62542 L
183.48463 186.53131 L
183.57846 186.43748 L
183.67228 186.43748 L
183.76639 186.43748 L
183.86050 186.43748 L
@c
F
@rax %Note: Object
182.35729 186.43748 182.92082 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
182.73317 186.43748 m
182.73317 186.53131 L
182.82699 186.62542 L
182.92082 186.71953 L
182.92082 186.71953 L
182.82699 186.81335 L
182.73317 186.90718 L
182.63877 187.00101 L
182.63877 187.00101 L
182.54494 187.00101 L
182.45112 186.90718 L
182.35729 186.81335 L
182.35729 186.71953 L
182.35729 186.62542 L
182.35729 186.53131 L
182.45112 186.43748 L
182.54494 186.43748 L
182.63877 186.43748 L
182.73317 186.43748 L
@c
F
@rax %Note: Object
181.22995 186.43748 181.79376 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
181.60583 186.43748 m
181.60583 186.53131 L
181.69994 186.62542 L
181.79376 186.71953 L
181.79376 186.71953 L
181.69994 186.81335 L
181.60583 186.90718 L
181.51172 187.00101 L
181.51172 187.00101 L
181.41789 187.00101 L
181.32406 186.90718 L
181.22995 186.81335 L
181.22995 186.71953 L
181.22995 186.62542 L
181.22995 186.53131 L
181.32406 186.43748 L
181.41789 186.43748 L
181.51172 186.43748 L
181.60583 186.43748 L
@c
F
@rax %Note: Object
180.10261 186.43748 180.66643 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
180.47820 186.43748 m
180.47820 186.53131 L
180.57260 186.62542 L
180.66643 186.71953 L
180.66643 186.71953 L
180.57260 186.81335 L
180.47820 186.90718 L
180.38438 187.00101 L
180.38438 187.00101 L
180.29055 187.00101 L
180.19672 186.90718 L
180.10261 186.81335 L
180.10261 186.71953 L
180.10261 186.62542 L
180.10261 186.53131 L
180.19672 186.43748 L
180.29055 186.43748 L
180.38438 186.43748 L
180.47820 186.43748 L
@c
F
@rax %Note: Object
178.97528 186.43748 179.53909 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
179.35087 186.43748 m
179.35087 186.53131 L
179.44498 186.62542 L
179.53909 186.71953 L
179.53909 186.71953 L
179.44498 186.81335 L
179.35087 186.90718 L
179.25704 187.00101 L
179.25704 187.00101 L
179.16321 187.00101 L
179.06910 186.90718 L
178.97528 186.81335 L
178.97528 186.71953 L
178.97528 186.62542 L
178.97528 186.53131 L
179.06910 186.43748 L
179.16321 186.43748 L
179.25704 186.43748 L
179.35087 186.43748 L
@c
F
@rax %Note: Object
177.84822 186.43748 178.41175 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
178.22381 186.43748 m
178.22381 186.53131 L
178.31792 186.62542 L
178.41175 186.71953 L
178.41175 186.71953 L
178.31792 186.81335 L
178.22381 186.90718 L
178.12998 187.00101 L
178.12998 187.00101 L
178.03587 187.00101 L
177.94205 186.90718 L
177.84822 186.81335 L
177.84822 186.71953 L
177.84822 186.62542 L
177.84822 186.53131 L
177.94205 186.43748 L
178.03587 186.43748 L
178.12998 186.43748 L
178.22381 186.43748 L
@c
F
@rax %Note: Object
176.72088 186.43748 177.28441 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
177.09647 186.43748 m
177.09647 186.53131 L
177.19030 186.62542 L
177.28441 186.71953 L
177.28441 186.71953 L
177.19030 186.81335 L
177.09647 186.90718 L
177.00236 187.00101 L
177.00236 187.00101 L
176.90854 187.00101 L
176.81471 186.90718 L
176.72088 186.81335 L
176.72088 186.71953 L
176.72088 186.62542 L
176.72088 186.53131 L
176.81471 186.43748 L
176.90854 186.43748 L
177.00236 186.43748 L
177.09647 186.43748 L
@c
F
@rax %Note: Object
175.59354 186.43748 176.15707 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
175.96913 186.43748 m
175.96913 186.53131 L
176.06296 186.62542 L
176.15707 186.71953 L
176.15707 186.71953 L
176.06296 186.81335 L
175.96913 186.90718 L
175.87531 187.00101 L
175.87531 187.00101 L
175.78148 187.00101 L
175.68765 186.90718 L
175.59354 186.81335 L
175.59354 186.71953 L
175.59354 186.62542 L
175.59354 186.53131 L
175.68765 186.43748 L
175.78148 186.43748 L
175.87531 186.43748 L
175.96913 186.43748 L
@c
F
@rax %Note: Object
174.46620 186.43748 175.03002 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
174.84180 186.43748 m
174.84180 186.53131 L
174.93591 186.62542 L
175.03002 186.71953 L
175.03002 186.71953 L
174.93591 186.81335 L
174.84180 186.90718 L
174.74797 187.00101 L
174.74797 187.00101 L
174.65414 187.00101 L
174.56031 186.90718 L
174.46620 186.81335 L
174.46620 186.71953 L
174.46620 186.62542 L
174.46620 186.53131 L
174.56031 186.43748 L
174.65414 186.43748 L
174.74797 186.43748 L
174.84180 186.43748 L
@c
F
@rax %Note: Object
173.33858 186.43748 173.90239 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
173.71446 186.43748 m
173.71446 186.53131 L
173.80828 186.62542 L
173.90239 186.71953 L
173.90239 186.71953 L
173.80828 186.81335 L
173.71446 186.90718 L
173.62063 187.00101 L
173.62063 187.00101 L
173.52680 187.00101 L
173.43269 186.90718 L
173.33858 186.81335 L
173.33858 186.71953 L
173.33858 186.62542 L
173.33858 186.53131 L
173.43269 186.43748 L
173.52680 186.43748 L
173.62063 186.43748 L
173.71446 186.43748 L
@c
F
@rax %Note: Object
172.21153 186.43748 172.77506 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
172.58740 186.43748 m
172.58740 186.53131 L
172.68123 186.62542 L
172.77506 186.71953 L
172.77506 186.71953 L
172.68123 186.81335 L
172.58740 186.90718 L
172.49357 187.00101 L
172.49357 187.00101 L
172.39946 187.00101 L
172.30564 186.90718 L
172.21153 186.81335 L
172.21153 186.71953 L
172.21153 186.62542 L
172.21153 186.53131 L
172.30564 186.43748 L
172.39946 186.43748 L
172.49357 186.43748 L
172.58740 186.43748 L
@c
F
@rax %Note: Object
171.08419 186.43748 171.64772 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
171.46006 186.43748 m
171.46006 186.53131 L
171.55389 186.62542 L
171.64772 186.71953 L
171.64772 186.71953 L
171.55389 186.81335 L
171.46006 186.90718 L
171.36624 187.00101 L
171.36624 187.00101 L
171.27213 187.00101 L
171.17802 186.90718 L
171.08419 186.81335 L
171.08419 186.71953 L
171.08419 186.62542 L
171.08419 186.53131 L
171.17802 186.43748 L
171.27213 186.43748 L
171.36624 186.43748 L
171.46006 186.43748 L
@c
F
@rax %Note: Object
169.95685 186.43748 170.52038 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
170.33272 186.43748 m
170.33272 186.53131 L
170.42655 186.62542 L
170.52038 186.71953 L
170.52038 186.71953 L
170.42655 186.81335 L
170.33272 186.90718 L
170.23861 187.00101 L
170.23861 187.00101 L
170.14507 187.00101 L
170.05096 186.90718 L
169.95685 186.81335 L
169.95685 186.71953 L
169.95685 186.62542 L
169.95685 186.53131 L
170.05096 186.43748 L
170.14507 186.43748 L
170.23861 186.43748 L
170.33272 186.43748 L
@c
F
@rax %Note: Object
168.82951 186.43748 169.39332 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
169.20539 186.43748 m
169.20539 186.53131 L
169.29950 186.62542 L
169.39332 186.71953 L
169.39332 186.71953 L
169.29950 186.81335 L
169.20539 186.90718 L
169.11156 187.00101 L
169.11156 187.00101 L
169.01773 187.00101 L
168.92362 186.90718 L
168.82951 186.81335 L
168.82951 186.71953 L
168.82951 186.62542 L
168.82951 186.53131 L
168.92362 186.43748 L
169.01773 186.43748 L
169.11156 186.43748 L
169.20539 186.43748 L
@c
F
@rax %Note: Object
167.70217 186.43748 168.26598 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
168.07805 186.43748 m
168.07805 186.53131 L
168.17187 186.62542 L
168.26598 186.71953 L
168.26598 186.71953 L
168.17187 186.81335 L
168.07805 186.90718 L
167.98422 187.00101 L
167.98422 187.00101 L
167.89011 187.00101 L
167.79600 186.90718 L
167.70217 186.81335 L
167.70217 186.71953 L
167.70217 186.62542 L
167.70217 186.53131 L
167.79600 186.43748 L
167.89011 186.43748 L
167.98422 186.43748 L
168.07805 186.43748 L
@c
F
@rax %Note: Object
166.57512 186.43748 167.13865 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
166.95099 186.43748 m
166.95099 186.53131 L
167.04482 186.62542 L
167.13865 186.71953 L
167.13865 186.71953 L
167.04482 186.81335 L
166.95099 186.90718 L
166.85717 187.00101 L
166.85717 187.00101 L
166.76277 187.00101 L
166.66894 186.90718 L
166.57512 186.81335 L
166.57512 186.71953 L
166.57512 186.62542 L
166.57512 186.53131 L
166.66894 186.43748 L
166.76277 186.43748 L
166.85717 186.43748 L
166.95099 186.43748 L
@c
F
@rax %Note: Object
165.44778 186.43748 166.01131 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
165.82365 186.43748 m
165.82365 186.53131 L
165.91748 186.62542 L
166.01131 186.71953 L
166.01131 186.71953 L
165.91748 186.81335 L
165.82365 186.90718 L
165.72983 187.00101 L
165.72983 187.00101 L
165.63543 187.00101 L
165.54161 186.90718 L
165.44778 186.81335 L
165.44778 186.71953 L
165.44778 186.62542 L
165.44778 186.53131 L
165.54161 186.43748 L
165.63543 186.43748 L
165.72983 186.43748 L
165.82365 186.43748 L
@c
F
@rax %Note: Object
164.32044 186.43748 164.88397 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
164.69631 186.43748 m
164.69631 186.53131 L
164.79014 186.62542 L
164.88397 186.71953 L
164.88397 186.71953 L
164.79014 186.81335 L
164.69631 186.90718 L
164.60220 187.00101 L
164.60220 187.00101 L
164.50809 187.00101 L
164.41455 186.90718 L
164.32044 186.81335 L
164.32044 186.71953 L
164.32044 186.62542 L
164.32044 186.53131 L
164.41455 186.43748 L
164.50809 186.43748 L
164.60220 186.43748 L
164.69631 186.43748 L
@c
F
@rax %Note: Object
163.19310 186.43748 163.75691 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
163.56898 186.43748 m
163.56898 186.53131 L
163.66309 186.62542 L
163.75691 186.71953 L
163.75691 186.71953 L
163.66309 186.81335 L
163.56898 186.90718 L
163.47487 187.00101 L
163.47487 187.00101 L
163.38104 187.00101 L
163.28721 186.90718 L
163.19310 186.81335 L
163.19310 186.71953 L
163.19310 186.62542 L
163.19310 186.53131 L
163.28721 186.43748 L
163.38104 186.43748 L
163.47487 186.43748 L
163.56898 186.43748 L
@c
F
@rax %Note: Object
162.06576 186.43748 162.62957 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
162.44164 186.43748 m
162.44164 186.53131 L
162.53546 186.62542 L
162.62957 186.71953 L
162.62957 186.71953 L
162.53546 186.81335 L
162.44164 186.90718 L
162.34753 187.00101 L
162.34753 187.00101 L
162.25370 187.00101 L
162.15959 186.90718 L
162.06576 186.81335 L
162.06576 186.71953 L
162.06576 186.62542 L
162.06576 186.53131 L
162.15959 186.43748 L
162.25370 186.43748 L
162.34753 186.43748 L
162.44164 186.43748 L
@c
F
@rax %Note: Object
160.93871 186.43748 161.50224 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
161.31430 186.43748 m
161.31430 186.53131 L
161.40841 186.62542 L
161.50224 186.71953 L
161.50224 186.71953 L
161.40841 186.81335 L
161.31430 186.90718 L
161.22047 187.00101 L
161.22047 187.00101 L
161.12636 187.00101 L
161.03254 186.90718 L
160.93871 186.81335 L
160.93871 186.71953 L
160.93871 186.62542 L
160.93871 186.53131 L
161.03254 186.43748 L
161.12636 186.43748 L
161.22047 186.43748 L
161.31430 186.43748 L
@c
F
@rax %Note: Object
159.81137 186.43748 160.37490 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
160.18696 186.43748 m
160.18696 186.53131 L
160.28107 186.62542 L
160.37490 186.71953 L
160.37490 186.71953 L
160.28107 186.81335 L
160.18696 186.90718 L
160.09313 187.00101 L
160.09313 187.00101 L
159.99902 187.00101 L
159.90520 186.90718 L
159.81137 186.81335 L
159.81137 186.71953 L
159.81137 186.62542 L
159.81137 186.53131 L
159.90520 186.43748 L
159.99902 186.43748 L
160.09313 186.43748 L
160.18696 186.43748 L
@c
F
@rax %Note: Object
158.68403 186.43748 159.24756 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
159.05962 186.43748 m
159.05962 186.53131 L
159.15373 186.62542 L
159.24756 186.71953 L
159.24756 186.71953 L
159.15373 186.81335 L
159.05962 186.90718 L
158.96551 187.00101 L
158.96551 187.00101 L
158.87169 187.00101 L
158.77786 186.90718 L
158.68403 186.81335 L
158.68403 186.71953 L
158.68403 186.62542 L
158.68403 186.53131 L
158.77786 186.43748 L
158.87169 186.43748 L
158.96551 186.43748 L
159.05962 186.43748 L
@c
F
@rax %Note: Object
157.55669 186.43748 158.12050 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
157.93228 186.43748 m
157.93228 186.53131 L
158.02639 186.62542 L
158.12050 186.71953 L
158.12050 186.71953 L
158.02639 186.81335 L
157.93228 186.90718 L
157.83846 187.00101 L
157.83846 187.00101 L
157.74463 187.00101 L
157.65080 186.90718 L
157.55669 186.81335 L
157.55669 186.71953 L
157.55669 186.62542 L
157.55669 186.53131 L
157.65080 186.43748 L
157.74463 186.43748 L
157.83846 186.43748 L
157.93228 186.43748 L
@c
F
@rax %Note: Object
156.42935 186.43748 156.99317 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
156.80494 186.43748 m
156.80494 186.53131 L
156.89906 186.62542 L
156.99317 186.71953 L
156.99317 186.71953 L
156.89906 186.81335 L
156.80494 186.90718 L
156.71112 187.00101 L
156.71112 187.00101 L
156.61729 187.00101 L
156.52318 186.90718 L
156.42935 186.81335 L
156.42935 186.71953 L
156.42935 186.62542 L
156.42935 186.53131 L
156.52318 186.43748 L
156.61729 186.43748 L
156.71112 186.43748 L
156.80494 186.43748 L
@c
F
@rax %Note: Object
155.30202 186.43748 155.86583 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
155.67789 186.43748 m
155.67789 186.53131 L
155.77143 186.62542 L
155.86583 186.71953 L
155.86583 186.71953 L
155.77143 186.81335 L
155.67789 186.90718 L
155.58406 187.00101 L
155.58406 187.00101 L
155.48995 187.00101 L
155.39613 186.90718 L
155.30202 186.81335 L
155.30202 186.71953 L
155.30202 186.62542 L
155.30202 186.53131 L
155.39613 186.43748 L
155.48995 186.43748 L
155.58406 186.43748 L
155.67789 186.43748 L
@c
F
@rax %Note: Object
154.17468 186.43748 154.73820 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
154.55055 186.43748 m
154.55055 186.53131 L
154.64438 186.62542 L
154.73820 186.71953 L
154.73820 186.71953 L
154.64438 186.81335 L
154.55055 186.90718 L
154.45672 187.00101 L
154.45672 187.00101 L
154.36261 187.00101 L
154.26879 186.90718 L
154.17468 186.81335 L
154.17468 186.71953 L
154.17468 186.62542 L
154.17468 186.53131 L
154.26879 186.43748 L
154.36261 186.43748 L
154.45672 186.43748 L
154.55055 186.43748 L
@c
F
@rax %Note: Object
153.04734 186.43748 153.61087 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
153.42321 186.43748 m
153.42321 186.53131 L
153.51704 186.62542 L
153.61087 186.71953 L
153.61087 186.71953 L
153.51704 186.81335 L
153.42321 186.90718 L
153.32910 187.00101 L
153.32910 187.00101 L
153.23528 187.00101 L
153.14145 186.90718 L
153.04734 186.81335 L
153.04734 186.71953 L
153.04734 186.62542 L
153.04734 186.53131 L
153.14145 186.43748 L
153.23528 186.43748 L
153.32910 186.43748 L
153.42321 186.43748 L
@c
F
@rax %Note: Object
151.92000 186.43748 152.48381 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
152.29587 186.43748 m
152.29587 186.53131 L
152.38998 186.62542 L
152.48381 186.71953 L
152.48381 186.71953 L
152.38998 186.81335 L
152.29587 186.90718 L
152.20205 187.00101 L
152.20205 187.00101 L
152.10822 187.00101 L
152.01411 186.90718 L
151.92000 186.81335 L
151.92000 186.71953 L
151.92000 186.62542 L
151.92000 186.53131 L
152.01411 186.43748 L
152.10822 186.43748 L
152.20205 186.43748 L
152.29587 186.43748 L
@c
F
@rax %Note: Object
150.79266 186.43748 151.35647 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
151.16854 186.43748 m
151.16854 186.53131 L
151.26265 186.62542 L
151.35647 186.71953 L
151.35647 186.71953 L
151.26265 186.81335 L
151.16854 186.90718 L
151.07471 187.00101 L
151.07471 187.00101 L
150.98088 187.00101 L
150.88649 186.90718 L
150.79266 186.81335 L
150.79266 186.71953 L
150.79266 186.62542 L
150.79266 186.53131 L
150.88649 186.43748 L
150.98088 186.43748 L
151.07471 186.43748 L
151.16854 186.43748 L
@c
F
@rax %Note: Object
149.66561 186.43748 150.22913 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
150.04120 186.43748 m
150.04120 186.53131 L
150.13502 186.62542 L
150.22913 186.71953 L
150.22913 186.71953 L
150.13502 186.81335 L
150.04120 186.90718 L
149.94737 187.00101 L
149.94737 187.00101 L
149.85354 187.00101 L
149.75943 186.90718 L
149.66561 186.81335 L
149.66561 186.71953 L
149.66561 186.62542 L
149.66561 186.53131 L
149.75943 186.43748 L
149.85354 186.43748 L
149.94737 186.43748 L
150.04120 186.43748 L
@c
F
@rax %Note: Object
148.53827 186.43748 149.10180 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
148.91414 186.43748 m
148.91414 186.53131 L
149.00797 186.62542 L
149.10180 186.71953 L
149.10180 186.71953 L
149.00797 186.81335 L
148.91414 186.90718 L
148.82031 187.00101 L
148.82031 187.00101 L
148.72620 187.00101 L
148.63209 186.90718 L
148.53827 186.81335 L
148.53827 186.71953 L
148.53827 186.62542 L
148.53827 186.53131 L
148.63209 186.43748 L
148.72620 186.43748 L
148.82031 186.43748 L
148.91414 186.43748 L
@c
F
@rax %Note: Object
147.41093 186.43748 147.97446 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
147.78680 186.43748 m
147.78680 186.53131 L
147.88063 186.62542 L
147.97446 186.71953 L
147.97446 186.71953 L
147.88063 186.81335 L
147.78680 186.90718 L
147.69269 187.00101 L
147.69269 187.00101 L
147.59858 187.00101 L
147.50476 186.90718 L
147.41093 186.81335 L
147.41093 186.71953 L
147.41093 186.62542 L
147.41093 186.53131 L
147.50476 186.43748 L
147.59858 186.43748 L
147.69269 186.43748 L
147.78680 186.43748 L
@c
F
@rax %Note: Object
146.28359 186.43748 146.84740 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
146.65946 186.43748 m
146.65946 186.53131 L
146.75357 186.62542 L
146.84740 186.71953 L
146.84740 186.71953 L
146.75357 186.81335 L
146.65946 186.90718 L
146.56564 187.00101 L
146.56564 187.00101 L
146.47153 187.00101 L
146.37770 186.90718 L
146.28359 186.81335 L
146.28359 186.71953 L
146.28359 186.62542 L
146.28359 186.53131 L
146.37770 186.43748 L
146.47153 186.43748 L
146.56564 186.43748 L
146.65946 186.43748 L
@c
F
@rax %Note: Object
145.15625 186.43748 145.72006 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
145.53213 186.43748 m
145.53213 186.53131 L
145.62624 186.62542 L
145.72006 186.71953 L
145.72006 186.71953 L
145.62624 186.81335 L
145.53213 186.90718 L
145.43830 187.00101 L
145.43830 187.00101 L
145.34419 187.00101 L
145.25008 186.90718 L
145.15625 186.81335 L
145.15625 186.71953 L
145.15625 186.62542 L
145.15625 186.53131 L
145.25008 186.43748 L
145.34419 186.43748 L
145.43830 186.43748 L
145.53213 186.43748 L
@c
F
@rax %Note: Object
144.02920 186.43748 144.59272 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
144.40479 186.43748 m
144.40479 186.53131 L
144.49861 186.62542 L
144.59272 186.71953 L
144.59272 186.71953 L
144.49861 186.81335 L
144.40479 186.90718 L
144.31068 187.00101 L
144.31068 187.00101 L
144.21685 187.00101 L
144.12274 186.90718 L
144.02920 186.81335 L
144.02920 186.71953 L
144.02920 186.62542 L
144.02920 186.53131 L
144.12274 186.43748 L
144.21685 186.43748 L
144.31068 186.43748 L
144.40479 186.43748 L
@c
F
@rax %Note: Object
142.90186 186.43748 143.46539 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
143.27773 186.43748 m
143.27773 186.53131 L
143.37156 186.62542 L
143.46539 186.71953 L
143.46539 186.71953 L
143.37156 186.81335 L
143.27773 186.90718 L
143.18362 187.00101 L
143.18362 187.00101 L
143.08951 187.00101 L
142.99569 186.90718 L
142.90186 186.81335 L
142.90186 186.71953 L
142.90186 186.62542 L
142.90186 186.53131 L
142.99569 186.43748 L
143.08951 186.43748 L
143.18362 186.43748 L
143.27773 186.43748 L
@c
F
@rax %Note: Object
141.77452 186.43748 142.33805 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
142.15011 186.43748 m
142.15011 186.53131 L
142.24422 186.62542 L
142.33805 186.71953 L
142.33805 186.71953 L
142.24422 186.81335 L
142.15011 186.90718 L
142.05600 187.00101 L
142.05600 187.00101 L
141.96217 187.00101 L
141.86835 186.90718 L
141.77452 186.81335 L
141.77452 186.71953 L
141.77452 186.62542 L
141.77452 186.53131 L
141.86835 186.43748 L
141.96217 186.43748 L
142.05600 186.43748 L
142.15011 186.43748 L
@c
F
@rax %Note: Object
140.64718 186.43748 141.21071 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
141.02277 186.43748 m
141.02277 186.53131 L
141.11717 186.62542 L
141.21071 186.71953 L
141.21071 186.71953 L
141.11717 186.81335 L
141.02277 186.90718 L
140.92894 187.00101 L
140.92894 187.00101 L
140.83512 187.00101 L
140.74129 186.90718 L
140.64718 186.81335 L
140.64718 186.71953 L
140.64718 186.62542 L
140.64718 186.53131 L
140.74129 186.43748 L
140.83512 186.43748 L
140.92894 186.43748 L
141.02277 186.43748 L
@c
F
@rax %Note: Object
139.51984 186.43748 140.08365 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
139.89543 186.43748 m
139.89543 186.53131 L
139.98983 186.62542 L
140.08365 186.71953 L
140.08365 186.71953 L
139.98983 186.81335 L
139.89543 186.90718 L
139.80161 187.00101 L
139.80161 187.00101 L
139.70778 187.00101 L
139.61395 186.90718 L
139.51984 186.81335 L
139.51984 186.71953 L
139.51984 186.62542 L
139.51984 186.53131 L
139.61395 186.43748 L
139.70778 186.43748 L
139.80161 186.43748 L
139.89543 186.43748 L
@c
F
@rax %Note: Object
138.39250 186.43748 138.95631 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
138.76809 186.43748 m
138.76809 186.53131 L
138.86220 186.62542 L
138.95631 186.71953 L
138.95631 186.71953 L
138.86220 186.81335 L
138.76809 186.90718 L
138.67427 187.00101 L
138.67427 187.00101 L
138.58044 187.00101 L
138.48633 186.90718 L
138.39250 186.81335 L
138.39250 186.71953 L
138.39250 186.62542 L
138.39250 186.53131 L
138.48633 186.43748 L
138.58044 186.43748 L
138.67427 186.43748 L
138.76809 186.43748 L
@c
F
@rax %Note: Object
137.26545 186.43748 137.82898 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
137.64104 186.43748 m
137.64104 186.53131 L
137.73487 186.62542 L
137.82898 186.71953 L
137.82898 186.71953 L
137.73487 186.81335 L
137.64104 186.90718 L
137.54721 187.00101 L
137.54721 187.00101 L
137.45310 187.00101 L
137.35928 186.90718 L
137.26545 186.81335 L
137.26545 186.71953 L
137.26545 186.62542 L
137.26545 186.53131 L
137.35928 186.43748 L
137.45310 186.43748 L
137.54721 186.43748 L
137.64104 186.43748 L
@c
F
@rax %Note: Object
136.13811 186.43748 136.70164 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
136.51370 186.43748 m
136.51370 186.53131 L
136.60753 186.62542 L
136.70164 186.71953 L
136.70164 186.71953 L
136.60753 186.81335 L
136.51370 186.90718 L
136.41959 187.00101 L
136.41959 187.00101 L
136.32576 187.00101 L
136.23194 186.90718 L
136.13811 186.81335 L
136.13811 186.71953 L
136.13811 186.62542 L
136.13811 186.53131 L
136.23194 186.43748 L
136.32576 186.43748 L
136.41959 186.43748 L
136.51370 186.43748 L
@c
F
@rax %Note: Object
135.01049 186.43748 135.57430 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
135.38636 186.43748 m
135.38636 186.53131 L
135.48019 186.62542 L
135.57430 186.71953 L
135.57430 186.71953 L
135.48019 186.81335 L
135.38636 186.90718 L
135.29254 187.00101 L
135.29254 187.00101 L
135.19871 187.00101 L
135.10488 186.90718 L
135.01049 186.81335 L
135.01049 186.71953 L
135.01049 186.62542 L
135.01049 186.53131 L
135.10488 186.43748 L
135.19871 186.43748 L
135.29254 186.43748 L
135.38636 186.43748 L
@c
F
@rax %Note: Object
133.88315 186.43748 134.44696 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
134.25902 186.43748 m
134.25902 186.53131 L
134.35313 186.62542 L
134.44696 186.71953 L
134.44696 186.71953 L
134.35313 186.81335 L
134.25902 186.90718 L
134.16520 187.00101 L
134.16520 187.00101 L
134.07137 187.00101 L
133.97754 186.90718 L
133.88315 186.81335 L
133.88315 186.71953 L
133.88315 186.62542 L
133.88315 186.53131 L
133.97754 186.43748 L
134.07137 186.43748 L
134.16520 186.43748 L
134.25902 186.43748 L
@c
F
@rax %Note: Object
132.75581 186.43748 133.31962 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
133.13169 186.43748 m
133.13169 186.53131 L
133.22551 186.62542 L
133.31962 186.71953 L
133.31962 186.71953 L
133.22551 186.81335 L
133.13169 186.90718 L
133.03786 187.00101 L
133.03786 187.00101 L
132.94403 187.00101 L
132.84992 186.90718 L
132.75581 186.81335 L
132.75581 186.71953 L
132.75581 186.62542 L
132.75581 186.53131 L
132.84992 186.43748 L
132.94403 186.43748 L
133.03786 186.43748 L
133.13169 186.43748 L
@c
F
@rax %Note: Object
131.62876 186.43748 132.19228 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
132.00463 186.43748 m
132.00463 186.53131 L
132.09846 186.62542 L
132.19228 186.71953 L
132.19228 186.71953 L
132.09846 186.81335 L
132.00463 186.90718 L
131.91080 187.00101 L
131.91080 187.00101 L
131.81669 187.00101 L
131.72258 186.90718 L
131.62876 186.81335 L
131.62876 186.71953 L
131.62876 186.62542 L
131.62876 186.53131 L
131.72258 186.43748 L
131.81669 186.43748 L
131.91080 186.43748 L
132.00463 186.43748 L
@c
F
@rax %Note: Object
130.50142 186.43748 131.06494 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
130.87729 186.43748 m
130.87729 186.53131 L
130.97112 186.62542 L
131.06494 186.71953 L
131.06494 186.71953 L
130.97112 186.81335 L
130.87729 186.90718 L
130.78318 187.00101 L
130.78318 187.00101 L
130.68935 187.00101 L
130.59524 186.90718 L
130.50142 186.81335 L
130.50142 186.71953 L
130.50142 186.62542 L
130.50142 186.53131 L
130.59524 186.43748 L
130.68935 186.43748 L
130.78318 186.43748 L
130.87729 186.43748 L
@c
F
@rax %Note: Object
129.37408 186.43748 129.93761 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
129.74995 186.43748 m
129.74995 186.53131 L
129.84378 186.62542 L
129.93761 186.71953 L
129.93761 186.71953 L
129.84378 186.81335 L
129.74995 186.90718 L
129.65584 187.00101 L
129.65584 187.00101 L
129.56230 187.00101 L
129.46819 186.90718 L
129.37408 186.81335 L
129.37408 186.71953 L
129.37408 186.62542 L
129.37408 186.53131 L
129.46819 186.43748 L
129.56230 186.43748 L
129.65584 186.43748 L
129.74995 186.43748 L
@c
F
@rax %Note: Object
128.24674 186.43748 128.81055 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.62261 186.43748 m
128.62261 186.53131 L
128.71672 186.62542 L
128.81055 186.71953 L
128.81055 186.71953 L
128.71672 186.81335 L
128.62261 186.90718 L
128.52879 187.00101 L
128.52879 187.00101 L
128.43468 187.00101 L
128.34085 186.90718 L
128.24674 186.81335 L
128.24674 186.71953 L
128.24674 186.62542 L
128.24674 186.53131 L
128.34085 186.43748 L
128.43468 186.43748 L
128.52879 186.43748 L
128.62261 186.43748 L
@c
F
@rax %Note: Object
127.11940 186.43748 127.68321 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
127.49528 186.43748 m
127.49528 186.53131 L
127.58910 186.62542 L
127.68321 186.71953 L
127.68321 186.71953 L
127.58910 186.81335 L
127.49528 186.90718 L
127.40145 187.00101 L
127.40145 187.00101 L
127.30734 187.00101 L
127.21323 186.90718 L
127.11940 186.81335 L
127.11940 186.71953 L
127.11940 186.62542 L
127.11940 186.53131 L
127.21323 186.43748 L
127.30734 186.43748 L
127.40145 186.43748 L
127.49528 186.43748 L
@c
F
@rax %Note: Object
125.99235 186.43748 126.55587 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
126.36822 186.43748 m
126.36822 186.53131 L
126.46205 186.62542 L
126.55587 186.71953 L
126.55587 186.71953 L
126.46205 186.81335 L
126.36822 186.90718 L
126.27411 187.00101 L
126.27411 187.00101 L
126.18000 187.00101 L
126.08617 186.90718 L
125.99235 186.81335 L
125.99235 186.71953 L
125.99235 186.62542 L
125.99235 186.53131 L
126.08617 186.43748 L
126.18000 186.43748 L
126.27411 186.43748 L
126.36822 186.43748 L
@c
F
@rax %Note: Object
124.86501 186.43748 125.42854 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
125.24088 186.43748 m
125.24088 186.53131 L
125.33471 186.62542 L
125.42854 186.71953 L
125.42854 186.71953 L
125.33471 186.81335 L
125.24088 186.90718 L
125.14677 187.00101 L
125.14677 187.00101 L
125.05266 187.00101 L
124.95883 186.90718 L
124.86501 186.81335 L
124.86501 186.71953 L
124.86501 186.62542 L
124.86501 186.53131 L
124.95883 186.43748 L
125.05266 186.43748 L
125.14677 186.43748 L
125.24088 186.43748 L
@c
F
@rax %Note: Object
123.73767 186.43748 124.30120 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.11354 186.43748 m
124.11354 186.53131 L
124.20737 186.62542 L
124.30120 186.71953 L
124.30120 186.71953 L
124.20737 186.81335 L
124.11354 186.90718 L
124.01915 187.00101 L
124.01915 187.00101 L
123.92532 187.00101 L
123.83150 186.90718 L
123.73767 186.81335 L
123.73767 186.71953 L
123.73767 186.62542 L
123.73767 186.53131 L
123.83150 186.43748 L
123.92532 186.43748 L
124.01915 186.43748 L
124.11354 186.43748 L
@c
F
@rax %Note: Object
122.61033 186.43748 123.17414 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
122.98620 186.43748 m
122.98620 186.53131 L
123.08031 186.62542 L
123.17414 186.71953 L
123.17414 186.71953 L
123.08031 186.81335 L
122.98620 186.90718 L
122.89209 187.00101 L
122.89209 187.00101 L
122.79827 187.00101 L
122.70444 186.90718 L
122.61033 186.81335 L
122.61033 186.71953 L
122.61033 186.62542 L
122.61033 186.53131 L
122.70444 186.43748 L
122.79827 186.43748 L
122.89209 186.43748 L
122.98620 186.43748 L
@c
F
@rax %Note: Object
121.48299 186.43748 122.04680 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
121.85858 186.43748 m
121.85858 186.53131 L
121.95269 186.62542 L
122.04680 186.71953 L
122.04680 186.71953 L
121.95269 186.81335 L
121.85858 186.90718 L
121.76476 187.00101 L
121.76476 187.00101 L
121.67093 187.00101 L
121.57682 186.90718 L
121.48299 186.81335 L
121.48299 186.71953 L
121.48299 186.62542 L
121.48299 186.53131 L
121.57682 186.43748 L
121.67093 186.43748 L
121.76476 186.43748 L
121.85858 186.43748 L
@c
F
@rax %Note: Object
120.35594 186.43748 120.91946 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
120.73153 186.43748 m
120.73153 186.53131 L
120.82564 186.62542 L
120.91946 186.71953 L
120.91946 186.71953 L
120.82564 186.81335 L
120.73153 186.90718 L
120.63770 187.00101 L
120.63770 187.00101 L
120.54359 187.00101 L
120.44976 186.90718 L
120.35594 186.81335 L
120.35594 186.71953 L
120.35594 186.62542 L
120.35594 186.53131 L
120.44976 186.43748 L
120.54359 186.43748 L
120.63770 186.43748 L
120.73153 186.43748 L
@c
F
@rax %Note: Object
119.22860 186.43748 119.79213 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
119.60419 186.43748 m
119.60419 186.53131 L
119.69830 186.62542 L
119.79213 186.71953 L
119.79213 186.71953 L
119.69830 186.81335 L
119.60419 186.90718 L
119.51036 187.00101 L
119.51036 187.00101 L
119.41625 187.00101 L
119.32243 186.90718 L
119.22860 186.81335 L
119.22860 186.71953 L
119.22860 186.62542 L
119.22860 186.53131 L
119.32243 186.43748 L
119.41625 186.43748 L
119.51036 186.43748 L
119.60419 186.43748 L
@c
F
@rax %Note: Object
118.10126 186.43748 118.66479 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
118.47685 186.43748 m
118.47685 186.53131 L
118.57068 186.62542 L
118.66479 186.71953 L
118.66479 186.71953 L
118.57068 186.81335 L
118.47685 186.90718 L
118.38274 187.00101 L
118.38274 187.00101 L
118.28891 187.00101 L
118.19509 186.90718 L
118.10126 186.81335 L
118.10126 186.71953 L
118.10126 186.62542 L
118.10126 186.53131 L
118.19509 186.43748 L
118.28891 186.43748 L
118.38274 186.43748 L
118.47685 186.43748 L
@c
F
@rax %Note: Object
116.97392 186.43748 117.53773 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
117.34951 186.43748 m
117.34951 186.53131 L
117.44362 186.62542 L
117.53773 186.71953 L
117.53773 186.71953 L
117.44362 186.81335 L
117.34951 186.90718 L
117.25569 187.00101 L
117.25569 187.00101 L
117.16186 187.00101 L
117.06803 186.90718 L
116.97392 186.81335 L
116.97392 186.71953 L
116.97392 186.62542 L
116.97392 186.53131 L
117.06803 186.43748 L
117.16186 186.43748 L
117.25569 186.43748 L
117.34951 186.43748 L
@c
F
@rax %Note: Object
115.84658 186.43748 116.41039 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
116.22217 186.43748 m
116.22217 186.53131 L
116.31600 186.62542 L
116.41039 186.71953 L
116.41039 186.71953 L
116.31600 186.81335 L
116.22217 186.90718 L
116.12835 187.00101 L
116.12835 187.00101 L
116.03452 187.00101 L
115.94041 186.90718 L
115.84658 186.81335 L
115.84658 186.71953 L
115.84658 186.62542 L
115.84658 186.53131 L
115.94041 186.43748 L
116.03452 186.43748 L
116.12835 186.43748 L
116.22217 186.43748 L
@c
F
@rax %Note: Object
114.71924 186.43748 115.28277 187.00101 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.28277 186.62542 m
115.28277 186.71953 L
115.18866 186.81335 L
115.09483 186.90718 L
115.00129 187.00101 L
115.00129 187.00101 L
114.90718 186.90718 L
114.81335 186.81335 L
114.71924 186.71953 L
114.71924 186.71953 L
114.71924 186.71953 L
114.81335 186.62542 L
114.90718 186.53131 L
115.00129 186.43748 L
115.00129 186.43748 L
115.09483 186.53131 L
115.18866 186.62542 L
115.28277 186.62542 L
@c
F
@rax %Note: Object
114.71924 185.31043 115.28277 185.87367 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.28277 185.49808 m
115.28277 185.59219 L
115.18866 185.68630 L
115.09483 185.78013 L
115.00129 185.87367 L
115.00129 185.87367 L
114.90718 185.78013 L
114.81335 185.68630 L
114.71924 185.59219 L
114.71924 185.59219 L
114.71924 185.59219 L
114.81335 185.49808 L
114.90718 185.40425 L
115.00129 185.31043 L
115.00129 185.31043 L
115.09483 185.40425 L
115.18866 185.49808 L
115.28277 185.49808 L
@c
F
@rax %Note: Object
114.71924 184.18280 115.28277 184.74661 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.28277 184.37074 m
115.28277 184.46485 L
115.18866 184.55896 L
115.09483 184.65279 L
115.00129 184.74661 L
115.00129 184.74661 L
114.90718 184.65279 L
114.81335 184.55896 L
114.71924 184.46485 L
114.71924 184.46485 L
114.71924 184.46485 L
114.81335 184.37074 L
114.90718 184.27691 L
115.00129 184.18280 L
115.00129 184.18280 L
115.09483 184.27691 L
115.18866 184.37074 L
115.28277 184.37074 L
@c
F
@rax %Note: Object
114.71924 183.05546 115.28277 183.61928 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.28277 183.24340 m
115.28277 183.33751 L
115.18866 183.43134 L
115.09483 183.52545 L
115.00129 183.61928 L
115.00129 183.61928 L
114.90718 183.52545 L
114.81335 183.43134 L
114.71924 183.33751 L
114.71924 183.33751 L
114.71924 183.33751 L
114.81335 183.24340 L
114.90718 183.14957 L
115.00129 183.05546 L
115.00129 183.05546 L
115.09483 183.14957 L
115.18866 183.24340 L
115.28277 183.24340 L
@c
F
@rax %Note: Object
114.71924 181.92841 115.28277 182.49222 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.28277 182.11635 m
115.28277 182.21017 L
115.18866 182.30428 L
115.09483 182.39811 L
115.00129 182.49222 L
115.00129 182.49222 L
114.90718 182.39811 L
114.81335 182.30428 L
114.71924 182.21017 L
114.71924 182.21017 L
114.71924 182.21017 L
114.81335 182.11635 L
114.90718 182.02224 L
115.00129 181.92841 L
115.00129 181.92841 L
115.09483 182.02224 L
115.18866 182.11635 L
115.28277 182.11635 L
@c
F
@rax %Note: Object
114.71924 180.80107 115.28277 181.36488 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.28277 180.98872 m
115.28277 181.08283 L
115.18866 181.17694 L
115.09483 181.27077 L
115.00129 181.36488 L
115.00129 181.36488 L
114.90718 181.27077 L
114.81335 181.17694 L
114.71924 181.08283 L
114.71924 181.08283 L
114.71924 181.08283 L
114.81335 180.98872 L
114.90718 180.89490 L
115.00129 180.80107 L
115.00129 180.80107 L
115.09483 180.89490 L
115.18866 180.98872 L
115.28277 180.98872 L
@c
F
@rax %Note: Object
114.71924 179.67402 115.28277 180.23726 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.28277 179.86167 m
115.28277 179.95550 L
115.18866 180.04961 L
115.09483 180.14343 L
115.00129 180.23726 L
115.00129 180.23726 L
114.90718 180.14343 L
114.81335 180.04961 L
114.71924 179.95550 L
114.71924 179.95550 L
114.71924 179.95550 L
114.81335 179.86167 L
114.90718 179.76784 L
115.00129 179.67402 L
115.00129 179.67402 L
115.09483 179.76784 L
115.18866 179.86167 L
115.28277 179.86167 L
@c
F
@rax %Note: Object
114.71924 178.54668 115.28277 179.11020 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.28277 178.73433 m
115.28277 178.82816 L
115.18866 178.92227 L
115.09483 179.01638 L
115.00129 179.11020 L
115.00129 179.11020 L
114.90718 179.01638 L
114.81335 178.92227 L
114.71924 178.82816 L
114.71924 178.82816 L
114.71924 178.82816 L
114.81335 178.73433 L
114.90718 178.64050 L
115.00129 178.54668 L
115.00129 178.54668 L
115.09483 178.64050 L
115.18866 178.73433 L
115.28277 178.73433 L
@c
F
@rax %Note: Object
114.71924 177.41906 115.28277 177.98287 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.28277 177.60699 m
115.28277 177.70082 L
115.18866 177.79465 L
115.09483 177.88904 L
115.00129 177.98287 L
115.00129 177.98287 L
114.90718 177.88904 L
114.81335 177.79465 L
114.71924 177.70082 L
114.71924 177.70082 L
114.71924 177.70082 L
114.81335 177.60699 L
114.90718 177.51317 L
115.00129 177.41906 L
115.00129 177.41906 L
115.09483 177.51317 L
115.18866 177.60699 L
115.28277 177.60699 L
@c
F
@rax %Note: Object
114.71924 176.29200 115.28277 176.85581 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.28277 176.47994 m
115.28277 176.57376 L
115.18866 176.66759 L
115.09483 176.76170 L
115.00129 176.85581 L
115.00129 176.85581 L
114.90718 176.76170 L
114.81335 176.66759 L
114.71924 176.57376 L
114.71924 176.57376 L
114.71924 176.57376 L
114.81335 176.47994 L
114.90718 176.38583 L
115.00129 176.29200 L
115.00129 176.29200 L
115.09483 176.38583 L
115.18866 176.47994 L
115.28277 176.47994 L
@c
F
@rax %Note: Object
114.71924 175.16466 115.28277 175.72847 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.28277 175.35231 m
115.28277 175.44643 L
115.18866 175.54025 L
115.09483 175.63408 L
115.00129 175.72847 L
115.00129 175.72847 L
114.90718 175.63408 L
114.81335 175.54025 L
114.71924 175.44643 L
114.71924 175.44643 L
114.71924 175.44643 L
114.81335 175.35231 L
114.90718 175.25849 L
115.00129 175.16466 L
115.00129 175.16466 L
115.09483 175.25849 L
115.18866 175.35231 L
115.28277 175.35231 L
@c
F
@rax %Note: Object
114.71924 174.03732 115.28277 174.60085 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.28277 174.22498 m
115.28277 174.31909 L
115.18866 174.41291 L
115.09483 174.50674 L
115.00129 174.60085 L
115.00129 174.60085 L
114.90718 174.50674 L
114.81335 174.41291 L
114.71924 174.31909 L
114.71924 174.31909 L
114.71924 174.31909 L
114.81335 174.22498 L
114.90718 174.13143 L
115.00129 174.03732 L
115.00129 174.03732 L
115.09483 174.13143 L
115.18866 174.22498 L
115.28277 174.22498 L
@c
F
@rax %Note: Object
114.71924 172.90998 115.28277 173.47351 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.28277 173.09792 m
115.28277 173.19175 L
115.18866 173.28586 L
115.09483 173.37969 L
115.00129 173.47351 L
115.00129 173.47351 L
114.90718 173.37969 L
114.81335 173.28586 L
114.71924 173.19175 L
114.71924 173.19175 L
114.71924 173.19175 L
114.81335 173.09792 L
114.90718 173.00409 L
115.00129 172.90998 L
115.00129 172.90998 L
115.09483 173.00409 L
115.18866 173.09792 L
115.28277 173.09792 L
@c
F
@rax %Note: Object
114.71924 171.78236 115.28277 172.34617 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.28277 171.97058 m
115.28277 172.06441 L
115.18866 172.15824 L
115.09483 172.25235 L
115.00129 172.34617 L
115.00129 172.34617 L
114.90718 172.25235 L
114.81335 172.15824 L
114.71924 172.06441 L
114.71924 172.06441 L
114.71924 172.06441 L
114.81335 171.97058 L
114.90718 171.87676 L
115.00129 171.78236 L
115.00129 171.78236 L
115.09483 171.87676 L
115.18866 171.97058 L
115.28277 171.97058 L
@c
F
@rax %Note: Object
114.71924 170.65531 115.28277 171.21912 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.28277 170.84353 m
115.28277 170.93735 L
115.18866 171.03118 L
115.09483 171.12501 L
115.00129 171.21912 L
115.00129 171.21912 L
114.90718 171.12501 L
114.81335 171.03118 L
114.71924 170.93735 L
114.71924 170.93735 L
114.71924 170.93735 L
114.81335 170.84353 L
114.90718 170.74942 L
115.00129 170.65531 L
115.00129 170.65531 L
115.09483 170.74942 L
115.18866 170.84353 L
115.28277 170.84353 L
@c
F
@rax %Note: Object
114.71924 169.52797 115.28277 170.09178 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.28277 169.71591 m
115.28277 169.81002 L
115.18866 169.90384 L
115.09483 169.99767 L
115.00129 170.09178 L
115.00129 170.09178 L
114.90718 169.99767 L
114.81335 169.90384 L
114.71924 169.81002 L
114.71924 169.81002 L
114.71924 169.81002 L
114.81335 169.71591 L
114.90718 169.62180 L
115.00129 169.52797 L
115.00129 169.52797 L
115.09483 169.62180 L
115.18866 169.71591 L
115.28277 169.71591 L
@c
F
@rax %Note: Object
190.34220 183.71310 196.16683 189.63156 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
190.34220 183.71310 m
196.16683 186.71953 L
190.34220 189.63156 L
190.34220 183.71310 L
@c
F
@rax %Note: Object
182.35729 281.13080 182.92082 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
182.73317 281.13080 m
182.73317 281.22463 L
182.82699 281.31874 L
182.92082 281.41257 L
182.92082 281.41257 L
182.82699 281.50668 L
182.73317 281.60050 L
182.63877 281.69433 L
182.63877 281.69433 L
182.54494 281.69433 L
182.45112 281.60050 L
182.35729 281.50668 L
182.35729 281.41257 L
182.35729 281.31874 L
182.35729 281.22463 L
182.45112 281.13080 L
182.54494 281.13080 L
182.63877 281.13080 L
182.73317 281.13080 L
@c
F
@rax %Note: Object
181.22995 281.13080 181.79376 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
181.60583 281.13080 m
181.60583 281.22463 L
181.69994 281.31874 L
181.79376 281.41257 L
181.79376 281.41257 L
181.69994 281.50668 L
181.60583 281.60050 L
181.51172 281.69433 L
181.51172 281.69433 L
181.41789 281.69433 L
181.32406 281.60050 L
181.22995 281.50668 L
181.22995 281.41257 L
181.22995 281.31874 L
181.22995 281.22463 L
181.32406 281.13080 L
181.41789 281.13080 L
181.51172 281.13080 L
181.60583 281.13080 L
@c
F
@rax %Note: Object
180.10261 281.13080 180.66643 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
180.47820 281.13080 m
180.47820 281.22463 L
180.57260 281.31874 L
180.66643 281.41257 L
180.66643 281.41257 L
180.57260 281.50668 L
180.47820 281.60050 L
180.38438 281.69433 L
180.38438 281.69433 L
180.29055 281.69433 L
180.19672 281.60050 L
180.10261 281.50668 L
180.10261 281.41257 L
180.10261 281.31874 L
180.10261 281.22463 L
180.19672 281.13080 L
180.29055 281.13080 L
180.38438 281.13080 L
180.47820 281.13080 L
@c
F
@rax %Note: Object
178.97528 281.13080 179.53909 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
179.35087 281.13080 m
179.35087 281.22463 L
179.44498 281.31874 L
179.53909 281.41257 L
179.53909 281.41257 L
179.44498 281.50668 L
179.35087 281.60050 L
179.25704 281.69433 L
179.25704 281.69433 L
179.16321 281.69433 L
179.06910 281.60050 L
178.97528 281.50668 L
178.97528 281.41257 L
178.97528 281.31874 L
178.97528 281.22463 L
179.06910 281.13080 L
179.16321 281.13080 L
179.25704 281.13080 L
179.35087 281.13080 L
@c
F
@rax %Note: Object
177.84822 281.13080 178.41175 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
178.22381 281.13080 m
178.22381 281.22463 L
178.31792 281.31874 L
178.41175 281.41257 L
178.41175 281.41257 L
178.31792 281.50668 L
178.22381 281.60050 L
178.12998 281.69433 L
178.12998 281.69433 L
178.03587 281.69433 L
177.94205 281.60050 L
177.84822 281.50668 L
177.84822 281.41257 L
177.84822 281.31874 L
177.84822 281.22463 L
177.94205 281.13080 L
178.03587 281.13080 L
178.12998 281.13080 L
178.22381 281.13080 L
@c
F
@rax %Note: Object
176.72088 281.13080 177.28441 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
177.09647 281.13080 m
177.09647 281.22463 L
177.19030 281.31874 L
177.28441 281.41257 L
177.28441 281.41257 L
177.19030 281.50668 L
177.09647 281.60050 L
177.00236 281.69433 L
177.00236 281.69433 L
176.90854 281.69433 L
176.81471 281.60050 L
176.72088 281.50668 L
176.72088 281.41257 L
176.72088 281.31874 L
176.72088 281.22463 L
176.81471 281.13080 L
176.90854 281.13080 L
177.00236 281.13080 L
177.09647 281.13080 L
@c
F
@rax %Note: Object
175.59354 281.13080 176.15707 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
175.96913 281.13080 m
175.96913 281.22463 L
176.06296 281.31874 L
176.15707 281.41257 L
176.15707 281.41257 L
176.06296 281.50668 L
175.96913 281.60050 L
175.87531 281.69433 L
175.87531 281.69433 L
175.78148 281.69433 L
175.68765 281.60050 L
175.59354 281.50668 L
175.59354 281.41257 L
175.59354 281.31874 L
175.59354 281.22463 L
175.68765 281.13080 L
175.78148 281.13080 L
175.87531 281.13080 L
175.96913 281.13080 L
@c
F
@rax %Note: Object
174.46620 281.13080 175.03002 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
174.84180 281.13080 m
174.84180 281.22463 L
174.93591 281.31874 L
175.03002 281.41257 L
175.03002 281.41257 L
174.93591 281.50668 L
174.84180 281.60050 L
174.74797 281.69433 L
174.74797 281.69433 L
174.65414 281.69433 L
174.56031 281.60050 L
174.46620 281.50668 L
174.46620 281.41257 L
174.46620 281.31874 L
174.46620 281.22463 L
174.56031 281.13080 L
174.65414 281.13080 L
174.74797 281.13080 L
174.84180 281.13080 L
@c
F
@rax %Note: Object
173.33858 281.13080 173.90239 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
173.71446 281.13080 m
173.71446 281.22463 L
173.80828 281.31874 L
173.90239 281.41257 L
173.90239 281.41257 L
173.80828 281.50668 L
173.71446 281.60050 L
173.62063 281.69433 L
173.62063 281.69433 L
173.52680 281.69433 L
173.43269 281.60050 L
173.33858 281.50668 L
173.33858 281.41257 L
173.33858 281.31874 L
173.33858 281.22463 L
173.43269 281.13080 L
173.52680 281.13080 L
173.62063 281.13080 L
173.71446 281.13080 L
@c
F
@rax %Note: Object
172.21153 281.13080 172.77506 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
172.58740 281.13080 m
172.58740 281.22463 L
172.68123 281.31874 L
172.77506 281.41257 L
172.77506 281.41257 L
172.68123 281.50668 L
172.58740 281.60050 L
172.49357 281.69433 L
172.49357 281.69433 L
172.39946 281.69433 L
172.30564 281.60050 L
172.21153 281.50668 L
172.21153 281.41257 L
172.21153 281.31874 L
172.21153 281.22463 L
172.30564 281.13080 L
172.39946 281.13080 L
172.49357 281.13080 L
172.58740 281.13080 L
@c
F
@rax %Note: Object
171.08419 281.13080 171.64772 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
171.46006 281.13080 m
171.46006 281.22463 L
171.55389 281.31874 L
171.64772 281.41257 L
171.64772 281.41257 L
171.55389 281.50668 L
171.46006 281.60050 L
171.36624 281.69433 L
171.36624 281.69433 L
171.27213 281.69433 L
171.17802 281.60050 L
171.08419 281.50668 L
171.08419 281.41257 L
171.08419 281.31874 L
171.08419 281.22463 L
171.17802 281.13080 L
171.27213 281.13080 L
171.36624 281.13080 L
171.46006 281.13080 L
@c
F
@rax %Note: Object
169.95685 281.13080 170.52038 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
170.33272 281.13080 m
170.33272 281.22463 L
170.42655 281.31874 L
170.52038 281.41257 L
170.52038 281.41257 L
170.42655 281.50668 L
170.33272 281.60050 L
170.23861 281.69433 L
170.23861 281.69433 L
170.14507 281.69433 L
170.05096 281.60050 L
169.95685 281.50668 L
169.95685 281.41257 L
169.95685 281.31874 L
169.95685 281.22463 L
170.05096 281.13080 L
170.14507 281.13080 L
170.23861 281.13080 L
170.33272 281.13080 L
@c
F
@rax %Note: Object
168.82951 281.13080 169.39332 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
169.20539 281.13080 m
169.20539 281.22463 L
169.29950 281.31874 L
169.39332 281.41257 L
169.39332 281.41257 L
169.29950 281.50668 L
169.20539 281.60050 L
169.11156 281.69433 L
169.11156 281.69433 L
169.01773 281.69433 L
168.92362 281.60050 L
168.82951 281.50668 L
168.82951 281.41257 L
168.82951 281.31874 L
168.82951 281.22463 L
168.92362 281.13080 L
169.01773 281.13080 L
169.11156 281.13080 L
169.20539 281.13080 L
@c
F
@rax %Note: Object
167.70217 281.13080 168.26598 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
168.07805 281.13080 m
168.07805 281.22463 L
168.17187 281.31874 L
168.26598 281.41257 L
168.26598 281.41257 L
168.17187 281.50668 L
168.07805 281.60050 L
167.98422 281.69433 L
167.98422 281.69433 L
167.89011 281.69433 L
167.79600 281.60050 L
167.70217 281.50668 L
167.70217 281.41257 L
167.70217 281.31874 L
167.70217 281.22463 L
167.79600 281.13080 L
167.89011 281.13080 L
167.98422 281.13080 L
168.07805 281.13080 L
@c
F
@rax %Note: Object
166.57512 281.13080 167.13865 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
166.95099 281.13080 m
166.95099 281.22463 L
167.04482 281.31874 L
167.13865 281.41257 L
167.13865 281.41257 L
167.04482 281.50668 L
166.95099 281.60050 L
166.85717 281.69433 L
166.85717 281.69433 L
166.76277 281.69433 L
166.66894 281.60050 L
166.57512 281.50668 L
166.57512 281.41257 L
166.57512 281.31874 L
166.57512 281.22463 L
166.66894 281.13080 L
166.76277 281.13080 L
166.85717 281.13080 L
166.95099 281.13080 L
@c
F
@rax %Note: Object
165.44778 281.13080 166.01131 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
165.82365 281.13080 m
165.82365 281.22463 L
165.91748 281.31874 L
166.01131 281.41257 L
166.01131 281.41257 L
165.91748 281.50668 L
165.82365 281.60050 L
165.72983 281.69433 L
165.72983 281.69433 L
165.63543 281.69433 L
165.54161 281.60050 L
165.44778 281.50668 L
165.44778 281.41257 L
165.44778 281.31874 L
165.44778 281.22463 L
165.54161 281.13080 L
165.63543 281.13080 L
165.72983 281.13080 L
165.82365 281.13080 L
@c
F
@rax %Note: Object
164.32044 281.13080 164.88397 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
164.69631 281.13080 m
164.69631 281.22463 L
164.79014 281.31874 L
164.88397 281.41257 L
164.88397 281.41257 L
164.79014 281.50668 L
164.69631 281.60050 L
164.60220 281.69433 L
164.60220 281.69433 L
164.50809 281.69433 L
164.41455 281.60050 L
164.32044 281.50668 L
164.32044 281.41257 L
164.32044 281.31874 L
164.32044 281.22463 L
164.41455 281.13080 L
164.50809 281.13080 L
164.60220 281.13080 L
164.69631 281.13080 L
@c
F
@rax %Note: Object
163.19310 281.13080 163.75691 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
163.56898 281.13080 m
163.56898 281.22463 L
163.66309 281.31874 L
163.75691 281.41257 L
163.75691 281.41257 L
163.66309 281.50668 L
163.56898 281.60050 L
163.47487 281.69433 L
163.47487 281.69433 L
163.38104 281.69433 L
163.28721 281.60050 L
163.19310 281.50668 L
163.19310 281.41257 L
163.19310 281.31874 L
163.19310 281.22463 L
163.28721 281.13080 L
163.38104 281.13080 L
163.47487 281.13080 L
163.56898 281.13080 L
@c
F
@rax %Note: Object
162.06576 281.13080 162.62957 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
162.44164 281.13080 m
162.44164 281.22463 L
162.53546 281.31874 L
162.62957 281.41257 L
162.62957 281.41257 L
162.53546 281.50668 L
162.44164 281.60050 L
162.34753 281.69433 L
162.34753 281.69433 L
162.25370 281.69433 L
162.15959 281.60050 L
162.06576 281.50668 L
162.06576 281.41257 L
162.06576 281.31874 L
162.06576 281.22463 L
162.15959 281.13080 L
162.25370 281.13080 L
162.34753 281.13080 L
162.44164 281.13080 L
@c
F
@rax %Note: Object
160.93871 281.13080 161.50224 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
161.31430 281.13080 m
161.31430 281.22463 L
161.40841 281.31874 L
161.50224 281.41257 L
161.50224 281.41257 L
161.40841 281.50668 L
161.31430 281.60050 L
161.22047 281.69433 L
161.22047 281.69433 L
161.12636 281.69433 L
161.03254 281.60050 L
160.93871 281.50668 L
160.93871 281.41257 L
160.93871 281.31874 L
160.93871 281.22463 L
161.03254 281.13080 L
161.12636 281.13080 L
161.22047 281.13080 L
161.31430 281.13080 L
@c
F
@rax %Note: Object
159.81137 281.13080 160.37490 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
160.18696 281.13080 m
160.18696 281.22463 L
160.28107 281.31874 L
160.37490 281.41257 L
160.37490 281.41257 L
160.28107 281.50668 L
160.18696 281.60050 L
160.09313 281.69433 L
160.09313 281.69433 L
159.99902 281.69433 L
159.90520 281.60050 L
159.81137 281.50668 L
159.81137 281.41257 L
159.81137 281.31874 L
159.81137 281.22463 L
159.90520 281.13080 L
159.99902 281.13080 L
160.09313 281.13080 L
160.18696 281.13080 L
@c
F
@rax %Note: Object
158.68403 281.13080 159.24756 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
159.05962 281.13080 m
159.05962 281.22463 L
159.15373 281.31874 L
159.24756 281.41257 L
159.24756 281.41257 L
159.15373 281.50668 L
159.05962 281.60050 L
158.96551 281.69433 L
158.96551 281.69433 L
158.87169 281.69433 L
158.77786 281.60050 L
158.68403 281.50668 L
158.68403 281.41257 L
158.68403 281.31874 L
158.68403 281.22463 L
158.77786 281.13080 L
158.87169 281.13080 L
158.96551 281.13080 L
159.05962 281.13080 L
@c
F
@rax %Note: Object
157.55669 281.13080 158.12050 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
157.93228 281.13080 m
157.93228 281.22463 L
158.02639 281.31874 L
158.12050 281.41257 L
158.12050 281.41257 L
158.02639 281.50668 L
157.93228 281.60050 L
157.83846 281.69433 L
157.83846 281.69433 L
157.74463 281.69433 L
157.65080 281.60050 L
157.55669 281.50668 L
157.55669 281.41257 L
157.55669 281.31874 L
157.55669 281.22463 L
157.65080 281.13080 L
157.74463 281.13080 L
157.83846 281.13080 L
157.93228 281.13080 L
@c
F
@rax %Note: Object
156.42935 281.13080 156.99317 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
156.80494 281.13080 m
156.80494 281.22463 L
156.89906 281.31874 L
156.99317 281.41257 L
156.99317 281.41257 L
156.89906 281.50668 L
156.80494 281.60050 L
156.71112 281.69433 L
156.71112 281.69433 L
156.61729 281.69433 L
156.52318 281.60050 L
156.42935 281.50668 L
156.42935 281.41257 L
156.42935 281.31874 L
156.42935 281.22463 L
156.52318 281.13080 L
156.61729 281.13080 L
156.71112 281.13080 L
156.80494 281.13080 L
@c
F
@rax %Note: Object
155.30202 281.13080 155.86583 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
155.67789 281.13080 m
155.67789 281.22463 L
155.77143 281.31874 L
155.86583 281.41257 L
155.86583 281.41257 L
155.77143 281.50668 L
155.67789 281.60050 L
155.58406 281.69433 L
155.58406 281.69433 L
155.48995 281.69433 L
155.39613 281.60050 L
155.30202 281.50668 L
155.30202 281.41257 L
155.30202 281.31874 L
155.30202 281.22463 L
155.39613 281.13080 L
155.48995 281.13080 L
155.58406 281.13080 L
155.67789 281.13080 L
@c
F
@rax %Note: Object
154.17468 281.13080 154.73820 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
154.55055 281.13080 m
154.55055 281.22463 L
154.64438 281.31874 L
154.73820 281.41257 L
154.73820 281.41257 L
154.64438 281.50668 L
154.55055 281.60050 L
154.45672 281.69433 L
154.45672 281.69433 L
154.36261 281.69433 L
154.26879 281.60050 L
154.17468 281.50668 L
154.17468 281.41257 L
154.17468 281.31874 L
154.17468 281.22463 L
154.26879 281.13080 L
154.36261 281.13080 L
154.45672 281.13080 L
154.55055 281.13080 L
@c
F
@rax %Note: Object
153.04734 281.13080 153.61087 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
153.42321 281.13080 m
153.42321 281.22463 L
153.51704 281.31874 L
153.61087 281.41257 L
153.61087 281.41257 L
153.51704 281.50668 L
153.42321 281.60050 L
153.32910 281.69433 L
153.32910 281.69433 L
153.23528 281.69433 L
153.14145 281.60050 L
153.04734 281.50668 L
153.04734 281.41257 L
153.04734 281.31874 L
153.04734 281.22463 L
153.14145 281.13080 L
153.23528 281.13080 L
153.32910 281.13080 L
153.42321 281.13080 L
@c
F
@rax %Note: Object
151.92000 281.13080 152.48381 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
152.29587 281.13080 m
152.29587 281.22463 L
152.38998 281.31874 L
152.48381 281.41257 L
152.48381 281.41257 L
152.38998 281.50668 L
152.29587 281.60050 L
152.20205 281.69433 L
152.20205 281.69433 L
152.10822 281.69433 L
152.01411 281.60050 L
151.92000 281.50668 L
151.92000 281.41257 L
151.92000 281.31874 L
151.92000 281.22463 L
152.01411 281.13080 L
152.10822 281.13080 L
152.20205 281.13080 L
152.29587 281.13080 L
@c
F
@rax %Note: Object
150.79266 281.13080 151.35647 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
151.16854 281.13080 m
151.16854 281.22463 L
151.26265 281.31874 L
151.35647 281.41257 L
151.35647 281.41257 L
151.26265 281.50668 L
151.16854 281.60050 L
151.07471 281.69433 L
151.07471 281.69433 L
150.98088 281.69433 L
150.88649 281.60050 L
150.79266 281.50668 L
150.79266 281.41257 L
150.79266 281.31874 L
150.79266 281.22463 L
150.88649 281.13080 L
150.98088 281.13080 L
151.07471 281.13080 L
151.16854 281.13080 L
@c
F
@rax %Note: Object
149.66561 281.13080 150.22913 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
150.04120 281.13080 m
150.04120 281.22463 L
150.13502 281.31874 L
150.22913 281.41257 L
150.22913 281.41257 L
150.13502 281.50668 L
150.04120 281.60050 L
149.94737 281.69433 L
149.94737 281.69433 L
149.85354 281.69433 L
149.75943 281.60050 L
149.66561 281.50668 L
149.66561 281.41257 L
149.66561 281.31874 L
149.66561 281.22463 L
149.75943 281.13080 L
149.85354 281.13080 L
149.94737 281.13080 L
150.04120 281.13080 L
@c
F
@rax %Note: Object
148.53827 281.13080 149.10180 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
148.91414 281.13080 m
148.91414 281.22463 L
149.00797 281.31874 L
149.10180 281.41257 L
149.10180 281.41257 L
149.00797 281.50668 L
148.91414 281.60050 L
148.82031 281.69433 L
148.82031 281.69433 L
148.72620 281.69433 L
148.63209 281.60050 L
148.53827 281.50668 L
148.53827 281.41257 L
148.53827 281.31874 L
148.53827 281.22463 L
148.63209 281.13080 L
148.72620 281.13080 L
148.82031 281.13080 L
148.91414 281.13080 L
@c
F
@rax %Note: Object
147.41093 281.13080 147.97446 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
147.78680 281.13080 m
147.78680 281.22463 L
147.88063 281.31874 L
147.97446 281.41257 L
147.97446 281.41257 L
147.88063 281.50668 L
147.78680 281.60050 L
147.69269 281.69433 L
147.69269 281.69433 L
147.59858 281.69433 L
147.50476 281.60050 L
147.41093 281.50668 L
147.41093 281.41257 L
147.41093 281.31874 L
147.41093 281.22463 L
147.50476 281.13080 L
147.59858 281.13080 L
147.69269 281.13080 L
147.78680 281.13080 L
@c
F
@rax %Note: Object
146.28359 281.13080 146.84740 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
146.65946 281.13080 m
146.65946 281.22463 L
146.75357 281.31874 L
146.84740 281.41257 L
146.84740 281.41257 L
146.75357 281.50668 L
146.65946 281.60050 L
146.56564 281.69433 L
146.56564 281.69433 L
146.47153 281.69433 L
146.37770 281.60050 L
146.28359 281.50668 L
146.28359 281.41257 L
146.28359 281.31874 L
146.28359 281.22463 L
146.37770 281.13080 L
146.47153 281.13080 L
146.56564 281.13080 L
146.65946 281.13080 L
@c
F
@rax %Note: Object
145.15625 281.13080 145.72006 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
145.53213 281.13080 m
145.53213 281.22463 L
145.62624 281.31874 L
145.72006 281.41257 L
145.72006 281.41257 L
145.62624 281.50668 L
145.53213 281.60050 L
145.43830 281.69433 L
145.43830 281.69433 L
145.34419 281.69433 L
145.25008 281.60050 L
145.15625 281.50668 L
145.15625 281.41257 L
145.15625 281.31874 L
145.15625 281.22463 L
145.25008 281.13080 L
145.34419 281.13080 L
145.43830 281.13080 L
145.53213 281.13080 L
@c
F
@rax %Note: Object
144.02920 281.13080 144.59272 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
144.40479 281.13080 m
144.40479 281.22463 L
144.49861 281.31874 L
144.59272 281.41257 L
144.59272 281.41257 L
144.49861 281.50668 L
144.40479 281.60050 L
144.31068 281.69433 L
144.31068 281.69433 L
144.21685 281.69433 L
144.12274 281.60050 L
144.02920 281.50668 L
144.02920 281.41257 L
144.02920 281.31874 L
144.02920 281.22463 L
144.12274 281.13080 L
144.21685 281.13080 L
144.31068 281.13080 L
144.40479 281.13080 L
@c
F
@rax %Note: Object
142.90186 281.13080 143.46539 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
143.27773 281.13080 m
143.27773 281.22463 L
143.37156 281.31874 L
143.46539 281.41257 L
143.46539 281.41257 L
143.37156 281.50668 L
143.27773 281.60050 L
143.18362 281.69433 L
143.18362 281.69433 L
143.08951 281.69433 L
142.99569 281.60050 L
142.90186 281.50668 L
142.90186 281.41257 L
142.90186 281.31874 L
142.90186 281.22463 L
142.99569 281.13080 L
143.08951 281.13080 L
143.18362 281.13080 L
143.27773 281.13080 L
@c
F
@rax %Note: Object
141.77452 281.13080 142.33805 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
142.15011 281.13080 m
142.15011 281.22463 L
142.24422 281.31874 L
142.33805 281.41257 L
142.33805 281.41257 L
142.24422 281.50668 L
142.15011 281.60050 L
142.05600 281.69433 L
142.05600 281.69433 L
141.96217 281.69433 L
141.86835 281.60050 L
141.77452 281.50668 L
141.77452 281.41257 L
141.77452 281.31874 L
141.77452 281.22463 L
141.86835 281.13080 L
141.96217 281.13080 L
142.05600 281.13080 L
142.15011 281.13080 L
@c
F
@rax %Note: Object
140.64718 281.13080 141.21071 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
141.02277 281.13080 m
141.02277 281.22463 L
141.11717 281.31874 L
141.21071 281.41257 L
141.21071 281.41257 L
141.11717 281.50668 L
141.02277 281.60050 L
140.92894 281.69433 L
140.92894 281.69433 L
140.83512 281.69433 L
140.74129 281.60050 L
140.64718 281.50668 L
140.64718 281.41257 L
140.64718 281.31874 L
140.64718 281.22463 L
140.74129 281.13080 L
140.83512 281.13080 L
140.92894 281.13080 L
141.02277 281.13080 L
@c
F
@rax %Note: Object
139.51984 281.13080 140.08365 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
139.89543 281.13080 m
139.89543 281.22463 L
139.98983 281.31874 L
140.08365 281.41257 L
140.08365 281.41257 L
139.98983 281.50668 L
139.89543 281.60050 L
139.80161 281.69433 L
139.80161 281.69433 L
139.70778 281.69433 L
139.61395 281.60050 L
139.51984 281.50668 L
139.51984 281.41257 L
139.51984 281.31874 L
139.51984 281.22463 L
139.61395 281.13080 L
139.70778 281.13080 L
139.80161 281.13080 L
139.89543 281.13080 L
@c
F
@rax %Note: Object
138.39250 281.13080 138.95631 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
138.76809 281.13080 m
138.76809 281.22463 L
138.86220 281.31874 L
138.95631 281.41257 L
138.95631 281.41257 L
138.86220 281.50668 L
138.76809 281.60050 L
138.67427 281.69433 L
138.67427 281.69433 L
138.58044 281.69433 L
138.48633 281.60050 L
138.39250 281.50668 L
138.39250 281.41257 L
138.39250 281.31874 L
138.39250 281.22463 L
138.48633 281.13080 L
138.58044 281.13080 L
138.67427 281.13080 L
138.76809 281.13080 L
@c
F
@rax %Note: Object
137.26545 281.13080 137.82898 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
137.64104 281.13080 m
137.64104 281.22463 L
137.73487 281.31874 L
137.82898 281.41257 L
137.82898 281.41257 L
137.73487 281.50668 L
137.64104 281.60050 L
137.54721 281.69433 L
137.54721 281.69433 L
137.45310 281.69433 L
137.35928 281.60050 L
137.26545 281.50668 L
137.26545 281.41257 L
137.26545 281.31874 L
137.26545 281.22463 L
137.35928 281.13080 L
137.45310 281.13080 L
137.54721 281.13080 L
137.64104 281.13080 L
@c
F
@rax %Note: Object
136.13811 281.13080 136.70164 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
136.51370 281.13080 m
136.51370 281.22463 L
136.60753 281.31874 L
136.70164 281.41257 L
136.70164 281.41257 L
136.60753 281.50668 L
136.51370 281.60050 L
136.41959 281.69433 L
136.41959 281.69433 L
136.32576 281.69433 L
136.23194 281.60050 L
136.13811 281.50668 L
136.13811 281.41257 L
136.13811 281.31874 L
136.13811 281.22463 L
136.23194 281.13080 L
136.32576 281.13080 L
136.41959 281.13080 L
136.51370 281.13080 L
@c
F
@rax %Note: Object
135.01049 281.13080 135.57430 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
135.38636 281.13080 m
135.38636 281.22463 L
135.48019 281.31874 L
135.57430 281.41257 L
135.57430 281.41257 L
135.48019 281.50668 L
135.38636 281.60050 L
135.29254 281.69433 L
135.29254 281.69433 L
135.19871 281.69433 L
135.10488 281.60050 L
135.01049 281.50668 L
135.01049 281.41257 L
135.01049 281.31874 L
135.01049 281.22463 L
135.10488 281.13080 L
135.19871 281.13080 L
135.29254 281.13080 L
135.38636 281.13080 L
@c
F
@rax %Note: Object
133.88315 281.13080 134.44696 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
134.25902 281.13080 m
134.25902 281.22463 L
134.35313 281.31874 L
134.44696 281.41257 L
134.44696 281.41257 L
134.35313 281.50668 L
134.25902 281.60050 L
134.16520 281.69433 L
134.16520 281.69433 L
134.07137 281.69433 L
133.97754 281.60050 L
133.88315 281.50668 L
133.88315 281.41257 L
133.88315 281.31874 L
133.88315 281.22463 L
133.97754 281.13080 L
134.07137 281.13080 L
134.16520 281.13080 L
134.25902 281.13080 L
@c
F
@rax %Note: Object
132.75581 281.13080 133.31962 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
133.13169 281.13080 m
133.13169 281.22463 L
133.22551 281.31874 L
133.31962 281.41257 L
133.31962 281.41257 L
133.22551 281.50668 L
133.13169 281.60050 L
133.03786 281.69433 L
133.03786 281.69433 L
132.94403 281.69433 L
132.84992 281.60050 L
132.75581 281.50668 L
132.75581 281.41257 L
132.75581 281.31874 L
132.75581 281.22463 L
132.84992 281.13080 L
132.94403 281.13080 L
133.03786 281.13080 L
133.13169 281.13080 L
@c
F
@rax %Note: Object
131.62876 281.13080 132.19228 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
132.00463 281.13080 m
132.00463 281.22463 L
132.09846 281.31874 L
132.19228 281.41257 L
132.19228 281.41257 L
132.09846 281.50668 L
132.00463 281.60050 L
131.91080 281.69433 L
131.91080 281.69433 L
131.81669 281.69433 L
131.72258 281.60050 L
131.62876 281.50668 L
131.62876 281.41257 L
131.62876 281.31874 L
131.62876 281.22463 L
131.72258 281.13080 L
131.81669 281.13080 L
131.91080 281.13080 L
132.00463 281.13080 L
@c
F
@rax %Note: Object
130.50142 281.13080 131.06494 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
130.87729 281.13080 m
130.87729 281.22463 L
130.97112 281.31874 L
131.06494 281.41257 L
131.06494 281.41257 L
130.97112 281.50668 L
130.87729 281.60050 L
130.78318 281.69433 L
130.78318 281.69433 L
130.68935 281.69433 L
130.59524 281.60050 L
130.50142 281.50668 L
130.50142 281.41257 L
130.50142 281.31874 L
130.50142 281.22463 L
130.59524 281.13080 L
130.68935 281.13080 L
130.78318 281.13080 L
130.87729 281.13080 L
@c
F
@rax %Note: Object
129.37408 281.13080 129.93761 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
129.74995 281.13080 m
129.74995 281.22463 L
129.84378 281.31874 L
129.93761 281.41257 L
129.93761 281.41257 L
129.84378 281.50668 L
129.74995 281.60050 L
129.65584 281.69433 L
129.65584 281.69433 L
129.56230 281.69433 L
129.46819 281.60050 L
129.37408 281.50668 L
129.37408 281.41257 L
129.37408 281.31874 L
129.37408 281.22463 L
129.46819 281.13080 L
129.56230 281.13080 L
129.65584 281.13080 L
129.74995 281.13080 L
@c
F
@rax %Note: Object
128.24674 281.13080 128.81055 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.62261 281.13080 m
128.62261 281.22463 L
128.71672 281.31874 L
128.81055 281.41257 L
128.81055 281.41257 L
128.71672 281.50668 L
128.62261 281.60050 L
128.52879 281.69433 L
128.52879 281.69433 L
128.43468 281.69433 L
128.34085 281.60050 L
128.24674 281.50668 L
128.24674 281.41257 L
128.24674 281.31874 L
128.24674 281.22463 L
128.34085 281.13080 L
128.43468 281.13080 L
128.52879 281.13080 L
128.62261 281.13080 L
@c
F
@rax %Note: Object
127.11940 281.13080 127.68321 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
127.49528 281.13080 m
127.49528 281.22463 L
127.58910 281.31874 L
127.68321 281.41257 L
127.68321 281.41257 L
127.58910 281.50668 L
127.49528 281.60050 L
127.40145 281.69433 L
127.40145 281.69433 L
127.30734 281.69433 L
127.21323 281.60050 L
127.11940 281.50668 L
127.11940 281.41257 L
127.11940 281.31874 L
127.11940 281.22463 L
127.21323 281.13080 L
127.30734 281.13080 L
127.40145 281.13080 L
127.49528 281.13080 L
@c
F
@rax %Note: Object
125.99235 281.13080 126.55587 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
126.36822 281.13080 m
126.36822 281.22463 L
126.46205 281.31874 L
126.55587 281.41257 L
126.55587 281.41257 L
126.46205 281.50668 L
126.36822 281.60050 L
126.27411 281.69433 L
126.27411 281.69433 L
126.18000 281.69433 L
126.08617 281.60050 L
125.99235 281.50668 L
125.99235 281.41257 L
125.99235 281.31874 L
125.99235 281.22463 L
126.08617 281.13080 L
126.18000 281.13080 L
126.27411 281.13080 L
126.36822 281.13080 L
@c
F
@rax %Note: Object
124.86501 281.13080 125.42854 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
125.24088 281.13080 m
125.24088 281.22463 L
125.33471 281.31874 L
125.42854 281.41257 L
125.42854 281.41257 L
125.33471 281.50668 L
125.24088 281.60050 L
125.14677 281.69433 L
125.14677 281.69433 L
125.05266 281.69433 L
124.95883 281.60050 L
124.86501 281.50668 L
124.86501 281.41257 L
124.86501 281.31874 L
124.86501 281.22463 L
124.95883 281.13080 L
125.05266 281.13080 L
125.14677 281.13080 L
125.24088 281.13080 L
@c
F
@rax %Note: Object
123.73767 281.13080 124.30120 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.11354 281.13080 m
124.11354 281.22463 L
124.20737 281.31874 L
124.30120 281.41257 L
124.30120 281.41257 L
124.20737 281.50668 L
124.11354 281.60050 L
124.01915 281.69433 L
124.01915 281.69433 L
123.92532 281.69433 L
123.83150 281.60050 L
123.73767 281.50668 L
123.73767 281.41257 L
123.73767 281.31874 L
123.73767 281.22463 L
123.83150 281.13080 L
123.92532 281.13080 L
124.01915 281.13080 L
124.11354 281.13080 L
@c
F
@rax %Note: Object
122.61033 281.13080 123.17414 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
122.98620 281.13080 m
122.98620 281.22463 L
123.08031 281.31874 L
123.17414 281.41257 L
123.17414 281.41257 L
123.08031 281.50668 L
122.98620 281.60050 L
122.89209 281.69433 L
122.89209 281.69433 L
122.79827 281.69433 L
122.70444 281.60050 L
122.61033 281.50668 L
122.61033 281.41257 L
122.61033 281.31874 L
122.61033 281.22463 L
122.70444 281.13080 L
122.79827 281.13080 L
122.89209 281.13080 L
122.98620 281.13080 L
@c
F
@rax %Note: Object
121.48299 281.13080 122.04680 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
121.85858 281.13080 m
121.85858 281.22463 L
121.95269 281.31874 L
122.04680 281.41257 L
122.04680 281.41257 L
121.95269 281.50668 L
121.85858 281.60050 L
121.76476 281.69433 L
121.76476 281.69433 L
121.67093 281.69433 L
121.57682 281.60050 L
121.48299 281.50668 L
121.48299 281.41257 L
121.48299 281.31874 L
121.48299 281.22463 L
121.57682 281.13080 L
121.67093 281.13080 L
121.76476 281.13080 L
121.85858 281.13080 L
@c
F
@rax %Note: Object
120.35594 281.13080 120.91946 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
120.73153 281.13080 m
120.73153 281.22463 L
120.82564 281.31874 L
120.91946 281.41257 L
120.91946 281.41257 L
120.82564 281.50668 L
120.73153 281.60050 L
120.63770 281.69433 L
120.63770 281.69433 L
120.54359 281.69433 L
120.44976 281.60050 L
120.35594 281.50668 L
120.35594 281.41257 L
120.35594 281.31874 L
120.35594 281.22463 L
120.44976 281.13080 L
120.54359 281.13080 L
120.63770 281.13080 L
120.73153 281.13080 L
@c
F
@rax %Note: Object
119.22860 281.13080 119.79213 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
119.60419 281.13080 m
119.60419 281.22463 L
119.69830 281.31874 L
119.79213 281.41257 L
119.79213 281.41257 L
119.69830 281.50668 L
119.60419 281.60050 L
119.51036 281.69433 L
119.51036 281.69433 L
119.41625 281.69433 L
119.32243 281.60050 L
119.22860 281.50668 L
119.22860 281.41257 L
119.22860 281.31874 L
119.22860 281.22463 L
119.32243 281.13080 L
119.41625 281.13080 L
119.51036 281.13080 L
119.60419 281.13080 L
@c
F
@rax %Note: Object
118.10126 281.13080 118.66479 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
118.47685 281.13080 m
118.47685 281.22463 L
118.57068 281.31874 L
118.66479 281.41257 L
118.66479 281.41257 L
118.57068 281.50668 L
118.47685 281.60050 L
118.38274 281.69433 L
118.38274 281.69433 L
118.28891 281.69433 L
118.19509 281.60050 L
118.10126 281.50668 L
118.10126 281.41257 L
118.10126 281.31874 L
118.10126 281.22463 L
118.19509 281.13080 L
118.28891 281.13080 L
118.38274 281.13080 L
118.47685 281.13080 L
@c
F
@rax %Note: Object
116.97392 281.13080 117.53773 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
117.34951 281.13080 m
117.34951 281.22463 L
117.44362 281.31874 L
117.53773 281.41257 L
117.53773 281.41257 L
117.44362 281.50668 L
117.34951 281.60050 L
117.25569 281.69433 L
117.25569 281.69433 L
117.16186 281.69433 L
117.06803 281.60050 L
116.97392 281.50668 L
116.97392 281.41257 L
116.97392 281.31874 L
116.97392 281.22463 L
117.06803 281.13080 L
117.16186 281.13080 L
117.25569 281.13080 L
117.34951 281.13080 L
@c
F
@rax %Note: Object
115.84658 281.13080 116.41039 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
116.22217 281.13080 m
116.22217 281.22463 L
116.31600 281.31874 L
116.41039 281.41257 L
116.41039 281.41257 L
116.31600 281.50668 L
116.22217 281.60050 L
116.12835 281.69433 L
116.12835 281.69433 L
116.03452 281.69433 L
115.94041 281.60050 L
115.84658 281.50668 L
115.84658 281.41257 L
115.84658 281.31874 L
115.84658 281.22463 L
115.94041 281.13080 L
116.03452 281.13080 L
116.12835 281.13080 L
116.22217 281.13080 L
@c
F
@rax %Note: Object
114.71924 281.13080 115.28277 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.09483 281.13080 m
115.09483 281.22463 L
115.18866 281.31874 L
115.28277 281.41257 L
115.28277 281.41257 L
115.18866 281.50668 L
115.09483 281.60050 L
115.00129 281.69433 L
115.00129 281.69433 L
114.90718 281.69433 L
114.81335 281.60050 L
114.71924 281.50668 L
114.71924 281.41257 L
114.71924 281.31874 L
114.71924 281.22463 L
114.81335 281.13080 L
114.90718 281.13080 L
115.00129 281.13080 L
115.09483 281.13080 L
@c
F
@rax %Note: Object
113.59191 281.13080 114.15543 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
113.96778 281.13080 m
113.96778 281.22463 L
114.06161 281.31874 L
114.15543 281.41257 L
114.15543 281.41257 L
114.06161 281.50668 L
113.96778 281.60050 L
113.87395 281.69433 L
113.87395 281.69433 L
113.77984 281.69433 L
113.68602 281.60050 L
113.59191 281.50668 L
113.59191 281.41257 L
113.59191 281.31874 L
113.59191 281.22463 L
113.68602 281.13080 L
113.77984 281.13080 L
113.87395 281.13080 L
113.96778 281.13080 L
@c
F
@rax %Note: Object
112.46457 281.13080 113.02809 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
112.84044 281.13080 m
112.84044 281.22463 L
112.93427 281.31874 L
113.02809 281.41257 L
113.02809 281.41257 L
112.93427 281.50668 L
112.84044 281.60050 L
112.74633 281.69433 L
112.74633 281.69433 L
112.65250 281.69433 L
112.55868 281.60050 L
112.46457 281.50668 L
112.46457 281.41257 L
112.46457 281.31874 L
112.46457 281.22463 L
112.55868 281.13080 L
112.65250 281.13080 L
112.74633 281.13080 L
112.84044 281.13080 L
@c
F
@rax %Note: Object
111.33723 281.13080 111.90104 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
111.71310 281.13080 m
111.71310 281.22463 L
111.80721 281.31874 L
111.90104 281.41257 L
111.90104 281.41257 L
111.80721 281.50668 L
111.71310 281.60050 L
111.61928 281.69433 L
111.61928 281.69433 L
111.52545 281.69433 L
111.43134 281.60050 L
111.33723 281.50668 L
111.33723 281.41257 L
111.33723 281.31874 L
111.33723 281.22463 L
111.43134 281.13080 L
111.52545 281.13080 L
111.61928 281.13080 L
111.71310 281.13080 L
@c
F
@rax %Note: Object
110.20989 281.13080 110.77370 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.58576 281.13080 m
110.58576 281.22463 L
110.67987 281.31874 L
110.77370 281.41257 L
110.77370 281.41257 L
110.67987 281.50668 L
110.58576 281.60050 L
110.49194 281.69433 L
110.49194 281.69433 L
110.39811 281.69433 L
110.30372 281.60050 L
110.20989 281.50668 L
110.20989 281.41257 L
110.20989 281.31874 L
110.20989 281.22463 L
110.30372 281.13080 L
110.39811 281.13080 L
110.49194 281.13080 L
110.58576 281.13080 L
@c
F
@rax %Note: Object
109.08283 281.13080 109.64636 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
109.45843 281.13080 m
109.45843 281.22463 L
109.55225 281.31874 L
109.64636 281.41257 L
109.64636 281.41257 L
109.55225 281.50668 L
109.45843 281.60050 L
109.36460 281.69433 L
109.36460 281.69433 L
109.27049 281.69433 L
109.17666 281.60050 L
109.08283 281.50668 L
109.08283 281.41257 L
109.08283 281.31874 L
109.08283 281.22463 L
109.17666 281.13080 L
109.27049 281.13080 L
109.36460 281.13080 L
109.45843 281.13080 L
@c
F
@rax %Note: Object
107.95550 281.13080 108.51902 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
108.33137 281.13080 m
108.33137 281.22463 L
108.42520 281.31874 L
108.51902 281.41257 L
108.51902 281.41257 L
108.42520 281.50668 L
108.33137 281.60050 L
108.23754 281.69433 L
108.23754 281.69433 L
108.14315 281.69433 L
108.04932 281.60050 L
107.95550 281.50668 L
107.95550 281.41257 L
107.95550 281.31874 L
107.95550 281.22463 L
108.04932 281.13080 L
108.14315 281.13080 L
108.23754 281.13080 L
108.33137 281.13080 L
@c
F
@rax %Note: Object
106.82816 281.13080 107.39169 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
107.20403 281.13080 m
107.20403 281.22463 L
107.29786 281.31874 L
107.39169 281.41257 L
107.39169 281.41257 L
107.29786 281.50668 L
107.20403 281.60050 L
107.10992 281.69433 L
107.10992 281.69433 L
107.01581 281.69433 L
106.92198 281.60050 L
106.82816 281.50668 L
106.82816 281.41257 L
106.82816 281.31874 L
106.82816 281.22463 L
106.92198 281.13080 L
107.01581 281.13080 L
107.10992 281.13080 L
107.20403 281.13080 L
@c
F
@rax %Note: Object
105.70082 281.13080 106.26463 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
106.07669 281.13080 m
106.07669 281.22463 L
106.17080 281.31874 L
106.26463 281.41257 L
106.26463 281.41257 L
106.17080 281.50668 L
106.07669 281.60050 L
105.98258 281.69433 L
105.98258 281.69433 L
105.88876 281.69433 L
105.79493 281.60050 L
105.70082 281.50668 L
105.70082 281.41257 L
105.70082 281.31874 L
105.70082 281.22463 L
105.79493 281.13080 L
105.88876 281.13080 L
105.98258 281.13080 L
106.07669 281.13080 L
@c
F
@rax %Note: Object
104.57348 281.13080 105.13729 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
104.94935 281.13080 m
104.94935 281.22463 L
105.04346 281.31874 L
105.13729 281.41257 L
105.13729 281.41257 L
105.04346 281.50668 L
104.94935 281.60050 L
104.85524 281.69433 L
104.85524 281.69433 L
104.76142 281.69433 L
104.66731 281.60050 L
104.57348 281.50668 L
104.57348 281.41257 L
104.57348 281.31874 L
104.57348 281.22463 L
104.66731 281.13080 L
104.76142 281.13080 L
104.85524 281.13080 L
104.94935 281.13080 L
@c
F
@rax %Note: Object
103.44614 281.13080 104.00995 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
103.82202 281.13080 m
103.82202 281.22463 L
103.91584 281.31874 L
104.00995 281.41257 L
104.00995 281.41257 L
103.91584 281.50668 L
103.82202 281.60050 L
103.72791 281.69433 L
103.72791 281.69433 L
103.63408 281.69433 L
103.53997 281.60050 L
103.44614 281.50668 L
103.44614 281.41257 L
103.44614 281.31874 L
103.44614 281.22463 L
103.53997 281.13080 L
103.63408 281.13080 L
103.72791 281.13080 L
103.82202 281.13080 L
@c
F
@rax %Note: Object
102.31909 281.13080 102.88261 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
102.69468 281.13080 m
102.69468 281.22463 L
102.78879 281.31874 L
102.88261 281.41257 L
102.88261 281.41257 L
102.78879 281.50668 L
102.69468 281.60050 L
102.60085 281.69433 L
102.60085 281.69433 L
102.50674 281.69433 L
102.41291 281.60050 L
102.31909 281.50668 L
102.31909 281.41257 L
102.31909 281.31874 L
102.31909 281.22463 L
102.41291 281.13080 L
102.50674 281.13080 L
102.60085 281.13080 L
102.69468 281.13080 L
@c
F
@rax %Note: Object
101.19175 281.13080 101.75528 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
101.56734 281.13080 m
101.56734 281.22463 L
101.66145 281.31874 L
101.75528 281.41257 L
101.75528 281.41257 L
101.66145 281.50668 L
101.56734 281.60050 L
101.47323 281.69433 L
101.47323 281.69433 L
101.37940 281.69433 L
101.28557 281.60050 L
101.19175 281.50668 L
101.19175 281.41257 L
101.19175 281.31874 L
101.19175 281.22463 L
101.28557 281.13080 L
101.37940 281.13080 L
101.47323 281.13080 L
101.56734 281.13080 L
@c
F
@rax %Note: Object
100.06441 281.13080 100.62794 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
100.44000 281.13080 m
100.44000 281.22463 L
100.53439 281.31874 L
100.62794 281.41257 L
100.62794 281.41257 L
100.53439 281.50668 L
100.44000 281.60050 L
100.34617 281.69433 L
100.34617 281.69433 L
100.25235 281.69433 L
100.15852 281.60050 L
100.06441 281.50668 L
100.06441 281.41257 L
100.06441 281.31874 L
100.06441 281.22463 L
100.15852 281.13080 L
100.25235 281.13080 L
100.34617 281.13080 L
100.44000 281.13080 L
@c
F
@rax %Note: Object
98.93707 281.13080 99.50088 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
99.31266 281.13080 m
99.31266 281.22463 L
99.40677 281.31874 L
99.50088 281.41257 L
99.50088 281.41257 L
99.40677 281.50668 L
99.31266 281.60050 L
99.21883 281.69433 L
99.21883 281.69433 L
99.12501 281.69433 L
99.03118 281.60050 L
98.93707 281.50668 L
98.93707 281.41257 L
98.93707 281.31874 L
98.93707 281.22463 L
99.03118 281.13080 L
99.12501 281.13080 L
99.21883 281.13080 L
99.31266 281.13080 L
@c
F
@rax %Note: Object
97.80973 281.13080 98.37354 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
98.18532 281.13080 m
98.18532 281.22463 L
98.27915 281.31874 L
98.37354 281.41257 L
98.37354 281.41257 L
98.27915 281.50668 L
98.18532 281.60050 L
98.09150 281.69433 L
98.09150 281.69433 L
97.99767 281.69433 L
97.90356 281.60050 L
97.80973 281.50668 L
97.80973 281.41257 L
97.80973 281.31874 L
97.80973 281.22463 L
97.90356 281.13080 L
97.99767 281.13080 L
98.09150 281.13080 L
98.18532 281.13080 L
@c
F
@rax %Note: Object
96.68268 281.13080 97.24620 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
97.05827 281.13080 m
97.05827 281.22463 L
97.15209 281.31874 L
97.24620 281.41257 L
97.24620 281.41257 L
97.15209 281.50668 L
97.05827 281.60050 L
96.96444 281.69433 L
96.96444 281.69433 L
96.87033 281.69433 L
96.77650 281.60050 L
96.68268 281.50668 L
96.68268 281.41257 L
96.68268 281.31874 L
96.68268 281.22463 L
96.77650 281.13080 L
96.87033 281.13080 L
96.96444 281.13080 L
97.05827 281.13080 L
@c
F
@rax %Note: Object
95.55506 281.13080 96.11887 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
95.93093 281.13080 m
95.93093 281.22463 L
96.02476 281.31874 L
96.11887 281.41257 L
96.11887 281.41257 L
96.02476 281.50668 L
95.93093 281.60050 L
95.83682 281.69433 L
95.83682 281.69433 L
95.74299 281.69433 L
95.64917 281.60050 L
95.55506 281.50668 L
95.55506 281.41257 L
95.55506 281.31874 L
95.55506 281.22463 L
95.64917 281.13080 L
95.74299 281.13080 L
95.83682 281.13080 L
95.93093 281.13080 L
@c
F
@rax %Note: Object
94.42772 281.13080 94.99124 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
94.80359 281.13080 m
94.80359 281.22463 L
94.89742 281.31874 L
94.99124 281.41257 L
94.99124 281.41257 L
94.89742 281.50668 L
94.80359 281.60050 L
94.70976 281.69433 L
94.70976 281.69433 L
94.61594 281.69433 L
94.52211 281.60050 L
94.42772 281.50668 L
94.42772 281.41257 L
94.42772 281.31874 L
94.42772 281.22463 L
94.52211 281.13080 L
94.61594 281.13080 L
94.70976 281.13080 L
94.80359 281.13080 L
@c
F
@rax %Note: Object
93.30038 281.13080 93.86419 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
93.67625 281.13080 m
93.67625 281.22463 L
93.77036 281.31874 L
93.86419 281.41257 L
93.86419 281.41257 L
93.77036 281.50668 L
93.67625 281.60050 L
93.58243 281.69433 L
93.58243 281.69433 L
93.48860 281.69433 L
93.39449 281.60050 L
93.30038 281.50668 L
93.30038 281.41257 L
93.30038 281.31874 L
93.30038 281.22463 L
93.39449 281.13080 L
93.48860 281.13080 L
93.58243 281.13080 L
93.67625 281.13080 L
@c
F
@rax %Note: Object
92.17304 281.13080 92.73685 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
92.54891 281.13080 m
92.54891 281.22463 L
92.64274 281.31874 L
92.73685 281.41257 L
92.73685 281.41257 L
92.64274 281.50668 L
92.54891 281.60050 L
92.45509 281.69433 L
92.45509 281.69433 L
92.36126 281.69433 L
92.26687 281.60050 L
92.17304 281.50668 L
92.17304 281.41257 L
92.17304 281.31874 L
92.17304 281.22463 L
92.26687 281.13080 L
92.36126 281.13080 L
92.45509 281.13080 L
92.54891 281.13080 L
@c
F
@rax %Note: Object
91.04598 281.13080 91.60951 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
91.42186 281.13080 m
91.42186 281.22463 L
91.51569 281.31874 L
91.60951 281.41257 L
91.60951 281.41257 L
91.51569 281.50668 L
91.42186 281.60050 L
91.32803 281.69433 L
91.32803 281.69433 L
91.23392 281.69433 L
91.13981 281.60050 L
91.04598 281.50668 L
91.04598 281.41257 L
91.04598 281.31874 L
91.04598 281.22463 L
91.13981 281.13080 L
91.23392 281.13080 L
91.32803 281.13080 L
91.42186 281.13080 L
@c
F
@rax %Note: Object
89.91865 281.13080 90.48217 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
90.29452 281.13080 m
90.29452 281.22463 L
90.38835 281.31874 L
90.48217 281.41257 L
90.48217 281.41257 L
90.38835 281.50668 L
90.29452 281.60050 L
90.20041 281.69433 L
90.20041 281.69433 L
90.10658 281.69433 L
90.01247 281.60050 L
89.91865 281.50668 L
89.91865 281.41257 L
89.91865 281.31874 L
89.91865 281.22463 L
90.01247 281.13080 L
90.10658 281.13080 L
90.20041 281.13080 L
90.29452 281.13080 L
@c
F
@rax %Note: Object
88.79131 281.13080 89.35483 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
89.16718 281.13080 m
89.16718 281.22463 L
89.26101 281.31874 L
89.35483 281.41257 L
89.35483 281.41257 L
89.26101 281.50668 L
89.16718 281.60050 L
89.07307 281.69433 L
89.07307 281.69433 L
88.97896 281.69433 L
88.88542 281.60050 L
88.79131 281.50668 L
88.79131 281.41257 L
88.79131 281.31874 L
88.79131 281.22463 L
88.88542 281.13080 L
88.97896 281.13080 L
89.07307 281.13080 L
89.16718 281.13080 L
@c
F
@rax %Note: Object
87.66397 281.13080 88.22778 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
88.03984 281.13080 m
88.03984 281.22463 L
88.13395 281.31874 L
88.22778 281.41257 L
88.22778 281.41257 L
88.13395 281.50668 L
88.03984 281.60050 L
87.94602 281.69433 L
87.94602 281.69433 L
87.85191 281.69433 L
87.75808 281.60050 L
87.66397 281.50668 L
87.66397 281.41257 L
87.66397 281.31874 L
87.66397 281.22463 L
87.75808 281.13080 L
87.85191 281.13080 L
87.94602 281.13080 L
88.03984 281.13080 L
@c
F
@rax %Note: Object
86.53663 281.13080 87.10044 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
86.91250 281.13080 m
86.91250 281.22463 L
87.00633 281.31874 L
87.10044 281.41257 L
87.10044 281.41257 L
87.00633 281.50668 L
86.91250 281.60050 L
86.81868 281.69433 L
86.81868 281.69433 L
86.72457 281.69433 L
86.63046 281.60050 L
86.53663 281.50668 L
86.53663 281.41257 L
86.53663 281.31874 L
86.53663 281.22463 L
86.63046 281.13080 L
86.72457 281.13080 L
86.81868 281.13080 L
86.91250 281.13080 L
@c
F
@rax %Note: Object
85.40957 281.13080 85.97310 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
85.78545 281.13080 m
85.78545 281.22463 L
85.87928 281.31874 L
85.97310 281.41257 L
85.97310 281.41257 L
85.87928 281.50668 L
85.78545 281.60050 L
85.69134 281.69433 L
85.69134 281.69433 L
85.59723 281.69433 L
85.50340 281.60050 L
85.40957 281.50668 L
85.40957 281.41257 L
85.40957 281.31874 L
85.40957 281.22463 L
85.50340 281.13080 L
85.59723 281.13080 L
85.69134 281.13080 L
85.78545 281.13080 L
@c
F
@rax %Note: Object
84.28224 281.13080 84.84576 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
84.65811 281.13080 m
84.65811 281.22463 L
84.75194 281.31874 L
84.84576 281.41257 L
84.84576 281.41257 L
84.75194 281.50668 L
84.65811 281.60050 L
84.56400 281.69433 L
84.56400 281.69433 L
84.46989 281.69433 L
84.37606 281.60050 L
84.28224 281.50668 L
84.28224 281.41257 L
84.28224 281.31874 L
84.28224 281.22463 L
84.37606 281.13080 L
84.46989 281.13080 L
84.56400 281.13080 L
84.65811 281.13080 L
@c
F
@rax %Note: Object
83.15490 281.13080 83.71843 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.53077 281.13080 m
83.53077 281.22463 L
83.62460 281.31874 L
83.71843 281.41257 L
83.71843 281.41257 L
83.62460 281.50668 L
83.53077 281.60050 L
83.43638 281.69433 L
83.43638 281.69433 L
83.34255 281.69433 L
83.24872 281.60050 L
83.15490 281.50668 L
83.15490 281.41257 L
83.15490 281.31874 L
83.15490 281.22463 L
83.24872 281.13080 L
83.34255 281.13080 L
83.43638 281.13080 L
83.53077 281.13080 L
@c
F
@rax %Note: Object
82.02756 281.13080 82.59137 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
82.40315 281.13080 m
82.40315 281.22463 L
82.49754 281.31874 L
82.59137 281.41257 L
82.59137 281.41257 L
82.49754 281.50668 L
82.40315 281.60050 L
82.30932 281.69433 L
82.30932 281.69433 L
82.21550 281.69433 L
82.12167 281.60050 L
82.02756 281.50668 L
82.02756 281.41257 L
82.02756 281.31874 L
82.02756 281.22463 L
82.12167 281.13080 L
82.21550 281.13080 L
82.30932 281.13080 L
82.40315 281.13080 L
@c
F
@rax %Note: Object
80.90022 281.13080 81.46403 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
81.27581 281.13080 m
81.27581 281.22463 L
81.36992 281.31874 L
81.46403 281.41257 L
81.46403 281.41257 L
81.36992 281.50668 L
81.27581 281.60050 L
81.18198 281.69433 L
81.18198 281.69433 L
81.08816 281.69433 L
80.99405 281.60050 L
80.90022 281.50668 L
80.90022 281.41257 L
80.90022 281.31874 L
80.90022 281.22463 L
80.99405 281.13080 L
81.08816 281.13080 L
81.18198 281.13080 L
81.27581 281.13080 L
@c
F
@rax %Note: Object
79.77317 281.13080 80.33669 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
80.14876 281.13080 m
80.14876 281.22463 L
80.24258 281.31874 L
80.33669 281.41257 L
80.33669 281.41257 L
80.24258 281.50668 L
80.14876 281.60050 L
80.05493 281.69433 L
80.05493 281.69433 L
79.96082 281.69433 L
79.86699 281.60050 L
79.77317 281.50668 L
79.77317 281.41257 L
79.77317 281.31874 L
79.77317 281.22463 L
79.86699 281.13080 L
79.96082 281.13080 L
80.05493 281.13080 L
80.14876 281.13080 L
@c
F
@rax %Note: Object
78.64583 281.13080 79.20935 281.69433 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
78.64583 281.41257 m
78.73965 281.31874 L
78.83348 281.22463 L
78.92759 281.13080 L
79.02142 281.13080 L
79.11524 281.22463 L
79.20935 281.31874 L
79.20935 281.41257 L
79.20935 281.50668 L
79.20935 281.50668 L
79.20935 281.60050 L
79.11524 281.69433 L
79.02142 281.69433 L
78.92759 281.69433 L
78.83348 281.69433 L
78.73965 281.60050 L
78.64583 281.50668 L
78.64583 281.41257 L
@c
F
@rax %Note: Object
78.64583 282.25786 79.20935 282.82167 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
78.64583 282.53991 m
78.73965 282.44580 L
78.83348 282.35197 L
78.92759 282.25786 L
79.02142 282.25786 L
79.11524 282.35197 L
79.20935 282.44580 L
79.20935 282.53991 L
79.20935 282.63402 L
79.20935 282.63402 L
79.20935 282.72784 L
79.11524 282.82167 L
79.02142 282.82167 L
78.92759 282.82167 L
78.83348 282.82167 L
78.73965 282.72784 L
78.64583 282.63402 L
78.64583 282.53991 L
@c
F
@rax %Note: Object
78.64583 283.38548 79.20935 283.94901 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
78.64583 283.66724 m
78.73965 283.57313 L
78.83348 283.47931 L
78.92759 283.38548 L
79.02142 283.38548 L
79.11524 283.47931 L
79.20935 283.57313 L
79.20935 283.66724 L
79.20935 283.76135 L
79.20935 283.76135 L
79.20935 283.85518 L
79.11524 283.94901 L
79.02142 283.94901 L
78.92759 283.94901 L
78.83348 283.94901 L
78.73965 283.85518 L
78.64583 283.76135 L
78.64583 283.66724 L
@c
F
@rax %Note: Object
78.64583 284.51282 79.20935 285.07606 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
78.64583 284.79458 m
78.73965 284.70047 L
78.83348 284.60636 L
78.92759 284.51282 L
79.02142 284.51282 L
79.11524 284.60636 L
79.20935 284.70047 L
79.20935 284.79458 L
79.20935 284.88841 L
79.20935 284.88841 L
79.20935 284.98224 L
79.11524 285.07606 L
79.02142 285.07606 L
78.92759 285.07606 L
78.83348 285.07606 L
78.73965 284.98224 L
78.64583 284.88841 L
78.64583 284.79458 L
@c
F
@rax %Note: Object
78.64583 285.63987 79.20935 286.20369 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
78.64583 285.92192 m
78.73965 285.82809 L
78.83348 285.73370 L
78.92759 285.63987 L
79.02142 285.63987 L
79.11524 285.73370 L
79.20935 285.82809 L
79.20935 285.92192 L
79.20935 286.01575 L
79.20935 286.01575 L
79.20935 286.10957 L
79.11524 286.20369 L
79.02142 286.20369 L
78.92759 286.20369 L
78.83348 286.20369 L
78.73965 286.10957 L
78.64583 286.01575 L
78.64583 285.92192 L
@c
F
@rax %Note: Object
78.64583 286.76721 79.20935 287.33102 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
78.64583 287.04926 m
78.73965 286.95543 L
78.83348 286.86104 L
78.92759 286.76721 L
79.02142 286.76721 L
79.11524 286.86104 L
79.20935 286.95543 L
79.20935 287.04926 L
79.20935 287.14309 L
79.20935 287.14309 L
79.20935 287.23691 L
79.11524 287.33102 L
79.02142 287.33102 L
78.92759 287.33102 L
78.83348 287.33102 L
78.73965 287.23691 L
78.64583 287.14309 L
78.64583 287.04926 L
@c
F
@rax %Note: Object
78.64583 287.89427 79.20935 288.45808 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
78.64583 288.17631 m
78.73965 288.08249 L
78.83348 287.98866 L
78.92759 287.89427 L
79.02142 287.89427 L
79.11524 287.98866 L
79.20935 288.08249 L
79.20935 288.17631 L
79.20935 288.27014 L
79.20935 288.27014 L
79.20935 288.36425 L
79.11524 288.45808 L
79.02142 288.45808 L
78.92759 288.45808 L
78.83348 288.45808 L
78.73965 288.36425 L
78.64583 288.27014 L
78.64583 288.17631 L
@c
F
@rax %Note: Object
76.01528 289.02189 81.93373 294.94006 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
81.93373 289.02189 m
78.92759 294.94006 L
76.01528 289.02189 L
81.93373 289.02189 L
@c
F
@rax %Note: Object
176.72088 272.11266 177.28441 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
177.09647 272.11266 m
177.09647 272.20649 L
177.19030 272.30031 L
177.28441 272.39414 L
177.28441 272.39414 L
177.19030 272.48825 L
177.09647 272.58208 L
177.00236 272.67619 L
177.00236 272.67619 L
176.90854 272.67619 L
176.81471 272.58208 L
176.72088 272.48825 L
176.72088 272.39414 L
176.72088 272.30031 L
176.72088 272.20649 L
176.81471 272.11266 L
176.90854 272.11266 L
177.00236 272.11266 L
177.09647 272.11266 L
@c
F
@rax %Note: Object
175.59354 272.11266 176.15707 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
175.96913 272.11266 m
175.96913 272.20649 L
176.06296 272.30031 L
176.15707 272.39414 L
176.15707 272.39414 L
176.06296 272.48825 L
175.96913 272.58208 L
175.87531 272.67619 L
175.87531 272.67619 L
175.78148 272.67619 L
175.68765 272.58208 L
175.59354 272.48825 L
175.59354 272.39414 L
175.59354 272.30031 L
175.59354 272.20649 L
175.68765 272.11266 L
175.78148 272.11266 L
175.87531 272.11266 L
175.96913 272.11266 L
@c
F
@rax %Note: Object
174.46620 272.11266 175.03002 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
174.84180 272.11266 m
174.84180 272.20649 L
174.93591 272.30031 L
175.03002 272.39414 L
175.03002 272.39414 L
174.93591 272.48825 L
174.84180 272.58208 L
174.74797 272.67619 L
174.74797 272.67619 L
174.65414 272.67619 L
174.56031 272.58208 L
174.46620 272.48825 L
174.46620 272.39414 L
174.46620 272.30031 L
174.46620 272.20649 L
174.56031 272.11266 L
174.65414 272.11266 L
174.74797 272.11266 L
174.84180 272.11266 L
@c
F
@rax %Note: Object
173.33858 272.11266 173.90239 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
173.71446 272.11266 m
173.71446 272.20649 L
173.80828 272.30031 L
173.90239 272.39414 L
173.90239 272.39414 L
173.80828 272.48825 L
173.71446 272.58208 L
173.62063 272.67619 L
173.62063 272.67619 L
173.52680 272.67619 L
173.43269 272.58208 L
173.33858 272.48825 L
173.33858 272.39414 L
173.33858 272.30031 L
173.33858 272.20649 L
173.43269 272.11266 L
173.52680 272.11266 L
173.62063 272.11266 L
173.71446 272.11266 L
@c
F
@rax %Note: Object
172.21153 272.11266 172.77506 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
172.58740 272.11266 m
172.58740 272.20649 L
172.68123 272.30031 L
172.77506 272.39414 L
172.77506 272.39414 L
172.68123 272.48825 L
172.58740 272.58208 L
172.49357 272.67619 L
172.49357 272.67619 L
172.39946 272.67619 L
172.30564 272.58208 L
172.21153 272.48825 L
172.21153 272.39414 L
172.21153 272.30031 L
172.21153 272.20649 L
172.30564 272.11266 L
172.39946 272.11266 L
172.49357 272.11266 L
172.58740 272.11266 L
@c
F
@rax %Note: Object
171.08419 272.11266 171.64772 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
171.46006 272.11266 m
171.46006 272.20649 L
171.55389 272.30031 L
171.64772 272.39414 L
171.64772 272.39414 L
171.55389 272.48825 L
171.46006 272.58208 L
171.36624 272.67619 L
171.36624 272.67619 L
171.27213 272.67619 L
171.17802 272.58208 L
171.08419 272.48825 L
171.08419 272.39414 L
171.08419 272.30031 L
171.08419 272.20649 L
171.17802 272.11266 L
171.27213 272.11266 L
171.36624 272.11266 L
171.46006 272.11266 L
@c
F
@rax %Note: Object
169.95685 272.11266 170.52038 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
170.33272 272.11266 m
170.33272 272.20649 L
170.42655 272.30031 L
170.52038 272.39414 L
170.52038 272.39414 L
170.42655 272.48825 L
170.33272 272.58208 L
170.23861 272.67619 L
170.23861 272.67619 L
170.14507 272.67619 L
170.05096 272.58208 L
169.95685 272.48825 L
169.95685 272.39414 L
169.95685 272.30031 L
169.95685 272.20649 L
170.05096 272.11266 L
170.14507 272.11266 L
170.23861 272.11266 L
170.33272 272.11266 L
@c
F
@rax %Note: Object
168.82951 272.11266 169.39332 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
169.20539 272.11266 m
169.20539 272.20649 L
169.29950 272.30031 L
169.39332 272.39414 L
169.39332 272.39414 L
169.29950 272.48825 L
169.20539 272.58208 L
169.11156 272.67619 L
169.11156 272.67619 L
169.01773 272.67619 L
168.92362 272.58208 L
168.82951 272.48825 L
168.82951 272.39414 L
168.82951 272.30031 L
168.82951 272.20649 L
168.92362 272.11266 L
169.01773 272.11266 L
169.11156 272.11266 L
169.20539 272.11266 L
@c
F
@rax %Note: Object
167.70217 272.11266 168.26598 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
168.07805 272.11266 m
168.07805 272.20649 L
168.17187 272.30031 L
168.26598 272.39414 L
168.26598 272.39414 L
168.17187 272.48825 L
168.07805 272.58208 L
167.98422 272.67619 L
167.98422 272.67619 L
167.89011 272.67619 L
167.79600 272.58208 L
167.70217 272.48825 L
167.70217 272.39414 L
167.70217 272.30031 L
167.70217 272.20649 L
167.79600 272.11266 L
167.89011 272.11266 L
167.98422 272.11266 L
168.07805 272.11266 L
@c
F
@rax %Note: Object
166.57512 272.11266 167.13865 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
166.95099 272.11266 m
166.95099 272.20649 L
167.04482 272.30031 L
167.13865 272.39414 L
167.13865 272.39414 L
167.04482 272.48825 L
166.95099 272.58208 L
166.85717 272.67619 L
166.85717 272.67619 L
166.76277 272.67619 L
166.66894 272.58208 L
166.57512 272.48825 L
166.57512 272.39414 L
166.57512 272.30031 L
166.57512 272.20649 L
166.66894 272.11266 L
166.76277 272.11266 L
166.85717 272.11266 L
166.95099 272.11266 L
@c
F
@rax %Note: Object
165.44778 272.11266 166.01131 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
165.82365 272.11266 m
165.82365 272.20649 L
165.91748 272.30031 L
166.01131 272.39414 L
166.01131 272.39414 L
165.91748 272.48825 L
165.82365 272.58208 L
165.72983 272.67619 L
165.72983 272.67619 L
165.63543 272.67619 L
165.54161 272.58208 L
165.44778 272.48825 L
165.44778 272.39414 L
165.44778 272.30031 L
165.44778 272.20649 L
165.54161 272.11266 L
165.63543 272.11266 L
165.72983 272.11266 L
165.82365 272.11266 L
@c
F
@rax %Note: Object
164.32044 272.11266 164.88397 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
164.69631 272.11266 m
164.69631 272.20649 L
164.79014 272.30031 L
164.88397 272.39414 L
164.88397 272.39414 L
164.79014 272.48825 L
164.69631 272.58208 L
164.60220 272.67619 L
164.60220 272.67619 L
164.50809 272.67619 L
164.41455 272.58208 L
164.32044 272.48825 L
164.32044 272.39414 L
164.32044 272.30031 L
164.32044 272.20649 L
164.41455 272.11266 L
164.50809 272.11266 L
164.60220 272.11266 L
164.69631 272.11266 L
@c
F
@rax %Note: Object
163.19310 272.11266 163.75691 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
163.56898 272.11266 m
163.56898 272.20649 L
163.66309 272.30031 L
163.75691 272.39414 L
163.75691 272.39414 L
163.66309 272.48825 L
163.56898 272.58208 L
163.47487 272.67619 L
163.47487 272.67619 L
163.38104 272.67619 L
163.28721 272.58208 L
163.19310 272.48825 L
163.19310 272.39414 L
163.19310 272.30031 L
163.19310 272.20649 L
163.28721 272.11266 L
163.38104 272.11266 L
163.47487 272.11266 L
163.56898 272.11266 L
@c
F
@rax %Note: Object
162.06576 272.11266 162.62957 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
162.44164 272.11266 m
162.44164 272.20649 L
162.53546 272.30031 L
162.62957 272.39414 L
162.62957 272.39414 L
162.53546 272.48825 L
162.44164 272.58208 L
162.34753 272.67619 L
162.34753 272.67619 L
162.25370 272.67619 L
162.15959 272.58208 L
162.06576 272.48825 L
162.06576 272.39414 L
162.06576 272.30031 L
162.06576 272.20649 L
162.15959 272.11266 L
162.25370 272.11266 L
162.34753 272.11266 L
162.44164 272.11266 L
@c
F
@rax %Note: Object
160.93871 272.11266 161.50224 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
161.31430 272.11266 m
161.31430 272.20649 L
161.40841 272.30031 L
161.50224 272.39414 L
161.50224 272.39414 L
161.40841 272.48825 L
161.31430 272.58208 L
161.22047 272.67619 L
161.22047 272.67619 L
161.12636 272.67619 L
161.03254 272.58208 L
160.93871 272.48825 L
160.93871 272.39414 L
160.93871 272.30031 L
160.93871 272.20649 L
161.03254 272.11266 L
161.12636 272.11266 L
161.22047 272.11266 L
161.31430 272.11266 L
@c
F
@rax %Note: Object
159.81137 272.11266 160.37490 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
160.18696 272.11266 m
160.18696 272.20649 L
160.28107 272.30031 L
160.37490 272.39414 L
160.37490 272.39414 L
160.28107 272.48825 L
160.18696 272.58208 L
160.09313 272.67619 L
160.09313 272.67619 L
159.99902 272.67619 L
159.90520 272.58208 L
159.81137 272.48825 L
159.81137 272.39414 L
159.81137 272.30031 L
159.81137 272.20649 L
159.90520 272.11266 L
159.99902 272.11266 L
160.09313 272.11266 L
160.18696 272.11266 L
@c
F
@rax %Note: Object
158.68403 272.11266 159.24756 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
159.05962 272.11266 m
159.05962 272.20649 L
159.15373 272.30031 L
159.24756 272.39414 L
159.24756 272.39414 L
159.15373 272.48825 L
159.05962 272.58208 L
158.96551 272.67619 L
158.96551 272.67619 L
158.87169 272.67619 L
158.77786 272.58208 L
158.68403 272.48825 L
158.68403 272.39414 L
158.68403 272.30031 L
158.68403 272.20649 L
158.77786 272.11266 L
158.87169 272.11266 L
158.96551 272.11266 L
159.05962 272.11266 L
@c
F
@rax %Note: Object
157.55669 272.11266 158.12050 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
157.93228 272.11266 m
157.93228 272.20649 L
158.02639 272.30031 L
158.12050 272.39414 L
158.12050 272.39414 L
158.02639 272.48825 L
157.93228 272.58208 L
157.83846 272.67619 L
157.83846 272.67619 L
157.74463 272.67619 L
157.65080 272.58208 L
157.55669 272.48825 L
157.55669 272.39414 L
157.55669 272.30031 L
157.55669 272.20649 L
157.65080 272.11266 L
157.74463 272.11266 L
157.83846 272.11266 L
157.93228 272.11266 L
@c
F
@rax %Note: Object
156.42935 272.11266 156.99317 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
156.80494 272.11266 m
156.80494 272.20649 L
156.89906 272.30031 L
156.99317 272.39414 L
156.99317 272.39414 L
156.89906 272.48825 L
156.80494 272.58208 L
156.71112 272.67619 L
156.71112 272.67619 L
156.61729 272.67619 L
156.52318 272.58208 L
156.42935 272.48825 L
156.42935 272.39414 L
156.42935 272.30031 L
156.42935 272.20649 L
156.52318 272.11266 L
156.61729 272.11266 L
156.71112 272.11266 L
156.80494 272.11266 L
@c
F
@rax %Note: Object
155.30202 272.11266 155.86583 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
155.67789 272.11266 m
155.67789 272.20649 L
155.77143 272.30031 L
155.86583 272.39414 L
155.86583 272.39414 L
155.77143 272.48825 L
155.67789 272.58208 L
155.58406 272.67619 L
155.58406 272.67619 L
155.48995 272.67619 L
155.39613 272.58208 L
155.30202 272.48825 L
155.30202 272.39414 L
155.30202 272.30031 L
155.30202 272.20649 L
155.39613 272.11266 L
155.48995 272.11266 L
155.58406 272.11266 L
155.67789 272.11266 L
@c
F
@rax %Note: Object
154.17468 272.11266 154.73820 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
154.55055 272.11266 m
154.55055 272.20649 L
154.64438 272.30031 L
154.73820 272.39414 L
154.73820 272.39414 L
154.64438 272.48825 L
154.55055 272.58208 L
154.45672 272.67619 L
154.45672 272.67619 L
154.36261 272.67619 L
154.26879 272.58208 L
154.17468 272.48825 L
154.17468 272.39414 L
154.17468 272.30031 L
154.17468 272.20649 L
154.26879 272.11266 L
154.36261 272.11266 L
154.45672 272.11266 L
154.55055 272.11266 L
@c
F
@rax %Note: Object
153.04734 272.11266 153.61087 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
153.42321 272.11266 m
153.42321 272.20649 L
153.51704 272.30031 L
153.61087 272.39414 L
153.61087 272.39414 L
153.51704 272.48825 L
153.42321 272.58208 L
153.32910 272.67619 L
153.32910 272.67619 L
153.23528 272.67619 L
153.14145 272.58208 L
153.04734 272.48825 L
153.04734 272.39414 L
153.04734 272.30031 L
153.04734 272.20649 L
153.14145 272.11266 L
153.23528 272.11266 L
153.32910 272.11266 L
153.42321 272.11266 L
@c
F
@rax %Note: Object
151.92000 272.11266 152.48381 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
152.29587 272.11266 m
152.29587 272.20649 L
152.38998 272.30031 L
152.48381 272.39414 L
152.48381 272.39414 L
152.38998 272.48825 L
152.29587 272.58208 L
152.20205 272.67619 L
152.20205 272.67619 L
152.10822 272.67619 L
152.01411 272.58208 L
151.92000 272.48825 L
151.92000 272.39414 L
151.92000 272.30031 L
151.92000 272.20649 L
152.01411 272.11266 L
152.10822 272.11266 L
152.20205 272.11266 L
152.29587 272.11266 L
@c
F
@rax %Note: Object
150.79266 272.11266 151.35647 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
151.16854 272.11266 m
151.16854 272.20649 L
151.26265 272.30031 L
151.35647 272.39414 L
151.35647 272.39414 L
151.26265 272.48825 L
151.16854 272.58208 L
151.07471 272.67619 L
151.07471 272.67619 L
150.98088 272.67619 L
150.88649 272.58208 L
150.79266 272.48825 L
150.79266 272.39414 L
150.79266 272.30031 L
150.79266 272.20649 L
150.88649 272.11266 L
150.98088 272.11266 L
151.07471 272.11266 L
151.16854 272.11266 L
@c
F
@rax %Note: Object
149.66561 272.11266 150.22913 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
150.04120 272.11266 m
150.04120 272.20649 L
150.13502 272.30031 L
150.22913 272.39414 L
150.22913 272.39414 L
150.13502 272.48825 L
150.04120 272.58208 L
149.94737 272.67619 L
149.94737 272.67619 L
149.85354 272.67619 L
149.75943 272.58208 L
149.66561 272.48825 L
149.66561 272.39414 L
149.66561 272.30031 L
149.66561 272.20649 L
149.75943 272.11266 L
149.85354 272.11266 L
149.94737 272.11266 L
150.04120 272.11266 L
@c
F
@rax %Note: Object
148.53827 272.11266 149.10180 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
148.91414 272.11266 m
148.91414 272.20649 L
149.00797 272.30031 L
149.10180 272.39414 L
149.10180 272.39414 L
149.00797 272.48825 L
148.91414 272.58208 L
148.82031 272.67619 L
148.82031 272.67619 L
148.72620 272.67619 L
148.63209 272.58208 L
148.53827 272.48825 L
148.53827 272.39414 L
148.53827 272.30031 L
148.53827 272.20649 L
148.63209 272.11266 L
148.72620 272.11266 L
148.82031 272.11266 L
148.91414 272.11266 L
@c
F
@rax %Note: Object
147.41093 272.11266 147.97446 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
147.78680 272.11266 m
147.78680 272.20649 L
147.88063 272.30031 L
147.97446 272.39414 L
147.97446 272.39414 L
147.88063 272.48825 L
147.78680 272.58208 L
147.69269 272.67619 L
147.69269 272.67619 L
147.59858 272.67619 L
147.50476 272.58208 L
147.41093 272.48825 L
147.41093 272.39414 L
147.41093 272.30031 L
147.41093 272.20649 L
147.50476 272.11266 L
147.59858 272.11266 L
147.69269 272.11266 L
147.78680 272.11266 L
@c
F
@rax %Note: Object
146.28359 272.11266 146.84740 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
146.65946 272.11266 m
146.65946 272.20649 L
146.75357 272.30031 L
146.84740 272.39414 L
146.84740 272.39414 L
146.75357 272.48825 L
146.65946 272.58208 L
146.56564 272.67619 L
146.56564 272.67619 L
146.47153 272.67619 L
146.37770 272.58208 L
146.28359 272.48825 L
146.28359 272.39414 L
146.28359 272.30031 L
146.28359 272.20649 L
146.37770 272.11266 L
146.47153 272.11266 L
146.56564 272.11266 L
146.65946 272.11266 L
@c
F
@rax %Note: Object
145.15625 272.11266 145.72006 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
145.53213 272.11266 m
145.53213 272.20649 L
145.62624 272.30031 L
145.72006 272.39414 L
145.72006 272.39414 L
145.62624 272.48825 L
145.53213 272.58208 L
145.43830 272.67619 L
145.43830 272.67619 L
145.34419 272.67619 L
145.25008 272.58208 L
145.15625 272.48825 L
145.15625 272.39414 L
145.15625 272.30031 L
145.15625 272.20649 L
145.25008 272.11266 L
145.34419 272.11266 L
145.43830 272.11266 L
145.53213 272.11266 L
@c
F
@rax %Note: Object
144.02920 272.11266 144.59272 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
144.40479 272.11266 m
144.40479 272.20649 L
144.49861 272.30031 L
144.59272 272.39414 L
144.59272 272.39414 L
144.49861 272.48825 L
144.40479 272.58208 L
144.31068 272.67619 L
144.31068 272.67619 L
144.21685 272.67619 L
144.12274 272.58208 L
144.02920 272.48825 L
144.02920 272.39414 L
144.02920 272.30031 L
144.02920 272.20649 L
144.12274 272.11266 L
144.21685 272.11266 L
144.31068 272.11266 L
144.40479 272.11266 L
@c
F
@rax %Note: Object
142.90186 272.11266 143.46539 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
143.27773 272.11266 m
143.27773 272.20649 L
143.37156 272.30031 L
143.46539 272.39414 L
143.46539 272.39414 L
143.37156 272.48825 L
143.27773 272.58208 L
143.18362 272.67619 L
143.18362 272.67619 L
143.08951 272.67619 L
142.99569 272.58208 L
142.90186 272.48825 L
142.90186 272.39414 L
142.90186 272.30031 L
142.90186 272.20649 L
142.99569 272.11266 L
143.08951 272.11266 L
143.18362 272.11266 L
143.27773 272.11266 L
@c
F
@rax %Note: Object
141.77452 272.11266 142.33805 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
142.15011 272.11266 m
142.15011 272.20649 L
142.24422 272.30031 L
142.33805 272.39414 L
142.33805 272.39414 L
142.24422 272.48825 L
142.15011 272.58208 L
142.05600 272.67619 L
142.05600 272.67619 L
141.96217 272.67619 L
141.86835 272.58208 L
141.77452 272.48825 L
141.77452 272.39414 L
141.77452 272.30031 L
141.77452 272.20649 L
141.86835 272.11266 L
141.96217 272.11266 L
142.05600 272.11266 L
142.15011 272.11266 L
@c
F
@rax %Note: Object
140.64718 272.11266 141.21071 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
141.02277 272.11266 m
141.02277 272.20649 L
141.11717 272.30031 L
141.21071 272.39414 L
141.21071 272.39414 L
141.11717 272.48825 L
141.02277 272.58208 L
140.92894 272.67619 L
140.92894 272.67619 L
140.83512 272.67619 L
140.74129 272.58208 L
140.64718 272.48825 L
140.64718 272.39414 L
140.64718 272.30031 L
140.64718 272.20649 L
140.74129 272.11266 L
140.83512 272.11266 L
140.92894 272.11266 L
141.02277 272.11266 L
@c
F
@rax %Note: Object
139.51984 272.11266 140.08365 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
139.89543 272.11266 m
139.89543 272.20649 L
139.98983 272.30031 L
140.08365 272.39414 L
140.08365 272.39414 L
139.98983 272.48825 L
139.89543 272.58208 L
139.80161 272.67619 L
139.80161 272.67619 L
139.70778 272.67619 L
139.61395 272.58208 L
139.51984 272.48825 L
139.51984 272.39414 L
139.51984 272.30031 L
139.51984 272.20649 L
139.61395 272.11266 L
139.70778 272.11266 L
139.80161 272.11266 L
139.89543 272.11266 L
@c
F
@rax %Note: Object
138.39250 272.11266 138.95631 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
138.76809 272.11266 m
138.76809 272.20649 L
138.86220 272.30031 L
138.95631 272.39414 L
138.95631 272.39414 L
138.86220 272.48825 L
138.76809 272.58208 L
138.67427 272.67619 L
138.67427 272.67619 L
138.58044 272.67619 L
138.48633 272.58208 L
138.39250 272.48825 L
138.39250 272.39414 L
138.39250 272.30031 L
138.39250 272.20649 L
138.48633 272.11266 L
138.58044 272.11266 L
138.67427 272.11266 L
138.76809 272.11266 L
@c
F
@rax %Note: Object
137.26545 272.11266 137.82898 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
137.64104 272.11266 m
137.64104 272.20649 L
137.73487 272.30031 L
137.82898 272.39414 L
137.82898 272.39414 L
137.73487 272.48825 L
137.64104 272.58208 L
137.54721 272.67619 L
137.54721 272.67619 L
137.45310 272.67619 L
137.35928 272.58208 L
137.26545 272.48825 L
137.26545 272.39414 L
137.26545 272.30031 L
137.26545 272.20649 L
137.35928 272.11266 L
137.45310 272.11266 L
137.54721 272.11266 L
137.64104 272.11266 L
@c
F
@rax %Note: Object
136.13811 272.11266 136.70164 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
136.51370 272.11266 m
136.51370 272.20649 L
136.60753 272.30031 L
136.70164 272.39414 L
136.70164 272.39414 L
136.60753 272.48825 L
136.51370 272.58208 L
136.41959 272.67619 L
136.41959 272.67619 L
136.32576 272.67619 L
136.23194 272.58208 L
136.13811 272.48825 L
136.13811 272.39414 L
136.13811 272.30031 L
136.13811 272.20649 L
136.23194 272.11266 L
136.32576 272.11266 L
136.41959 272.11266 L
136.51370 272.11266 L
@c
F
@rax %Note: Object
135.01049 272.11266 135.57430 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
135.38636 272.11266 m
135.38636 272.20649 L
135.48019 272.30031 L
135.57430 272.39414 L
135.57430 272.39414 L
135.48019 272.48825 L
135.38636 272.58208 L
135.29254 272.67619 L
135.29254 272.67619 L
135.19871 272.67619 L
135.10488 272.58208 L
135.01049 272.48825 L
135.01049 272.39414 L
135.01049 272.30031 L
135.01049 272.20649 L
135.10488 272.11266 L
135.19871 272.11266 L
135.29254 272.11266 L
135.38636 272.11266 L
@c
F
@rax %Note: Object
133.88315 272.11266 134.44696 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
134.25902 272.11266 m
134.25902 272.20649 L
134.35313 272.30031 L
134.44696 272.39414 L
134.44696 272.39414 L
134.35313 272.48825 L
134.25902 272.58208 L
134.16520 272.67619 L
134.16520 272.67619 L
134.07137 272.67619 L
133.97754 272.58208 L
133.88315 272.48825 L
133.88315 272.39414 L
133.88315 272.30031 L
133.88315 272.20649 L
133.97754 272.11266 L
134.07137 272.11266 L
134.16520 272.11266 L
134.25902 272.11266 L
@c
F
@rax %Note: Object
132.75581 272.11266 133.31962 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
133.13169 272.11266 m
133.13169 272.20649 L
133.22551 272.30031 L
133.31962 272.39414 L
133.31962 272.39414 L
133.22551 272.48825 L
133.13169 272.58208 L
133.03786 272.67619 L
133.03786 272.67619 L
132.94403 272.67619 L
132.84992 272.58208 L
132.75581 272.48825 L
132.75581 272.39414 L
132.75581 272.30031 L
132.75581 272.20649 L
132.84992 272.11266 L
132.94403 272.11266 L
133.03786 272.11266 L
133.13169 272.11266 L
@c
F
@rax %Note: Object
131.62876 272.11266 132.19228 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
132.00463 272.11266 m
132.00463 272.20649 L
132.09846 272.30031 L
132.19228 272.39414 L
132.19228 272.39414 L
132.09846 272.48825 L
132.00463 272.58208 L
131.91080 272.67619 L
131.91080 272.67619 L
131.81669 272.67619 L
131.72258 272.58208 L
131.62876 272.48825 L
131.62876 272.39414 L
131.62876 272.30031 L
131.62876 272.20649 L
131.72258 272.11266 L
131.81669 272.11266 L
131.91080 272.11266 L
132.00463 272.11266 L
@c
F
@rax %Note: Object
130.50142 272.11266 131.06494 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
130.87729 272.11266 m
130.87729 272.20649 L
130.97112 272.30031 L
131.06494 272.39414 L
131.06494 272.39414 L
130.97112 272.48825 L
130.87729 272.58208 L
130.78318 272.67619 L
130.78318 272.67619 L
130.68935 272.67619 L
130.59524 272.58208 L
130.50142 272.48825 L
130.50142 272.39414 L
130.50142 272.30031 L
130.50142 272.20649 L
130.59524 272.11266 L
130.68935 272.11266 L
130.78318 272.11266 L
130.87729 272.11266 L
@c
F
@rax %Note: Object
129.37408 272.11266 129.93761 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
129.74995 272.11266 m
129.74995 272.20649 L
129.84378 272.30031 L
129.93761 272.39414 L
129.93761 272.39414 L
129.84378 272.48825 L
129.74995 272.58208 L
129.65584 272.67619 L
129.65584 272.67619 L
129.56230 272.67619 L
129.46819 272.58208 L
129.37408 272.48825 L
129.37408 272.39414 L
129.37408 272.30031 L
129.37408 272.20649 L
129.46819 272.11266 L
129.56230 272.11266 L
129.65584 272.11266 L
129.74995 272.11266 L
@c
F
@rax %Note: Object
128.24674 272.11266 128.81055 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.62261 272.11266 m
128.62261 272.20649 L
128.71672 272.30031 L
128.81055 272.39414 L
128.81055 272.39414 L
128.71672 272.48825 L
128.62261 272.58208 L
128.52879 272.67619 L
128.52879 272.67619 L
128.43468 272.67619 L
128.34085 272.58208 L
128.24674 272.48825 L
128.24674 272.39414 L
128.24674 272.30031 L
128.24674 272.20649 L
128.34085 272.11266 L
128.43468 272.11266 L
128.52879 272.11266 L
128.62261 272.11266 L
@c
F
@rax %Note: Object
127.11940 272.11266 127.68321 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
127.49528 272.11266 m
127.49528 272.20649 L
127.58910 272.30031 L
127.68321 272.39414 L
127.68321 272.39414 L
127.58910 272.48825 L
127.49528 272.58208 L
127.40145 272.67619 L
127.40145 272.67619 L
127.30734 272.67619 L
127.21323 272.58208 L
127.11940 272.48825 L
127.11940 272.39414 L
127.11940 272.30031 L
127.11940 272.20649 L
127.21323 272.11266 L
127.30734 272.11266 L
127.40145 272.11266 L
127.49528 272.11266 L
@c
F
@rax %Note: Object
125.99235 272.11266 126.55587 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
126.36822 272.11266 m
126.36822 272.20649 L
126.46205 272.30031 L
126.55587 272.39414 L
126.55587 272.39414 L
126.46205 272.48825 L
126.36822 272.58208 L
126.27411 272.67619 L
126.27411 272.67619 L
126.18000 272.67619 L
126.08617 272.58208 L
125.99235 272.48825 L
125.99235 272.39414 L
125.99235 272.30031 L
125.99235 272.20649 L
126.08617 272.11266 L
126.18000 272.11266 L
126.27411 272.11266 L
126.36822 272.11266 L
@c
F
@rax %Note: Object
124.86501 272.11266 125.42854 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
125.24088 272.11266 m
125.24088 272.20649 L
125.33471 272.30031 L
125.42854 272.39414 L
125.42854 272.39414 L
125.33471 272.48825 L
125.24088 272.58208 L
125.14677 272.67619 L
125.14677 272.67619 L
125.05266 272.67619 L
124.95883 272.58208 L
124.86501 272.48825 L
124.86501 272.39414 L
124.86501 272.30031 L
124.86501 272.20649 L
124.95883 272.11266 L
125.05266 272.11266 L
125.14677 272.11266 L
125.24088 272.11266 L
@c
F
@rax %Note: Object
123.73767 272.11266 124.30120 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.11354 272.11266 m
124.11354 272.20649 L
124.20737 272.30031 L
124.30120 272.39414 L
124.30120 272.39414 L
124.20737 272.48825 L
124.11354 272.58208 L
124.01915 272.67619 L
124.01915 272.67619 L
123.92532 272.67619 L
123.83150 272.58208 L
123.73767 272.48825 L
123.73767 272.39414 L
123.73767 272.30031 L
123.73767 272.20649 L
123.83150 272.11266 L
123.92532 272.11266 L
124.01915 272.11266 L
124.11354 272.11266 L
@c
F
@rax %Note: Object
122.61033 272.11266 123.17414 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
122.98620 272.11266 m
122.98620 272.20649 L
123.08031 272.30031 L
123.17414 272.39414 L
123.17414 272.39414 L
123.08031 272.48825 L
122.98620 272.58208 L
122.89209 272.67619 L
122.89209 272.67619 L
122.79827 272.67619 L
122.70444 272.58208 L
122.61033 272.48825 L
122.61033 272.39414 L
122.61033 272.30031 L
122.61033 272.20649 L
122.70444 272.11266 L
122.79827 272.11266 L
122.89209 272.11266 L
122.98620 272.11266 L
@c
F
@rax %Note: Object
121.48299 272.11266 122.04680 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
121.85858 272.11266 m
121.85858 272.20649 L
121.95269 272.30031 L
122.04680 272.39414 L
122.04680 272.39414 L
121.95269 272.48825 L
121.85858 272.58208 L
121.76476 272.67619 L
121.76476 272.67619 L
121.67093 272.67619 L
121.57682 272.58208 L
121.48299 272.48825 L
121.48299 272.39414 L
121.48299 272.30031 L
121.48299 272.20649 L
121.57682 272.11266 L
121.67093 272.11266 L
121.76476 272.11266 L
121.85858 272.11266 L
@c
F
@rax %Note: Object
120.35594 272.11266 120.91946 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
120.73153 272.11266 m
120.73153 272.20649 L
120.82564 272.30031 L
120.91946 272.39414 L
120.91946 272.39414 L
120.82564 272.48825 L
120.73153 272.58208 L
120.63770 272.67619 L
120.63770 272.67619 L
120.54359 272.67619 L
120.44976 272.58208 L
120.35594 272.48825 L
120.35594 272.39414 L
120.35594 272.30031 L
120.35594 272.20649 L
120.44976 272.11266 L
120.54359 272.11266 L
120.63770 272.11266 L
120.73153 272.11266 L
@c
F
@rax %Note: Object
119.22860 272.11266 119.79213 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
119.60419 272.11266 m
119.60419 272.20649 L
119.69830 272.30031 L
119.79213 272.39414 L
119.79213 272.39414 L
119.69830 272.48825 L
119.60419 272.58208 L
119.51036 272.67619 L
119.51036 272.67619 L
119.41625 272.67619 L
119.32243 272.58208 L
119.22860 272.48825 L
119.22860 272.39414 L
119.22860 272.30031 L
119.22860 272.20649 L
119.32243 272.11266 L
119.41625 272.11266 L
119.51036 272.11266 L
119.60419 272.11266 L
@c
F
@rax %Note: Object
118.10126 272.11266 118.66479 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
118.47685 272.11266 m
118.47685 272.20649 L
118.57068 272.30031 L
118.66479 272.39414 L
118.66479 272.39414 L
118.57068 272.48825 L
118.47685 272.58208 L
118.38274 272.67619 L
118.38274 272.67619 L
118.28891 272.67619 L
118.19509 272.58208 L
118.10126 272.48825 L
118.10126 272.39414 L
118.10126 272.30031 L
118.10126 272.20649 L
118.19509 272.11266 L
118.28891 272.11266 L
118.38274 272.11266 L
118.47685 272.11266 L
@c
F
@rax %Note: Object
116.97392 272.11266 117.53773 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
117.34951 272.11266 m
117.34951 272.20649 L
117.44362 272.30031 L
117.53773 272.39414 L
117.53773 272.39414 L
117.44362 272.48825 L
117.34951 272.58208 L
117.25569 272.67619 L
117.25569 272.67619 L
117.16186 272.67619 L
117.06803 272.58208 L
116.97392 272.48825 L
116.97392 272.39414 L
116.97392 272.30031 L
116.97392 272.20649 L
117.06803 272.11266 L
117.16186 272.11266 L
117.25569 272.11266 L
117.34951 272.11266 L
@c
F
@rax %Note: Object
115.84658 272.11266 116.41039 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
116.22217 272.11266 m
116.22217 272.20649 L
116.31600 272.30031 L
116.41039 272.39414 L
116.41039 272.39414 L
116.31600 272.48825 L
116.22217 272.58208 L
116.12835 272.67619 L
116.12835 272.67619 L
116.03452 272.67619 L
115.94041 272.58208 L
115.84658 272.48825 L
115.84658 272.39414 L
115.84658 272.30031 L
115.84658 272.20649 L
115.94041 272.11266 L
116.03452 272.11266 L
116.12835 272.11266 L
116.22217 272.11266 L
@c
F
@rax %Note: Object
114.71924 272.11266 115.28277 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.09483 272.11266 m
115.09483 272.20649 L
115.18866 272.30031 L
115.28277 272.39414 L
115.28277 272.39414 L
115.18866 272.48825 L
115.09483 272.58208 L
115.00129 272.67619 L
115.00129 272.67619 L
114.90718 272.67619 L
114.81335 272.58208 L
114.71924 272.48825 L
114.71924 272.39414 L
114.71924 272.30031 L
114.71924 272.20649 L
114.81335 272.11266 L
114.90718 272.11266 L
115.00129 272.11266 L
115.09483 272.11266 L
@c
F
@rax %Note: Object
113.59191 272.11266 114.15543 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
113.96778 272.11266 m
113.96778 272.20649 L
114.06161 272.30031 L
114.15543 272.39414 L
114.15543 272.39414 L
114.06161 272.48825 L
113.96778 272.58208 L
113.87395 272.67619 L
113.87395 272.67619 L
113.77984 272.67619 L
113.68602 272.58208 L
113.59191 272.48825 L
113.59191 272.39414 L
113.59191 272.30031 L
113.59191 272.20649 L
113.68602 272.11266 L
113.77984 272.11266 L
113.87395 272.11266 L
113.96778 272.11266 L
@c
F
@rax %Note: Object
112.46457 272.11266 113.02809 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
112.84044 272.11266 m
112.84044 272.20649 L
112.93427 272.30031 L
113.02809 272.39414 L
113.02809 272.39414 L
112.93427 272.48825 L
112.84044 272.58208 L
112.74633 272.67619 L
112.74633 272.67619 L
112.65250 272.67619 L
112.55868 272.58208 L
112.46457 272.48825 L
112.46457 272.39414 L
112.46457 272.30031 L
112.46457 272.20649 L
112.55868 272.11266 L
112.65250 272.11266 L
112.74633 272.11266 L
112.84044 272.11266 L
@c
F
@rax %Note: Object
111.33723 272.11266 111.90104 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
111.71310 272.11266 m
111.71310 272.20649 L
111.80721 272.30031 L
111.90104 272.39414 L
111.90104 272.39414 L
111.80721 272.48825 L
111.71310 272.58208 L
111.61928 272.67619 L
111.61928 272.67619 L
111.52545 272.67619 L
111.43134 272.58208 L
111.33723 272.48825 L
111.33723 272.39414 L
111.33723 272.30031 L
111.33723 272.20649 L
111.43134 272.11266 L
111.52545 272.11266 L
111.61928 272.11266 L
111.71310 272.11266 L
@c
F
@rax %Note: Object
110.20989 272.11266 110.77370 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.58576 272.11266 m
110.58576 272.20649 L
110.67987 272.30031 L
110.77370 272.39414 L
110.77370 272.39414 L
110.67987 272.48825 L
110.58576 272.58208 L
110.49194 272.67619 L
110.49194 272.67619 L
110.39811 272.67619 L
110.30372 272.58208 L
110.20989 272.48825 L
110.20989 272.39414 L
110.20989 272.30031 L
110.20989 272.20649 L
110.30372 272.11266 L
110.39811 272.11266 L
110.49194 272.11266 L
110.58576 272.11266 L
@c
F
@rax %Note: Object
109.08283 272.11266 109.64636 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
109.45843 272.11266 m
109.45843 272.20649 L
109.55225 272.30031 L
109.64636 272.39414 L
109.64636 272.39414 L
109.55225 272.48825 L
109.45843 272.58208 L
109.36460 272.67619 L
109.36460 272.67619 L
109.27049 272.67619 L
109.17666 272.58208 L
109.08283 272.48825 L
109.08283 272.39414 L
109.08283 272.30031 L
109.08283 272.20649 L
109.17666 272.11266 L
109.27049 272.11266 L
109.36460 272.11266 L
109.45843 272.11266 L
@c
F
@rax %Note: Object
107.95550 272.11266 108.51902 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
108.33137 272.11266 m
108.33137 272.20649 L
108.42520 272.30031 L
108.51902 272.39414 L
108.51902 272.39414 L
108.42520 272.48825 L
108.33137 272.58208 L
108.23754 272.67619 L
108.23754 272.67619 L
108.14315 272.67619 L
108.04932 272.58208 L
107.95550 272.48825 L
107.95550 272.39414 L
107.95550 272.30031 L
107.95550 272.20649 L
108.04932 272.11266 L
108.14315 272.11266 L
108.23754 272.11266 L
108.33137 272.11266 L
@c
F
@rax %Note: Object
106.82816 272.11266 107.39169 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
107.20403 272.11266 m
107.20403 272.20649 L
107.29786 272.30031 L
107.39169 272.39414 L
107.39169 272.39414 L
107.29786 272.48825 L
107.20403 272.58208 L
107.10992 272.67619 L
107.10992 272.67619 L
107.01581 272.67619 L
106.92198 272.58208 L
106.82816 272.48825 L
106.82816 272.39414 L
106.82816 272.30031 L
106.82816 272.20649 L
106.92198 272.11266 L
107.01581 272.11266 L
107.10992 272.11266 L
107.20403 272.11266 L
@c
F
@rax %Note: Object
105.70082 272.11266 106.26463 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
106.07669 272.11266 m
106.07669 272.20649 L
106.17080 272.30031 L
106.26463 272.39414 L
106.26463 272.39414 L
106.17080 272.48825 L
106.07669 272.58208 L
105.98258 272.67619 L
105.98258 272.67619 L
105.88876 272.67619 L
105.79493 272.58208 L
105.70082 272.48825 L
105.70082 272.39414 L
105.70082 272.30031 L
105.70082 272.20649 L
105.79493 272.11266 L
105.88876 272.11266 L
105.98258 272.11266 L
106.07669 272.11266 L
@c
F
@rax %Note: Object
104.57348 272.11266 105.13729 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
104.94935 272.11266 m
104.94935 272.20649 L
105.04346 272.30031 L
105.13729 272.39414 L
105.13729 272.39414 L
105.04346 272.48825 L
104.94935 272.58208 L
104.85524 272.67619 L
104.85524 272.67619 L
104.76142 272.67619 L
104.66731 272.58208 L
104.57348 272.48825 L
104.57348 272.39414 L
104.57348 272.30031 L
104.57348 272.20649 L
104.66731 272.11266 L
104.76142 272.11266 L
104.85524 272.11266 L
104.94935 272.11266 L
@c
F
@rax %Note: Object
103.44614 272.11266 104.00995 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
103.82202 272.11266 m
103.82202 272.20649 L
103.91584 272.30031 L
104.00995 272.39414 L
104.00995 272.39414 L
103.91584 272.48825 L
103.82202 272.58208 L
103.72791 272.67619 L
103.72791 272.67619 L
103.63408 272.67619 L
103.53997 272.58208 L
103.44614 272.48825 L
103.44614 272.39414 L
103.44614 272.30031 L
103.44614 272.20649 L
103.53997 272.11266 L
103.63408 272.11266 L
103.72791 272.11266 L
103.82202 272.11266 L
@c
F
@rax %Note: Object
102.31909 272.11266 102.88261 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
102.69468 272.11266 m
102.69468 272.20649 L
102.78879 272.30031 L
102.88261 272.39414 L
102.88261 272.39414 L
102.78879 272.48825 L
102.69468 272.58208 L
102.60085 272.67619 L
102.60085 272.67619 L
102.50674 272.67619 L
102.41291 272.58208 L
102.31909 272.48825 L
102.31909 272.39414 L
102.31909 272.30031 L
102.31909 272.20649 L
102.41291 272.11266 L
102.50674 272.11266 L
102.60085 272.11266 L
102.69468 272.11266 L
@c
F
@rax %Note: Object
101.19175 272.11266 101.75528 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
101.56734 272.11266 m
101.56734 272.20649 L
101.66145 272.30031 L
101.75528 272.39414 L
101.75528 272.39414 L
101.66145 272.48825 L
101.56734 272.58208 L
101.47323 272.67619 L
101.47323 272.67619 L
101.37940 272.67619 L
101.28557 272.58208 L
101.19175 272.48825 L
101.19175 272.39414 L
101.19175 272.30031 L
101.19175 272.20649 L
101.28557 272.11266 L
101.37940 272.11266 L
101.47323 272.11266 L
101.56734 272.11266 L
@c
F
@rax %Note: Object
100.06441 272.11266 100.62794 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
100.44000 272.11266 m
100.44000 272.20649 L
100.53439 272.30031 L
100.62794 272.39414 L
100.62794 272.39414 L
100.53439 272.48825 L
100.44000 272.58208 L
100.34617 272.67619 L
100.34617 272.67619 L
100.25235 272.67619 L
100.15852 272.58208 L
100.06441 272.48825 L
100.06441 272.39414 L
100.06441 272.30031 L
100.06441 272.20649 L
100.15852 272.11266 L
100.25235 272.11266 L
100.34617 272.11266 L
100.44000 272.11266 L
@c
F
@rax %Note: Object
98.93707 272.11266 99.50088 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
99.31266 272.11266 m
99.31266 272.20649 L
99.40677 272.30031 L
99.50088 272.39414 L
99.50088 272.39414 L
99.40677 272.48825 L
99.31266 272.58208 L
99.21883 272.67619 L
99.21883 272.67619 L
99.12501 272.67619 L
99.03118 272.58208 L
98.93707 272.48825 L
98.93707 272.39414 L
98.93707 272.30031 L
98.93707 272.20649 L
99.03118 272.11266 L
99.12501 272.11266 L
99.21883 272.11266 L
99.31266 272.11266 L
@c
F
@rax %Note: Object
97.80973 272.11266 98.37354 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
98.18532 272.11266 m
98.18532 272.20649 L
98.27915 272.30031 L
98.37354 272.39414 L
98.37354 272.39414 L
98.27915 272.48825 L
98.18532 272.58208 L
98.09150 272.67619 L
98.09150 272.67619 L
97.99767 272.67619 L
97.90356 272.58208 L
97.80973 272.48825 L
97.80973 272.39414 L
97.80973 272.30031 L
97.80973 272.20649 L
97.90356 272.11266 L
97.99767 272.11266 L
98.09150 272.11266 L
98.18532 272.11266 L
@c
F
@rax %Note: Object
96.68268 272.11266 97.24620 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
97.05827 272.11266 m
97.05827 272.20649 L
97.15209 272.30031 L
97.24620 272.39414 L
97.24620 272.39414 L
97.15209 272.48825 L
97.05827 272.58208 L
96.96444 272.67619 L
96.96444 272.67619 L
96.87033 272.67619 L
96.77650 272.58208 L
96.68268 272.48825 L
96.68268 272.39414 L
96.68268 272.30031 L
96.68268 272.20649 L
96.77650 272.11266 L
96.87033 272.11266 L
96.96444 272.11266 L
97.05827 272.11266 L
@c
F
@rax %Note: Object
95.55506 272.11266 96.11887 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
95.93093 272.11266 m
95.93093 272.20649 L
96.02476 272.30031 L
96.11887 272.39414 L
96.11887 272.39414 L
96.02476 272.48825 L
95.93093 272.58208 L
95.83682 272.67619 L
95.83682 272.67619 L
95.74299 272.67619 L
95.64917 272.58208 L
95.55506 272.48825 L
95.55506 272.39414 L
95.55506 272.30031 L
95.55506 272.20649 L
95.64917 272.11266 L
95.74299 272.11266 L
95.83682 272.11266 L
95.93093 272.11266 L
@c
F
@rax %Note: Object
94.42772 272.11266 94.99124 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
94.80359 272.11266 m
94.80359 272.20649 L
94.89742 272.30031 L
94.99124 272.39414 L
94.99124 272.39414 L
94.89742 272.48825 L
94.80359 272.58208 L
94.70976 272.67619 L
94.70976 272.67619 L
94.61594 272.67619 L
94.52211 272.58208 L
94.42772 272.48825 L
94.42772 272.39414 L
94.42772 272.30031 L
94.42772 272.20649 L
94.52211 272.11266 L
94.61594 272.11266 L
94.70976 272.11266 L
94.80359 272.11266 L
@c
F
@rax %Note: Object
93.30038 272.11266 93.86419 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
93.67625 272.11266 m
93.67625 272.20649 L
93.77036 272.30031 L
93.86419 272.39414 L
93.86419 272.39414 L
93.77036 272.48825 L
93.67625 272.58208 L
93.58243 272.67619 L
93.58243 272.67619 L
93.48860 272.67619 L
93.39449 272.58208 L
93.30038 272.48825 L
93.30038 272.39414 L
93.30038 272.30031 L
93.30038 272.20649 L
93.39449 272.11266 L
93.48860 272.11266 L
93.58243 272.11266 L
93.67625 272.11266 L
@c
F
@rax %Note: Object
92.17304 272.11266 92.73685 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
92.54891 272.11266 m
92.54891 272.20649 L
92.64274 272.30031 L
92.73685 272.39414 L
92.73685 272.39414 L
92.64274 272.48825 L
92.54891 272.58208 L
92.45509 272.67619 L
92.45509 272.67619 L
92.36126 272.67619 L
92.26687 272.58208 L
92.17304 272.48825 L
92.17304 272.39414 L
92.17304 272.30031 L
92.17304 272.20649 L
92.26687 272.11266 L
92.36126 272.11266 L
92.45509 272.11266 L
92.54891 272.11266 L
@c
F
@rax %Note: Object
91.04598 272.11266 91.60951 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
91.42186 272.11266 m
91.42186 272.20649 L
91.51569 272.30031 L
91.60951 272.39414 L
91.60951 272.39414 L
91.51569 272.48825 L
91.42186 272.58208 L
91.32803 272.67619 L
91.32803 272.67619 L
91.23392 272.67619 L
91.13981 272.58208 L
91.04598 272.48825 L
91.04598 272.39414 L
91.04598 272.30031 L
91.04598 272.20649 L
91.13981 272.11266 L
91.23392 272.11266 L
91.32803 272.11266 L
91.42186 272.11266 L
@c
F
@rax %Note: Object
89.91865 272.11266 90.48217 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
90.29452 272.11266 m
90.29452 272.20649 L
90.38835 272.30031 L
90.48217 272.39414 L
90.48217 272.39414 L
90.38835 272.48825 L
90.29452 272.58208 L
90.20041 272.67619 L
90.20041 272.67619 L
90.10658 272.67619 L
90.01247 272.58208 L
89.91865 272.48825 L
89.91865 272.39414 L
89.91865 272.30031 L
89.91865 272.20649 L
90.01247 272.11266 L
90.10658 272.11266 L
90.20041 272.11266 L
90.29452 272.11266 L
@c
F
@rax %Note: Object
88.79131 272.11266 89.35483 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
89.16718 272.11266 m
89.16718 272.20649 L
89.26101 272.30031 L
89.35483 272.39414 L
89.35483 272.39414 L
89.26101 272.48825 L
89.16718 272.58208 L
89.07307 272.67619 L
89.07307 272.67619 L
88.97896 272.67619 L
88.88542 272.58208 L
88.79131 272.48825 L
88.79131 272.39414 L
88.79131 272.30031 L
88.79131 272.20649 L
88.88542 272.11266 L
88.97896 272.11266 L
89.07307 272.11266 L
89.16718 272.11266 L
@c
F
@rax %Note: Object
87.66397 272.11266 88.22778 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
88.03984 272.11266 m
88.03984 272.20649 L
88.13395 272.30031 L
88.22778 272.39414 L
88.22778 272.39414 L
88.13395 272.48825 L
88.03984 272.58208 L
87.94602 272.67619 L
87.94602 272.67619 L
87.85191 272.67619 L
87.75808 272.58208 L
87.66397 272.48825 L
87.66397 272.39414 L
87.66397 272.30031 L
87.66397 272.20649 L
87.75808 272.11266 L
87.85191 272.11266 L
87.94602 272.11266 L
88.03984 272.11266 L
@c
F
@rax %Note: Object
86.53663 272.11266 87.10044 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
86.91250 272.11266 m
86.91250 272.20649 L
87.00633 272.30031 L
87.10044 272.39414 L
87.10044 272.39414 L
87.00633 272.48825 L
86.91250 272.58208 L
86.81868 272.67619 L
86.81868 272.67619 L
86.72457 272.67619 L
86.63046 272.58208 L
86.53663 272.48825 L
86.53663 272.39414 L
86.53663 272.30031 L
86.53663 272.20649 L
86.63046 272.11266 L
86.72457 272.11266 L
86.81868 272.11266 L
86.91250 272.11266 L
@c
F
@rax %Note: Object
85.40957 272.11266 85.97310 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
85.78545 272.11266 m
85.78545 272.20649 L
85.87928 272.30031 L
85.97310 272.39414 L
85.97310 272.39414 L
85.87928 272.48825 L
85.78545 272.58208 L
85.69134 272.67619 L
85.69134 272.67619 L
85.59723 272.67619 L
85.50340 272.58208 L
85.40957 272.48825 L
85.40957 272.39414 L
85.40957 272.30031 L
85.40957 272.20649 L
85.50340 272.11266 L
85.59723 272.11266 L
85.69134 272.11266 L
85.78545 272.11266 L
@c
F
@rax %Note: Object
84.28224 272.11266 84.84576 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
84.65811 272.11266 m
84.65811 272.20649 L
84.75194 272.30031 L
84.84576 272.39414 L
84.84576 272.39414 L
84.75194 272.48825 L
84.65811 272.58208 L
84.56400 272.67619 L
84.56400 272.67619 L
84.46989 272.67619 L
84.37606 272.58208 L
84.28224 272.48825 L
84.28224 272.39414 L
84.28224 272.30031 L
84.28224 272.20649 L
84.37606 272.11266 L
84.46989 272.11266 L
84.56400 272.11266 L
84.65811 272.11266 L
@c
F
@rax %Note: Object
83.15490 272.11266 83.71843 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.53077 272.11266 m
83.53077 272.20649 L
83.62460 272.30031 L
83.71843 272.39414 L
83.71843 272.39414 L
83.62460 272.48825 L
83.53077 272.58208 L
83.43638 272.67619 L
83.43638 272.67619 L
83.34255 272.67619 L
83.24872 272.58208 L
83.15490 272.48825 L
83.15490 272.39414 L
83.15490 272.30031 L
83.15490 272.20649 L
83.24872 272.11266 L
83.34255 272.11266 L
83.43638 272.11266 L
83.53077 272.11266 L
@c
F
@rax %Note: Object
82.02756 272.11266 82.59137 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
82.40315 272.11266 m
82.40315 272.20649 L
82.49754 272.30031 L
82.59137 272.39414 L
82.59137 272.39414 L
82.49754 272.48825 L
82.40315 272.58208 L
82.30932 272.67619 L
82.30932 272.67619 L
82.21550 272.67619 L
82.12167 272.58208 L
82.02756 272.48825 L
82.02756 272.39414 L
82.02756 272.30031 L
82.02756 272.20649 L
82.12167 272.11266 L
82.21550 272.11266 L
82.30932 272.11266 L
82.40315 272.11266 L
@c
F
@rax %Note: Object
80.90022 272.11266 81.46403 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
81.27581 272.11266 m
81.27581 272.20649 L
81.36992 272.30031 L
81.46403 272.39414 L
81.46403 272.39414 L
81.36992 272.48825 L
81.27581 272.58208 L
81.18198 272.67619 L
81.18198 272.67619 L
81.08816 272.67619 L
80.99405 272.58208 L
80.90022 272.48825 L
80.90022 272.39414 L
80.90022 272.30031 L
80.90022 272.20649 L
80.99405 272.11266 L
81.08816 272.11266 L
81.18198 272.11266 L
81.27581 272.11266 L
@c
F
@rax %Note: Object
79.77317 272.11266 80.33669 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
80.14876 272.11266 m
80.14876 272.20649 L
80.24258 272.30031 L
80.33669 272.39414 L
80.33669 272.39414 L
80.24258 272.48825 L
80.14876 272.58208 L
80.05493 272.67619 L
80.05493 272.67619 L
79.96082 272.67619 L
79.86699 272.58208 L
79.77317 272.48825 L
79.77317 272.39414 L
79.77317 272.30031 L
79.77317 272.20649 L
79.86699 272.11266 L
79.96082 272.11266 L
80.05493 272.11266 L
80.14876 272.11266 L
@c
F
@rax %Note: Object
78.64583 272.11266 79.20935 272.67619 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
79.20935 272.30031 m
79.20935 272.39414 L
79.11524 272.48825 L
79.02142 272.58208 L
78.92759 272.67619 L
78.92759 272.67619 L
78.83348 272.58208 L
78.73965 272.48825 L
78.64583 272.39414 L
78.64583 272.39414 L
78.64583 272.39414 L
78.73965 272.30031 L
78.83348 272.20649 L
78.92759 272.11266 L
78.92759 272.11266 L
79.02142 272.20649 L
79.11524 272.30031 L
79.20935 272.30031 L
@c
F
@rax %Note: Object
78.64583 270.98504 79.20935 271.54885 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
79.20935 271.17298 m
79.20935 271.26680 L
79.11524 271.36091 L
79.02142 271.45474 L
78.92759 271.54885 L
78.92759 271.54885 L
78.83348 271.45474 L
78.73965 271.36091 L
78.64583 271.26680 L
78.64583 271.26680 L
78.64583 271.26680 L
78.73965 271.17298 L
78.83348 271.07915 L
78.92759 270.98504 L
78.92759 270.98504 L
79.02142 271.07915 L
79.11524 271.17298 L
79.20935 271.17298 L
@c
F
@rax %Note: Object
78.64583 269.85770 79.20935 270.42123 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
79.20935 270.04564 m
79.20935 270.13946 L
79.11524 270.23329 L
79.02142 270.32740 L
78.92759 270.42123 L
78.92759 270.42123 L
78.83348 270.32740 L
78.73965 270.23329 L
78.64583 270.13946 L
78.64583 270.13946 L
78.64583 270.13946 L
78.73965 270.04564 L
78.83348 269.95181 L
78.92759 269.85770 L
78.92759 269.85770 L
79.02142 269.95181 L
79.11524 270.04564 L
79.20935 270.04564 L
@c
F
@rax %Note: Object
78.64583 268.73036 79.20935 269.29417 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
79.20935 268.91858 m
79.20935 269.01241 L
79.11524 269.10624 L
79.02142 269.20006 L
78.92759 269.29417 L
78.92759 269.29417 L
78.83348 269.20006 L
78.73965 269.10624 L
78.64583 269.01241 L
78.64583 269.01241 L
78.64583 269.01241 L
78.73965 268.91858 L
78.83348 268.82447 L
78.92759 268.73036 L
78.92759 268.73036 L
79.02142 268.82447 L
79.11524 268.91858 L
79.20935 268.91858 L
@c
F
@rax %Note: Object
78.64583 267.60302 79.20935 268.16683 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
79.20935 267.79096 m
79.20935 267.88507 L
79.11524 267.97890 L
79.02142 268.07272 L
78.92759 268.16683 L
78.92759 268.16683 L
78.83348 268.07272 L
78.73965 267.97890 L
78.64583 267.88507 L
78.64583 267.88507 L
78.64583 267.88507 L
78.73965 267.79096 L
78.83348 267.69713 L
78.92759 267.60302 L
78.92759 267.60302 L
79.02142 267.69713 L
79.11524 267.79096 L
79.20935 267.79096 L
@c
F
@rax %Note: Object
78.64583 266.47597 79.20935 267.03950 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
79.20935 266.66391 m
79.20935 266.75773 L
79.11524 266.85184 L
79.02142 266.94567 L
78.92759 267.03950 L
78.92759 267.03950 L
78.83348 266.94567 L
78.73965 266.85184 L
78.64583 266.75773 L
78.64583 266.75773 L
78.64583 266.75773 L
78.73965 266.66391 L
78.83348 266.56980 L
78.92759 266.47597 L
78.92759 266.47597 L
79.02142 266.56980 L
79.11524 266.66391 L
79.20935 266.66391 L
@c
F
@rax %Note: Object
78.64583 265.34863 79.20935 265.91216 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
79.20935 265.53657 m
79.20935 265.63039 L
79.11524 265.72450 L
79.02142 265.81833 L
78.92759 265.91216 L
78.92759 265.91216 L
78.83348 265.81833 L
78.73965 265.72450 L
78.64583 265.63039 L
78.64583 265.63039 L
78.64583 265.63039 L
78.73965 265.53657 L
78.83348 265.44246 L
78.92759 265.34863 L
78.92759 265.34863 L
79.02142 265.44246 L
79.11524 265.53657 L
79.20935 265.53657 L
@c
F
@rax %Note: Object
78.64583 264.22101 79.20935 264.78482 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
79.20935 264.40894 m
79.20935 264.50306 L
79.11524 264.59688 L
79.02142 264.69099 L
78.92759 264.78482 L
78.92759 264.78482 L
78.83348 264.69099 L
78.73965 264.59688 L
78.64583 264.50306 L
78.64583 264.50306 L
78.64583 264.50306 L
78.73965 264.40894 L
78.83348 264.31512 L
78.92759 264.22101 L
78.92759 264.22101 L
79.02142 264.31512 L
79.11524 264.40894 L
79.20935 264.40894 L
@c
F
@rax %Note: Object
78.64583 263.09395 79.20935 263.65776 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
79.20935 263.28189 m
79.20935 263.37600 L
79.11524 263.46983 L
79.02142 263.56365 L
78.92759 263.65776 L
78.92759 263.65776 L
78.83348 263.56365 L
78.73965 263.46983 L
78.64583 263.37600 L
78.64583 263.37600 L
78.64583 263.37600 L
78.73965 263.28189 L
78.83348 263.18778 L
78.92759 263.09395 L
78.92759 263.09395 L
79.02142 263.18778 L
79.11524 263.28189 L
79.20935 263.28189 L
@c
F
@rax %Note: Object
78.64583 261.96661 79.20935 262.53043 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
79.20935 262.15427 m
79.20935 262.24866 L
79.11524 262.34249 L
79.02142 262.43631 L
78.92759 262.53043 L
78.92759 262.53043 L
78.83348 262.43631 L
78.73965 262.34249 L
78.64583 262.24866 L
78.64583 262.24866 L
78.64583 262.24866 L
78.73965 262.15427 L
78.83348 262.06044 L
78.92759 261.96661 L
78.92759 261.96661 L
79.02142 262.06044 L
79.11524 262.15427 L
79.20935 262.15427 L
@c
F
@rax %Note: Object
78.64583 260.83956 79.20935 261.40280 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
79.20935 261.02721 m
79.20935 261.12104 L
79.11524 261.21543 L
79.02142 261.30926 L
78.92759 261.40280 L
78.92759 261.40280 L
78.83348 261.30926 L
78.73965 261.21543 L
78.64583 261.12104 L
78.64583 261.12104 L
78.64583 261.12104 L
78.73965 261.02721 L
78.83348 260.93339 L
78.92759 260.83956 L
78.92759 260.83956 L
79.02142 260.93339 L
79.11524 261.02721 L
79.20935 261.02721 L
@c
F
@rax %Note: Object
78.64583 259.71222 79.20935 260.27575 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
79.20935 259.89987 m
79.20935 259.99370 L
79.11524 260.08809 L
79.02142 260.18192 L
78.92759 260.27575 L
78.92759 260.27575 L
78.83348 260.18192 L
78.73965 260.08809 L
78.64583 259.99370 L
78.64583 259.99370 L
78.64583 259.99370 L
78.73965 259.89987 L
78.83348 259.80605 L
78.92759 259.71222 L
78.92759 259.71222 L
79.02142 259.80605 L
79.11524 259.89987 L
79.20935 259.89987 L
@c
F
@rax %Note: Object
78.64583 258.58460 79.20935 259.14841 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
79.20935 258.77254 m
79.20935 258.86636 L
79.11524 258.96047 L
79.02142 259.05458 L
78.92759 259.14841 L
78.92759 259.14841 L
78.83348 259.05458 L
78.73965 258.96047 L
78.64583 258.86636 L
78.64583 258.86636 L
78.64583 258.86636 L
78.73965 258.77254 L
78.83348 258.67871 L
78.92759 258.58460 L
78.92759 258.58460 L
79.02142 258.67871 L
79.11524 258.77254 L
79.20935 258.77254 L
@c
F
@rax %Note: Object
78.64583 257.45754 79.20935 258.02135 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
79.20935 257.64548 m
79.20935 257.73931 L
79.11524 257.83313 L
79.02142 257.92724 L
78.92759 258.02135 L
78.92759 258.02135 L
78.83348 257.92724 L
78.73965 257.83313 L
78.64583 257.73931 L
78.64583 257.73931 L
78.64583 257.73931 L
78.73965 257.64548 L
78.83348 257.55137 L
78.92759 257.45754 L
78.92759 257.45754 L
79.02142 257.55137 L
79.11524 257.64548 L
79.20935 257.64548 L
@c
F
@rax %Note: Object
78.64583 256.33020 79.20935 256.89402 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
79.20935 256.51786 m
79.20935 256.61197 L
79.11524 256.70580 L
79.02142 256.79991 L
78.92759 256.89402 L
78.92759 256.89402 L
78.83348 256.79991 L
78.73965 256.70580 L
78.64583 256.61197 L
78.64583 256.61197 L
78.64583 256.61197 L
78.73965 256.51786 L
78.83348 256.42403 L
78.92759 256.33020 L
78.92759 256.33020 L
79.02142 256.42403 L
79.11524 256.51786 L
79.20935 256.51786 L
@c
F
@rax %Note: Object
78.64583 255.20315 79.20935 255.76639 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
79.20935 255.39080 m
79.20935 255.48463 L
79.11524 255.57846 L
79.02142 255.67257 L
78.92759 255.76639 L
78.92759 255.76639 L
78.83348 255.67257 L
78.73965 255.57846 L
78.64583 255.48463 L
78.64583 255.48463 L
78.64583 255.48463 L
78.73965 255.39080 L
78.83348 255.29698 L
78.92759 255.20315 L
78.92759 255.20315 L
79.02142 255.29698 L
79.11524 255.39080 L
79.20935 255.39080 L
@c
F
@rax %Note: Object
176.81471 269.38828 182.63877 275.30646 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
176.81471 269.38828 m
182.63877 272.39414 L
176.81471 275.30646 L
176.81471 269.38828 L
@c
F
@rax %Note: Object
173.33858 366.80542 173.90239 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
173.71446 366.80542 m
173.71446 366.89953 L
173.80828 366.99364 L
173.90239 367.08746 L
173.90239 367.08746 L
173.80828 367.18129 L
173.71446 367.27512 L
173.62063 367.36923 L
173.62063 367.36923 L
173.52680 367.36923 L
173.43269 367.27512 L
173.33858 367.18129 L
173.33858 367.08746 L
173.33858 366.99364 L
173.33858 366.89953 L
173.43269 366.80542 L
173.52680 366.80542 L
173.62063 366.80542 L
173.71446 366.80542 L
@c
F
@rax %Note: Object
172.21153 366.80542 172.77506 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
172.58740 366.80542 m
172.58740 366.89953 L
172.68123 366.99364 L
172.77506 367.08746 L
172.77506 367.08746 L
172.68123 367.18129 L
172.58740 367.27512 L
172.49357 367.36923 L
172.49357 367.36923 L
172.39946 367.36923 L
172.30564 367.27512 L
172.21153 367.18129 L
172.21153 367.08746 L
172.21153 366.99364 L
172.21153 366.89953 L
172.30564 366.80542 L
172.39946 366.80542 L
172.49357 366.80542 L
172.58740 366.80542 L
@c
F
@rax %Note: Object
171.08419 366.80542 171.64772 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
171.46006 366.80542 m
171.46006 366.89953 L
171.55389 366.99364 L
171.64772 367.08746 L
171.64772 367.08746 L
171.55389 367.18129 L
171.46006 367.27512 L
171.36624 367.36923 L
171.36624 367.36923 L
171.27213 367.36923 L
171.17802 367.27512 L
171.08419 367.18129 L
171.08419 367.08746 L
171.08419 366.99364 L
171.08419 366.89953 L
171.17802 366.80542 L
171.27213 366.80542 L
171.36624 366.80542 L
171.46006 366.80542 L
@c
F
@rax %Note: Object
169.95685 366.80542 170.52038 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
170.33272 366.80542 m
170.33272 366.89953 L
170.42655 366.99364 L
170.52038 367.08746 L
170.52038 367.08746 L
170.42655 367.18129 L
170.33272 367.27512 L
170.23861 367.36923 L
170.23861 367.36923 L
170.14507 367.36923 L
170.05096 367.27512 L
169.95685 367.18129 L
169.95685 367.08746 L
169.95685 366.99364 L
169.95685 366.89953 L
170.05096 366.80542 L
170.14507 366.80542 L
170.23861 366.80542 L
170.33272 366.80542 L
@c
F
@rax %Note: Object
168.82951 366.80542 169.39332 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
169.20539 366.80542 m
169.20539 366.89953 L
169.29950 366.99364 L
169.39332 367.08746 L
169.39332 367.08746 L
169.29950 367.18129 L
169.20539 367.27512 L
169.11156 367.36923 L
169.11156 367.36923 L
169.01773 367.36923 L
168.92362 367.27512 L
168.82951 367.18129 L
168.82951 367.08746 L
168.82951 366.99364 L
168.82951 366.89953 L
168.92362 366.80542 L
169.01773 366.80542 L
169.11156 366.80542 L
169.20539 366.80542 L
@c
F
@rax %Note: Object
167.70217 366.80542 168.26598 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
168.07805 366.80542 m
168.07805 366.89953 L
168.17187 366.99364 L
168.26598 367.08746 L
168.26598 367.08746 L
168.17187 367.18129 L
168.07805 367.27512 L
167.98422 367.36923 L
167.98422 367.36923 L
167.89011 367.36923 L
167.79600 367.27512 L
167.70217 367.18129 L
167.70217 367.08746 L
167.70217 366.99364 L
167.70217 366.89953 L
167.79600 366.80542 L
167.89011 366.80542 L
167.98422 366.80542 L
168.07805 366.80542 L
@c
F
@rax %Note: Object
166.57512 366.80542 167.13865 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
166.95099 366.80542 m
166.95099 366.89953 L
167.04482 366.99364 L
167.13865 367.08746 L
167.13865 367.08746 L
167.04482 367.18129 L
166.95099 367.27512 L
166.85717 367.36923 L
166.85717 367.36923 L
166.76277 367.36923 L
166.66894 367.27512 L
166.57512 367.18129 L
166.57512 367.08746 L
166.57512 366.99364 L
166.57512 366.89953 L
166.66894 366.80542 L
166.76277 366.80542 L
166.85717 366.80542 L
166.95099 366.80542 L
@c
F
@rax %Note: Object
165.44778 366.80542 166.01131 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
165.82365 366.80542 m
165.82365 366.89953 L
165.91748 366.99364 L
166.01131 367.08746 L
166.01131 367.08746 L
165.91748 367.18129 L
165.82365 367.27512 L
165.72983 367.36923 L
165.72983 367.36923 L
165.63543 367.36923 L
165.54161 367.27512 L
165.44778 367.18129 L
165.44778 367.08746 L
165.44778 366.99364 L
165.44778 366.89953 L
165.54161 366.80542 L
165.63543 366.80542 L
165.72983 366.80542 L
165.82365 366.80542 L
@c
F
@rax %Note: Object
164.32044 366.80542 164.88397 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
164.69631 366.80542 m
164.69631 366.89953 L
164.79014 366.99364 L
164.88397 367.08746 L
164.88397 367.08746 L
164.79014 367.18129 L
164.69631 367.27512 L
164.60220 367.36923 L
164.60220 367.36923 L
164.50809 367.36923 L
164.41455 367.27512 L
164.32044 367.18129 L
164.32044 367.08746 L
164.32044 366.99364 L
164.32044 366.89953 L
164.41455 366.80542 L
164.50809 366.80542 L
164.60220 366.80542 L
164.69631 366.80542 L
@c
F
@rax %Note: Object
163.19310 366.80542 163.75691 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
163.56898 366.80542 m
163.56898 366.89953 L
163.66309 366.99364 L
163.75691 367.08746 L
163.75691 367.08746 L
163.66309 367.18129 L
163.56898 367.27512 L
163.47487 367.36923 L
163.47487 367.36923 L
163.38104 367.36923 L
163.28721 367.27512 L
163.19310 367.18129 L
163.19310 367.08746 L
163.19310 366.99364 L
163.19310 366.89953 L
163.28721 366.80542 L
163.38104 366.80542 L
163.47487 366.80542 L
163.56898 366.80542 L
@c
F
@rax %Note: Object
162.06576 366.80542 162.62957 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
162.44164 366.80542 m
162.44164 366.89953 L
162.53546 366.99364 L
162.62957 367.08746 L
162.62957 367.08746 L
162.53546 367.18129 L
162.44164 367.27512 L
162.34753 367.36923 L
162.34753 367.36923 L
162.25370 367.36923 L
162.15959 367.27512 L
162.06576 367.18129 L
162.06576 367.08746 L
162.06576 366.99364 L
162.06576 366.89953 L
162.15959 366.80542 L
162.25370 366.80542 L
162.34753 366.80542 L
162.44164 366.80542 L
@c
F
@rax %Note: Object
160.93871 366.80542 161.50224 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
161.31430 366.80542 m
161.31430 366.89953 L
161.40841 366.99364 L
161.50224 367.08746 L
161.50224 367.08746 L
161.40841 367.18129 L
161.31430 367.27512 L
161.22047 367.36923 L
161.22047 367.36923 L
161.12636 367.36923 L
161.03254 367.27512 L
160.93871 367.18129 L
160.93871 367.08746 L
160.93871 366.99364 L
160.93871 366.89953 L
161.03254 366.80542 L
161.12636 366.80542 L
161.22047 366.80542 L
161.31430 366.80542 L
@c
F
@rax %Note: Object
159.81137 366.80542 160.37490 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
160.18696 366.80542 m
160.18696 366.89953 L
160.28107 366.99364 L
160.37490 367.08746 L
160.37490 367.08746 L
160.28107 367.18129 L
160.18696 367.27512 L
160.09313 367.36923 L
160.09313 367.36923 L
159.99902 367.36923 L
159.90520 367.27512 L
159.81137 367.18129 L
159.81137 367.08746 L
159.81137 366.99364 L
159.81137 366.89953 L
159.90520 366.80542 L
159.99902 366.80542 L
160.09313 366.80542 L
160.18696 366.80542 L
@c
F
@rax %Note: Object
158.68403 366.80542 159.24756 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
159.05962 366.80542 m
159.05962 366.89953 L
159.15373 366.99364 L
159.24756 367.08746 L
159.24756 367.08746 L
159.15373 367.18129 L
159.05962 367.27512 L
158.96551 367.36923 L
158.96551 367.36923 L
158.87169 367.36923 L
158.77786 367.27512 L
158.68403 367.18129 L
158.68403 367.08746 L
158.68403 366.99364 L
158.68403 366.89953 L
158.77786 366.80542 L
158.87169 366.80542 L
158.96551 366.80542 L
159.05962 366.80542 L
@c
F
@rax %Note: Object
157.55669 366.80542 158.12050 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
157.93228 366.80542 m
157.93228 366.89953 L
158.02639 366.99364 L
158.12050 367.08746 L
158.12050 367.08746 L
158.02639 367.18129 L
157.93228 367.27512 L
157.83846 367.36923 L
157.83846 367.36923 L
157.74463 367.36923 L
157.65080 367.27512 L
157.55669 367.18129 L
157.55669 367.08746 L
157.55669 366.99364 L
157.55669 366.89953 L
157.65080 366.80542 L
157.74463 366.80542 L
157.83846 366.80542 L
157.93228 366.80542 L
@c
F
@rax %Note: Object
156.42935 366.80542 156.99317 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
156.80494 366.80542 m
156.80494 366.89953 L
156.89906 366.99364 L
156.99317 367.08746 L
156.99317 367.08746 L
156.89906 367.18129 L
156.80494 367.27512 L
156.71112 367.36923 L
156.71112 367.36923 L
156.61729 367.36923 L
156.52318 367.27512 L
156.42935 367.18129 L
156.42935 367.08746 L
156.42935 366.99364 L
156.42935 366.89953 L
156.52318 366.80542 L
156.61729 366.80542 L
156.71112 366.80542 L
156.80494 366.80542 L
@c
F
@rax %Note: Object
155.30202 366.80542 155.86583 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
155.67789 366.80542 m
155.67789 366.89953 L
155.77143 366.99364 L
155.86583 367.08746 L
155.86583 367.08746 L
155.77143 367.18129 L
155.67789 367.27512 L
155.58406 367.36923 L
155.58406 367.36923 L
155.48995 367.36923 L
155.39613 367.27512 L
155.30202 367.18129 L
155.30202 367.08746 L
155.30202 366.99364 L
155.30202 366.89953 L
155.39613 366.80542 L
155.48995 366.80542 L
155.58406 366.80542 L
155.67789 366.80542 L
@c
F
@rax %Note: Object
154.17468 366.80542 154.73820 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
154.55055 366.80542 m
154.55055 366.89953 L
154.64438 366.99364 L
154.73820 367.08746 L
154.73820 367.08746 L
154.64438 367.18129 L
154.55055 367.27512 L
154.45672 367.36923 L
154.45672 367.36923 L
154.36261 367.36923 L
154.26879 367.27512 L
154.17468 367.18129 L
154.17468 367.08746 L
154.17468 366.99364 L
154.17468 366.89953 L
154.26879 366.80542 L
154.36261 366.80542 L
154.45672 366.80542 L
154.55055 366.80542 L
@c
F
@rax %Note: Object
153.04734 366.80542 153.61087 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
153.42321 366.80542 m
153.42321 366.89953 L
153.51704 366.99364 L
153.61087 367.08746 L
153.61087 367.08746 L
153.51704 367.18129 L
153.42321 367.27512 L
153.32910 367.36923 L
153.32910 367.36923 L
153.23528 367.36923 L
153.14145 367.27512 L
153.04734 367.18129 L
153.04734 367.08746 L
153.04734 366.99364 L
153.04734 366.89953 L
153.14145 366.80542 L
153.23528 366.80542 L
153.32910 366.80542 L
153.42321 366.80542 L
@c
F
@rax %Note: Object
151.92000 366.80542 152.48381 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
152.29587 366.80542 m
152.29587 366.89953 L
152.38998 366.99364 L
152.48381 367.08746 L
152.48381 367.08746 L
152.38998 367.18129 L
152.29587 367.27512 L
152.20205 367.36923 L
152.20205 367.36923 L
152.10822 367.36923 L
152.01411 367.27512 L
151.92000 367.18129 L
151.92000 367.08746 L
151.92000 366.99364 L
151.92000 366.89953 L
152.01411 366.80542 L
152.10822 366.80542 L
152.20205 366.80542 L
152.29587 366.80542 L
@c
F
@rax %Note: Object
150.79266 366.80542 151.35647 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
151.16854 366.80542 m
151.16854 366.89953 L
151.26265 366.99364 L
151.35647 367.08746 L
151.35647 367.08746 L
151.26265 367.18129 L
151.16854 367.27512 L
151.07471 367.36923 L
151.07471 367.36923 L
150.98088 367.36923 L
150.88649 367.27512 L
150.79266 367.18129 L
150.79266 367.08746 L
150.79266 366.99364 L
150.79266 366.89953 L
150.88649 366.80542 L
150.98088 366.80542 L
151.07471 366.80542 L
151.16854 366.80542 L
@c
F
@rax %Note: Object
149.66561 366.80542 150.22913 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
150.04120 366.80542 m
150.04120 366.89953 L
150.13502 366.99364 L
150.22913 367.08746 L
150.22913 367.08746 L
150.13502 367.18129 L
150.04120 367.27512 L
149.94737 367.36923 L
149.94737 367.36923 L
149.85354 367.36923 L
149.75943 367.27512 L
149.66561 367.18129 L
149.66561 367.08746 L
149.66561 366.99364 L
149.66561 366.89953 L
149.75943 366.80542 L
149.85354 366.80542 L
149.94737 366.80542 L
150.04120 366.80542 L
@c
F
@rax %Note: Object
148.53827 366.80542 149.10180 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
148.91414 366.80542 m
148.91414 366.89953 L
149.00797 366.99364 L
149.10180 367.08746 L
149.10180 367.08746 L
149.00797 367.18129 L
148.91414 367.27512 L
148.82031 367.36923 L
148.82031 367.36923 L
148.72620 367.36923 L
148.63209 367.27512 L
148.53827 367.18129 L
148.53827 367.08746 L
148.53827 366.99364 L
148.53827 366.89953 L
148.63209 366.80542 L
148.72620 366.80542 L
148.82031 366.80542 L
148.91414 366.80542 L
@c
F
@rax %Note: Object
147.41093 366.80542 147.97446 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
147.78680 366.80542 m
147.78680 366.89953 L
147.88063 366.99364 L
147.97446 367.08746 L
147.97446 367.08746 L
147.88063 367.18129 L
147.78680 367.27512 L
147.69269 367.36923 L
147.69269 367.36923 L
147.59858 367.36923 L
147.50476 367.27512 L
147.41093 367.18129 L
147.41093 367.08746 L
147.41093 366.99364 L
147.41093 366.89953 L
147.50476 366.80542 L
147.59858 366.80542 L
147.69269 366.80542 L
147.78680 366.80542 L
@c
F
@rax %Note: Object
146.28359 366.80542 146.84740 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
146.65946 366.80542 m
146.65946 366.89953 L
146.75357 366.99364 L
146.84740 367.08746 L
146.84740 367.08746 L
146.75357 367.18129 L
146.65946 367.27512 L
146.56564 367.36923 L
146.56564 367.36923 L
146.47153 367.36923 L
146.37770 367.27512 L
146.28359 367.18129 L
146.28359 367.08746 L
146.28359 366.99364 L
146.28359 366.89953 L
146.37770 366.80542 L
146.47153 366.80542 L
146.56564 366.80542 L
146.65946 366.80542 L
@c
F
@rax %Note: Object
145.15625 366.80542 145.72006 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
145.53213 366.80542 m
145.53213 366.89953 L
145.62624 366.99364 L
145.72006 367.08746 L
145.72006 367.08746 L
145.62624 367.18129 L
145.53213 367.27512 L
145.43830 367.36923 L
145.43830 367.36923 L
145.34419 367.36923 L
145.25008 367.27512 L
145.15625 367.18129 L
145.15625 367.08746 L
145.15625 366.99364 L
145.15625 366.89953 L
145.25008 366.80542 L
145.34419 366.80542 L
145.43830 366.80542 L
145.53213 366.80542 L
@c
F
@rax %Note: Object
144.02920 366.80542 144.59272 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
144.40479 366.80542 m
144.40479 366.89953 L
144.49861 366.99364 L
144.59272 367.08746 L
144.59272 367.08746 L
144.49861 367.18129 L
144.40479 367.27512 L
144.31068 367.36923 L
144.31068 367.36923 L
144.21685 367.36923 L
144.12274 367.27512 L
144.02920 367.18129 L
144.02920 367.08746 L
144.02920 366.99364 L
144.02920 366.89953 L
144.12274 366.80542 L
144.21685 366.80542 L
144.31068 366.80542 L
144.40479 366.80542 L
@c
F
@rax %Note: Object
142.90186 366.80542 143.46539 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
143.27773 366.80542 m
143.27773 366.89953 L
143.37156 366.99364 L
143.46539 367.08746 L
143.46539 367.08746 L
143.37156 367.18129 L
143.27773 367.27512 L
143.18362 367.36923 L
143.18362 367.36923 L
143.08951 367.36923 L
142.99569 367.27512 L
142.90186 367.18129 L
142.90186 367.08746 L
142.90186 366.99364 L
142.90186 366.89953 L
142.99569 366.80542 L
143.08951 366.80542 L
143.18362 366.80542 L
143.27773 366.80542 L
@c
F
@rax %Note: Object
141.77452 366.80542 142.33805 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
142.15011 366.80542 m
142.15011 366.89953 L
142.24422 366.99364 L
142.33805 367.08746 L
142.33805 367.08746 L
142.24422 367.18129 L
142.15011 367.27512 L
142.05600 367.36923 L
142.05600 367.36923 L
141.96217 367.36923 L
141.86835 367.27512 L
141.77452 367.18129 L
141.77452 367.08746 L
141.77452 366.99364 L
141.77452 366.89953 L
141.86835 366.80542 L
141.96217 366.80542 L
142.05600 366.80542 L
142.15011 366.80542 L
@c
F
@rax %Note: Object
140.64718 366.80542 141.21071 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
141.02277 366.80542 m
141.02277 366.89953 L
141.11717 366.99364 L
141.21071 367.08746 L
141.21071 367.08746 L
141.11717 367.18129 L
141.02277 367.27512 L
140.92894 367.36923 L
140.92894 367.36923 L
140.83512 367.36923 L
140.74129 367.27512 L
140.64718 367.18129 L
140.64718 367.08746 L
140.64718 366.99364 L
140.64718 366.89953 L
140.74129 366.80542 L
140.83512 366.80542 L
140.92894 366.80542 L
141.02277 366.80542 L
@c
F
@rax %Note: Object
139.51984 366.80542 140.08365 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
139.89543 366.80542 m
139.89543 366.89953 L
139.98983 366.99364 L
140.08365 367.08746 L
140.08365 367.08746 L
139.98983 367.18129 L
139.89543 367.27512 L
139.80161 367.36923 L
139.80161 367.36923 L
139.70778 367.36923 L
139.61395 367.27512 L
139.51984 367.18129 L
139.51984 367.08746 L
139.51984 366.99364 L
139.51984 366.89953 L
139.61395 366.80542 L
139.70778 366.80542 L
139.80161 366.80542 L
139.89543 366.80542 L
@c
F
@rax %Note: Object
138.39250 366.80542 138.95631 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
138.76809 366.80542 m
138.76809 366.89953 L
138.86220 366.99364 L
138.95631 367.08746 L
138.95631 367.08746 L
138.86220 367.18129 L
138.76809 367.27512 L
138.67427 367.36923 L
138.67427 367.36923 L
138.58044 367.36923 L
138.48633 367.27512 L
138.39250 367.18129 L
138.39250 367.08746 L
138.39250 366.99364 L
138.39250 366.89953 L
138.48633 366.80542 L
138.58044 366.80542 L
138.67427 366.80542 L
138.76809 366.80542 L
@c
F
@rax %Note: Object
137.26545 366.80542 137.82898 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
137.64104 366.80542 m
137.64104 366.89953 L
137.73487 366.99364 L
137.82898 367.08746 L
137.82898 367.08746 L
137.73487 367.18129 L
137.64104 367.27512 L
137.54721 367.36923 L
137.54721 367.36923 L
137.45310 367.36923 L
137.35928 367.27512 L
137.26545 367.18129 L
137.26545 367.08746 L
137.26545 366.99364 L
137.26545 366.89953 L
137.35928 366.80542 L
137.45310 366.80542 L
137.54721 366.80542 L
137.64104 366.80542 L
@c
F
@rax %Note: Object
136.13811 366.80542 136.70164 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
136.51370 366.80542 m
136.51370 366.89953 L
136.60753 366.99364 L
136.70164 367.08746 L
136.70164 367.08746 L
136.60753 367.18129 L
136.51370 367.27512 L
136.41959 367.36923 L
136.41959 367.36923 L
136.32576 367.36923 L
136.23194 367.27512 L
136.13811 367.18129 L
136.13811 367.08746 L
136.13811 366.99364 L
136.13811 366.89953 L
136.23194 366.80542 L
136.32576 366.80542 L
136.41959 366.80542 L
136.51370 366.80542 L
@c
F
@rax %Note: Object
135.01049 366.80542 135.57430 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
135.38636 366.80542 m
135.38636 366.89953 L
135.48019 366.99364 L
135.57430 367.08746 L
135.57430 367.08746 L
135.48019 367.18129 L
135.38636 367.27512 L
135.29254 367.36923 L
135.29254 367.36923 L
135.19871 367.36923 L
135.10488 367.27512 L
135.01049 367.18129 L
135.01049 367.08746 L
135.01049 366.99364 L
135.01049 366.89953 L
135.10488 366.80542 L
135.19871 366.80542 L
135.29254 366.80542 L
135.38636 366.80542 L
@c
F
@rax %Note: Object
133.88315 366.80542 134.44696 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
134.25902 366.80542 m
134.25902 366.89953 L
134.35313 366.99364 L
134.44696 367.08746 L
134.44696 367.08746 L
134.35313 367.18129 L
134.25902 367.27512 L
134.16520 367.36923 L
134.16520 367.36923 L
134.07137 367.36923 L
133.97754 367.27512 L
133.88315 367.18129 L
133.88315 367.08746 L
133.88315 366.99364 L
133.88315 366.89953 L
133.97754 366.80542 L
134.07137 366.80542 L
134.16520 366.80542 L
134.25902 366.80542 L
@c
F
@rax %Note: Object
132.75581 366.80542 133.31962 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
133.13169 366.80542 m
133.13169 366.89953 L
133.22551 366.99364 L
133.31962 367.08746 L
133.31962 367.08746 L
133.22551 367.18129 L
133.13169 367.27512 L
133.03786 367.36923 L
133.03786 367.36923 L
132.94403 367.36923 L
132.84992 367.27512 L
132.75581 367.18129 L
132.75581 367.08746 L
132.75581 366.99364 L
132.75581 366.89953 L
132.84992 366.80542 L
132.94403 366.80542 L
133.03786 366.80542 L
133.13169 366.80542 L
@c
F
@rax %Note: Object
131.62876 366.80542 132.19228 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
132.00463 366.80542 m
132.00463 366.89953 L
132.09846 366.99364 L
132.19228 367.08746 L
132.19228 367.08746 L
132.09846 367.18129 L
132.00463 367.27512 L
131.91080 367.36923 L
131.91080 367.36923 L
131.81669 367.36923 L
131.72258 367.27512 L
131.62876 367.18129 L
131.62876 367.08746 L
131.62876 366.99364 L
131.62876 366.89953 L
131.72258 366.80542 L
131.81669 366.80542 L
131.91080 366.80542 L
132.00463 366.80542 L
@c
F
@rax %Note: Object
130.50142 366.80542 131.06494 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
130.87729 366.80542 m
130.87729 366.89953 L
130.97112 366.99364 L
131.06494 367.08746 L
131.06494 367.08746 L
130.97112 367.18129 L
130.87729 367.27512 L
130.78318 367.36923 L
130.78318 367.36923 L
130.68935 367.36923 L
130.59524 367.27512 L
130.50142 367.18129 L
130.50142 367.08746 L
130.50142 366.99364 L
130.50142 366.89953 L
130.59524 366.80542 L
130.68935 366.80542 L
130.78318 366.80542 L
130.87729 366.80542 L
@c
F
@rax %Note: Object
129.37408 366.80542 129.93761 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
129.74995 366.80542 m
129.74995 366.89953 L
129.84378 366.99364 L
129.93761 367.08746 L
129.93761 367.08746 L
129.84378 367.18129 L
129.74995 367.27512 L
129.65584 367.36923 L
129.65584 367.36923 L
129.56230 367.36923 L
129.46819 367.27512 L
129.37408 367.18129 L
129.37408 367.08746 L
129.37408 366.99364 L
129.37408 366.89953 L
129.46819 366.80542 L
129.56230 366.80542 L
129.65584 366.80542 L
129.74995 366.80542 L
@c
F
@rax %Note: Object
128.24674 366.80542 128.81055 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.62261 366.80542 m
128.62261 366.89953 L
128.71672 366.99364 L
128.81055 367.08746 L
128.81055 367.08746 L
128.71672 367.18129 L
128.62261 367.27512 L
128.52879 367.36923 L
128.52879 367.36923 L
128.43468 367.36923 L
128.34085 367.27512 L
128.24674 367.18129 L
128.24674 367.08746 L
128.24674 366.99364 L
128.24674 366.89953 L
128.34085 366.80542 L
128.43468 366.80542 L
128.52879 366.80542 L
128.62261 366.80542 L
@c
F
@rax %Note: Object
127.11940 366.80542 127.68321 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
127.49528 366.80542 m
127.49528 366.89953 L
127.58910 366.99364 L
127.68321 367.08746 L
127.68321 367.08746 L
127.58910 367.18129 L
127.49528 367.27512 L
127.40145 367.36923 L
127.40145 367.36923 L
127.30734 367.36923 L
127.21323 367.27512 L
127.11940 367.18129 L
127.11940 367.08746 L
127.11940 366.99364 L
127.11940 366.89953 L
127.21323 366.80542 L
127.30734 366.80542 L
127.40145 366.80542 L
127.49528 366.80542 L
@c
F
@rax %Note: Object
125.99235 366.80542 126.55587 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
126.36822 366.80542 m
126.36822 366.89953 L
126.46205 366.99364 L
126.55587 367.08746 L
126.55587 367.08746 L
126.46205 367.18129 L
126.36822 367.27512 L
126.27411 367.36923 L
126.27411 367.36923 L
126.18000 367.36923 L
126.08617 367.27512 L
125.99235 367.18129 L
125.99235 367.08746 L
125.99235 366.99364 L
125.99235 366.89953 L
126.08617 366.80542 L
126.18000 366.80542 L
126.27411 366.80542 L
126.36822 366.80542 L
@c
F
@rax %Note: Object
124.86501 366.80542 125.42854 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
125.24088 366.80542 m
125.24088 366.89953 L
125.33471 366.99364 L
125.42854 367.08746 L
125.42854 367.08746 L
125.33471 367.18129 L
125.24088 367.27512 L
125.14677 367.36923 L
125.14677 367.36923 L
125.05266 367.36923 L
124.95883 367.27512 L
124.86501 367.18129 L
124.86501 367.08746 L
124.86501 366.99364 L
124.86501 366.89953 L
124.95883 366.80542 L
125.05266 366.80542 L
125.14677 366.80542 L
125.24088 366.80542 L
@c
F
@rax %Note: Object
123.73767 366.80542 124.30120 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.11354 366.80542 m
124.11354 366.89953 L
124.20737 366.99364 L
124.30120 367.08746 L
124.30120 367.08746 L
124.20737 367.18129 L
124.11354 367.27512 L
124.01915 367.36923 L
124.01915 367.36923 L
123.92532 367.36923 L
123.83150 367.27512 L
123.73767 367.18129 L
123.73767 367.08746 L
123.73767 366.99364 L
123.73767 366.89953 L
123.83150 366.80542 L
123.92532 366.80542 L
124.01915 366.80542 L
124.11354 366.80542 L
@c
F
@rax %Note: Object
122.61033 366.80542 123.17414 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
122.98620 366.80542 m
122.98620 366.89953 L
123.08031 366.99364 L
123.17414 367.08746 L
123.17414 367.08746 L
123.08031 367.18129 L
122.98620 367.27512 L
122.89209 367.36923 L
122.89209 367.36923 L
122.79827 367.36923 L
122.70444 367.27512 L
122.61033 367.18129 L
122.61033 367.08746 L
122.61033 366.99364 L
122.61033 366.89953 L
122.70444 366.80542 L
122.79827 366.80542 L
122.89209 366.80542 L
122.98620 366.80542 L
@c
F
@rax %Note: Object
121.48299 366.80542 122.04680 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
121.85858 366.80542 m
121.85858 366.89953 L
121.95269 366.99364 L
122.04680 367.08746 L
122.04680 367.08746 L
121.95269 367.18129 L
121.85858 367.27512 L
121.76476 367.36923 L
121.76476 367.36923 L
121.67093 367.36923 L
121.57682 367.27512 L
121.48299 367.18129 L
121.48299 367.08746 L
121.48299 366.99364 L
121.48299 366.89953 L
121.57682 366.80542 L
121.67093 366.80542 L
121.76476 366.80542 L
121.85858 366.80542 L
@c
F
@rax %Note: Object
120.35594 366.80542 120.91946 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
120.73153 366.80542 m
120.73153 366.89953 L
120.82564 366.99364 L
120.91946 367.08746 L
120.91946 367.08746 L
120.82564 367.18129 L
120.73153 367.27512 L
120.63770 367.36923 L
120.63770 367.36923 L
120.54359 367.36923 L
120.44976 367.27512 L
120.35594 367.18129 L
120.35594 367.08746 L
120.35594 366.99364 L
120.35594 366.89953 L
120.44976 366.80542 L
120.54359 366.80542 L
120.63770 366.80542 L
120.73153 366.80542 L
@c
F
@rax %Note: Object
119.22860 366.80542 119.79213 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
119.60419 366.80542 m
119.60419 366.89953 L
119.69830 366.99364 L
119.79213 367.08746 L
119.79213 367.08746 L
119.69830 367.18129 L
119.60419 367.27512 L
119.51036 367.36923 L
119.51036 367.36923 L
119.41625 367.36923 L
119.32243 367.27512 L
119.22860 367.18129 L
119.22860 367.08746 L
119.22860 366.99364 L
119.22860 366.89953 L
119.32243 366.80542 L
119.41625 366.80542 L
119.51036 366.80542 L
119.60419 366.80542 L
@c
F
@rax %Note: Object
118.10126 366.80542 118.66479 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
118.47685 366.80542 m
118.47685 366.89953 L
118.57068 366.99364 L
118.66479 367.08746 L
118.66479 367.08746 L
118.57068 367.18129 L
118.47685 367.27512 L
118.38274 367.36923 L
118.38274 367.36923 L
118.28891 367.36923 L
118.19509 367.27512 L
118.10126 367.18129 L
118.10126 367.08746 L
118.10126 366.99364 L
118.10126 366.89953 L
118.19509 366.80542 L
118.28891 366.80542 L
118.38274 366.80542 L
118.47685 366.80542 L
@c
F
@rax %Note: Object
116.97392 366.80542 117.53773 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
117.34951 366.80542 m
117.34951 366.89953 L
117.44362 366.99364 L
117.53773 367.08746 L
117.53773 367.08746 L
117.44362 367.18129 L
117.34951 367.27512 L
117.25569 367.36923 L
117.25569 367.36923 L
117.16186 367.36923 L
117.06803 367.27512 L
116.97392 367.18129 L
116.97392 367.08746 L
116.97392 366.99364 L
116.97392 366.89953 L
117.06803 366.80542 L
117.16186 366.80542 L
117.25569 366.80542 L
117.34951 366.80542 L
@c
F
@rax %Note: Object
115.84658 366.80542 116.41039 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
116.22217 366.80542 m
116.22217 366.89953 L
116.31600 366.99364 L
116.41039 367.08746 L
116.41039 367.08746 L
116.31600 367.18129 L
116.22217 367.27512 L
116.12835 367.36923 L
116.12835 367.36923 L
116.03452 367.36923 L
115.94041 367.27512 L
115.84658 367.18129 L
115.84658 367.08746 L
115.84658 366.99364 L
115.84658 366.89953 L
115.94041 366.80542 L
116.03452 366.80542 L
116.12835 366.80542 L
116.22217 366.80542 L
@c
F
@rax %Note: Object
114.71924 366.80542 115.28277 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.09483 366.80542 m
115.09483 366.89953 L
115.18866 366.99364 L
115.28277 367.08746 L
115.28277 367.08746 L
115.18866 367.18129 L
115.09483 367.27512 L
115.00129 367.36923 L
115.00129 367.36923 L
114.90718 367.36923 L
114.81335 367.27512 L
114.71924 367.18129 L
114.71924 367.08746 L
114.71924 366.99364 L
114.71924 366.89953 L
114.81335 366.80542 L
114.90718 366.80542 L
115.00129 366.80542 L
115.09483 366.80542 L
@c
F
@rax %Note: Object
113.59191 366.80542 114.15543 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
113.96778 366.80542 m
113.96778 366.89953 L
114.06161 366.99364 L
114.15543 367.08746 L
114.15543 367.08746 L
114.06161 367.18129 L
113.96778 367.27512 L
113.87395 367.36923 L
113.87395 367.36923 L
113.77984 367.36923 L
113.68602 367.27512 L
113.59191 367.18129 L
113.59191 367.08746 L
113.59191 366.99364 L
113.59191 366.89953 L
113.68602 366.80542 L
113.77984 366.80542 L
113.87395 366.80542 L
113.96778 366.80542 L
@c
F
@rax %Note: Object
112.46457 366.80542 113.02809 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
112.84044 366.80542 m
112.84044 366.89953 L
112.93427 366.99364 L
113.02809 367.08746 L
113.02809 367.08746 L
112.93427 367.18129 L
112.84044 367.27512 L
112.74633 367.36923 L
112.74633 367.36923 L
112.65250 367.36923 L
112.55868 367.27512 L
112.46457 367.18129 L
112.46457 367.08746 L
112.46457 366.99364 L
112.46457 366.89953 L
112.55868 366.80542 L
112.65250 366.80542 L
112.74633 366.80542 L
112.84044 366.80542 L
@c
F
@rax %Note: Object
111.33723 366.80542 111.90104 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
111.71310 366.80542 m
111.71310 366.89953 L
111.80721 366.99364 L
111.90104 367.08746 L
111.90104 367.08746 L
111.80721 367.18129 L
111.71310 367.27512 L
111.61928 367.36923 L
111.61928 367.36923 L
111.52545 367.36923 L
111.43134 367.27512 L
111.33723 367.18129 L
111.33723 367.08746 L
111.33723 366.99364 L
111.33723 366.89953 L
111.43134 366.80542 L
111.52545 366.80542 L
111.61928 366.80542 L
111.71310 366.80542 L
@c
F
@rax %Note: Object
110.20989 366.80542 110.77370 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.58576 366.80542 m
110.58576 366.89953 L
110.67987 366.99364 L
110.77370 367.08746 L
110.77370 367.08746 L
110.67987 367.18129 L
110.58576 367.27512 L
110.49194 367.36923 L
110.49194 367.36923 L
110.39811 367.36923 L
110.30372 367.27512 L
110.20989 367.18129 L
110.20989 367.08746 L
110.20989 366.99364 L
110.20989 366.89953 L
110.30372 366.80542 L
110.39811 366.80542 L
110.49194 366.80542 L
110.58576 366.80542 L
@c
F
@rax %Note: Object
109.08283 366.80542 109.64636 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
109.45843 366.80542 m
109.45843 366.89953 L
109.55225 366.99364 L
109.64636 367.08746 L
109.64636 367.08746 L
109.55225 367.18129 L
109.45843 367.27512 L
109.36460 367.36923 L
109.36460 367.36923 L
109.27049 367.36923 L
109.17666 367.27512 L
109.08283 367.18129 L
109.08283 367.08746 L
109.08283 366.99364 L
109.08283 366.89953 L
109.17666 366.80542 L
109.27049 366.80542 L
109.36460 366.80542 L
109.45843 366.80542 L
@c
F
@rax %Note: Object
107.95550 366.80542 108.51902 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
108.33137 366.80542 m
108.33137 366.89953 L
108.42520 366.99364 L
108.51902 367.08746 L
108.51902 367.08746 L
108.42520 367.18129 L
108.33137 367.27512 L
108.23754 367.36923 L
108.23754 367.36923 L
108.14315 367.36923 L
108.04932 367.27512 L
107.95550 367.18129 L
107.95550 367.08746 L
107.95550 366.99364 L
107.95550 366.89953 L
108.04932 366.80542 L
108.14315 366.80542 L
108.23754 366.80542 L
108.33137 366.80542 L
@c
F
@rax %Note: Object
106.82816 366.80542 107.39169 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
107.20403 366.80542 m
107.20403 366.89953 L
107.29786 366.99364 L
107.39169 367.08746 L
107.39169 367.08746 L
107.29786 367.18129 L
107.20403 367.27512 L
107.10992 367.36923 L
107.10992 367.36923 L
107.01581 367.36923 L
106.92198 367.27512 L
106.82816 367.18129 L
106.82816 367.08746 L
106.82816 366.99364 L
106.82816 366.89953 L
106.92198 366.80542 L
107.01581 366.80542 L
107.10992 366.80542 L
107.20403 366.80542 L
@c
F
@rax %Note: Object
105.70082 366.80542 106.26463 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
106.07669 366.80542 m
106.07669 366.89953 L
106.17080 366.99364 L
106.26463 367.08746 L
106.26463 367.08746 L
106.17080 367.18129 L
106.07669 367.27512 L
105.98258 367.36923 L
105.98258 367.36923 L
105.88876 367.36923 L
105.79493 367.27512 L
105.70082 367.18129 L
105.70082 367.08746 L
105.70082 366.99364 L
105.70082 366.89953 L
105.79493 366.80542 L
105.88876 366.80542 L
105.98258 366.80542 L
106.07669 366.80542 L
@c
F
@rax %Note: Object
104.57348 366.80542 105.13729 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
104.94935 366.80542 m
104.94935 366.89953 L
105.04346 366.99364 L
105.13729 367.08746 L
105.13729 367.08746 L
105.04346 367.18129 L
104.94935 367.27512 L
104.85524 367.36923 L
104.85524 367.36923 L
104.76142 367.36923 L
104.66731 367.27512 L
104.57348 367.18129 L
104.57348 367.08746 L
104.57348 366.99364 L
104.57348 366.89953 L
104.66731 366.80542 L
104.76142 366.80542 L
104.85524 366.80542 L
104.94935 366.80542 L
@c
F
@rax %Note: Object
103.44614 366.80542 104.00995 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
103.82202 366.80542 m
103.82202 366.89953 L
103.91584 366.99364 L
104.00995 367.08746 L
104.00995 367.08746 L
103.91584 367.18129 L
103.82202 367.27512 L
103.72791 367.36923 L
103.72791 367.36923 L
103.63408 367.36923 L
103.53997 367.27512 L
103.44614 367.18129 L
103.44614 367.08746 L
103.44614 366.99364 L
103.44614 366.89953 L
103.53997 366.80542 L
103.63408 366.80542 L
103.72791 366.80542 L
103.82202 366.80542 L
@c
F
@rax %Note: Object
102.31909 366.80542 102.88261 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
102.69468 366.80542 m
102.69468 366.89953 L
102.78879 366.99364 L
102.88261 367.08746 L
102.88261 367.08746 L
102.78879 367.18129 L
102.69468 367.27512 L
102.60085 367.36923 L
102.60085 367.36923 L
102.50674 367.36923 L
102.41291 367.27512 L
102.31909 367.18129 L
102.31909 367.08746 L
102.31909 366.99364 L
102.31909 366.89953 L
102.41291 366.80542 L
102.50674 366.80542 L
102.60085 366.80542 L
102.69468 366.80542 L
@c
F
@rax %Note: Object
101.19175 366.80542 101.75528 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
101.56734 366.80542 m
101.56734 366.89953 L
101.66145 366.99364 L
101.75528 367.08746 L
101.75528 367.08746 L
101.66145 367.18129 L
101.56734 367.27512 L
101.47323 367.36923 L
101.47323 367.36923 L
101.37940 367.36923 L
101.28557 367.27512 L
101.19175 367.18129 L
101.19175 367.08746 L
101.19175 366.99364 L
101.19175 366.89953 L
101.28557 366.80542 L
101.37940 366.80542 L
101.47323 366.80542 L
101.56734 366.80542 L
@c
F
@rax %Note: Object
100.06441 366.80542 100.62794 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
100.44000 366.80542 m
100.44000 366.89953 L
100.53439 366.99364 L
100.62794 367.08746 L
100.62794 367.08746 L
100.53439 367.18129 L
100.44000 367.27512 L
100.34617 367.36923 L
100.34617 367.36923 L
100.25235 367.36923 L
100.15852 367.27512 L
100.06441 367.18129 L
100.06441 367.08746 L
100.06441 366.99364 L
100.06441 366.89953 L
100.15852 366.80542 L
100.25235 366.80542 L
100.34617 366.80542 L
100.44000 366.80542 L
@c
F
@rax %Note: Object
98.93707 366.80542 99.50088 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
99.31266 366.80542 m
99.31266 366.89953 L
99.40677 366.99364 L
99.50088 367.08746 L
99.50088 367.08746 L
99.40677 367.18129 L
99.31266 367.27512 L
99.21883 367.36923 L
99.21883 367.36923 L
99.12501 367.36923 L
99.03118 367.27512 L
98.93707 367.18129 L
98.93707 367.08746 L
98.93707 366.99364 L
98.93707 366.89953 L
99.03118 366.80542 L
99.12501 366.80542 L
99.21883 366.80542 L
99.31266 366.80542 L
@c
F
@rax %Note: Object
97.80973 366.80542 98.37354 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
98.18532 366.80542 m
98.18532 366.89953 L
98.27915 366.99364 L
98.37354 367.08746 L
98.37354 367.08746 L
98.27915 367.18129 L
98.18532 367.27512 L
98.09150 367.36923 L
98.09150 367.36923 L
97.99767 367.36923 L
97.90356 367.27512 L
97.80973 367.18129 L
97.80973 367.08746 L
97.80973 366.99364 L
97.80973 366.89953 L
97.90356 366.80542 L
97.99767 366.80542 L
98.09150 366.80542 L
98.18532 366.80542 L
@c
F
@rax %Note: Object
96.68268 366.80542 97.24620 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
97.05827 366.80542 m
97.05827 366.89953 L
97.15209 366.99364 L
97.24620 367.08746 L
97.24620 367.08746 L
97.15209 367.18129 L
97.05827 367.27512 L
96.96444 367.36923 L
96.96444 367.36923 L
96.87033 367.36923 L
96.77650 367.27512 L
96.68268 367.18129 L
96.68268 367.08746 L
96.68268 366.99364 L
96.68268 366.89953 L
96.77650 366.80542 L
96.87033 366.80542 L
96.96444 366.80542 L
97.05827 366.80542 L
@c
F
@rax %Note: Object
95.55506 366.80542 96.11887 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
95.93093 366.80542 m
95.93093 366.89953 L
96.02476 366.99364 L
96.11887 367.08746 L
96.11887 367.08746 L
96.02476 367.18129 L
95.93093 367.27512 L
95.83682 367.36923 L
95.83682 367.36923 L
95.74299 367.36923 L
95.64917 367.27512 L
95.55506 367.18129 L
95.55506 367.08746 L
95.55506 366.99364 L
95.55506 366.89953 L
95.64917 366.80542 L
95.74299 366.80542 L
95.83682 366.80542 L
95.93093 366.80542 L
@c
F
@rax %Note: Object
94.42772 366.80542 94.99124 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
94.80359 366.80542 m
94.80359 366.89953 L
94.89742 366.99364 L
94.99124 367.08746 L
94.99124 367.08746 L
94.89742 367.18129 L
94.80359 367.27512 L
94.70976 367.36923 L
94.70976 367.36923 L
94.61594 367.36923 L
94.52211 367.27512 L
94.42772 367.18129 L
94.42772 367.08746 L
94.42772 366.99364 L
94.42772 366.89953 L
94.52211 366.80542 L
94.61594 366.80542 L
94.70976 366.80542 L
94.80359 366.80542 L
@c
F
@rax %Note: Object
93.30038 366.80542 93.86419 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
93.67625 366.80542 m
93.67625 366.89953 L
93.77036 366.99364 L
93.86419 367.08746 L
93.86419 367.08746 L
93.77036 367.18129 L
93.67625 367.27512 L
93.58243 367.36923 L
93.58243 367.36923 L
93.48860 367.36923 L
93.39449 367.27512 L
93.30038 367.18129 L
93.30038 367.08746 L
93.30038 366.99364 L
93.30038 366.89953 L
93.39449 366.80542 L
93.48860 366.80542 L
93.58243 366.80542 L
93.67625 366.80542 L
@c
F
@rax %Note: Object
92.17304 366.80542 92.73685 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
92.54891 366.80542 m
92.54891 366.89953 L
92.64274 366.99364 L
92.73685 367.08746 L
92.73685 367.08746 L
92.64274 367.18129 L
92.54891 367.27512 L
92.45509 367.36923 L
92.45509 367.36923 L
92.36126 367.36923 L
92.26687 367.27512 L
92.17304 367.18129 L
92.17304 367.08746 L
92.17304 366.99364 L
92.17304 366.89953 L
92.26687 366.80542 L
92.36126 366.80542 L
92.45509 366.80542 L
92.54891 366.80542 L
@c
F
@rax %Note: Object
91.04598 366.80542 91.60951 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
91.42186 366.80542 m
91.42186 366.89953 L
91.51569 366.99364 L
91.60951 367.08746 L
91.60951 367.08746 L
91.51569 367.18129 L
91.42186 367.27512 L
91.32803 367.36923 L
91.32803 367.36923 L
91.23392 367.36923 L
91.13981 367.27512 L
91.04598 367.18129 L
91.04598 367.08746 L
91.04598 366.99364 L
91.04598 366.89953 L
91.13981 366.80542 L
91.23392 366.80542 L
91.32803 366.80542 L
91.42186 366.80542 L
@c
F
@rax %Note: Object
89.91865 366.80542 90.48217 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
90.29452 366.80542 m
90.29452 366.89953 L
90.38835 366.99364 L
90.48217 367.08746 L
90.48217 367.08746 L
90.38835 367.18129 L
90.29452 367.27512 L
90.20041 367.36923 L
90.20041 367.36923 L
90.10658 367.36923 L
90.01247 367.27512 L
89.91865 367.18129 L
89.91865 367.08746 L
89.91865 366.99364 L
89.91865 366.89953 L
90.01247 366.80542 L
90.10658 366.80542 L
90.20041 366.80542 L
90.29452 366.80542 L
@c
F
@rax %Note: Object
88.79131 366.80542 89.35483 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
89.16718 366.80542 m
89.16718 366.89953 L
89.26101 366.99364 L
89.35483 367.08746 L
89.35483 367.08746 L
89.26101 367.18129 L
89.16718 367.27512 L
89.07307 367.36923 L
89.07307 367.36923 L
88.97896 367.36923 L
88.88542 367.27512 L
88.79131 367.18129 L
88.79131 367.08746 L
88.79131 366.99364 L
88.79131 366.89953 L
88.88542 366.80542 L
88.97896 366.80542 L
89.07307 366.80542 L
89.16718 366.80542 L
@c
F
@rax %Note: Object
87.66397 366.80542 88.22778 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
88.03984 366.80542 m
88.03984 366.89953 L
88.13395 366.99364 L
88.22778 367.08746 L
88.22778 367.08746 L
88.13395 367.18129 L
88.03984 367.27512 L
87.94602 367.36923 L
87.94602 367.36923 L
87.85191 367.36923 L
87.75808 367.27512 L
87.66397 367.18129 L
87.66397 367.08746 L
87.66397 366.99364 L
87.66397 366.89953 L
87.75808 366.80542 L
87.85191 366.80542 L
87.94602 366.80542 L
88.03984 366.80542 L
@c
F
@rax %Note: Object
86.53663 366.80542 87.10044 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
86.91250 366.80542 m
86.91250 366.89953 L
87.00633 366.99364 L
87.10044 367.08746 L
87.10044 367.08746 L
87.00633 367.18129 L
86.91250 367.27512 L
86.81868 367.36923 L
86.81868 367.36923 L
86.72457 367.36923 L
86.63046 367.27512 L
86.53663 367.18129 L
86.53663 367.08746 L
86.53663 366.99364 L
86.53663 366.89953 L
86.63046 366.80542 L
86.72457 366.80542 L
86.81868 366.80542 L
86.91250 366.80542 L
@c
F
@rax %Note: Object
85.40957 366.80542 85.97310 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
85.78545 366.80542 m
85.78545 366.89953 L
85.87928 366.99364 L
85.97310 367.08746 L
85.97310 367.08746 L
85.87928 367.18129 L
85.78545 367.27512 L
85.69134 367.36923 L
85.69134 367.36923 L
85.59723 367.36923 L
85.50340 367.27512 L
85.40957 367.18129 L
85.40957 367.08746 L
85.40957 366.99364 L
85.40957 366.89953 L
85.50340 366.80542 L
85.59723 366.80542 L
85.69134 366.80542 L
85.78545 366.80542 L
@c
F
@rax %Note: Object
84.28224 366.80542 84.84576 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
84.65811 366.80542 m
84.65811 366.89953 L
84.75194 366.99364 L
84.84576 367.08746 L
84.84576 367.08746 L
84.75194 367.18129 L
84.65811 367.27512 L
84.56400 367.36923 L
84.56400 367.36923 L
84.46989 367.36923 L
84.37606 367.27512 L
84.28224 367.18129 L
84.28224 367.08746 L
84.28224 366.99364 L
84.28224 366.89953 L
84.37606 366.80542 L
84.46989 366.80542 L
84.56400 366.80542 L
84.65811 366.80542 L
@c
F
@rax %Note: Object
83.15490 366.80542 83.71843 367.36923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.15490 367.08746 m
83.24872 366.99364 L
83.34255 366.89953 L
83.43638 366.80542 L
83.53077 366.80542 L
83.62460 366.89953 L
83.71843 366.99364 L
83.71843 367.08746 L
83.71843 367.18129 L
83.71843 367.18129 L
83.71843 367.27512 L
83.62460 367.36923 L
83.53077 367.36923 L
83.43638 367.36923 L
83.34255 367.36923 L
83.24872 367.27512 L
83.15490 367.18129 L
83.15490 367.08746 L
@c
F
@rax %Note: Object
83.15490 367.93276 83.71843 368.49657 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.15490 368.21480 m
83.24872 368.12098 L
83.34255 368.02687 L
83.43638 367.93276 L
83.53077 367.93276 L
83.62460 368.02687 L
83.71843 368.12098 L
83.71843 368.21480 L
83.71843 368.30863 L
83.71843 368.30863 L
83.71843 368.40246 L
83.62460 368.49657 L
83.53077 368.49657 L
83.43638 368.49657 L
83.34255 368.49657 L
83.24872 368.40246 L
83.15490 368.30863 L
83.15490 368.21480 L
@c
F
@rax %Note: Object
83.15490 369.06009 83.71843 369.62391 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.15490 369.34186 m
83.24872 369.24803 L
83.34255 369.15420 L
83.43638 369.06009 L
83.53077 369.06009 L
83.62460 369.15420 L
83.71843 369.24803 L
83.71843 369.34186 L
83.71843 369.43597 L
83.71843 369.43597 L
83.71843 369.52980 L
83.62460 369.62391 L
83.53077 369.62391 L
83.43638 369.62391 L
83.34255 369.62391 L
83.24872 369.52980 L
83.15490 369.43597 L
83.15490 369.34186 L
@c
F
@rax %Note: Object
83.15490 370.18772 83.71843 370.75124 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.15490 370.46920 m
83.24872 370.37537 L
83.34255 370.28154 L
83.43638 370.18772 L
83.53077 370.18772 L
83.62460 370.28154 L
83.71843 370.37537 L
83.71843 370.46920 L
83.71843 370.56331 L
83.71843 370.56331 L
83.71843 370.65713 L
83.62460 370.75124 L
83.53077 370.75124 L
83.43638 370.75124 L
83.34255 370.75124 L
83.24872 370.65713 L
83.15490 370.56331 L
83.15490 370.46920 L
@c
F
@rax %Note: Object
83.15490 371.31506 83.71843 371.87830 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.15490 371.59654 m
83.24872 371.50271 L
83.34255 371.40888 L
83.43638 371.31506 L
83.53077 371.31506 L
83.62460 371.40888 L
83.71843 371.50271 L
83.71843 371.59654 L
83.71843 371.69036 L
83.71843 371.69036 L
83.71843 371.78419 L
83.62460 371.87830 L
83.53077 371.87830 L
83.43638 371.87830 L
83.34255 371.87830 L
83.24872 371.78419 L
83.15490 371.69036 L
83.15490 371.59654 L
@c
F
@rax %Note: Object
83.15490 372.44211 83.71843 373.00592 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.15490 372.72387 m
83.24872 372.63005 L
83.34255 372.53594 L
83.43638 372.44211 L
83.53077 372.44211 L
83.62460 372.53594 L
83.71843 372.63005 L
83.71843 372.72387 L
83.71843 372.81770 L
83.71843 372.81770 L
83.71843 372.91181 L
83.62460 373.00592 L
83.53077 373.00592 L
83.43638 373.00592 L
83.34255 373.00592 L
83.24872 372.91181 L
83.15490 372.81770 L
83.15490 372.72387 L
@c
F
@rax %Note: Object
83.15490 373.56945 83.71843 374.13326 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.15490 373.85121 m
83.24872 373.75739 L
83.34255 373.66328 L
83.43638 373.56945 L
83.53077 373.56945 L
83.62460 373.66328 L
83.71843 373.75739 L
83.71843 373.85121 L
83.71843 373.94504 L
83.71843 373.94504 L
83.71843 374.03915 L
83.62460 374.13326 L
83.53077 374.13326 L
83.43638 374.13326 L
83.34255 374.13326 L
83.24872 374.03915 L
83.15490 373.94504 L
83.15490 373.85121 L
@c
F
@rax %Note: Object
83.15490 374.69650 83.71843 375.26031 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.15490 374.97827 m
83.24872 374.88444 L
83.34255 374.79061 L
83.43638 374.69650 L
83.53077 374.69650 L
83.62460 374.79061 L
83.71843 374.88444 L
83.71843 374.97827 L
83.71843 375.07238 L
83.71843 375.07238 L
83.71843 375.16649 L
83.62460 375.26031 L
83.53077 375.26031 L
83.43638 375.26031 L
83.34255 375.26031 L
83.24872 375.16649 L
83.15490 375.07238 L
83.15490 374.97827 L
@c
F
@rax %Note: Object
83.15490 375.82413 83.71843 376.38765 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.15490 376.10561 m
83.24872 376.01178 L
83.34255 375.91795 L
83.43638 375.82413 L
83.53077 375.82413 L
83.62460 375.91795 L
83.71843 376.01178 L
83.71843 376.10561 L
83.71843 376.19972 L
83.71843 376.19972 L
83.71843 376.29383 L
83.62460 376.38765 L
83.53077 376.38765 L
83.43638 376.38765 L
83.34255 376.38765 L
83.24872 376.29383 L
83.15490 376.19972 L
83.15490 376.10561 L
@c
F
@rax %Note: Object
83.15490 376.95146 83.71843 377.51471 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.15490 377.23294 m
83.24872 377.13912 L
83.34255 377.04529 L
83.43638 376.95146 L
83.53077 376.95146 L
83.62460 377.04529 L
83.71843 377.13912 L
83.71843 377.23294 L
83.71843 377.32734 L
83.71843 377.32734 L
83.71843 377.42117 L
83.62460 377.51471 L
83.53077 377.51471 L
83.43638 377.51471 L
83.34255 377.51471 L
83.24872 377.42117 L
83.15490 377.32734 L
83.15490 377.23294 L
@c
F
@rax %Note: Object
83.15490 378.07852 83.71843 378.64233 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.15490 378.36028 m
83.24872 378.26646 L
83.34255 378.17235 L
83.43638 378.07852 L
83.53077 378.07852 L
83.62460 378.17235 L
83.71843 378.26646 L
83.71843 378.36028 L
83.71843 378.45439 L
83.71843 378.45439 L
83.71843 378.54822 L
83.62460 378.64233 L
83.53077 378.64233 L
83.43638 378.64233 L
83.34255 378.64233 L
83.24872 378.54822 L
83.15490 378.45439 L
83.15490 378.36028 L
@c
F
@rax %Note: Object
80.52435 379.20586 86.44280 385.12431 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
86.44280 379.20586 m
83.43638 385.12431 L
80.52435 379.20586 L
86.44280 379.20586 L
@c
F
@rax %Note: Object
167.70217 357.78728 168.26598 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
168.07805 357.78728 m
168.07805 357.88110 L
168.17187 357.97493 L
168.26598 358.06876 L
168.26598 358.06876 L
168.17187 358.16315 L
168.07805 358.25698 L
167.98422 358.35080 L
167.98422 358.35080 L
167.89011 358.35080 L
167.79600 358.25698 L
167.70217 358.16315 L
167.70217 358.06876 L
167.70217 357.97493 L
167.70217 357.88110 L
167.79600 357.78728 L
167.89011 357.78728 L
167.98422 357.78728 L
168.07805 357.78728 L
@c
F
@rax %Note: Object
166.57512 357.78728 167.13865 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
166.95099 357.78728 m
166.95099 357.88110 L
167.04482 357.97493 L
167.13865 358.06876 L
167.13865 358.06876 L
167.04482 358.16315 L
166.95099 358.25698 L
166.85717 358.35080 L
166.85717 358.35080 L
166.76277 358.35080 L
166.66894 358.25698 L
166.57512 358.16315 L
166.57512 358.06876 L
166.57512 357.97493 L
166.57512 357.88110 L
166.66894 357.78728 L
166.76277 357.78728 L
166.85717 357.78728 L
166.95099 357.78728 L
@c
F
@rax %Note: Object
165.44778 357.78728 166.01131 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
165.82365 357.78728 m
165.82365 357.88110 L
165.91748 357.97493 L
166.01131 358.06876 L
166.01131 358.06876 L
165.91748 358.16315 L
165.82365 358.25698 L
165.72983 358.35080 L
165.72983 358.35080 L
165.63543 358.35080 L
165.54161 358.25698 L
165.44778 358.16315 L
165.44778 358.06876 L
165.44778 357.97493 L
165.44778 357.88110 L
165.54161 357.78728 L
165.63543 357.78728 L
165.72983 357.78728 L
165.82365 357.78728 L
@c
F
@rax %Note: Object
164.32044 357.78728 164.88397 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
164.69631 357.78728 m
164.69631 357.88110 L
164.79014 357.97493 L
164.88397 358.06876 L
164.88397 358.06876 L
164.79014 358.16315 L
164.69631 358.25698 L
164.60220 358.35080 L
164.60220 358.35080 L
164.50809 358.35080 L
164.41455 358.25698 L
164.32044 358.16315 L
164.32044 358.06876 L
164.32044 357.97493 L
164.32044 357.88110 L
164.41455 357.78728 L
164.50809 357.78728 L
164.60220 357.78728 L
164.69631 357.78728 L
@c
F
@rax %Note: Object
163.19310 357.78728 163.75691 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
163.56898 357.78728 m
163.56898 357.88110 L
163.66309 357.97493 L
163.75691 358.06876 L
163.75691 358.06876 L
163.66309 358.16315 L
163.56898 358.25698 L
163.47487 358.35080 L
163.47487 358.35080 L
163.38104 358.35080 L
163.28721 358.25698 L
163.19310 358.16315 L
163.19310 358.06876 L
163.19310 357.97493 L
163.19310 357.88110 L
163.28721 357.78728 L
163.38104 357.78728 L
163.47487 357.78728 L
163.56898 357.78728 L
@c
F
@rax %Note: Object
162.06576 357.78728 162.62957 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
162.44164 357.78728 m
162.44164 357.88110 L
162.53546 357.97493 L
162.62957 358.06876 L
162.62957 358.06876 L
162.53546 358.16315 L
162.44164 358.25698 L
162.34753 358.35080 L
162.34753 358.35080 L
162.25370 358.35080 L
162.15959 358.25698 L
162.06576 358.16315 L
162.06576 358.06876 L
162.06576 357.97493 L
162.06576 357.88110 L
162.15959 357.78728 L
162.25370 357.78728 L
162.34753 357.78728 L
162.44164 357.78728 L
@c
F
@rax %Note: Object
160.93871 357.78728 161.50224 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
161.31430 357.78728 m
161.31430 357.88110 L
161.40841 357.97493 L
161.50224 358.06876 L
161.50224 358.06876 L
161.40841 358.16315 L
161.31430 358.25698 L
161.22047 358.35080 L
161.22047 358.35080 L
161.12636 358.35080 L
161.03254 358.25698 L
160.93871 358.16315 L
160.93871 358.06876 L
160.93871 357.97493 L
160.93871 357.88110 L
161.03254 357.78728 L
161.12636 357.78728 L
161.22047 357.78728 L
161.31430 357.78728 L
@c
F
@rax %Note: Object
159.81137 357.78728 160.37490 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
160.18696 357.78728 m
160.18696 357.88110 L
160.28107 357.97493 L
160.37490 358.06876 L
160.37490 358.06876 L
160.28107 358.16315 L
160.18696 358.25698 L
160.09313 358.35080 L
160.09313 358.35080 L
159.99902 358.35080 L
159.90520 358.25698 L
159.81137 358.16315 L
159.81137 358.06876 L
159.81137 357.97493 L
159.81137 357.88110 L
159.90520 357.78728 L
159.99902 357.78728 L
160.09313 357.78728 L
160.18696 357.78728 L
@c
F
@rax %Note: Object
158.68403 357.78728 159.24756 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
159.05962 357.78728 m
159.05962 357.88110 L
159.15373 357.97493 L
159.24756 358.06876 L
159.24756 358.06876 L
159.15373 358.16315 L
159.05962 358.25698 L
158.96551 358.35080 L
158.96551 358.35080 L
158.87169 358.35080 L
158.77786 358.25698 L
158.68403 358.16315 L
158.68403 358.06876 L
158.68403 357.97493 L
158.68403 357.88110 L
158.77786 357.78728 L
158.87169 357.78728 L
158.96551 357.78728 L
159.05962 357.78728 L
@c
F
@rax %Note: Object
157.55669 357.78728 158.12050 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
157.93228 357.78728 m
157.93228 357.88110 L
158.02639 357.97493 L
158.12050 358.06876 L
158.12050 358.06876 L
158.02639 358.16315 L
157.93228 358.25698 L
157.83846 358.35080 L
157.83846 358.35080 L
157.74463 358.35080 L
157.65080 358.25698 L
157.55669 358.16315 L
157.55669 358.06876 L
157.55669 357.97493 L
157.55669 357.88110 L
157.65080 357.78728 L
157.74463 357.78728 L
157.83846 357.78728 L
157.93228 357.78728 L
@c
F
@rax %Note: Object
156.42935 357.78728 156.99317 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
156.80494 357.78728 m
156.80494 357.88110 L
156.89906 357.97493 L
156.99317 358.06876 L
156.99317 358.06876 L
156.89906 358.16315 L
156.80494 358.25698 L
156.71112 358.35080 L
156.71112 358.35080 L
156.61729 358.35080 L
156.52318 358.25698 L
156.42935 358.16315 L
156.42935 358.06876 L
156.42935 357.97493 L
156.42935 357.88110 L
156.52318 357.78728 L
156.61729 357.78728 L
156.71112 357.78728 L
156.80494 357.78728 L
@c
F
@rax %Note: Object
155.30202 357.78728 155.86583 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
155.67789 357.78728 m
155.67789 357.88110 L
155.77143 357.97493 L
155.86583 358.06876 L
155.86583 358.06876 L
155.77143 358.16315 L
155.67789 358.25698 L
155.58406 358.35080 L
155.58406 358.35080 L
155.48995 358.35080 L
155.39613 358.25698 L
155.30202 358.16315 L
155.30202 358.06876 L
155.30202 357.97493 L
155.30202 357.88110 L
155.39613 357.78728 L
155.48995 357.78728 L
155.58406 357.78728 L
155.67789 357.78728 L
@c
F
@rax %Note: Object
154.17468 357.78728 154.73820 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
154.55055 357.78728 m
154.55055 357.88110 L
154.64438 357.97493 L
154.73820 358.06876 L
154.73820 358.06876 L
154.64438 358.16315 L
154.55055 358.25698 L
154.45672 358.35080 L
154.45672 358.35080 L
154.36261 358.35080 L
154.26879 358.25698 L
154.17468 358.16315 L
154.17468 358.06876 L
154.17468 357.97493 L
154.17468 357.88110 L
154.26879 357.78728 L
154.36261 357.78728 L
154.45672 357.78728 L
154.55055 357.78728 L
@c
F
@rax %Note: Object
153.04734 357.78728 153.61087 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
153.42321 357.78728 m
153.42321 357.88110 L
153.51704 357.97493 L
153.61087 358.06876 L
153.61087 358.06876 L
153.51704 358.16315 L
153.42321 358.25698 L
153.32910 358.35080 L
153.32910 358.35080 L
153.23528 358.35080 L
153.14145 358.25698 L
153.04734 358.16315 L
153.04734 358.06876 L
153.04734 357.97493 L
153.04734 357.88110 L
153.14145 357.78728 L
153.23528 357.78728 L
153.32910 357.78728 L
153.42321 357.78728 L
@c
F
@rax %Note: Object
151.92000 357.78728 152.48381 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
152.29587 357.78728 m
152.29587 357.88110 L
152.38998 357.97493 L
152.48381 358.06876 L
152.48381 358.06876 L
152.38998 358.16315 L
152.29587 358.25698 L
152.20205 358.35080 L
152.20205 358.35080 L
152.10822 358.35080 L
152.01411 358.25698 L
151.92000 358.16315 L
151.92000 358.06876 L
151.92000 357.97493 L
151.92000 357.88110 L
152.01411 357.78728 L
152.10822 357.78728 L
152.20205 357.78728 L
152.29587 357.78728 L
@c
F
@rax %Note: Object
150.79266 357.78728 151.35647 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
151.16854 357.78728 m
151.16854 357.88110 L
151.26265 357.97493 L
151.35647 358.06876 L
151.35647 358.06876 L
151.26265 358.16315 L
151.16854 358.25698 L
151.07471 358.35080 L
151.07471 358.35080 L
150.98088 358.35080 L
150.88649 358.25698 L
150.79266 358.16315 L
150.79266 358.06876 L
150.79266 357.97493 L
150.79266 357.88110 L
150.88649 357.78728 L
150.98088 357.78728 L
151.07471 357.78728 L
151.16854 357.78728 L
@c
F
@rax %Note: Object
149.66561 357.78728 150.22913 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
150.04120 357.78728 m
150.04120 357.88110 L
150.13502 357.97493 L
150.22913 358.06876 L
150.22913 358.06876 L
150.13502 358.16315 L
150.04120 358.25698 L
149.94737 358.35080 L
149.94737 358.35080 L
149.85354 358.35080 L
149.75943 358.25698 L
149.66561 358.16315 L
149.66561 358.06876 L
149.66561 357.97493 L
149.66561 357.88110 L
149.75943 357.78728 L
149.85354 357.78728 L
149.94737 357.78728 L
150.04120 357.78728 L
@c
F
@rax %Note: Object
148.53827 357.78728 149.10180 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
148.91414 357.78728 m
148.91414 357.88110 L
149.00797 357.97493 L
149.10180 358.06876 L
149.10180 358.06876 L
149.00797 358.16315 L
148.91414 358.25698 L
148.82031 358.35080 L
148.82031 358.35080 L
148.72620 358.35080 L
148.63209 358.25698 L
148.53827 358.16315 L
148.53827 358.06876 L
148.53827 357.97493 L
148.53827 357.88110 L
148.63209 357.78728 L
148.72620 357.78728 L
148.82031 357.78728 L
148.91414 357.78728 L
@c
F
@rax %Note: Object
147.41093 357.78728 147.97446 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
147.78680 357.78728 m
147.78680 357.88110 L
147.88063 357.97493 L
147.97446 358.06876 L
147.97446 358.06876 L
147.88063 358.16315 L
147.78680 358.25698 L
147.69269 358.35080 L
147.69269 358.35080 L
147.59858 358.35080 L
147.50476 358.25698 L
147.41093 358.16315 L
147.41093 358.06876 L
147.41093 357.97493 L
147.41093 357.88110 L
147.50476 357.78728 L
147.59858 357.78728 L
147.69269 357.78728 L
147.78680 357.78728 L
@c
F
@rax %Note: Object
146.28359 357.78728 146.84740 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
146.65946 357.78728 m
146.65946 357.88110 L
146.75357 357.97493 L
146.84740 358.06876 L
146.84740 358.06876 L
146.75357 358.16315 L
146.65946 358.25698 L
146.56564 358.35080 L
146.56564 358.35080 L
146.47153 358.35080 L
146.37770 358.25698 L
146.28359 358.16315 L
146.28359 358.06876 L
146.28359 357.97493 L
146.28359 357.88110 L
146.37770 357.78728 L
146.47153 357.78728 L
146.56564 357.78728 L
146.65946 357.78728 L
@c
F
@rax %Note: Object
145.15625 357.78728 145.72006 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
145.53213 357.78728 m
145.53213 357.88110 L
145.62624 357.97493 L
145.72006 358.06876 L
145.72006 358.06876 L
145.62624 358.16315 L
145.53213 358.25698 L
145.43830 358.35080 L
145.43830 358.35080 L
145.34419 358.35080 L
145.25008 358.25698 L
145.15625 358.16315 L
145.15625 358.06876 L
145.15625 357.97493 L
145.15625 357.88110 L
145.25008 357.78728 L
145.34419 357.78728 L
145.43830 357.78728 L
145.53213 357.78728 L
@c
F
@rax %Note: Object
144.02920 357.78728 144.59272 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
144.40479 357.78728 m
144.40479 357.88110 L
144.49861 357.97493 L
144.59272 358.06876 L
144.59272 358.06876 L
144.49861 358.16315 L
144.40479 358.25698 L
144.31068 358.35080 L
144.31068 358.35080 L
144.21685 358.35080 L
144.12274 358.25698 L
144.02920 358.16315 L
144.02920 358.06876 L
144.02920 357.97493 L
144.02920 357.88110 L
144.12274 357.78728 L
144.21685 357.78728 L
144.31068 357.78728 L
144.40479 357.78728 L
@c
F
@rax %Note: Object
142.90186 357.78728 143.46539 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
143.27773 357.78728 m
143.27773 357.88110 L
143.37156 357.97493 L
143.46539 358.06876 L
143.46539 358.06876 L
143.37156 358.16315 L
143.27773 358.25698 L
143.18362 358.35080 L
143.18362 358.35080 L
143.08951 358.35080 L
142.99569 358.25698 L
142.90186 358.16315 L
142.90186 358.06876 L
142.90186 357.97493 L
142.90186 357.88110 L
142.99569 357.78728 L
143.08951 357.78728 L
143.18362 357.78728 L
143.27773 357.78728 L
@c
F
@rax %Note: Object
141.77452 357.78728 142.33805 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
142.15011 357.78728 m
142.15011 357.88110 L
142.24422 357.97493 L
142.33805 358.06876 L
142.33805 358.06876 L
142.24422 358.16315 L
142.15011 358.25698 L
142.05600 358.35080 L
142.05600 358.35080 L
141.96217 358.35080 L
141.86835 358.25698 L
141.77452 358.16315 L
141.77452 358.06876 L
141.77452 357.97493 L
141.77452 357.88110 L
141.86835 357.78728 L
141.96217 357.78728 L
142.05600 357.78728 L
142.15011 357.78728 L
@c
F
@rax %Note: Object
140.64718 357.78728 141.21071 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
141.02277 357.78728 m
141.02277 357.88110 L
141.11717 357.97493 L
141.21071 358.06876 L
141.21071 358.06876 L
141.11717 358.16315 L
141.02277 358.25698 L
140.92894 358.35080 L
140.92894 358.35080 L
140.83512 358.35080 L
140.74129 358.25698 L
140.64718 358.16315 L
140.64718 358.06876 L
140.64718 357.97493 L
140.64718 357.88110 L
140.74129 357.78728 L
140.83512 357.78728 L
140.92894 357.78728 L
141.02277 357.78728 L
@c
F
@rax %Note: Object
139.51984 357.78728 140.08365 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
139.89543 357.78728 m
139.89543 357.88110 L
139.98983 357.97493 L
140.08365 358.06876 L
140.08365 358.06876 L
139.98983 358.16315 L
139.89543 358.25698 L
139.80161 358.35080 L
139.80161 358.35080 L
139.70778 358.35080 L
139.61395 358.25698 L
139.51984 358.16315 L
139.51984 358.06876 L
139.51984 357.97493 L
139.51984 357.88110 L
139.61395 357.78728 L
139.70778 357.78728 L
139.80161 357.78728 L
139.89543 357.78728 L
@c
F
@rax %Note: Object
138.39250 357.78728 138.95631 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
138.76809 357.78728 m
138.76809 357.88110 L
138.86220 357.97493 L
138.95631 358.06876 L
138.95631 358.06876 L
138.86220 358.16315 L
138.76809 358.25698 L
138.67427 358.35080 L
138.67427 358.35080 L
138.58044 358.35080 L
138.48633 358.25698 L
138.39250 358.16315 L
138.39250 358.06876 L
138.39250 357.97493 L
138.39250 357.88110 L
138.48633 357.78728 L
138.58044 357.78728 L
138.67427 357.78728 L
138.76809 357.78728 L
@c
F
@rax %Note: Object
137.26545 357.78728 137.82898 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
137.64104 357.78728 m
137.64104 357.88110 L
137.73487 357.97493 L
137.82898 358.06876 L
137.82898 358.06876 L
137.73487 358.16315 L
137.64104 358.25698 L
137.54721 358.35080 L
137.54721 358.35080 L
137.45310 358.35080 L
137.35928 358.25698 L
137.26545 358.16315 L
137.26545 358.06876 L
137.26545 357.97493 L
137.26545 357.88110 L
137.35928 357.78728 L
137.45310 357.78728 L
137.54721 357.78728 L
137.64104 357.78728 L
@c
F
@rax %Note: Object
136.13811 357.78728 136.70164 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
136.51370 357.78728 m
136.51370 357.88110 L
136.60753 357.97493 L
136.70164 358.06876 L
136.70164 358.06876 L
136.60753 358.16315 L
136.51370 358.25698 L
136.41959 358.35080 L
136.41959 358.35080 L
136.32576 358.35080 L
136.23194 358.25698 L
136.13811 358.16315 L
136.13811 358.06876 L
136.13811 357.97493 L
136.13811 357.88110 L
136.23194 357.78728 L
136.32576 357.78728 L
136.41959 357.78728 L
136.51370 357.78728 L
@c
F
@rax %Note: Object
135.01049 357.78728 135.57430 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
135.38636 357.78728 m
135.38636 357.88110 L
135.48019 357.97493 L
135.57430 358.06876 L
135.57430 358.06876 L
135.48019 358.16315 L
135.38636 358.25698 L
135.29254 358.35080 L
135.29254 358.35080 L
135.19871 358.35080 L
135.10488 358.25698 L
135.01049 358.16315 L
135.01049 358.06876 L
135.01049 357.97493 L
135.01049 357.88110 L
135.10488 357.78728 L
135.19871 357.78728 L
135.29254 357.78728 L
135.38636 357.78728 L
@c
F
@rax %Note: Object
133.88315 357.78728 134.44696 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
134.25902 357.78728 m
134.25902 357.88110 L
134.35313 357.97493 L
134.44696 358.06876 L
134.44696 358.06876 L
134.35313 358.16315 L
134.25902 358.25698 L
134.16520 358.35080 L
134.16520 358.35080 L
134.07137 358.35080 L
133.97754 358.25698 L
133.88315 358.16315 L
133.88315 358.06876 L
133.88315 357.97493 L
133.88315 357.88110 L
133.97754 357.78728 L
134.07137 357.78728 L
134.16520 357.78728 L
134.25902 357.78728 L
@c
F
@rax %Note: Object
132.75581 357.78728 133.31962 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
133.13169 357.78728 m
133.13169 357.88110 L
133.22551 357.97493 L
133.31962 358.06876 L
133.31962 358.06876 L
133.22551 358.16315 L
133.13169 358.25698 L
133.03786 358.35080 L
133.03786 358.35080 L
132.94403 358.35080 L
132.84992 358.25698 L
132.75581 358.16315 L
132.75581 358.06876 L
132.75581 357.97493 L
132.75581 357.88110 L
132.84992 357.78728 L
132.94403 357.78728 L
133.03786 357.78728 L
133.13169 357.78728 L
@c
F
@rax %Note: Object
131.62876 357.78728 132.19228 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
132.00463 357.78728 m
132.00463 357.88110 L
132.09846 357.97493 L
132.19228 358.06876 L
132.19228 358.06876 L
132.09846 358.16315 L
132.00463 358.25698 L
131.91080 358.35080 L
131.91080 358.35080 L
131.81669 358.35080 L
131.72258 358.25698 L
131.62876 358.16315 L
131.62876 358.06876 L
131.62876 357.97493 L
131.62876 357.88110 L
131.72258 357.78728 L
131.81669 357.78728 L
131.91080 357.78728 L
132.00463 357.78728 L
@c
F
@rax %Note: Object
130.50142 357.78728 131.06494 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
130.87729 357.78728 m
130.87729 357.88110 L
130.97112 357.97493 L
131.06494 358.06876 L
131.06494 358.06876 L
130.97112 358.16315 L
130.87729 358.25698 L
130.78318 358.35080 L
130.78318 358.35080 L
130.68935 358.35080 L
130.59524 358.25698 L
130.50142 358.16315 L
130.50142 358.06876 L
130.50142 357.97493 L
130.50142 357.88110 L
130.59524 357.78728 L
130.68935 357.78728 L
130.78318 357.78728 L
130.87729 357.78728 L
@c
F
@rax %Note: Object
129.37408 357.78728 129.93761 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
129.74995 357.78728 m
129.74995 357.88110 L
129.84378 357.97493 L
129.93761 358.06876 L
129.93761 358.06876 L
129.84378 358.16315 L
129.74995 358.25698 L
129.65584 358.35080 L
129.65584 358.35080 L
129.56230 358.35080 L
129.46819 358.25698 L
129.37408 358.16315 L
129.37408 358.06876 L
129.37408 357.97493 L
129.37408 357.88110 L
129.46819 357.78728 L
129.56230 357.78728 L
129.65584 357.78728 L
129.74995 357.78728 L
@c
F
@rax %Note: Object
128.24674 357.78728 128.81055 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.62261 357.78728 m
128.62261 357.88110 L
128.71672 357.97493 L
128.81055 358.06876 L
128.81055 358.06876 L
128.71672 358.16315 L
128.62261 358.25698 L
128.52879 358.35080 L
128.52879 358.35080 L
128.43468 358.35080 L
128.34085 358.25698 L
128.24674 358.16315 L
128.24674 358.06876 L
128.24674 357.97493 L
128.24674 357.88110 L
128.34085 357.78728 L
128.43468 357.78728 L
128.52879 357.78728 L
128.62261 357.78728 L
@c
F
@rax %Note: Object
127.11940 357.78728 127.68321 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
127.49528 357.78728 m
127.49528 357.88110 L
127.58910 357.97493 L
127.68321 358.06876 L
127.68321 358.06876 L
127.58910 358.16315 L
127.49528 358.25698 L
127.40145 358.35080 L
127.40145 358.35080 L
127.30734 358.35080 L
127.21323 358.25698 L
127.11940 358.16315 L
127.11940 358.06876 L
127.11940 357.97493 L
127.11940 357.88110 L
127.21323 357.78728 L
127.30734 357.78728 L
127.40145 357.78728 L
127.49528 357.78728 L
@c
F
@rax %Note: Object
125.99235 357.78728 126.55587 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
126.36822 357.78728 m
126.36822 357.88110 L
126.46205 357.97493 L
126.55587 358.06876 L
126.55587 358.06876 L
126.46205 358.16315 L
126.36822 358.25698 L
126.27411 358.35080 L
126.27411 358.35080 L
126.18000 358.35080 L
126.08617 358.25698 L
125.99235 358.16315 L
125.99235 358.06876 L
125.99235 357.97493 L
125.99235 357.88110 L
126.08617 357.78728 L
126.18000 357.78728 L
126.27411 357.78728 L
126.36822 357.78728 L
@c
F
@rax %Note: Object
124.86501 357.78728 125.42854 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
125.24088 357.78728 m
125.24088 357.88110 L
125.33471 357.97493 L
125.42854 358.06876 L
125.42854 358.06876 L
125.33471 358.16315 L
125.24088 358.25698 L
125.14677 358.35080 L
125.14677 358.35080 L
125.05266 358.35080 L
124.95883 358.25698 L
124.86501 358.16315 L
124.86501 358.06876 L
124.86501 357.97493 L
124.86501 357.88110 L
124.95883 357.78728 L
125.05266 357.78728 L
125.14677 357.78728 L
125.24088 357.78728 L
@c
F
@rax %Note: Object
123.73767 357.78728 124.30120 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.11354 357.78728 m
124.11354 357.88110 L
124.20737 357.97493 L
124.30120 358.06876 L
124.30120 358.06876 L
124.20737 358.16315 L
124.11354 358.25698 L
124.01915 358.35080 L
124.01915 358.35080 L
123.92532 358.35080 L
123.83150 358.25698 L
123.73767 358.16315 L
123.73767 358.06876 L
123.73767 357.97493 L
123.73767 357.88110 L
123.83150 357.78728 L
123.92532 357.78728 L
124.01915 357.78728 L
124.11354 357.78728 L
@c
F
@rax %Note: Object
122.61033 357.78728 123.17414 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
122.98620 357.78728 m
122.98620 357.88110 L
123.08031 357.97493 L
123.17414 358.06876 L
123.17414 358.06876 L
123.08031 358.16315 L
122.98620 358.25698 L
122.89209 358.35080 L
122.89209 358.35080 L
122.79827 358.35080 L
122.70444 358.25698 L
122.61033 358.16315 L
122.61033 358.06876 L
122.61033 357.97493 L
122.61033 357.88110 L
122.70444 357.78728 L
122.79827 357.78728 L
122.89209 357.78728 L
122.98620 357.78728 L
@c
F
@rax %Note: Object
121.48299 357.78728 122.04680 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
121.85858 357.78728 m
121.85858 357.88110 L
121.95269 357.97493 L
122.04680 358.06876 L
122.04680 358.06876 L
121.95269 358.16315 L
121.85858 358.25698 L
121.76476 358.35080 L
121.76476 358.35080 L
121.67093 358.35080 L
121.57682 358.25698 L
121.48299 358.16315 L
121.48299 358.06876 L
121.48299 357.97493 L
121.48299 357.88110 L
121.57682 357.78728 L
121.67093 357.78728 L
121.76476 357.78728 L
121.85858 357.78728 L
@c
F
@rax %Note: Object
120.35594 357.78728 120.91946 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
120.73153 357.78728 m
120.73153 357.88110 L
120.82564 357.97493 L
120.91946 358.06876 L
120.91946 358.06876 L
120.82564 358.16315 L
120.73153 358.25698 L
120.63770 358.35080 L
120.63770 358.35080 L
120.54359 358.35080 L
120.44976 358.25698 L
120.35594 358.16315 L
120.35594 358.06876 L
120.35594 357.97493 L
120.35594 357.88110 L
120.44976 357.78728 L
120.54359 357.78728 L
120.63770 357.78728 L
120.73153 357.78728 L
@c
F
@rax %Note: Object
119.22860 357.78728 119.79213 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
119.60419 357.78728 m
119.60419 357.88110 L
119.69830 357.97493 L
119.79213 358.06876 L
119.79213 358.06876 L
119.69830 358.16315 L
119.60419 358.25698 L
119.51036 358.35080 L
119.51036 358.35080 L
119.41625 358.35080 L
119.32243 358.25698 L
119.22860 358.16315 L
119.22860 358.06876 L
119.22860 357.97493 L
119.22860 357.88110 L
119.32243 357.78728 L
119.41625 357.78728 L
119.51036 357.78728 L
119.60419 357.78728 L
@c
F
@rax %Note: Object
118.10126 357.78728 118.66479 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
118.47685 357.78728 m
118.47685 357.88110 L
118.57068 357.97493 L
118.66479 358.06876 L
118.66479 358.06876 L
118.57068 358.16315 L
118.47685 358.25698 L
118.38274 358.35080 L
118.38274 358.35080 L
118.28891 358.35080 L
118.19509 358.25698 L
118.10126 358.16315 L
118.10126 358.06876 L
118.10126 357.97493 L
118.10126 357.88110 L
118.19509 357.78728 L
118.28891 357.78728 L
118.38274 357.78728 L
118.47685 357.78728 L
@c
F
@rax %Note: Object
116.97392 357.78728 117.53773 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
117.34951 357.78728 m
117.34951 357.88110 L
117.44362 357.97493 L
117.53773 358.06876 L
117.53773 358.06876 L
117.44362 358.16315 L
117.34951 358.25698 L
117.25569 358.35080 L
117.25569 358.35080 L
117.16186 358.35080 L
117.06803 358.25698 L
116.97392 358.16315 L
116.97392 358.06876 L
116.97392 357.97493 L
116.97392 357.88110 L
117.06803 357.78728 L
117.16186 357.78728 L
117.25569 357.78728 L
117.34951 357.78728 L
@c
F
@rax %Note: Object
115.84658 357.78728 116.41039 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
116.22217 357.78728 m
116.22217 357.88110 L
116.31600 357.97493 L
116.41039 358.06876 L
116.41039 358.06876 L
116.31600 358.16315 L
116.22217 358.25698 L
116.12835 358.35080 L
116.12835 358.35080 L
116.03452 358.35080 L
115.94041 358.25698 L
115.84658 358.16315 L
115.84658 358.06876 L
115.84658 357.97493 L
115.84658 357.88110 L
115.94041 357.78728 L
116.03452 357.78728 L
116.12835 357.78728 L
116.22217 357.78728 L
@c
F
@rax %Note: Object
114.71924 357.78728 115.28277 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.09483 357.78728 m
115.09483 357.88110 L
115.18866 357.97493 L
115.28277 358.06876 L
115.28277 358.06876 L
115.18866 358.16315 L
115.09483 358.25698 L
115.00129 358.35080 L
115.00129 358.35080 L
114.90718 358.35080 L
114.81335 358.25698 L
114.71924 358.16315 L
114.71924 358.06876 L
114.71924 357.97493 L
114.71924 357.88110 L
114.81335 357.78728 L
114.90718 357.78728 L
115.00129 357.78728 L
115.09483 357.78728 L
@c
F
@rax %Note: Object
113.59191 357.78728 114.15543 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
113.96778 357.78728 m
113.96778 357.88110 L
114.06161 357.97493 L
114.15543 358.06876 L
114.15543 358.06876 L
114.06161 358.16315 L
113.96778 358.25698 L
113.87395 358.35080 L
113.87395 358.35080 L
113.77984 358.35080 L
113.68602 358.25698 L
113.59191 358.16315 L
113.59191 358.06876 L
113.59191 357.97493 L
113.59191 357.88110 L
113.68602 357.78728 L
113.77984 357.78728 L
113.87395 357.78728 L
113.96778 357.78728 L
@c
F
@rax %Note: Object
112.46457 357.78728 113.02809 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
112.84044 357.78728 m
112.84044 357.88110 L
112.93427 357.97493 L
113.02809 358.06876 L
113.02809 358.06876 L
112.93427 358.16315 L
112.84044 358.25698 L
112.74633 358.35080 L
112.74633 358.35080 L
112.65250 358.35080 L
112.55868 358.25698 L
112.46457 358.16315 L
112.46457 358.06876 L
112.46457 357.97493 L
112.46457 357.88110 L
112.55868 357.78728 L
112.65250 357.78728 L
112.74633 357.78728 L
112.84044 357.78728 L
@c
F
@rax %Note: Object
111.33723 357.78728 111.90104 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
111.71310 357.78728 m
111.71310 357.88110 L
111.80721 357.97493 L
111.90104 358.06876 L
111.90104 358.06876 L
111.80721 358.16315 L
111.71310 358.25698 L
111.61928 358.35080 L
111.61928 358.35080 L
111.52545 358.35080 L
111.43134 358.25698 L
111.33723 358.16315 L
111.33723 358.06876 L
111.33723 357.97493 L
111.33723 357.88110 L
111.43134 357.78728 L
111.52545 357.78728 L
111.61928 357.78728 L
111.71310 357.78728 L
@c
F
@rax %Note: Object
110.20989 357.78728 110.77370 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.58576 357.78728 m
110.58576 357.88110 L
110.67987 357.97493 L
110.77370 358.06876 L
110.77370 358.06876 L
110.67987 358.16315 L
110.58576 358.25698 L
110.49194 358.35080 L
110.49194 358.35080 L
110.39811 358.35080 L
110.30372 358.25698 L
110.20989 358.16315 L
110.20989 358.06876 L
110.20989 357.97493 L
110.20989 357.88110 L
110.30372 357.78728 L
110.39811 357.78728 L
110.49194 357.78728 L
110.58576 357.78728 L
@c
F
@rax %Note: Object
109.08283 357.78728 109.64636 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
109.45843 357.78728 m
109.45843 357.88110 L
109.55225 357.97493 L
109.64636 358.06876 L
109.64636 358.06876 L
109.55225 358.16315 L
109.45843 358.25698 L
109.36460 358.35080 L
109.36460 358.35080 L
109.27049 358.35080 L
109.17666 358.25698 L
109.08283 358.16315 L
109.08283 358.06876 L
109.08283 357.97493 L
109.08283 357.88110 L
109.17666 357.78728 L
109.27049 357.78728 L
109.36460 357.78728 L
109.45843 357.78728 L
@c
F
@rax %Note: Object
107.95550 357.78728 108.51902 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
108.33137 357.78728 m
108.33137 357.88110 L
108.42520 357.97493 L
108.51902 358.06876 L
108.51902 358.06876 L
108.42520 358.16315 L
108.33137 358.25698 L
108.23754 358.35080 L
108.23754 358.35080 L
108.14315 358.35080 L
108.04932 358.25698 L
107.95550 358.16315 L
107.95550 358.06876 L
107.95550 357.97493 L
107.95550 357.88110 L
108.04932 357.78728 L
108.14315 357.78728 L
108.23754 357.78728 L
108.33137 357.78728 L
@c
F
@rax %Note: Object
106.82816 357.78728 107.39169 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
107.20403 357.78728 m
107.20403 357.88110 L
107.29786 357.97493 L
107.39169 358.06876 L
107.39169 358.06876 L
107.29786 358.16315 L
107.20403 358.25698 L
107.10992 358.35080 L
107.10992 358.35080 L
107.01581 358.35080 L
106.92198 358.25698 L
106.82816 358.16315 L
106.82816 358.06876 L
106.82816 357.97493 L
106.82816 357.88110 L
106.92198 357.78728 L
107.01581 357.78728 L
107.10992 357.78728 L
107.20403 357.78728 L
@c
F
@rax %Note: Object
105.70082 357.78728 106.26463 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
106.07669 357.78728 m
106.07669 357.88110 L
106.17080 357.97493 L
106.26463 358.06876 L
106.26463 358.06876 L
106.17080 358.16315 L
106.07669 358.25698 L
105.98258 358.35080 L
105.98258 358.35080 L
105.88876 358.35080 L
105.79493 358.25698 L
105.70082 358.16315 L
105.70082 358.06876 L
105.70082 357.97493 L
105.70082 357.88110 L
105.79493 357.78728 L
105.88876 357.78728 L
105.98258 357.78728 L
106.07669 357.78728 L
@c
F
@rax %Note: Object
104.57348 357.78728 105.13729 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
104.94935 357.78728 m
104.94935 357.88110 L
105.04346 357.97493 L
105.13729 358.06876 L
105.13729 358.06876 L
105.04346 358.16315 L
104.94935 358.25698 L
104.85524 358.35080 L
104.85524 358.35080 L
104.76142 358.35080 L
104.66731 358.25698 L
104.57348 358.16315 L
104.57348 358.06876 L
104.57348 357.97493 L
104.57348 357.88110 L
104.66731 357.78728 L
104.76142 357.78728 L
104.85524 357.78728 L
104.94935 357.78728 L
@c
F
@rax %Note: Object
103.44614 357.78728 104.00995 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
103.82202 357.78728 m
103.82202 357.88110 L
103.91584 357.97493 L
104.00995 358.06876 L
104.00995 358.06876 L
103.91584 358.16315 L
103.82202 358.25698 L
103.72791 358.35080 L
103.72791 358.35080 L
103.63408 358.35080 L
103.53997 358.25698 L
103.44614 358.16315 L
103.44614 358.06876 L
103.44614 357.97493 L
103.44614 357.88110 L
103.53997 357.78728 L
103.63408 357.78728 L
103.72791 357.78728 L
103.82202 357.78728 L
@c
F
@rax %Note: Object
102.31909 357.78728 102.88261 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
102.69468 357.78728 m
102.69468 357.88110 L
102.78879 357.97493 L
102.88261 358.06876 L
102.88261 358.06876 L
102.78879 358.16315 L
102.69468 358.25698 L
102.60085 358.35080 L
102.60085 358.35080 L
102.50674 358.35080 L
102.41291 358.25698 L
102.31909 358.16315 L
102.31909 358.06876 L
102.31909 357.97493 L
102.31909 357.88110 L
102.41291 357.78728 L
102.50674 357.78728 L
102.60085 357.78728 L
102.69468 357.78728 L
@c
F
@rax %Note: Object
101.19175 357.78728 101.75528 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
101.56734 357.78728 m
101.56734 357.88110 L
101.66145 357.97493 L
101.75528 358.06876 L
101.75528 358.06876 L
101.66145 358.16315 L
101.56734 358.25698 L
101.47323 358.35080 L
101.47323 358.35080 L
101.37940 358.35080 L
101.28557 358.25698 L
101.19175 358.16315 L
101.19175 358.06876 L
101.19175 357.97493 L
101.19175 357.88110 L
101.28557 357.78728 L
101.37940 357.78728 L
101.47323 357.78728 L
101.56734 357.78728 L
@c
F
@rax %Note: Object
100.06441 357.78728 100.62794 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
100.44000 357.78728 m
100.44000 357.88110 L
100.53439 357.97493 L
100.62794 358.06876 L
100.62794 358.06876 L
100.53439 358.16315 L
100.44000 358.25698 L
100.34617 358.35080 L
100.34617 358.35080 L
100.25235 358.35080 L
100.15852 358.25698 L
100.06441 358.16315 L
100.06441 358.06876 L
100.06441 357.97493 L
100.06441 357.88110 L
100.15852 357.78728 L
100.25235 357.78728 L
100.34617 357.78728 L
100.44000 357.78728 L
@c
F
@rax %Note: Object
98.93707 357.78728 99.50088 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
99.31266 357.78728 m
99.31266 357.88110 L
99.40677 357.97493 L
99.50088 358.06876 L
99.50088 358.06876 L
99.40677 358.16315 L
99.31266 358.25698 L
99.21883 358.35080 L
99.21883 358.35080 L
99.12501 358.35080 L
99.03118 358.25698 L
98.93707 358.16315 L
98.93707 358.06876 L
98.93707 357.97493 L
98.93707 357.88110 L
99.03118 357.78728 L
99.12501 357.78728 L
99.21883 357.78728 L
99.31266 357.78728 L
@c
F
@rax %Note: Object
97.80973 357.78728 98.37354 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
98.18532 357.78728 m
98.18532 357.88110 L
98.27915 357.97493 L
98.37354 358.06876 L
98.37354 358.06876 L
98.27915 358.16315 L
98.18532 358.25698 L
98.09150 358.35080 L
98.09150 358.35080 L
97.99767 358.35080 L
97.90356 358.25698 L
97.80973 358.16315 L
97.80973 358.06876 L
97.80973 357.97493 L
97.80973 357.88110 L
97.90356 357.78728 L
97.99767 357.78728 L
98.09150 357.78728 L
98.18532 357.78728 L
@c
F
@rax %Note: Object
96.68268 357.78728 97.24620 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
97.05827 357.78728 m
97.05827 357.88110 L
97.15209 357.97493 L
97.24620 358.06876 L
97.24620 358.06876 L
97.15209 358.16315 L
97.05827 358.25698 L
96.96444 358.35080 L
96.96444 358.35080 L
96.87033 358.35080 L
96.77650 358.25698 L
96.68268 358.16315 L
96.68268 358.06876 L
96.68268 357.97493 L
96.68268 357.88110 L
96.77650 357.78728 L
96.87033 357.78728 L
96.96444 357.78728 L
97.05827 357.78728 L
@c
F
@rax %Note: Object
95.55506 357.78728 96.11887 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
95.93093 357.78728 m
95.93093 357.88110 L
96.02476 357.97493 L
96.11887 358.06876 L
96.11887 358.06876 L
96.02476 358.16315 L
95.93093 358.25698 L
95.83682 358.35080 L
95.83682 358.35080 L
95.74299 358.35080 L
95.64917 358.25698 L
95.55506 358.16315 L
95.55506 358.06876 L
95.55506 357.97493 L
95.55506 357.88110 L
95.64917 357.78728 L
95.74299 357.78728 L
95.83682 357.78728 L
95.93093 357.78728 L
@c
F
@rax %Note: Object
94.42772 357.78728 94.99124 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
94.80359 357.78728 m
94.80359 357.88110 L
94.89742 357.97493 L
94.99124 358.06876 L
94.99124 358.06876 L
94.89742 358.16315 L
94.80359 358.25698 L
94.70976 358.35080 L
94.70976 358.35080 L
94.61594 358.35080 L
94.52211 358.25698 L
94.42772 358.16315 L
94.42772 358.06876 L
94.42772 357.97493 L
94.42772 357.88110 L
94.52211 357.78728 L
94.61594 357.78728 L
94.70976 357.78728 L
94.80359 357.78728 L
@c
F
@rax %Note: Object
93.30038 357.78728 93.86419 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
93.67625 357.78728 m
93.67625 357.88110 L
93.77036 357.97493 L
93.86419 358.06876 L
93.86419 358.06876 L
93.77036 358.16315 L
93.67625 358.25698 L
93.58243 358.35080 L
93.58243 358.35080 L
93.48860 358.35080 L
93.39449 358.25698 L
93.30038 358.16315 L
93.30038 358.06876 L
93.30038 357.97493 L
93.30038 357.88110 L
93.39449 357.78728 L
93.48860 357.78728 L
93.58243 357.78728 L
93.67625 357.78728 L
@c
F
@rax %Note: Object
92.17304 357.78728 92.73685 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
92.54891 357.78728 m
92.54891 357.88110 L
92.64274 357.97493 L
92.73685 358.06876 L
92.73685 358.06876 L
92.64274 358.16315 L
92.54891 358.25698 L
92.45509 358.35080 L
92.45509 358.35080 L
92.36126 358.35080 L
92.26687 358.25698 L
92.17304 358.16315 L
92.17304 358.06876 L
92.17304 357.97493 L
92.17304 357.88110 L
92.26687 357.78728 L
92.36126 357.78728 L
92.45509 357.78728 L
92.54891 357.78728 L
@c
F
@rax %Note: Object
91.04598 357.78728 91.60951 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
91.42186 357.78728 m
91.42186 357.88110 L
91.51569 357.97493 L
91.60951 358.06876 L
91.60951 358.06876 L
91.51569 358.16315 L
91.42186 358.25698 L
91.32803 358.35080 L
91.32803 358.35080 L
91.23392 358.35080 L
91.13981 358.25698 L
91.04598 358.16315 L
91.04598 358.06876 L
91.04598 357.97493 L
91.04598 357.88110 L
91.13981 357.78728 L
91.23392 357.78728 L
91.32803 357.78728 L
91.42186 357.78728 L
@c
F
@rax %Note: Object
89.91865 357.78728 90.48217 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
90.29452 357.78728 m
90.29452 357.88110 L
90.38835 357.97493 L
90.48217 358.06876 L
90.48217 358.06876 L
90.38835 358.16315 L
90.29452 358.25698 L
90.20041 358.35080 L
90.20041 358.35080 L
90.10658 358.35080 L
90.01247 358.25698 L
89.91865 358.16315 L
89.91865 358.06876 L
89.91865 357.97493 L
89.91865 357.88110 L
90.01247 357.78728 L
90.10658 357.78728 L
90.20041 357.78728 L
90.29452 357.78728 L
@c
F
@rax %Note: Object
88.79131 357.78728 89.35483 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
89.16718 357.78728 m
89.16718 357.88110 L
89.26101 357.97493 L
89.35483 358.06876 L
89.35483 358.06876 L
89.26101 358.16315 L
89.16718 358.25698 L
89.07307 358.35080 L
89.07307 358.35080 L
88.97896 358.35080 L
88.88542 358.25698 L
88.79131 358.16315 L
88.79131 358.06876 L
88.79131 357.97493 L
88.79131 357.88110 L
88.88542 357.78728 L
88.97896 357.78728 L
89.07307 357.78728 L
89.16718 357.78728 L
@c
F
@rax %Note: Object
87.66397 357.78728 88.22778 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
88.03984 357.78728 m
88.03984 357.88110 L
88.13395 357.97493 L
88.22778 358.06876 L
88.22778 358.06876 L
88.13395 358.16315 L
88.03984 358.25698 L
87.94602 358.35080 L
87.94602 358.35080 L
87.85191 358.35080 L
87.75808 358.25698 L
87.66397 358.16315 L
87.66397 358.06876 L
87.66397 357.97493 L
87.66397 357.88110 L
87.75808 357.78728 L
87.85191 357.78728 L
87.94602 357.78728 L
88.03984 357.78728 L
@c
F
@rax %Note: Object
86.53663 357.78728 87.10044 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
86.91250 357.78728 m
86.91250 357.88110 L
87.00633 357.97493 L
87.10044 358.06876 L
87.10044 358.06876 L
87.00633 358.16315 L
86.91250 358.25698 L
86.81868 358.35080 L
86.81868 358.35080 L
86.72457 358.35080 L
86.63046 358.25698 L
86.53663 358.16315 L
86.53663 358.06876 L
86.53663 357.97493 L
86.53663 357.88110 L
86.63046 357.78728 L
86.72457 357.78728 L
86.81868 357.78728 L
86.91250 357.78728 L
@c
F
@rax %Note: Object
85.40957 357.78728 85.97310 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
85.78545 357.78728 m
85.78545 357.88110 L
85.87928 357.97493 L
85.97310 358.06876 L
85.97310 358.06876 L
85.87928 358.16315 L
85.78545 358.25698 L
85.69134 358.35080 L
85.69134 358.35080 L
85.59723 358.35080 L
85.50340 358.25698 L
85.40957 358.16315 L
85.40957 358.06876 L
85.40957 357.97493 L
85.40957 357.88110 L
85.50340 357.78728 L
85.59723 357.78728 L
85.69134 357.78728 L
85.78545 357.78728 L
@c
F
@rax %Note: Object
84.28224 357.78728 84.84576 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
84.65811 357.78728 m
84.65811 357.88110 L
84.75194 357.97493 L
84.84576 358.06876 L
84.84576 358.06876 L
84.75194 358.16315 L
84.65811 358.25698 L
84.56400 358.35080 L
84.56400 358.35080 L
84.46989 358.35080 L
84.37606 358.25698 L
84.28224 358.16315 L
84.28224 358.06876 L
84.28224 357.97493 L
84.28224 357.88110 L
84.37606 357.78728 L
84.46989 357.78728 L
84.56400 357.78728 L
84.65811 357.78728 L
@c
F
@rax %Note: Object
83.15490 357.78728 83.71843 358.35080 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.71843 357.97493 m
83.71843 358.06876 L
83.62460 358.16315 L
83.53077 358.25698 L
83.43638 358.35080 L
83.43638 358.35080 L
83.34255 358.25698 L
83.24872 358.16315 L
83.15490 358.06876 L
83.15490 358.06876 L
83.15490 358.06876 L
83.24872 357.97493 L
83.34255 357.88110 L
83.43638 357.78728 L
83.43638 357.78728 L
83.53077 357.88110 L
83.62460 357.97493 L
83.71843 357.97493 L
@c
F
@rax %Note: Object
83.15490 356.65994 83.71843 357.22346 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.71843 356.84787 m
83.71843 356.94170 L
83.62460 357.03581 L
83.53077 357.12964 L
83.43638 357.22346 L
83.43638 357.22346 L
83.34255 357.12964 L
83.24872 357.03581 L
83.15490 356.94170 L
83.15490 356.94170 L
83.15490 356.94170 L
83.24872 356.84787 L
83.34255 356.75376 L
83.43638 356.65994 L
83.43638 356.65994 L
83.53077 356.75376 L
83.62460 356.84787 L
83.71843 356.84787 L
@c
F
@rax %Note: Object
83.15490 355.53260 83.71843 356.09641 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.71843 355.72054 m
83.71843 355.81436 L
83.62460 355.90819 L
83.53077 356.00230 L
83.43638 356.09641 L
83.43638 356.09641 L
83.34255 356.00230 L
83.24872 355.90819 L
83.15490 355.81436 L
83.15490 355.81436 L
83.15490 355.81436 L
83.24872 355.72054 L
83.34255 355.62643 L
83.43638 355.53260 L
83.43638 355.53260 L
83.53077 355.62643 L
83.62460 355.72054 L
83.71843 355.72054 L
@c
F
@rax %Note: Object
83.15490 354.40526 83.71843 354.96907 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.71843 354.59291 m
83.71843 354.68702 L
83.62460 354.78085 L
83.53077 354.87496 L
83.43638 354.96907 L
83.43638 354.96907 L
83.34255 354.87496 L
83.24872 354.78085 L
83.15490 354.68702 L
83.15490 354.68702 L
83.15490 354.68702 L
83.24872 354.59291 L
83.34255 354.49909 L
83.43638 354.40526 L
83.43638 354.40526 L
83.53077 354.49909 L
83.62460 354.59291 L
83.71843 354.59291 L
@c
F
@rax %Note: Object
83.15490 353.27820 83.71843 353.84173 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.71843 353.46586 m
83.71843 353.55969 L
83.62460 353.65380 L
83.53077 353.74791 L
83.43638 353.84173 L
83.43638 353.84173 L
83.34255 353.74791 L
83.24872 353.65380 L
83.15490 353.55969 L
83.15490 353.55969 L
83.15490 353.55969 L
83.24872 353.46586 L
83.34255 353.37203 L
83.43638 353.27820 L
83.43638 353.27820 L
83.53077 353.37203 L
83.62460 353.46586 L
83.71843 353.46586 L
@c
F
@rax %Note: Object
83.15490 352.15087 83.71843 352.71439 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.71843 352.33852 m
83.71843 352.43235 L
83.62460 352.52646 L
83.53077 352.62028 L
83.43638 352.71439 L
83.43638 352.71439 L
83.34255 352.62028 L
83.24872 352.52646 L
83.15490 352.43235 L
83.15490 352.43235 L
83.15490 352.43235 L
83.24872 352.33852 L
83.34255 352.24469 L
83.43638 352.15087 L
83.43638 352.15087 L
83.53077 352.24469 L
83.62460 352.33852 L
83.71843 352.33852 L
@c
F
@rax %Note: Object
83.15490 351.02353 83.71843 351.58706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.71843 351.21146 m
83.71843 351.30529 L
83.62460 351.39883 L
83.53077 351.49294 L
83.43638 351.58706 L
83.43638 351.58706 L
83.34255 351.49294 L
83.24872 351.39883 L
83.15490 351.30529 L
83.15490 351.30529 L
83.15490 351.30529 L
83.24872 351.21146 L
83.34255 351.11735 L
83.43638 351.02353 L
83.43638 351.02353 L
83.53077 351.11735 L
83.62460 351.21146 L
83.71843 351.21146 L
@c
F
@rax %Note: Object
83.15490 349.89619 83.71843 350.46000 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.71843 350.08413 m
83.71843 350.17795 L
83.62460 350.27178 L
83.53077 350.36561 L
83.43638 350.46000 L
83.43638 350.46000 L
83.34255 350.36561 L
83.24872 350.27178 L
83.15490 350.17795 L
83.15490 350.17795 L
83.15490 350.17795 L
83.24872 350.08413 L
83.34255 349.99002 L
83.43638 349.89619 L
83.43638 349.89619 L
83.53077 349.99002 L
83.62460 350.08413 L
83.71843 350.08413 L
@c
F
@rax %Note: Object
83.15490 348.76857 83.71843 349.33238 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.71843 348.95650 m
83.71843 349.05061 L
83.62460 349.14444 L
83.53077 349.23827 L
83.43638 349.33238 L
83.43638 349.33238 L
83.34255 349.23827 L
83.24872 349.14444 L
83.15490 349.05061 L
83.15490 349.05061 L
83.15490 349.05061 L
83.24872 348.95650 L
83.34255 348.86268 L
83.43638 348.76857 L
83.43638 348.76857 L
83.53077 348.86268 L
83.62460 348.95650 L
83.71843 348.95650 L
@c
F
@rax %Note: Object
83.15490 347.64151 83.71843 348.20504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.71843 347.82945 m
83.71843 347.92328 L
83.62460 348.01739 L
83.53077 348.11121 L
83.43638 348.20504 L
83.43638 348.20504 L
83.34255 348.11121 L
83.24872 348.01739 L
83.15490 347.92328 L
83.15490 347.92328 L
83.15490 347.92328 L
83.24872 347.82945 L
83.34255 347.73562 L
83.43638 347.64151 L
83.43638 347.64151 L
83.53077 347.73562 L
83.62460 347.82945 L
83.71843 347.82945 L
@c
F
@rax %Note: Object
83.15490 346.51417 83.71843 347.07770 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.71843 346.70211 m
83.71843 346.79594 L
83.62460 346.89005 L
83.53077 346.98387 L
83.43638 347.07770 L
83.43638 347.07770 L
83.34255 346.98387 L
83.24872 346.89005 L
83.15490 346.79594 L
83.15490 346.79594 L
83.15490 346.79594 L
83.24872 346.70211 L
83.34255 346.60828 L
83.43638 346.51417 L
83.43638 346.51417 L
83.53077 346.60828 L
83.62460 346.70211 L
83.71843 346.70211 L
@c
F
@rax %Note: Object
83.15490 345.38683 83.71843 345.95036 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
83.71843 345.57477 m
83.71843 345.66860 L
83.62460 345.76243 L
83.53077 345.85654 L
83.43638 345.95036 L
83.43638 345.95036 L
83.34255 345.85654 L
83.24872 345.76243 L
83.15490 345.66860 L
83.15490 345.66860 L
83.15490 345.66860 L
83.24872 345.57477 L
83.34255 345.48066 L
83.43638 345.38683 L
83.43638 345.38683 L
83.53077 345.48066 L
83.62460 345.57477 L
83.71843 345.57477 L
@c
F
@rax %Note: Object
167.79600 355.06290 173.62063 360.98135 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
167.79600 355.06290 m
173.62063 358.06876 L
167.79600 360.98135 L
167.79600 355.06290 L
@c
F
@rax %Note: Object
218.43099 438.95282 218.99452 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
218.80658 438.95282 m
218.80658 439.04665 L
218.90069 439.14047 L
218.99452 439.23458 L
218.99452 439.23458 L
218.90069 439.32869 L
218.80658 439.42252 L
218.71276 439.51635 L
218.71276 439.51635 L
218.61865 439.51635 L
218.52482 439.42252 L
218.43099 439.32869 L
218.43099 439.23458 L
218.43099 439.14047 L
218.43099 439.04665 L
218.52482 438.95282 L
218.61865 438.95282 L
218.71276 438.95282 L
218.80658 438.95282 L
@c
F
@rax %Note: Object
217.30365 438.95282 217.86718 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
217.67924 438.95282 m
217.67924 439.04665 L
217.77335 439.14047 L
217.86718 439.23458 L
217.86718 439.23458 L
217.77335 439.32869 L
217.67924 439.42252 L
217.58542 439.51635 L
217.58542 439.51635 L
217.49131 439.51635 L
217.39748 439.42252 L
217.30365 439.32869 L
217.30365 439.23458 L
217.30365 439.14047 L
217.30365 439.04665 L
217.39748 438.95282 L
217.49131 438.95282 L
217.58542 438.95282 L
217.67924 438.95282 L
@c
F
@rax %Note: Object
216.17631 438.95282 216.73984 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
216.55191 438.95282 m
216.55191 439.04665 L
216.64602 439.14047 L
216.73984 439.23458 L
216.73984 439.23458 L
216.64602 439.32869 L
216.55191 439.42252 L
216.45808 439.51635 L
216.45808 439.51635 L
216.36425 439.51635 L
216.27043 439.42252 L
216.17631 439.32869 L
216.17631 439.23458 L
216.17631 439.14047 L
216.17631 439.04665 L
216.27043 438.95282 L
216.36425 438.95282 L
216.45808 438.95282 L
216.55191 438.95282 L
@c
F
@rax %Note: Object
215.04898 438.95282 215.61279 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
215.42457 438.95282 m
215.42457 439.04665 L
215.51868 439.14047 L
215.61279 439.23458 L
215.61279 439.23458 L
215.51868 439.32869 L
215.42457 439.42252 L
215.33074 439.51635 L
215.33074 439.51635 L
215.23691 439.51635 L
215.14309 439.42252 L
215.04898 439.32869 L
215.04898 439.23458 L
215.04898 439.14047 L
215.04898 439.04665 L
215.14309 438.95282 L
215.23691 438.95282 L
215.33074 438.95282 L
215.42457 438.95282 L
@c
F
@rax %Note: Object
213.92164 438.95282 214.48545 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
214.29723 438.95282 m
214.29723 439.04665 L
214.39106 439.14047 L
214.48545 439.23458 L
214.48545 439.23458 L
214.39106 439.32869 L
214.29723 439.42252 L
214.20340 439.51635 L
214.20340 439.51635 L
214.10957 439.51635 L
214.01546 439.42252 L
213.92164 439.32869 L
213.92164 439.23458 L
213.92164 439.14047 L
213.92164 439.04665 L
214.01546 438.95282 L
214.10957 438.95282 L
214.20340 438.95282 L
214.29723 438.95282 L
@c
F
@rax %Note: Object
212.79430 438.95282 213.35783 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
213.17017 438.95282 m
213.17017 439.04665 L
213.26400 439.14047 L
213.35783 439.23458 L
213.35783 439.23458 L
213.26400 439.32869 L
213.17017 439.42252 L
213.07635 439.51635 L
213.07635 439.51635 L
212.98224 439.51635 L
212.88841 439.42252 L
212.79430 439.32869 L
212.79430 439.23458 L
212.79430 439.14047 L
212.79430 439.04665 L
212.88841 438.95282 L
212.98224 438.95282 L
213.07635 438.95282 L
213.17017 438.95282 L
@c
F
@rax %Note: Object
211.66696 438.95282 212.23049 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
212.04283 438.95282 m
212.04283 439.04665 L
212.13666 439.14047 L
212.23049 439.23458 L
212.23049 439.23458 L
212.13666 439.32869 L
212.04283 439.42252 L
211.94901 439.51635 L
211.94901 439.51635 L
211.85490 439.51635 L
211.76107 439.42252 L
211.66696 439.32869 L
211.66696 439.23458 L
211.66696 439.14047 L
211.66696 439.04665 L
211.76107 438.95282 L
211.85490 438.95282 L
211.94901 438.95282 L
212.04283 438.95282 L
@c
F
@rax %Note: Object
210.53962 438.95282 211.10315 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
210.91550 438.95282 m
210.91550 439.04665 L
211.00932 439.14047 L
211.10315 439.23458 L
211.10315 439.23458 L
211.00932 439.32869 L
210.91550 439.42252 L
210.82167 439.51635 L
210.82167 439.51635 L
210.72784 439.51635 L
210.63373 439.42252 L
210.53962 439.32869 L
210.53962 439.23458 L
210.53962 439.14047 L
210.53962 439.04665 L
210.63373 438.95282 L
210.72784 438.95282 L
210.82167 438.95282 L
210.91550 438.95282 L
@c
F
@rax %Note: Object
209.41228 438.95282 209.97609 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
209.78816 438.95282 m
209.78816 439.04665 L
209.88227 439.14047 L
209.97609 439.23458 L
209.97609 439.23458 L
209.88227 439.32869 L
209.78816 439.42252 L
209.69433 439.51635 L
209.69433 439.51635 L
209.60050 439.51635 L
209.50639 439.42252 L
209.41228 439.32869 L
209.41228 439.23458 L
209.41228 439.14047 L
209.41228 439.04665 L
209.50639 438.95282 L
209.60050 438.95282 L
209.69433 438.95282 L
209.78816 438.95282 L
@c
F
@rax %Note: Object
208.28494 438.95282 208.84876 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
208.66082 438.95282 m
208.66082 439.04665 L
208.75465 439.14047 L
208.84876 439.23458 L
208.84876 439.23458 L
208.75465 439.32869 L
208.66082 439.42252 L
208.56699 439.51635 L
208.56699 439.51635 L
208.47317 439.51635 L
208.37877 439.42252 L
208.28494 439.32869 L
208.28494 439.23458 L
208.28494 439.14047 L
208.28494 439.04665 L
208.37877 438.95282 L
208.47317 438.95282 L
208.56699 438.95282 L
208.66082 438.95282 L
@c
F
@rax %Note: Object
207.15789 438.95282 207.72142 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
207.53376 438.95282 m
207.53376 439.04665 L
207.62759 439.14047 L
207.72142 439.23458 L
207.72142 439.23458 L
207.62759 439.32869 L
207.53376 439.42252 L
207.43994 439.51635 L
207.43994 439.51635 L
207.34583 439.51635 L
207.25172 439.42252 L
207.15789 439.32869 L
207.15789 439.23458 L
207.15789 439.14047 L
207.15789 439.04665 L
207.25172 438.95282 L
207.34583 438.95282 L
207.43994 438.95282 L
207.53376 438.95282 L
@c
F
@rax %Note: Object
206.03055 438.95282 206.59408 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
206.40643 438.95282 m
206.40643 439.04665 L
206.50025 439.14047 L
206.59408 439.23458 L
206.59408 439.23458 L
206.50025 439.32869 L
206.40643 439.42252 L
206.31260 439.51635 L
206.31260 439.51635 L
206.21820 439.51635 L
206.12438 439.42252 L
206.03055 439.32869 L
206.03055 439.23458 L
206.03055 439.14047 L
206.03055 439.04665 L
206.12438 438.95282 L
206.21820 438.95282 L
206.31260 438.95282 L
206.40643 438.95282 L
@c
F
@rax %Note: Object
204.90321 438.95282 205.46674 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
205.27909 438.95282 m
205.27909 439.04665 L
205.37291 439.14047 L
205.46674 439.23458 L
205.46674 439.23458 L
205.37291 439.32869 L
205.27909 439.42252 L
205.18498 439.51635 L
205.18498 439.51635 L
205.09087 439.51635 L
204.99732 439.42252 L
204.90321 439.32869 L
204.90321 439.23458 L
204.90321 439.14047 L
204.90321 439.04665 L
204.99732 438.95282 L
205.09087 438.95282 L
205.18498 438.95282 L
205.27909 438.95282 L
@c
F
@rax %Note: Object
203.77587 438.95282 204.33969 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
204.15175 438.95282 m
204.15175 439.04665 L
204.24586 439.14047 L
204.33969 439.23458 L
204.33969 439.23458 L
204.24586 439.32869 L
204.15175 439.42252 L
204.05764 439.51635 L
204.05764 439.51635 L
203.96381 439.51635 L
203.86998 439.42252 L
203.77587 439.32869 L
203.77587 439.23458 L
203.77587 439.14047 L
203.77587 439.04665 L
203.86998 438.95282 L
203.96381 438.95282 L
204.05764 438.95282 L
204.15175 438.95282 L
@c
F
@rax %Note: Object
202.64854 438.95282 203.21235 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
203.02441 438.95282 m
203.02441 439.04665 L
203.11852 439.14047 L
203.21235 439.23458 L
203.21235 439.23458 L
203.11852 439.32869 L
203.02441 439.42252 L
202.93030 439.51635 L
202.93030 439.51635 L
202.83647 439.51635 L
202.74236 439.42252 L
202.64854 439.32869 L
202.64854 439.23458 L
202.64854 439.14047 L
202.64854 439.04665 L
202.74236 438.95282 L
202.83647 438.95282 L
202.93030 438.95282 L
203.02441 438.95282 L
@c
F
@rax %Note: Object
201.52148 438.95282 202.08501 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
201.89735 438.95282 m
201.89735 439.04665 L
201.99118 439.14047 L
202.08501 439.23458 L
202.08501 439.23458 L
201.99118 439.32869 L
201.89735 439.42252 L
201.80324 439.51635 L
201.80324 439.51635 L
201.70913 439.51635 L
201.61531 439.42252 L
201.52148 439.32869 L
201.52148 439.23458 L
201.52148 439.14047 L
201.52148 439.04665 L
201.61531 438.95282 L
201.70913 438.95282 L
201.80324 438.95282 L
201.89735 438.95282 L
@c
F
@rax %Note: Object
200.39414 438.95282 200.95767 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
200.76973 438.95282 m
200.76973 439.04665 L
200.86384 439.14047 L
200.95767 439.23458 L
200.95767 439.23458 L
200.86384 439.32869 L
200.76973 439.42252 L
200.67591 439.51635 L
200.67591 439.51635 L
200.58180 439.51635 L
200.48797 439.42252 L
200.39414 439.32869 L
200.39414 439.23458 L
200.39414 439.14047 L
200.39414 439.04665 L
200.48797 438.95282 L
200.58180 438.95282 L
200.67591 438.95282 L
200.76973 438.95282 L
@c
F
@rax %Note: Object
199.26680 438.95282 199.83033 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
199.64239 438.95282 m
199.64239 439.04665 L
199.73650 439.14047 L
199.83033 439.23458 L
199.83033 439.23458 L
199.73650 439.32869 L
199.64239 439.42252 L
199.54828 439.51635 L
199.54828 439.51635 L
199.45446 439.51635 L
199.36063 439.42252 L
199.26680 439.32869 L
199.26680 439.23458 L
199.26680 439.14047 L
199.26680 439.04665 L
199.36063 438.95282 L
199.45446 438.95282 L
199.54828 438.95282 L
199.64239 438.95282 L
@c
F
@rax %Note: Object
198.13946 438.95282 198.70328 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
198.51506 438.95282 m
198.51506 439.04665 L
198.60945 439.14047 L
198.70328 439.23458 L
198.70328 439.23458 L
198.60945 439.32869 L
198.51506 439.42252 L
198.42123 439.51635 L
198.42123 439.51635 L
198.32740 439.51635 L
198.23357 439.42252 L
198.13946 439.32869 L
198.13946 439.23458 L
198.13946 439.14047 L
198.13946 439.04665 L
198.23357 438.95282 L
198.32740 438.95282 L
198.42123 438.95282 L
198.51506 438.95282 L
@c
F
@rax %Note: Object
197.01213 438.95282 197.57594 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
197.38772 438.95282 m
197.38772 439.04665 L
197.48183 439.14047 L
197.57594 439.23458 L
197.57594 439.23458 L
197.48183 439.32869 L
197.38772 439.42252 L
197.29389 439.51635 L
197.29389 439.51635 L
197.20006 439.51635 L
197.10595 439.42252 L
197.01213 439.32869 L
197.01213 439.23458 L
197.01213 439.14047 L
197.01213 439.04665 L
197.10595 438.95282 L
197.20006 438.95282 L
197.29389 438.95282 L
197.38772 438.95282 L
@c
F
@rax %Note: Object
195.88507 438.95282 196.44860 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
196.26066 438.95282 m
196.26066 439.04665 L
196.35449 439.14047 L
196.44860 439.23458 L
196.44860 439.23458 L
196.35449 439.32869 L
196.26066 439.42252 L
196.16683 439.51635 L
196.16683 439.51635 L
196.07272 439.51635 L
195.97890 439.42252 L
195.88507 439.32869 L
195.88507 439.23458 L
195.88507 439.14047 L
195.88507 439.04665 L
195.97890 438.95282 L
196.07272 438.95282 L
196.16683 438.95282 L
196.26066 438.95282 L
@c
F
@rax %Note: Object
194.75773 438.95282 195.32126 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
195.13332 438.95282 m
195.13332 439.04665 L
195.22715 439.14047 L
195.32126 439.23458 L
195.32126 439.23458 L
195.22715 439.32869 L
195.13332 439.42252 L
195.03950 439.51635 L
195.03950 439.51635 L
194.94539 439.51635 L
194.85156 439.42252 L
194.75773 439.32869 L
194.75773 439.23458 L
194.75773 439.14047 L
194.75773 439.04665 L
194.85156 438.95282 L
194.94539 438.95282 L
195.03950 438.95282 L
195.13332 438.95282 L
@c
F
@rax %Note: Object
193.63011 438.95282 194.19392 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
194.00598 438.95282 m
194.00598 439.04665 L
194.09981 439.14047 L
194.19392 439.23458 L
194.19392 439.23458 L
194.09981 439.32869 L
194.00598 439.42252 L
193.91187 439.51635 L
193.91187 439.51635 L
193.81805 439.51635 L
193.72422 439.42252 L
193.63011 439.32869 L
193.63011 439.23458 L
193.63011 439.14047 L
193.63011 439.04665 L
193.72422 438.95282 L
193.81805 438.95282 L
193.91187 438.95282 L
194.00598 438.95282 L
@c
F
@rax %Note: Object
192.50277 438.95282 193.06658 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
192.87865 438.95282 m
192.87865 439.04665 L
192.97276 439.14047 L
193.06658 439.23458 L
193.06658 439.23458 L
192.97276 439.32869 L
192.87865 439.42252 L
192.78482 439.51635 L
192.78482 439.51635 L
192.69099 439.51635 L
192.59717 439.42252 L
192.50277 439.32869 L
192.50277 439.23458 L
192.50277 439.14047 L
192.50277 439.04665 L
192.59717 438.95282 L
192.69099 438.95282 L
192.78482 438.95282 L
192.87865 438.95282 L
@c
F
@rax %Note: Object
191.37543 438.95282 191.93924 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
191.75131 438.95282 m
191.75131 439.04665 L
191.84542 439.14047 L
191.93924 439.23458 L
191.93924 439.23458 L
191.84542 439.32869 L
191.75131 439.42252 L
191.65748 439.51635 L
191.65748 439.51635 L
191.56365 439.51635 L
191.46954 439.42252 L
191.37543 439.32869 L
191.37543 439.23458 L
191.37543 439.14047 L
191.37543 439.04665 L
191.46954 438.95282 L
191.56365 438.95282 L
191.65748 438.95282 L
191.75131 438.95282 L
@c
F
@rax %Note: Object
190.24838 438.95282 190.81191 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
190.62397 438.95282 m
190.62397 439.04665 L
190.71780 439.14047 L
190.81191 439.23458 L
190.81191 439.23458 L
190.71780 439.32869 L
190.62397 439.42252 L
190.53043 439.51635 L
190.53043 439.51635 L
190.43631 439.51635 L
190.34220 439.42252 L
190.24838 439.32869 L
190.24838 439.23458 L
190.24838 439.14047 L
190.24838 439.04665 L
190.34220 438.95282 L
190.43631 438.95282 L
190.53043 438.95282 L
190.62397 438.95282 L
@c
F
@rax %Note: Object
189.12104 438.95282 189.68457 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
189.49691 438.95282 m
189.49691 439.04665 L
189.59074 439.14047 L
189.68457 439.23458 L
189.68457 439.23458 L
189.59074 439.32869 L
189.49691 439.42252 L
189.40309 439.51635 L
189.40309 439.51635 L
189.30898 439.51635 L
189.21487 439.42252 L
189.12104 439.32869 L
189.12104 439.23458 L
189.12104 439.14047 L
189.12104 439.04665 L
189.21487 438.95282 L
189.30898 438.95282 L
189.40309 438.95282 L
189.49691 438.95282 L
@c
F
@rax %Note: Object
187.99370 438.95282 188.55723 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
188.36957 438.95282 m
188.36957 439.04665 L
188.46340 439.14047 L
188.55723 439.23458 L
188.55723 439.23458 L
188.46340 439.32869 L
188.36957 439.42252 L
188.27546 439.51635 L
188.27546 439.51635 L
188.18164 439.51635 L
188.08753 439.42252 L
187.99370 439.32869 L
187.99370 439.23458 L
187.99370 439.14047 L
187.99370 439.04665 L
188.08753 438.95282 L
188.18164 438.95282 L
188.27546 438.95282 L
188.36957 438.95282 L
@c
F
@rax %Note: Object
186.86636 438.95282 187.43017 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
187.24224 438.95282 m
187.24224 439.04665 L
187.33635 439.14047 L
187.43017 439.23458 L
187.43017 439.23458 L
187.33635 439.32869 L
187.24224 439.42252 L
187.14841 439.51635 L
187.14841 439.51635 L
187.05430 439.51635 L
186.96047 439.42252 L
186.86636 439.32869 L
186.86636 439.23458 L
186.86636 439.14047 L
186.86636 439.04665 L
186.96047 438.95282 L
187.05430 438.95282 L
187.14841 438.95282 L
187.24224 438.95282 L
@c
F
@rax %Note: Object
185.73902 438.95282 186.30283 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
186.11490 438.95282 m
186.11490 439.04665 L
186.20901 439.14047 L
186.30283 439.23458 L
186.30283 439.23458 L
186.20901 439.32869 L
186.11490 439.42252 L
186.02107 439.51635 L
186.02107 439.51635 L
185.92696 439.51635 L
185.83313 439.42252 L
185.73902 439.32869 L
185.73902 439.23458 L
185.73902 439.14047 L
185.73902 439.04665 L
185.83313 438.95282 L
185.92696 438.95282 L
186.02107 438.95282 L
186.11490 438.95282 L
@c
F
@rax %Note: Object
184.61197 438.95282 185.17550 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
184.98756 438.95282 m
184.98756 439.04665 L
185.08139 439.14047 L
185.17550 439.23458 L
185.17550 439.23458 L
185.08139 439.32869 L
184.98756 439.42252 L
184.89373 439.51635 L
184.89373 439.51635 L
184.79962 439.51635 L
184.70580 439.42252 L
184.61197 439.32869 L
184.61197 439.23458 L
184.61197 439.14047 L
184.61197 439.04665 L
184.70580 438.95282 L
184.79962 438.95282 L
184.89373 438.95282 L
184.98756 438.95282 L
@c
F
@rax %Note: Object
183.48463 438.95282 184.04816 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
183.86050 438.95282 m
183.86050 439.04665 L
183.95433 439.14047 L
184.04816 439.23458 L
184.04816 439.23458 L
183.95433 439.32869 L
183.86050 439.42252 L
183.76639 439.51635 L
183.76639 439.51635 L
183.67228 439.51635 L
183.57846 439.42252 L
183.48463 439.32869 L
183.48463 439.23458 L
183.48463 439.14047 L
183.48463 439.04665 L
183.57846 438.95282 L
183.67228 438.95282 L
183.76639 438.95282 L
183.86050 438.95282 L
@c
F
@rax %Note: Object
182.35729 438.95282 182.92082 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
182.73317 438.95282 m
182.73317 439.04665 L
182.82699 439.14047 L
182.92082 439.23458 L
182.92082 439.23458 L
182.82699 439.32869 L
182.73317 439.42252 L
182.63877 439.51635 L
182.63877 439.51635 L
182.54494 439.51635 L
182.45112 439.42252 L
182.35729 439.32869 L
182.35729 439.23458 L
182.35729 439.14047 L
182.35729 439.04665 L
182.45112 438.95282 L
182.54494 438.95282 L
182.63877 438.95282 L
182.73317 438.95282 L
@c
F
@rax %Note: Object
181.22995 438.95282 181.79376 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
181.60583 438.95282 m
181.60583 439.04665 L
181.69994 439.14047 L
181.79376 439.23458 L
181.79376 439.23458 L
181.69994 439.32869 L
181.60583 439.42252 L
181.51172 439.51635 L
181.51172 439.51635 L
181.41789 439.51635 L
181.32406 439.42252 L
181.22995 439.32869 L
181.22995 439.23458 L
181.22995 439.14047 L
181.22995 439.04665 L
181.32406 438.95282 L
181.41789 438.95282 L
181.51172 438.95282 L
181.60583 438.95282 L
@c
F
@rax %Note: Object
180.10261 438.95282 180.66643 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
180.47820 438.95282 m
180.47820 439.04665 L
180.57260 439.14047 L
180.66643 439.23458 L
180.66643 439.23458 L
180.57260 439.32869 L
180.47820 439.42252 L
180.38438 439.51635 L
180.38438 439.51635 L
180.29055 439.51635 L
180.19672 439.42252 L
180.10261 439.32869 L
180.10261 439.23458 L
180.10261 439.14047 L
180.10261 439.04665 L
180.19672 438.95282 L
180.29055 438.95282 L
180.38438 438.95282 L
180.47820 438.95282 L
@c
F
@rax %Note: Object
178.97528 438.95282 179.53909 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
179.35087 438.95282 m
179.35087 439.04665 L
179.44498 439.14047 L
179.53909 439.23458 L
179.53909 439.23458 L
179.44498 439.32869 L
179.35087 439.42252 L
179.25704 439.51635 L
179.25704 439.51635 L
179.16321 439.51635 L
179.06910 439.42252 L
178.97528 439.32869 L
178.97528 439.23458 L
178.97528 439.14047 L
178.97528 439.04665 L
179.06910 438.95282 L
179.16321 438.95282 L
179.25704 438.95282 L
179.35087 438.95282 L
@c
F
@rax %Note: Object
177.84822 438.95282 178.41175 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
178.22381 438.95282 m
178.22381 439.04665 L
178.31792 439.14047 L
178.41175 439.23458 L
178.41175 439.23458 L
178.31792 439.32869 L
178.22381 439.42252 L
178.12998 439.51635 L
178.12998 439.51635 L
178.03587 439.51635 L
177.94205 439.42252 L
177.84822 439.32869 L
177.84822 439.23458 L
177.84822 439.14047 L
177.84822 439.04665 L
177.94205 438.95282 L
178.03587 438.95282 L
178.12998 438.95282 L
178.22381 438.95282 L
@c
F
@rax %Note: Object
176.72088 438.95282 177.28441 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
177.09647 438.95282 m
177.09647 439.04665 L
177.19030 439.14047 L
177.28441 439.23458 L
177.28441 439.23458 L
177.19030 439.32869 L
177.09647 439.42252 L
177.00236 439.51635 L
177.00236 439.51635 L
176.90854 439.51635 L
176.81471 439.42252 L
176.72088 439.32869 L
176.72088 439.23458 L
176.72088 439.14047 L
176.72088 439.04665 L
176.81471 438.95282 L
176.90854 438.95282 L
177.00236 438.95282 L
177.09647 438.95282 L
@c
F
@rax %Note: Object
175.59354 438.95282 176.15707 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
175.96913 438.95282 m
175.96913 439.04665 L
176.06296 439.14047 L
176.15707 439.23458 L
176.15707 439.23458 L
176.06296 439.32869 L
175.96913 439.42252 L
175.87531 439.51635 L
175.87531 439.51635 L
175.78148 439.51635 L
175.68765 439.42252 L
175.59354 439.32869 L
175.59354 439.23458 L
175.59354 439.14047 L
175.59354 439.04665 L
175.68765 438.95282 L
175.78148 438.95282 L
175.87531 438.95282 L
175.96913 438.95282 L
@c
F
@rax %Note: Object
174.46620 438.95282 175.03002 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
174.84180 438.95282 m
174.84180 439.04665 L
174.93591 439.14047 L
175.03002 439.23458 L
175.03002 439.23458 L
174.93591 439.32869 L
174.84180 439.42252 L
174.74797 439.51635 L
174.74797 439.51635 L
174.65414 439.51635 L
174.56031 439.42252 L
174.46620 439.32869 L
174.46620 439.23458 L
174.46620 439.14047 L
174.46620 439.04665 L
174.56031 438.95282 L
174.65414 438.95282 L
174.74797 438.95282 L
174.84180 438.95282 L
@c
F
@rax %Note: Object
173.33858 438.95282 173.90239 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
173.71446 438.95282 m
173.71446 439.04665 L
173.80828 439.14047 L
173.90239 439.23458 L
173.90239 439.23458 L
173.80828 439.32869 L
173.71446 439.42252 L
173.62063 439.51635 L
173.62063 439.51635 L
173.52680 439.51635 L
173.43269 439.42252 L
173.33858 439.32869 L
173.33858 439.23458 L
173.33858 439.14047 L
173.33858 439.04665 L
173.43269 438.95282 L
173.52680 438.95282 L
173.62063 438.95282 L
173.71446 438.95282 L
@c
F
@rax %Note: Object
172.21153 438.95282 172.77506 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
172.58740 438.95282 m
172.58740 439.04665 L
172.68123 439.14047 L
172.77506 439.23458 L
172.77506 439.23458 L
172.68123 439.32869 L
172.58740 439.42252 L
172.49357 439.51635 L
172.49357 439.51635 L
172.39946 439.51635 L
172.30564 439.42252 L
172.21153 439.32869 L
172.21153 439.23458 L
172.21153 439.14047 L
172.21153 439.04665 L
172.30564 438.95282 L
172.39946 438.95282 L
172.49357 438.95282 L
172.58740 438.95282 L
@c
F
@rax %Note: Object
171.08419 438.95282 171.64772 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
171.46006 438.95282 m
171.46006 439.04665 L
171.55389 439.14047 L
171.64772 439.23458 L
171.64772 439.23458 L
171.55389 439.32869 L
171.46006 439.42252 L
171.36624 439.51635 L
171.36624 439.51635 L
171.27213 439.51635 L
171.17802 439.42252 L
171.08419 439.32869 L
171.08419 439.23458 L
171.08419 439.14047 L
171.08419 439.04665 L
171.17802 438.95282 L
171.27213 438.95282 L
171.36624 438.95282 L
171.46006 438.95282 L
@c
F
@rax %Note: Object
169.95685 438.95282 170.52038 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
170.33272 438.95282 m
170.33272 439.04665 L
170.42655 439.14047 L
170.52038 439.23458 L
170.52038 439.23458 L
170.42655 439.32869 L
170.33272 439.42252 L
170.23861 439.51635 L
170.23861 439.51635 L
170.14507 439.51635 L
170.05096 439.42252 L
169.95685 439.32869 L
169.95685 439.23458 L
169.95685 439.14047 L
169.95685 439.04665 L
170.05096 438.95282 L
170.14507 438.95282 L
170.23861 438.95282 L
170.33272 438.95282 L
@c
F
@rax %Note: Object
168.82951 438.95282 169.39332 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
169.20539 438.95282 m
169.20539 439.04665 L
169.29950 439.14047 L
169.39332 439.23458 L
169.39332 439.23458 L
169.29950 439.32869 L
169.20539 439.42252 L
169.11156 439.51635 L
169.11156 439.51635 L
169.01773 439.51635 L
168.92362 439.42252 L
168.82951 439.32869 L
168.82951 439.23458 L
168.82951 439.14047 L
168.82951 439.04665 L
168.92362 438.95282 L
169.01773 438.95282 L
169.11156 438.95282 L
169.20539 438.95282 L
@c
F
@rax %Note: Object
167.70217 438.95282 168.26598 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
168.07805 438.95282 m
168.07805 439.04665 L
168.17187 439.14047 L
168.26598 439.23458 L
168.26598 439.23458 L
168.17187 439.32869 L
168.07805 439.42252 L
167.98422 439.51635 L
167.98422 439.51635 L
167.89011 439.51635 L
167.79600 439.42252 L
167.70217 439.32869 L
167.70217 439.23458 L
167.70217 439.14047 L
167.70217 439.04665 L
167.79600 438.95282 L
167.89011 438.95282 L
167.98422 438.95282 L
168.07805 438.95282 L
@c
F
@rax %Note: Object
166.57512 438.95282 167.13865 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
166.95099 438.95282 m
166.95099 439.04665 L
167.04482 439.14047 L
167.13865 439.23458 L
167.13865 439.23458 L
167.04482 439.32869 L
166.95099 439.42252 L
166.85717 439.51635 L
166.85717 439.51635 L
166.76277 439.51635 L
166.66894 439.42252 L
166.57512 439.32869 L
166.57512 439.23458 L
166.57512 439.14047 L
166.57512 439.04665 L
166.66894 438.95282 L
166.76277 438.95282 L
166.85717 438.95282 L
166.95099 438.95282 L
@c
F
@rax %Note: Object
165.44778 438.95282 166.01131 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
165.82365 438.95282 m
165.82365 439.04665 L
165.91748 439.14047 L
166.01131 439.23458 L
166.01131 439.23458 L
165.91748 439.32869 L
165.82365 439.42252 L
165.72983 439.51635 L
165.72983 439.51635 L
165.63543 439.51635 L
165.54161 439.42252 L
165.44778 439.32869 L
165.44778 439.23458 L
165.44778 439.14047 L
165.44778 439.04665 L
165.54161 438.95282 L
165.63543 438.95282 L
165.72983 438.95282 L
165.82365 438.95282 L
@c
F
@rax %Note: Object
164.32044 438.95282 164.88397 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
164.69631 438.95282 m
164.69631 439.04665 L
164.79014 439.14047 L
164.88397 439.23458 L
164.88397 439.23458 L
164.79014 439.32869 L
164.69631 439.42252 L
164.60220 439.51635 L
164.60220 439.51635 L
164.50809 439.51635 L
164.41455 439.42252 L
164.32044 439.32869 L
164.32044 439.23458 L
164.32044 439.14047 L
164.32044 439.04665 L
164.41455 438.95282 L
164.50809 438.95282 L
164.60220 438.95282 L
164.69631 438.95282 L
@c
F
@rax %Note: Object
163.19310 438.95282 163.75691 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
163.56898 438.95282 m
163.56898 439.04665 L
163.66309 439.14047 L
163.75691 439.23458 L
163.75691 439.23458 L
163.66309 439.32869 L
163.56898 439.42252 L
163.47487 439.51635 L
163.47487 439.51635 L
163.38104 439.51635 L
163.28721 439.42252 L
163.19310 439.32869 L
163.19310 439.23458 L
163.19310 439.14047 L
163.19310 439.04665 L
163.28721 438.95282 L
163.38104 438.95282 L
163.47487 438.95282 L
163.56898 438.95282 L
@c
F
@rax %Note: Object
162.06576 438.95282 162.62957 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
162.44164 438.95282 m
162.44164 439.04665 L
162.53546 439.14047 L
162.62957 439.23458 L
162.62957 439.23458 L
162.53546 439.32869 L
162.44164 439.42252 L
162.34753 439.51635 L
162.34753 439.51635 L
162.25370 439.51635 L
162.15959 439.42252 L
162.06576 439.32869 L
162.06576 439.23458 L
162.06576 439.14047 L
162.06576 439.04665 L
162.15959 438.95282 L
162.25370 438.95282 L
162.34753 438.95282 L
162.44164 438.95282 L
@c
F
@rax %Note: Object
160.93871 438.95282 161.50224 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
161.31430 438.95282 m
161.31430 439.04665 L
161.40841 439.14047 L
161.50224 439.23458 L
161.50224 439.23458 L
161.40841 439.32869 L
161.31430 439.42252 L
161.22047 439.51635 L
161.22047 439.51635 L
161.12636 439.51635 L
161.03254 439.42252 L
160.93871 439.32869 L
160.93871 439.23458 L
160.93871 439.14047 L
160.93871 439.04665 L
161.03254 438.95282 L
161.12636 438.95282 L
161.22047 438.95282 L
161.31430 438.95282 L
@c
F
@rax %Note: Object
159.81137 438.95282 160.37490 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
160.18696 438.95282 m
160.18696 439.04665 L
160.28107 439.14047 L
160.37490 439.23458 L
160.37490 439.23458 L
160.28107 439.32869 L
160.18696 439.42252 L
160.09313 439.51635 L
160.09313 439.51635 L
159.99902 439.51635 L
159.90520 439.42252 L
159.81137 439.32869 L
159.81137 439.23458 L
159.81137 439.14047 L
159.81137 439.04665 L
159.90520 438.95282 L
159.99902 438.95282 L
160.09313 438.95282 L
160.18696 438.95282 L
@c
F
@rax %Note: Object
158.68403 438.95282 159.24756 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
159.05962 438.95282 m
159.05962 439.04665 L
159.15373 439.14047 L
159.24756 439.23458 L
159.24756 439.23458 L
159.15373 439.32869 L
159.05962 439.42252 L
158.96551 439.51635 L
158.96551 439.51635 L
158.87169 439.51635 L
158.77786 439.42252 L
158.68403 439.32869 L
158.68403 439.23458 L
158.68403 439.14047 L
158.68403 439.04665 L
158.77786 438.95282 L
158.87169 438.95282 L
158.96551 438.95282 L
159.05962 438.95282 L
@c
F
@rax %Note: Object
157.55669 438.95282 158.12050 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
157.93228 438.95282 m
157.93228 439.04665 L
158.02639 439.14047 L
158.12050 439.23458 L
158.12050 439.23458 L
158.02639 439.32869 L
157.93228 439.42252 L
157.83846 439.51635 L
157.83846 439.51635 L
157.74463 439.51635 L
157.65080 439.42252 L
157.55669 439.32869 L
157.55669 439.23458 L
157.55669 439.14047 L
157.55669 439.04665 L
157.65080 438.95282 L
157.74463 438.95282 L
157.83846 438.95282 L
157.93228 438.95282 L
@c
F
@rax %Note: Object
156.42935 438.95282 156.99317 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
156.80494 438.95282 m
156.80494 439.04665 L
156.89906 439.14047 L
156.99317 439.23458 L
156.99317 439.23458 L
156.89906 439.32869 L
156.80494 439.42252 L
156.71112 439.51635 L
156.71112 439.51635 L
156.61729 439.51635 L
156.52318 439.42252 L
156.42935 439.32869 L
156.42935 439.23458 L
156.42935 439.14047 L
156.42935 439.04665 L
156.52318 438.95282 L
156.61729 438.95282 L
156.71112 438.95282 L
156.80494 438.95282 L
@c
F
@rax %Note: Object
155.30202 438.95282 155.86583 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
155.67789 438.95282 m
155.67789 439.04665 L
155.77143 439.14047 L
155.86583 439.23458 L
155.86583 439.23458 L
155.77143 439.32869 L
155.67789 439.42252 L
155.58406 439.51635 L
155.58406 439.51635 L
155.48995 439.51635 L
155.39613 439.42252 L
155.30202 439.32869 L
155.30202 439.23458 L
155.30202 439.14047 L
155.30202 439.04665 L
155.39613 438.95282 L
155.48995 438.95282 L
155.58406 438.95282 L
155.67789 438.95282 L
@c
F
@rax %Note: Object
154.17468 438.95282 154.73820 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
154.55055 438.95282 m
154.55055 439.04665 L
154.64438 439.14047 L
154.73820 439.23458 L
154.73820 439.23458 L
154.64438 439.32869 L
154.55055 439.42252 L
154.45672 439.51635 L
154.45672 439.51635 L
154.36261 439.51635 L
154.26879 439.42252 L
154.17468 439.32869 L
154.17468 439.23458 L
154.17468 439.14047 L
154.17468 439.04665 L
154.26879 438.95282 L
154.36261 438.95282 L
154.45672 438.95282 L
154.55055 438.95282 L
@c
F
@rax %Note: Object
153.04734 438.95282 153.61087 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
153.42321 438.95282 m
153.42321 439.04665 L
153.51704 439.14047 L
153.61087 439.23458 L
153.61087 439.23458 L
153.51704 439.32869 L
153.42321 439.42252 L
153.32910 439.51635 L
153.32910 439.51635 L
153.23528 439.51635 L
153.14145 439.42252 L
153.04734 439.32869 L
153.04734 439.23458 L
153.04734 439.14047 L
153.04734 439.04665 L
153.14145 438.95282 L
153.23528 438.95282 L
153.32910 438.95282 L
153.42321 438.95282 L
@c
F
@rax %Note: Object
151.92000 438.95282 152.48381 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
152.29587 438.95282 m
152.29587 439.04665 L
152.38998 439.14047 L
152.48381 439.23458 L
152.48381 439.23458 L
152.38998 439.32869 L
152.29587 439.42252 L
152.20205 439.51635 L
152.20205 439.51635 L
152.10822 439.51635 L
152.01411 439.42252 L
151.92000 439.32869 L
151.92000 439.23458 L
151.92000 439.14047 L
151.92000 439.04665 L
152.01411 438.95282 L
152.10822 438.95282 L
152.20205 438.95282 L
152.29587 438.95282 L
@c
F
@rax %Note: Object
150.79266 438.95282 151.35647 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
151.16854 438.95282 m
151.16854 439.04665 L
151.26265 439.14047 L
151.35647 439.23458 L
151.35647 439.23458 L
151.26265 439.32869 L
151.16854 439.42252 L
151.07471 439.51635 L
151.07471 439.51635 L
150.98088 439.51635 L
150.88649 439.42252 L
150.79266 439.32869 L
150.79266 439.23458 L
150.79266 439.14047 L
150.79266 439.04665 L
150.88649 438.95282 L
150.98088 438.95282 L
151.07471 438.95282 L
151.16854 438.95282 L
@c
F
@rax %Note: Object
149.66561 438.95282 150.22913 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
150.04120 438.95282 m
150.04120 439.04665 L
150.13502 439.14047 L
150.22913 439.23458 L
150.22913 439.23458 L
150.13502 439.32869 L
150.04120 439.42252 L
149.94737 439.51635 L
149.94737 439.51635 L
149.85354 439.51635 L
149.75943 439.42252 L
149.66561 439.32869 L
149.66561 439.23458 L
149.66561 439.14047 L
149.66561 439.04665 L
149.75943 438.95282 L
149.85354 438.95282 L
149.94737 438.95282 L
150.04120 438.95282 L
@c
F
@rax %Note: Object
148.53827 438.95282 149.10180 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
148.91414 438.95282 m
148.91414 439.04665 L
149.00797 439.14047 L
149.10180 439.23458 L
149.10180 439.23458 L
149.00797 439.32869 L
148.91414 439.42252 L
148.82031 439.51635 L
148.82031 439.51635 L
148.72620 439.51635 L
148.63209 439.42252 L
148.53827 439.32869 L
148.53827 439.23458 L
148.53827 439.14047 L
148.53827 439.04665 L
148.63209 438.95282 L
148.72620 438.95282 L
148.82031 438.95282 L
148.91414 438.95282 L
@c
F
@rax %Note: Object
147.41093 438.95282 147.97446 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
147.78680 438.95282 m
147.78680 439.04665 L
147.88063 439.14047 L
147.97446 439.23458 L
147.97446 439.23458 L
147.88063 439.32869 L
147.78680 439.42252 L
147.69269 439.51635 L
147.69269 439.51635 L
147.59858 439.51635 L
147.50476 439.42252 L
147.41093 439.32869 L
147.41093 439.23458 L
147.41093 439.14047 L
147.41093 439.04665 L
147.50476 438.95282 L
147.59858 438.95282 L
147.69269 438.95282 L
147.78680 438.95282 L
@c
F
@rax %Note: Object
146.28359 438.95282 146.84740 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
146.65946 438.95282 m
146.65946 439.04665 L
146.75357 439.14047 L
146.84740 439.23458 L
146.84740 439.23458 L
146.75357 439.32869 L
146.65946 439.42252 L
146.56564 439.51635 L
146.56564 439.51635 L
146.47153 439.51635 L
146.37770 439.42252 L
146.28359 439.32869 L
146.28359 439.23458 L
146.28359 439.14047 L
146.28359 439.04665 L
146.37770 438.95282 L
146.47153 438.95282 L
146.56564 438.95282 L
146.65946 438.95282 L
@c
F
@rax %Note: Object
145.15625 438.95282 145.72006 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
145.53213 438.95282 m
145.53213 439.04665 L
145.62624 439.14047 L
145.72006 439.23458 L
145.72006 439.23458 L
145.62624 439.32869 L
145.53213 439.42252 L
145.43830 439.51635 L
145.43830 439.51635 L
145.34419 439.51635 L
145.25008 439.42252 L
145.15625 439.32869 L
145.15625 439.23458 L
145.15625 439.14047 L
145.15625 439.04665 L
145.25008 438.95282 L
145.34419 438.95282 L
145.43830 438.95282 L
145.53213 438.95282 L
@c
F
@rax %Note: Object
144.02920 438.95282 144.59272 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
144.40479 438.95282 m
144.40479 439.04665 L
144.49861 439.14047 L
144.59272 439.23458 L
144.59272 439.23458 L
144.49861 439.32869 L
144.40479 439.42252 L
144.31068 439.51635 L
144.31068 439.51635 L
144.21685 439.51635 L
144.12274 439.42252 L
144.02920 439.32869 L
144.02920 439.23458 L
144.02920 439.14047 L
144.02920 439.04665 L
144.12274 438.95282 L
144.21685 438.95282 L
144.31068 438.95282 L
144.40479 438.95282 L
@c
F
@rax %Note: Object
142.90186 438.95282 143.46539 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
143.27773 438.95282 m
143.27773 439.04665 L
143.37156 439.14047 L
143.46539 439.23458 L
143.46539 439.23458 L
143.37156 439.32869 L
143.27773 439.42252 L
143.18362 439.51635 L
143.18362 439.51635 L
143.08951 439.51635 L
142.99569 439.42252 L
142.90186 439.32869 L
142.90186 439.23458 L
142.90186 439.14047 L
142.90186 439.04665 L
142.99569 438.95282 L
143.08951 438.95282 L
143.18362 438.95282 L
143.27773 438.95282 L
@c
F
@rax %Note: Object
141.77452 438.95282 142.33805 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
142.15011 438.95282 m
142.15011 439.04665 L
142.24422 439.14047 L
142.33805 439.23458 L
142.33805 439.23458 L
142.24422 439.32869 L
142.15011 439.42252 L
142.05600 439.51635 L
142.05600 439.51635 L
141.96217 439.51635 L
141.86835 439.42252 L
141.77452 439.32869 L
141.77452 439.23458 L
141.77452 439.14047 L
141.77452 439.04665 L
141.86835 438.95282 L
141.96217 438.95282 L
142.05600 438.95282 L
142.15011 438.95282 L
@c
F
@rax %Note: Object
140.64718 438.95282 141.21071 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
141.02277 438.95282 m
141.02277 439.04665 L
141.11717 439.14047 L
141.21071 439.23458 L
141.21071 439.23458 L
141.11717 439.32869 L
141.02277 439.42252 L
140.92894 439.51635 L
140.92894 439.51635 L
140.83512 439.51635 L
140.74129 439.42252 L
140.64718 439.32869 L
140.64718 439.23458 L
140.64718 439.14047 L
140.64718 439.04665 L
140.74129 438.95282 L
140.83512 438.95282 L
140.92894 438.95282 L
141.02277 438.95282 L
@c
F
@rax %Note: Object
139.51984 438.95282 140.08365 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
139.89543 438.95282 m
139.89543 439.04665 L
139.98983 439.14047 L
140.08365 439.23458 L
140.08365 439.23458 L
139.98983 439.32869 L
139.89543 439.42252 L
139.80161 439.51635 L
139.80161 439.51635 L
139.70778 439.51635 L
139.61395 439.42252 L
139.51984 439.32869 L
139.51984 439.23458 L
139.51984 439.14047 L
139.51984 439.04665 L
139.61395 438.95282 L
139.70778 438.95282 L
139.80161 438.95282 L
139.89543 438.95282 L
@c
F
@rax %Note: Object
138.39250 438.95282 138.95631 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
138.76809 438.95282 m
138.76809 439.04665 L
138.86220 439.14047 L
138.95631 439.23458 L
138.95631 439.23458 L
138.86220 439.32869 L
138.76809 439.42252 L
138.67427 439.51635 L
138.67427 439.51635 L
138.58044 439.51635 L
138.48633 439.42252 L
138.39250 439.32869 L
138.39250 439.23458 L
138.39250 439.14047 L
138.39250 439.04665 L
138.48633 438.95282 L
138.58044 438.95282 L
138.67427 438.95282 L
138.76809 438.95282 L
@c
F
@rax %Note: Object
137.26545 438.95282 137.82898 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
137.64104 438.95282 m
137.64104 439.04665 L
137.73487 439.14047 L
137.82898 439.23458 L
137.82898 439.23458 L
137.73487 439.32869 L
137.64104 439.42252 L
137.54721 439.51635 L
137.54721 439.51635 L
137.45310 439.51635 L
137.35928 439.42252 L
137.26545 439.32869 L
137.26545 439.23458 L
137.26545 439.14047 L
137.26545 439.04665 L
137.35928 438.95282 L
137.45310 438.95282 L
137.54721 438.95282 L
137.64104 438.95282 L
@c
F
@rax %Note: Object
136.13811 438.95282 136.70164 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
136.51370 438.95282 m
136.51370 439.04665 L
136.60753 439.14047 L
136.70164 439.23458 L
136.70164 439.23458 L
136.60753 439.32869 L
136.51370 439.42252 L
136.41959 439.51635 L
136.41959 439.51635 L
136.32576 439.51635 L
136.23194 439.42252 L
136.13811 439.32869 L
136.13811 439.23458 L
136.13811 439.14047 L
136.13811 439.04665 L
136.23194 438.95282 L
136.32576 438.95282 L
136.41959 438.95282 L
136.51370 438.95282 L
@c
F
@rax %Note: Object
135.01049 438.95282 135.57430 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
135.38636 438.95282 m
135.38636 439.04665 L
135.48019 439.14047 L
135.57430 439.23458 L
135.57430 439.23458 L
135.48019 439.32869 L
135.38636 439.42252 L
135.29254 439.51635 L
135.29254 439.51635 L
135.19871 439.51635 L
135.10488 439.42252 L
135.01049 439.32869 L
135.01049 439.23458 L
135.01049 439.14047 L
135.01049 439.04665 L
135.10488 438.95282 L
135.19871 438.95282 L
135.29254 438.95282 L
135.38636 438.95282 L
@c
F
@rax %Note: Object
133.88315 438.95282 134.44696 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
134.25902 438.95282 m
134.25902 439.04665 L
134.35313 439.14047 L
134.44696 439.23458 L
134.44696 439.23458 L
134.35313 439.32869 L
134.25902 439.42252 L
134.16520 439.51635 L
134.16520 439.51635 L
134.07137 439.51635 L
133.97754 439.42252 L
133.88315 439.32869 L
133.88315 439.23458 L
133.88315 439.14047 L
133.88315 439.04665 L
133.97754 438.95282 L
134.07137 438.95282 L
134.16520 438.95282 L
134.25902 438.95282 L
@c
F
@rax %Note: Object
132.75581 438.95282 133.31962 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
133.13169 438.95282 m
133.13169 439.04665 L
133.22551 439.14047 L
133.31962 439.23458 L
133.31962 439.23458 L
133.22551 439.32869 L
133.13169 439.42252 L
133.03786 439.51635 L
133.03786 439.51635 L
132.94403 439.51635 L
132.84992 439.42252 L
132.75581 439.32869 L
132.75581 439.23458 L
132.75581 439.14047 L
132.75581 439.04665 L
132.84992 438.95282 L
132.94403 438.95282 L
133.03786 438.95282 L
133.13169 438.95282 L
@c
F
@rax %Note: Object
131.62876 438.95282 132.19228 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
132.00463 438.95282 m
132.00463 439.04665 L
132.09846 439.14047 L
132.19228 439.23458 L
132.19228 439.23458 L
132.09846 439.32869 L
132.00463 439.42252 L
131.91080 439.51635 L
131.91080 439.51635 L
131.81669 439.51635 L
131.72258 439.42252 L
131.62876 439.32869 L
131.62876 439.23458 L
131.62876 439.14047 L
131.62876 439.04665 L
131.72258 438.95282 L
131.81669 438.95282 L
131.91080 438.95282 L
132.00463 438.95282 L
@c
F
@rax %Note: Object
130.50142 438.95282 131.06494 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
130.87729 438.95282 m
130.87729 439.04665 L
130.97112 439.14047 L
131.06494 439.23458 L
131.06494 439.23458 L
130.97112 439.32869 L
130.87729 439.42252 L
130.78318 439.51635 L
130.78318 439.51635 L
130.68935 439.51635 L
130.59524 439.42252 L
130.50142 439.32869 L
130.50142 439.23458 L
130.50142 439.14047 L
130.50142 439.04665 L
130.59524 438.95282 L
130.68935 438.95282 L
130.78318 438.95282 L
130.87729 438.95282 L
@c
F
@rax %Note: Object
129.37408 438.95282 129.93761 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
129.74995 438.95282 m
129.74995 439.04665 L
129.84378 439.14047 L
129.93761 439.23458 L
129.93761 439.23458 L
129.84378 439.32869 L
129.74995 439.42252 L
129.65584 439.51635 L
129.65584 439.51635 L
129.56230 439.51635 L
129.46819 439.42252 L
129.37408 439.32869 L
129.37408 439.23458 L
129.37408 439.14047 L
129.37408 439.04665 L
129.46819 438.95282 L
129.56230 438.95282 L
129.65584 438.95282 L
129.74995 438.95282 L
@c
F
@rax %Note: Object
128.24674 438.95282 128.81055 439.51635 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 439.23458 m
128.34085 439.14047 L
128.43468 439.04665 L
128.52879 438.95282 L
128.62261 438.95282 L
128.71672 439.04665 L
128.81055 439.14047 L
128.81055 439.23458 L
128.81055 439.32869 L
128.81055 439.32869 L
128.81055 439.42252 L
128.71672 439.51635 L
128.62261 439.51635 L
128.52879 439.51635 L
128.43468 439.51635 L
128.34085 439.42252 L
128.24674 439.32869 L
128.24674 439.23458 L
@c
F
@rax %Note: Object
128.24674 440.08016 128.81055 440.64369 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 440.36192 m
128.34085 440.26781 L
128.43468 440.17398 L
128.52879 440.08016 L
128.62261 440.08016 L
128.71672 440.17398 L
128.81055 440.26781 L
128.81055 440.36192 L
128.81055 440.45603 L
128.81055 440.45603 L
128.81055 440.54986 L
128.71672 440.64369 L
128.62261 440.64369 L
128.52879 440.64369 L
128.43468 440.64369 L
128.34085 440.54986 L
128.24674 440.45603 L
128.24674 440.36192 L
@c
F
@rax %Note: Object
128.24674 441.20750 128.81055 441.77102 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 441.48926 m
128.34085 441.39515 L
128.43468 441.30132 L
128.52879 441.20750 L
128.62261 441.20750 L
128.71672 441.30132 L
128.81055 441.39515 L
128.81055 441.48926 L
128.81055 441.58309 L
128.81055 441.58309 L
128.81055 441.67691 L
128.71672 441.77102 L
128.62261 441.77102 L
128.52879 441.77102 L
128.43468 441.77102 L
128.34085 441.67691 L
128.24674 441.58309 L
128.24674 441.48926 L
@c
F
@rax %Note: Object
128.24674 442.33455 128.81055 442.89836 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 442.61660 m
128.34085 442.52277 L
128.43468 442.42838 L
128.52879 442.33455 L
128.62261 442.33455 L
128.71672 442.42838 L
128.81055 442.52277 L
128.81055 442.61660 L
128.81055 442.71043 L
128.81055 442.71043 L
128.81055 442.80425 L
128.71672 442.89836 L
128.62261 442.89836 L
128.52879 442.89836 L
128.43468 442.89836 L
128.34085 442.80425 L
128.24674 442.71043 L
128.24674 442.61660 L
@c
F
@rax %Note: Object
128.24674 443.46189 128.81055 444.02570 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 443.74394 m
128.34085 443.65011 L
128.43468 443.55572 L
128.52879 443.46189 L
128.62261 443.46189 L
128.71672 443.55572 L
128.81055 443.65011 L
128.81055 443.74394 L
128.81055 443.83776 L
128.81055 443.83776 L
128.81055 443.93159 L
128.71672 444.02570 L
128.62261 444.02570 L
128.52879 444.02570 L
128.43468 444.02570 L
128.34085 443.93159 L
128.24674 443.83776 L
128.24674 443.74394 L
@c
F
@rax %Note: Object
128.24674 444.58923 128.81055 445.15276 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 444.87099 m
128.34085 444.77717 L
128.43468 444.68334 L
128.52879 444.58923 L
128.62261 444.58923 L
128.71672 444.68334 L
128.81055 444.77717 L
128.81055 444.87099 L
128.81055 444.96510 L
128.81055 444.96510 L
128.81055 445.05893 L
128.71672 445.15276 L
128.62261 445.15276 L
128.52879 445.15276 L
128.43468 445.15276 L
128.34085 445.05893 L
128.24674 444.96510 L
128.24674 444.87099 L
@c
F
@rax %Note: Object
128.24674 445.71657 128.81055 446.28009 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 445.99833 m
128.34085 445.90450 L
128.43468 445.81068 L
128.52879 445.71657 L
128.62261 445.71657 L
128.71672 445.81068 L
128.81055 445.90450 L
128.81055 445.99833 L
128.81055 446.09244 L
128.81055 446.09244 L
128.81055 446.18627 L
128.71672 446.28009 L
128.62261 446.28009 L
128.52879 446.28009 L
128.43468 446.28009 L
128.34085 446.18627 L
128.24674 446.09244 L
128.24674 445.99833 L
@c
F
@rax %Note: Object
128.24674 446.84391 128.81055 447.40743 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 447.12595 m
128.34085 447.03184 L
128.43468 446.93802 L
128.52879 446.84391 L
128.62261 446.84391 L
128.71672 446.93802 L
128.81055 447.03184 L
128.81055 447.12595 L
128.81055 447.21950 L
128.81055 447.21950 L
128.81055 447.31332 L
128.71672 447.40743 L
128.62261 447.40743 L
128.52879 447.40743 L
128.43468 447.40743 L
128.34085 447.31332 L
128.24674 447.21950 L
128.24674 447.12595 L
@c
F
@rax %Note: Object
128.24674 447.97124 128.81055 448.53506 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 448.25301 m
128.34085 448.15918 L
128.43468 448.06507 L
128.52879 447.97124 L
128.62261 447.97124 L
128.71672 448.06507 L
128.81055 448.15918 L
128.81055 448.25301 L
128.81055 448.34683 L
128.81055 448.34683 L
128.81055 448.44066 L
128.71672 448.53506 L
128.62261 448.53506 L
128.52879 448.53506 L
128.43468 448.53506 L
128.34085 448.44066 L
128.24674 448.34683 L
128.24674 448.25301 L
@c
F
@rax %Note: Object
128.24674 449.09858 128.81055 449.66239 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 449.38035 m
128.34085 449.28652 L
128.43468 449.19241 L
128.52879 449.09858 L
128.62261 449.09858 L
128.71672 449.19241 L
128.81055 449.28652 L
128.81055 449.38035 L
128.81055 449.47417 L
128.81055 449.47417 L
128.81055 449.56800 L
128.71672 449.66239 L
128.62261 449.66239 L
128.52879 449.66239 L
128.43468 449.66239 L
128.34085 449.56800 L
128.24674 449.47417 L
128.24674 449.38035 L
@c
F
@rax %Note: Object
128.24674 450.22564 128.81055 450.78945 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 450.50740 m
128.34085 450.41357 L
128.43468 450.31975 L
128.52879 450.22564 L
128.62261 450.22564 L
128.71672 450.31975 L
128.81055 450.41357 L
128.81055 450.50740 L
128.81055 450.60151 L
128.81055 450.60151 L
128.81055 450.69534 L
128.71672 450.78945 L
128.62261 450.78945 L
128.52879 450.78945 L
128.43468 450.78945 L
128.34085 450.69534 L
128.24674 450.60151 L
128.24674 450.50740 L
@c
F
@rax %Note: Object
128.24674 451.35326 128.81055 451.91679 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 451.63474 m
128.34085 451.54091 L
128.43468 451.44709 L
128.52879 451.35326 L
128.62261 451.35326 L
128.71672 451.44709 L
128.81055 451.54091 L
128.81055 451.63474 L
128.81055 451.72885 L
128.81055 451.72885 L
128.81055 451.82296 L
128.71672 451.91679 L
128.62261 451.91679 L
128.52879 451.91679 L
128.43468 451.91679 L
128.34085 451.82296 L
128.24674 451.72885 L
128.24674 451.63474 L
@c
F
@rax %Note: Object
128.24674 452.48060 128.81055 453.04384 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 452.76236 m
128.34085 452.66825 L
128.43468 452.57443 L
128.52879 452.48060 L
128.62261 452.48060 L
128.71672 452.57443 L
128.81055 452.66825 L
128.81055 452.76236 L
128.81055 452.85619 L
128.81055 452.85619 L
128.81055 452.95030 L
128.71672 453.04384 L
128.62261 453.04384 L
128.52879 453.04384 L
128.43468 453.04384 L
128.34085 452.95030 L
128.24674 452.85619 L
128.24674 452.76236 L
@c
F
@rax %Note: Object
128.24674 453.60765 128.81055 454.17146 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 453.88942 m
128.34085 453.79559 L
128.43468 453.70148 L
128.52879 453.60765 L
128.62261 453.60765 L
128.71672 453.70148 L
128.81055 453.79559 L
128.81055 453.88942 L
128.81055 453.98353 L
128.81055 453.98353 L
128.81055 454.07735 L
128.71672 454.17146 L
128.62261 454.17146 L
128.52879 454.17146 L
128.43468 454.17146 L
128.34085 454.07735 L
128.24674 453.98353 L
128.24674 453.88942 L
@c
F
@rax %Note: Object
128.24674 454.73499 128.81055 455.29880 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 455.01676 m
128.34085 454.92293 L
128.43468 454.82882 L
128.52879 454.73499 L
128.62261 454.73499 L
128.71672 454.82882 L
128.81055 454.92293 L
128.81055 455.01676 L
128.81055 455.11087 L
128.81055 455.11087 L
128.81055 455.20469 L
128.71672 455.29880 L
128.62261 455.29880 L
128.52879 455.29880 L
128.43468 455.29880 L
128.34085 455.20469 L
128.24674 455.11087 L
128.24674 455.01676 L
@c
F
@rax %Note: Object
128.24674 455.86233 128.81055 456.42586 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 456.14381 m
128.34085 456.04998 L
128.43468 455.95616 L
128.52879 455.86233 L
128.62261 455.86233 L
128.71672 455.95616 L
128.81055 456.04998 L
128.81055 456.14381 L
128.81055 456.23820 L
128.81055 456.23820 L
128.81055 456.33203 L
128.71672 456.42586 L
128.62261 456.42586 L
128.52879 456.42586 L
128.43468 456.42586 L
128.34085 456.33203 L
128.24674 456.23820 L
128.24674 456.14381 L
@c
F
@rax %Note: Object
128.24674 456.98967 128.81055 457.55320 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 457.27143 m
128.34085 457.17732 L
128.43468 457.08350 L
128.52879 456.98967 L
128.62261 456.98967 L
128.71672 457.08350 L
128.81055 457.17732 L
128.81055 457.27143 L
128.81055 457.36554 L
128.81055 457.36554 L
128.81055 457.45937 L
128.71672 457.55320 L
128.62261 457.55320 L
128.52879 457.55320 L
128.43468 457.55320 L
128.34085 457.45937 L
128.24674 457.36554 L
128.24674 457.27143 L
@c
F
@rax %Note: Object
128.24674 458.11701 128.81055 458.68054 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 458.39877 m
128.34085 458.30466 L
128.43468 458.21083 L
128.52879 458.11701 L
128.62261 458.11701 L
128.71672 458.21083 L
128.81055 458.30466 L
128.81055 458.39877 L
128.81055 458.49288 L
128.81055 458.49288 L
128.81055 458.58671 L
128.71672 458.68054 L
128.62261 458.68054 L
128.52879 458.68054 L
128.43468 458.68054 L
128.34085 458.58671 L
128.24674 458.49288 L
128.24674 458.39877 L
@c
F
@rax %Note: Object
128.24674 459.24406 128.81055 459.80787 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 459.52611 m
128.34085 459.43200 L
128.43468 459.33789 L
128.52879 459.24406 L
128.62261 459.24406 L
128.71672 459.33789 L
128.81055 459.43200 L
128.81055 459.52611 L
128.81055 459.61994 L
128.81055 459.61994 L
128.81055 459.71376 L
128.71672 459.80787 L
128.62261 459.80787 L
128.52879 459.80787 L
128.43468 459.80787 L
128.34085 459.71376 L
128.24674 459.61994 L
128.24674 459.52611 L
@c
F
@rax %Note: Object
128.24674 460.37140 128.81055 460.93521 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 460.65345 m
128.34085 460.55934 L
128.43468 460.46523 L
128.52879 460.37140 L
128.62261 460.37140 L
128.71672 460.46523 L
128.81055 460.55934 L
128.81055 460.65345 L
128.81055 460.74728 L
128.81055 460.74728 L
128.81055 460.84110 L
128.71672 460.93521 L
128.62261 460.93521 L
128.52879 460.93521 L
128.43468 460.93521 L
128.34085 460.84110 L
128.24674 460.74728 L
128.24674 460.65345 L
@c
F
@rax %Note: Object
128.24674 461.49874 128.81055 462.06227 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 461.78050 m
128.34085 461.68696 L
128.43468 461.59285 L
128.52879 461.49874 L
128.62261 461.49874 L
128.71672 461.59285 L
128.81055 461.68696 L
128.81055 461.78050 L
128.81055 461.87461 L
128.81055 461.87461 L
128.81055 461.96844 L
128.71672 462.06227 L
128.62261 462.06227 L
128.52879 462.06227 L
128.43468 462.06227 L
128.34085 461.96844 L
128.24674 461.87461 L
128.24674 461.78050 L
@c
F
@rax %Note: Object
128.24674 462.62608 128.81055 463.18961 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 462.90784 m
128.34085 462.81402 L
128.43468 462.71991 L
128.52879 462.62608 L
128.62261 462.62608 L
128.71672 462.71991 L
128.81055 462.81402 L
128.81055 462.90784 L
128.81055 463.00195 L
128.81055 463.00195 L
128.81055 463.09578 L
128.71672 463.18961 L
128.62261 463.18961 L
128.52879 463.18961 L
128.43468 463.18961 L
128.34085 463.09578 L
128.24674 463.00195 L
128.24674 462.90784 L
@c
F
@rax %Note: Object
128.24674 463.75342 128.81055 464.31694 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 464.03518 m
128.34085 463.94135 L
128.43468 463.84724 L
128.52879 463.75342 L
128.62261 463.75342 L
128.71672 463.84724 L
128.81055 463.94135 L
128.81055 464.03518 L
128.81055 464.12929 L
128.81055 464.12929 L
128.81055 464.22312 L
128.71672 464.31694 L
128.62261 464.31694 L
128.52879 464.31694 L
128.43468 464.31694 L
128.34085 464.22312 L
128.24674 464.12929 L
128.24674 464.03518 L
@c
F
@rax %Note: Object
128.24674 464.88047 128.81055 465.44428 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 465.16252 m
128.34085 465.06869 L
128.43468 464.97458 L
128.52879 464.88047 L
128.62261 464.88047 L
128.71672 464.97458 L
128.81055 465.06869 L
128.81055 465.16252 L
128.81055 465.25635 L
128.81055 465.25635 L
128.81055 465.35017 L
128.71672 465.44428 L
128.62261 465.44428 L
128.52879 465.44428 L
128.43468 465.44428 L
128.34085 465.35017 L
128.24674 465.25635 L
128.24674 465.16252 L
@c
F
@rax %Note: Object
128.24674 466.00781 128.81055 466.57162 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 466.28986 m
128.34085 466.19603 L
128.43468 466.10192 L
128.52879 466.00781 L
128.62261 466.00781 L
128.71672 466.10192 L
128.81055 466.19603 L
128.81055 466.28986 L
128.81055 466.38369 L
128.81055 466.38369 L
128.81055 466.47751 L
128.71672 466.57162 L
128.62261 466.57162 L
128.52879 466.57162 L
128.43468 466.57162 L
128.34085 466.47751 L
128.24674 466.38369 L
128.24674 466.28986 L
@c
F
@rax %Note: Object
128.24674 467.13515 128.81055 467.69896 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 467.41720 m
128.34085 467.32337 L
128.43468 467.22954 L
128.52879 467.13515 L
128.62261 467.13515 L
128.71672 467.22954 L
128.81055 467.32337 L
128.81055 467.41720 L
128.81055 467.51074 L
128.81055 467.51074 L
128.81055 467.60485 L
128.71672 467.69896 L
128.62261 467.69896 L
128.52879 467.69896 L
128.43468 467.69896 L
128.34085 467.60485 L
128.24674 467.51074 L
128.24674 467.41720 L
@c
F
@rax %Note: Object
128.24674 468.26277 128.81055 468.82630 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.24674 468.54425 m
128.34085 468.45043 L
128.43468 468.35660 L
128.52879 468.26277 L
128.62261 468.26277 L
128.71672 468.35660 L
128.81055 468.45043 L
128.81055 468.54425 L
128.81055 468.63836 L
128.81055 468.63836 L
128.81055 468.73219 L
128.71672 468.82630 L
128.62261 468.82630 L
128.52879 468.82630 L
128.43468 468.82630 L
128.34085 468.73219 L
128.24674 468.63836 L
128.24674 468.54425 L
@c
F
@rax %Note: Object
125.61647 469.39011 131.53493 475.30800 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
131.53493 469.39011 m
128.52879 475.30800 L
125.61647 469.39011 L
131.53493 469.39011 L
@c
F
@rax %Note: Object
212.79430 429.93439 213.35783 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
213.17017 429.93439 m
213.17017 430.02822 L
213.26400 430.12233 L
213.35783 430.21616 L
213.35783 430.21616 L
213.26400 430.30998 L
213.17017 430.40381 L
213.07635 430.49820 L
213.07635 430.49820 L
212.98224 430.49820 L
212.88841 430.40381 L
212.79430 430.30998 L
212.79430 430.21616 L
212.79430 430.12233 L
212.79430 430.02822 L
212.88841 429.93439 L
212.98224 429.93439 L
213.07635 429.93439 L
213.17017 429.93439 L
@c
F
@rax %Note: Object
211.66696 429.93439 212.23049 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
212.04283 429.93439 m
212.04283 430.02822 L
212.13666 430.12233 L
212.23049 430.21616 L
212.23049 430.21616 L
212.13666 430.30998 L
212.04283 430.40381 L
211.94901 430.49820 L
211.94901 430.49820 L
211.85490 430.49820 L
211.76107 430.40381 L
211.66696 430.30998 L
211.66696 430.21616 L
211.66696 430.12233 L
211.66696 430.02822 L
211.76107 429.93439 L
211.85490 429.93439 L
211.94901 429.93439 L
212.04283 429.93439 L
@c
F
@rax %Note: Object
210.53962 429.93439 211.10315 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
210.91550 429.93439 m
210.91550 430.02822 L
211.00932 430.12233 L
211.10315 430.21616 L
211.10315 430.21616 L
211.00932 430.30998 L
210.91550 430.40381 L
210.82167 430.49820 L
210.82167 430.49820 L
210.72784 430.49820 L
210.63373 430.40381 L
210.53962 430.30998 L
210.53962 430.21616 L
210.53962 430.12233 L
210.53962 430.02822 L
210.63373 429.93439 L
210.72784 429.93439 L
210.82167 429.93439 L
210.91550 429.93439 L
@c
F
@rax %Note: Object
209.41228 429.93439 209.97609 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
209.78816 429.93439 m
209.78816 430.02822 L
209.88227 430.12233 L
209.97609 430.21616 L
209.97609 430.21616 L
209.88227 430.30998 L
209.78816 430.40381 L
209.69433 430.49820 L
209.69433 430.49820 L
209.60050 430.49820 L
209.50639 430.40381 L
209.41228 430.30998 L
209.41228 430.21616 L
209.41228 430.12233 L
209.41228 430.02822 L
209.50639 429.93439 L
209.60050 429.93439 L
209.69433 429.93439 L
209.78816 429.93439 L
@c
F
@rax %Note: Object
208.28494 429.93439 208.84876 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
208.66082 429.93439 m
208.66082 430.02822 L
208.75465 430.12233 L
208.84876 430.21616 L
208.84876 430.21616 L
208.75465 430.30998 L
208.66082 430.40381 L
208.56699 430.49820 L
208.56699 430.49820 L
208.47317 430.49820 L
208.37877 430.40381 L
208.28494 430.30998 L
208.28494 430.21616 L
208.28494 430.12233 L
208.28494 430.02822 L
208.37877 429.93439 L
208.47317 429.93439 L
208.56699 429.93439 L
208.66082 429.93439 L
@c
F
@rax %Note: Object
207.15789 429.93439 207.72142 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
207.53376 429.93439 m
207.53376 430.02822 L
207.62759 430.12233 L
207.72142 430.21616 L
207.72142 430.21616 L
207.62759 430.30998 L
207.53376 430.40381 L
207.43994 430.49820 L
207.43994 430.49820 L
207.34583 430.49820 L
207.25172 430.40381 L
207.15789 430.30998 L
207.15789 430.21616 L
207.15789 430.12233 L
207.15789 430.02822 L
207.25172 429.93439 L
207.34583 429.93439 L
207.43994 429.93439 L
207.53376 429.93439 L
@c
F
@rax %Note: Object
206.03055 429.93439 206.59408 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
206.40643 429.93439 m
206.40643 430.02822 L
206.50025 430.12233 L
206.59408 430.21616 L
206.59408 430.21616 L
206.50025 430.30998 L
206.40643 430.40381 L
206.31260 430.49820 L
206.31260 430.49820 L
206.21820 430.49820 L
206.12438 430.40381 L
206.03055 430.30998 L
206.03055 430.21616 L
206.03055 430.12233 L
206.03055 430.02822 L
206.12438 429.93439 L
206.21820 429.93439 L
206.31260 429.93439 L
206.40643 429.93439 L
@c
F
@rax %Note: Object
204.90321 429.93439 205.46674 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
205.27909 429.93439 m
205.27909 430.02822 L
205.37291 430.12233 L
205.46674 430.21616 L
205.46674 430.21616 L
205.37291 430.30998 L
205.27909 430.40381 L
205.18498 430.49820 L
205.18498 430.49820 L
205.09087 430.49820 L
204.99732 430.40381 L
204.90321 430.30998 L
204.90321 430.21616 L
204.90321 430.12233 L
204.90321 430.02822 L
204.99732 429.93439 L
205.09087 429.93439 L
205.18498 429.93439 L
205.27909 429.93439 L
@c
F
@rax %Note: Object
203.77587 429.93439 204.33969 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
204.15175 429.93439 m
204.15175 430.02822 L
204.24586 430.12233 L
204.33969 430.21616 L
204.33969 430.21616 L
204.24586 430.30998 L
204.15175 430.40381 L
204.05764 430.49820 L
204.05764 430.49820 L
203.96381 430.49820 L
203.86998 430.40381 L
203.77587 430.30998 L
203.77587 430.21616 L
203.77587 430.12233 L
203.77587 430.02822 L
203.86998 429.93439 L
203.96381 429.93439 L
204.05764 429.93439 L
204.15175 429.93439 L
@c
F
@rax %Note: Object
202.64854 429.93439 203.21235 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
203.02441 429.93439 m
203.02441 430.02822 L
203.11852 430.12233 L
203.21235 430.21616 L
203.21235 430.21616 L
203.11852 430.30998 L
203.02441 430.40381 L
202.93030 430.49820 L
202.93030 430.49820 L
202.83647 430.49820 L
202.74236 430.40381 L
202.64854 430.30998 L
202.64854 430.21616 L
202.64854 430.12233 L
202.64854 430.02822 L
202.74236 429.93439 L
202.83647 429.93439 L
202.93030 429.93439 L
203.02441 429.93439 L
@c
F
@rax %Note: Object
201.52148 429.93439 202.08501 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
201.89735 429.93439 m
201.89735 430.02822 L
201.99118 430.12233 L
202.08501 430.21616 L
202.08501 430.21616 L
201.99118 430.30998 L
201.89735 430.40381 L
201.80324 430.49820 L
201.80324 430.49820 L
201.70913 430.49820 L
201.61531 430.40381 L
201.52148 430.30998 L
201.52148 430.21616 L
201.52148 430.12233 L
201.52148 430.02822 L
201.61531 429.93439 L
201.70913 429.93439 L
201.80324 429.93439 L
201.89735 429.93439 L
@c
F
@rax %Note: Object
200.39414 429.93439 200.95767 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
200.76973 429.93439 m
200.76973 430.02822 L
200.86384 430.12233 L
200.95767 430.21616 L
200.95767 430.21616 L
200.86384 430.30998 L
200.76973 430.40381 L
200.67591 430.49820 L
200.67591 430.49820 L
200.58180 430.49820 L
200.48797 430.40381 L
200.39414 430.30998 L
200.39414 430.21616 L
200.39414 430.12233 L
200.39414 430.02822 L
200.48797 429.93439 L
200.58180 429.93439 L
200.67591 429.93439 L
200.76973 429.93439 L
@c
F
@rax %Note: Object
199.26680 429.93439 199.83033 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
199.64239 429.93439 m
199.64239 430.02822 L
199.73650 430.12233 L
199.83033 430.21616 L
199.83033 430.21616 L
199.73650 430.30998 L
199.64239 430.40381 L
199.54828 430.49820 L
199.54828 430.49820 L
199.45446 430.49820 L
199.36063 430.40381 L
199.26680 430.30998 L
199.26680 430.21616 L
199.26680 430.12233 L
199.26680 430.02822 L
199.36063 429.93439 L
199.45446 429.93439 L
199.54828 429.93439 L
199.64239 429.93439 L
@c
F
@rax %Note: Object
198.13946 429.93439 198.70328 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
198.51506 429.93439 m
198.51506 430.02822 L
198.60945 430.12233 L
198.70328 430.21616 L
198.70328 430.21616 L
198.60945 430.30998 L
198.51506 430.40381 L
198.42123 430.49820 L
198.42123 430.49820 L
198.32740 430.49820 L
198.23357 430.40381 L
198.13946 430.30998 L
198.13946 430.21616 L
198.13946 430.12233 L
198.13946 430.02822 L
198.23357 429.93439 L
198.32740 429.93439 L
198.42123 429.93439 L
198.51506 429.93439 L
@c
F
@rax %Note: Object
197.01213 429.93439 197.57594 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
197.38772 429.93439 m
197.38772 430.02822 L
197.48183 430.12233 L
197.57594 430.21616 L
197.57594 430.21616 L
197.48183 430.30998 L
197.38772 430.40381 L
197.29389 430.49820 L
197.29389 430.49820 L
197.20006 430.49820 L
197.10595 430.40381 L
197.01213 430.30998 L
197.01213 430.21616 L
197.01213 430.12233 L
197.01213 430.02822 L
197.10595 429.93439 L
197.20006 429.93439 L
197.29389 429.93439 L
197.38772 429.93439 L
@c
F
@rax %Note: Object
195.88507 429.93439 196.44860 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
196.26066 429.93439 m
196.26066 430.02822 L
196.35449 430.12233 L
196.44860 430.21616 L
196.44860 430.21616 L
196.35449 430.30998 L
196.26066 430.40381 L
196.16683 430.49820 L
196.16683 430.49820 L
196.07272 430.49820 L
195.97890 430.40381 L
195.88507 430.30998 L
195.88507 430.21616 L
195.88507 430.12233 L
195.88507 430.02822 L
195.97890 429.93439 L
196.07272 429.93439 L
196.16683 429.93439 L
196.26066 429.93439 L
@c
F
@rax %Note: Object
194.75773 429.93439 195.32126 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
195.13332 429.93439 m
195.13332 430.02822 L
195.22715 430.12233 L
195.32126 430.21616 L
195.32126 430.21616 L
195.22715 430.30998 L
195.13332 430.40381 L
195.03950 430.49820 L
195.03950 430.49820 L
194.94539 430.49820 L
194.85156 430.40381 L
194.75773 430.30998 L
194.75773 430.21616 L
194.75773 430.12233 L
194.75773 430.02822 L
194.85156 429.93439 L
194.94539 429.93439 L
195.03950 429.93439 L
195.13332 429.93439 L
@c
F
@rax %Note: Object
193.63011 429.93439 194.19392 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
194.00598 429.93439 m
194.00598 430.02822 L
194.09981 430.12233 L
194.19392 430.21616 L
194.19392 430.21616 L
194.09981 430.30998 L
194.00598 430.40381 L
193.91187 430.49820 L
193.91187 430.49820 L
193.81805 430.49820 L
193.72422 430.40381 L
193.63011 430.30998 L
193.63011 430.21616 L
193.63011 430.12233 L
193.63011 430.02822 L
193.72422 429.93439 L
193.81805 429.93439 L
193.91187 429.93439 L
194.00598 429.93439 L
@c
F
@rax %Note: Object
192.50277 429.93439 193.06658 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
192.87865 429.93439 m
192.87865 430.02822 L
192.97276 430.12233 L
193.06658 430.21616 L
193.06658 430.21616 L
192.97276 430.30998 L
192.87865 430.40381 L
192.78482 430.49820 L
192.78482 430.49820 L
192.69099 430.49820 L
192.59717 430.40381 L
192.50277 430.30998 L
192.50277 430.21616 L
192.50277 430.12233 L
192.50277 430.02822 L
192.59717 429.93439 L
192.69099 429.93439 L
192.78482 429.93439 L
192.87865 429.93439 L
@c
F
@rax %Note: Object
191.37543 429.93439 191.93924 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
191.75131 429.93439 m
191.75131 430.02822 L
191.84542 430.12233 L
191.93924 430.21616 L
191.93924 430.21616 L
191.84542 430.30998 L
191.75131 430.40381 L
191.65748 430.49820 L
191.65748 430.49820 L
191.56365 430.49820 L
191.46954 430.40381 L
191.37543 430.30998 L
191.37543 430.21616 L
191.37543 430.12233 L
191.37543 430.02822 L
191.46954 429.93439 L
191.56365 429.93439 L
191.65748 429.93439 L
191.75131 429.93439 L
@c
F
@rax %Note: Object
190.24838 429.93439 190.81191 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
190.62397 429.93439 m
190.62397 430.02822 L
190.71780 430.12233 L
190.81191 430.21616 L
190.81191 430.21616 L
190.71780 430.30998 L
190.62397 430.40381 L
190.53043 430.49820 L
190.53043 430.49820 L
190.43631 430.49820 L
190.34220 430.40381 L
190.24838 430.30998 L
190.24838 430.21616 L
190.24838 430.12233 L
190.24838 430.02822 L
190.34220 429.93439 L
190.43631 429.93439 L
190.53043 429.93439 L
190.62397 429.93439 L
@c
F
@rax %Note: Object
189.12104 429.93439 189.68457 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
189.49691 429.93439 m
189.49691 430.02822 L
189.59074 430.12233 L
189.68457 430.21616 L
189.68457 430.21616 L
189.59074 430.30998 L
189.49691 430.40381 L
189.40309 430.49820 L
189.40309 430.49820 L
189.30898 430.49820 L
189.21487 430.40381 L
189.12104 430.30998 L
189.12104 430.21616 L
189.12104 430.12233 L
189.12104 430.02822 L
189.21487 429.93439 L
189.30898 429.93439 L
189.40309 429.93439 L
189.49691 429.93439 L
@c
F
@rax %Note: Object
187.99370 429.93439 188.55723 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
188.36957 429.93439 m
188.36957 430.02822 L
188.46340 430.12233 L
188.55723 430.21616 L
188.55723 430.21616 L
188.46340 430.30998 L
188.36957 430.40381 L
188.27546 430.49820 L
188.27546 430.49820 L
188.18164 430.49820 L
188.08753 430.40381 L
187.99370 430.30998 L
187.99370 430.21616 L
187.99370 430.12233 L
187.99370 430.02822 L
188.08753 429.93439 L
188.18164 429.93439 L
188.27546 429.93439 L
188.36957 429.93439 L
@c
F
@rax %Note: Object
186.86636 429.93439 187.43017 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
187.24224 429.93439 m
187.24224 430.02822 L
187.33635 430.12233 L
187.43017 430.21616 L
187.43017 430.21616 L
187.33635 430.30998 L
187.24224 430.40381 L
187.14841 430.49820 L
187.14841 430.49820 L
187.05430 430.49820 L
186.96047 430.40381 L
186.86636 430.30998 L
186.86636 430.21616 L
186.86636 430.12233 L
186.86636 430.02822 L
186.96047 429.93439 L
187.05430 429.93439 L
187.14841 429.93439 L
187.24224 429.93439 L
@c
F
@rax %Note: Object
185.73902 429.93439 186.30283 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
186.11490 429.93439 m
186.11490 430.02822 L
186.20901 430.12233 L
186.30283 430.21616 L
186.30283 430.21616 L
186.20901 430.30998 L
186.11490 430.40381 L
186.02107 430.49820 L
186.02107 430.49820 L
185.92696 430.49820 L
185.83313 430.40381 L
185.73902 430.30998 L
185.73902 430.21616 L
185.73902 430.12233 L
185.73902 430.02822 L
185.83313 429.93439 L
185.92696 429.93439 L
186.02107 429.93439 L
186.11490 429.93439 L
@c
F
@rax %Note: Object
184.61197 429.93439 185.17550 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
184.98756 429.93439 m
184.98756 430.02822 L
185.08139 430.12233 L
185.17550 430.21616 L
185.17550 430.21616 L
185.08139 430.30998 L
184.98756 430.40381 L
184.89373 430.49820 L
184.89373 430.49820 L
184.79962 430.49820 L
184.70580 430.40381 L
184.61197 430.30998 L
184.61197 430.21616 L
184.61197 430.12233 L
184.61197 430.02822 L
184.70580 429.93439 L
184.79962 429.93439 L
184.89373 429.93439 L
184.98756 429.93439 L
@c
F
@rax %Note: Object
183.48463 429.93439 184.04816 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
183.86050 429.93439 m
183.86050 430.02822 L
183.95433 430.12233 L
184.04816 430.21616 L
184.04816 430.21616 L
183.95433 430.30998 L
183.86050 430.40381 L
183.76639 430.49820 L
183.76639 430.49820 L
183.67228 430.49820 L
183.57846 430.40381 L
183.48463 430.30998 L
183.48463 430.21616 L
183.48463 430.12233 L
183.48463 430.02822 L
183.57846 429.93439 L
183.67228 429.93439 L
183.76639 429.93439 L
183.86050 429.93439 L
@c
F
@rax %Note: Object
182.35729 429.93439 182.92082 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
182.73317 429.93439 m
182.73317 430.02822 L
182.82699 430.12233 L
182.92082 430.21616 L
182.92082 430.21616 L
182.82699 430.30998 L
182.73317 430.40381 L
182.63877 430.49820 L
182.63877 430.49820 L
182.54494 430.49820 L
182.45112 430.40381 L
182.35729 430.30998 L
182.35729 430.21616 L
182.35729 430.12233 L
182.35729 430.02822 L
182.45112 429.93439 L
182.54494 429.93439 L
182.63877 429.93439 L
182.73317 429.93439 L
@c
F
@rax %Note: Object
181.22995 429.93439 181.79376 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
181.60583 429.93439 m
181.60583 430.02822 L
181.69994 430.12233 L
181.79376 430.21616 L
181.79376 430.21616 L
181.69994 430.30998 L
181.60583 430.40381 L
181.51172 430.49820 L
181.51172 430.49820 L
181.41789 430.49820 L
181.32406 430.40381 L
181.22995 430.30998 L
181.22995 430.21616 L
181.22995 430.12233 L
181.22995 430.02822 L
181.32406 429.93439 L
181.41789 429.93439 L
181.51172 429.93439 L
181.60583 429.93439 L
@c
F
@rax %Note: Object
180.10261 429.93439 180.66643 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
180.47820 429.93439 m
180.47820 430.02822 L
180.57260 430.12233 L
180.66643 430.21616 L
180.66643 430.21616 L
180.57260 430.30998 L
180.47820 430.40381 L
180.38438 430.49820 L
180.38438 430.49820 L
180.29055 430.49820 L
180.19672 430.40381 L
180.10261 430.30998 L
180.10261 430.21616 L
180.10261 430.12233 L
180.10261 430.02822 L
180.19672 429.93439 L
180.29055 429.93439 L
180.38438 429.93439 L
180.47820 429.93439 L
@c
F
@rax %Note: Object
178.97528 429.93439 179.53909 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
179.35087 429.93439 m
179.35087 430.02822 L
179.44498 430.12233 L
179.53909 430.21616 L
179.53909 430.21616 L
179.44498 430.30998 L
179.35087 430.40381 L
179.25704 430.49820 L
179.25704 430.49820 L
179.16321 430.49820 L
179.06910 430.40381 L
178.97528 430.30998 L
178.97528 430.21616 L
178.97528 430.12233 L
178.97528 430.02822 L
179.06910 429.93439 L
179.16321 429.93439 L
179.25704 429.93439 L
179.35087 429.93439 L
@c
F
@rax %Note: Object
177.84822 429.93439 178.41175 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
178.22381 429.93439 m
178.22381 430.02822 L
178.31792 430.12233 L
178.41175 430.21616 L
178.41175 430.21616 L
178.31792 430.30998 L
178.22381 430.40381 L
178.12998 430.49820 L
178.12998 430.49820 L
178.03587 430.49820 L
177.94205 430.40381 L
177.84822 430.30998 L
177.84822 430.21616 L
177.84822 430.12233 L
177.84822 430.02822 L
177.94205 429.93439 L
178.03587 429.93439 L
178.12998 429.93439 L
178.22381 429.93439 L
@c
F
@rax %Note: Object
176.72088 429.93439 177.28441 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
177.09647 429.93439 m
177.09647 430.02822 L
177.19030 430.12233 L
177.28441 430.21616 L
177.28441 430.21616 L
177.19030 430.30998 L
177.09647 430.40381 L
177.00236 430.49820 L
177.00236 430.49820 L
176.90854 430.49820 L
176.81471 430.40381 L
176.72088 430.30998 L
176.72088 430.21616 L
176.72088 430.12233 L
176.72088 430.02822 L
176.81471 429.93439 L
176.90854 429.93439 L
177.00236 429.93439 L
177.09647 429.93439 L
@c
F
@rax %Note: Object
175.59354 429.93439 176.15707 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
175.96913 429.93439 m
175.96913 430.02822 L
176.06296 430.12233 L
176.15707 430.21616 L
176.15707 430.21616 L
176.06296 430.30998 L
175.96913 430.40381 L
175.87531 430.49820 L
175.87531 430.49820 L
175.78148 430.49820 L
175.68765 430.40381 L
175.59354 430.30998 L
175.59354 430.21616 L
175.59354 430.12233 L
175.59354 430.02822 L
175.68765 429.93439 L
175.78148 429.93439 L
175.87531 429.93439 L
175.96913 429.93439 L
@c
F
@rax %Note: Object
174.46620 429.93439 175.03002 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
174.84180 429.93439 m
174.84180 430.02822 L
174.93591 430.12233 L
175.03002 430.21616 L
175.03002 430.21616 L
174.93591 430.30998 L
174.84180 430.40381 L
174.74797 430.49820 L
174.74797 430.49820 L
174.65414 430.49820 L
174.56031 430.40381 L
174.46620 430.30998 L
174.46620 430.21616 L
174.46620 430.12233 L
174.46620 430.02822 L
174.56031 429.93439 L
174.65414 429.93439 L
174.74797 429.93439 L
174.84180 429.93439 L
@c
F
@rax %Note: Object
173.33858 429.93439 173.90239 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
173.71446 429.93439 m
173.71446 430.02822 L
173.80828 430.12233 L
173.90239 430.21616 L
173.90239 430.21616 L
173.80828 430.30998 L
173.71446 430.40381 L
173.62063 430.49820 L
173.62063 430.49820 L
173.52680 430.49820 L
173.43269 430.40381 L
173.33858 430.30998 L
173.33858 430.21616 L
173.33858 430.12233 L
173.33858 430.02822 L
173.43269 429.93439 L
173.52680 429.93439 L
173.62063 429.93439 L
173.71446 429.93439 L
@c
F
@rax %Note: Object
172.21153 429.93439 172.77506 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
172.58740 429.93439 m
172.58740 430.02822 L
172.68123 430.12233 L
172.77506 430.21616 L
172.77506 430.21616 L
172.68123 430.30998 L
172.58740 430.40381 L
172.49357 430.49820 L
172.49357 430.49820 L
172.39946 430.49820 L
172.30564 430.40381 L
172.21153 430.30998 L
172.21153 430.21616 L
172.21153 430.12233 L
172.21153 430.02822 L
172.30564 429.93439 L
172.39946 429.93439 L
172.49357 429.93439 L
172.58740 429.93439 L
@c
F
@rax %Note: Object
171.08419 429.93439 171.64772 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
171.46006 429.93439 m
171.46006 430.02822 L
171.55389 430.12233 L
171.64772 430.21616 L
171.64772 430.21616 L
171.55389 430.30998 L
171.46006 430.40381 L
171.36624 430.49820 L
171.36624 430.49820 L
171.27213 430.49820 L
171.17802 430.40381 L
171.08419 430.30998 L
171.08419 430.21616 L
171.08419 430.12233 L
171.08419 430.02822 L
171.17802 429.93439 L
171.27213 429.93439 L
171.36624 429.93439 L
171.46006 429.93439 L
@c
F
@rax %Note: Object
169.95685 429.93439 170.52038 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
170.33272 429.93439 m
170.33272 430.02822 L
170.42655 430.12233 L
170.52038 430.21616 L
170.52038 430.21616 L
170.42655 430.30998 L
170.33272 430.40381 L
170.23861 430.49820 L
170.23861 430.49820 L
170.14507 430.49820 L
170.05096 430.40381 L
169.95685 430.30998 L
169.95685 430.21616 L
169.95685 430.12233 L
169.95685 430.02822 L
170.05096 429.93439 L
170.14507 429.93439 L
170.23861 429.93439 L
170.33272 429.93439 L
@c
F
@rax %Note: Object
168.82951 429.93439 169.39332 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
169.20539 429.93439 m
169.20539 430.02822 L
169.29950 430.12233 L
169.39332 430.21616 L
169.39332 430.21616 L
169.29950 430.30998 L
169.20539 430.40381 L
169.11156 430.49820 L
169.11156 430.49820 L
169.01773 430.49820 L
168.92362 430.40381 L
168.82951 430.30998 L
168.82951 430.21616 L
168.82951 430.12233 L
168.82951 430.02822 L
168.92362 429.93439 L
169.01773 429.93439 L
169.11156 429.93439 L
169.20539 429.93439 L
@c
F
@rax %Note: Object
167.70217 429.93439 168.26598 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
168.07805 429.93439 m
168.07805 430.02822 L
168.17187 430.12233 L
168.26598 430.21616 L
168.26598 430.21616 L
168.17187 430.30998 L
168.07805 430.40381 L
167.98422 430.49820 L
167.98422 430.49820 L
167.89011 430.49820 L
167.79600 430.40381 L
167.70217 430.30998 L
167.70217 430.21616 L
167.70217 430.12233 L
167.70217 430.02822 L
167.79600 429.93439 L
167.89011 429.93439 L
167.98422 429.93439 L
168.07805 429.93439 L
@c
F
@rax %Note: Object
166.57512 429.93439 167.13865 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
166.95099 429.93439 m
166.95099 430.02822 L
167.04482 430.12233 L
167.13865 430.21616 L
167.13865 430.21616 L
167.04482 430.30998 L
166.95099 430.40381 L
166.85717 430.49820 L
166.85717 430.49820 L
166.76277 430.49820 L
166.66894 430.40381 L
166.57512 430.30998 L
166.57512 430.21616 L
166.57512 430.12233 L
166.57512 430.02822 L
166.66894 429.93439 L
166.76277 429.93439 L
166.85717 429.93439 L
166.95099 429.93439 L
@c
F
@rax %Note: Object
165.44778 429.93439 166.01131 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
165.82365 429.93439 m
165.82365 430.02822 L
165.91748 430.12233 L
166.01131 430.21616 L
166.01131 430.21616 L
165.91748 430.30998 L
165.82365 430.40381 L
165.72983 430.49820 L
165.72983 430.49820 L
165.63543 430.49820 L
165.54161 430.40381 L
165.44778 430.30998 L
165.44778 430.21616 L
165.44778 430.12233 L
165.44778 430.02822 L
165.54161 429.93439 L
165.63543 429.93439 L
165.72983 429.93439 L
165.82365 429.93439 L
@c
F
@rax %Note: Object
164.32044 429.93439 164.88397 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
164.69631 429.93439 m
164.69631 430.02822 L
164.79014 430.12233 L
164.88397 430.21616 L
164.88397 430.21616 L
164.79014 430.30998 L
164.69631 430.40381 L
164.60220 430.49820 L
164.60220 430.49820 L
164.50809 430.49820 L
164.41455 430.40381 L
164.32044 430.30998 L
164.32044 430.21616 L
164.32044 430.12233 L
164.32044 430.02822 L
164.41455 429.93439 L
164.50809 429.93439 L
164.60220 429.93439 L
164.69631 429.93439 L
@c
F
@rax %Note: Object
163.19310 429.93439 163.75691 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
163.56898 429.93439 m
163.56898 430.02822 L
163.66309 430.12233 L
163.75691 430.21616 L
163.75691 430.21616 L
163.66309 430.30998 L
163.56898 430.40381 L
163.47487 430.49820 L
163.47487 430.49820 L
163.38104 430.49820 L
163.28721 430.40381 L
163.19310 430.30998 L
163.19310 430.21616 L
163.19310 430.12233 L
163.19310 430.02822 L
163.28721 429.93439 L
163.38104 429.93439 L
163.47487 429.93439 L
163.56898 429.93439 L
@c
F
@rax %Note: Object
162.06576 429.93439 162.62957 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
162.44164 429.93439 m
162.44164 430.02822 L
162.53546 430.12233 L
162.62957 430.21616 L
162.62957 430.21616 L
162.53546 430.30998 L
162.44164 430.40381 L
162.34753 430.49820 L
162.34753 430.49820 L
162.25370 430.49820 L
162.15959 430.40381 L
162.06576 430.30998 L
162.06576 430.21616 L
162.06576 430.12233 L
162.06576 430.02822 L
162.15959 429.93439 L
162.25370 429.93439 L
162.34753 429.93439 L
162.44164 429.93439 L
@c
F
@rax %Note: Object
160.93871 429.93439 161.50224 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
161.31430 429.93439 m
161.31430 430.02822 L
161.40841 430.12233 L
161.50224 430.21616 L
161.50224 430.21616 L
161.40841 430.30998 L
161.31430 430.40381 L
161.22047 430.49820 L
161.22047 430.49820 L
161.12636 430.49820 L
161.03254 430.40381 L
160.93871 430.30998 L
160.93871 430.21616 L
160.93871 430.12233 L
160.93871 430.02822 L
161.03254 429.93439 L
161.12636 429.93439 L
161.22047 429.93439 L
161.31430 429.93439 L
@c
F
@rax %Note: Object
159.81137 429.93439 160.37490 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
160.18696 429.93439 m
160.18696 430.02822 L
160.28107 430.12233 L
160.37490 430.21616 L
160.37490 430.21616 L
160.28107 430.30998 L
160.18696 430.40381 L
160.09313 430.49820 L
160.09313 430.49820 L
159.99902 430.49820 L
159.90520 430.40381 L
159.81137 430.30998 L
159.81137 430.21616 L
159.81137 430.12233 L
159.81137 430.02822 L
159.90520 429.93439 L
159.99902 429.93439 L
160.09313 429.93439 L
160.18696 429.93439 L
@c
F
@rax %Note: Object
158.68403 429.93439 159.24756 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
159.05962 429.93439 m
159.05962 430.02822 L
159.15373 430.12233 L
159.24756 430.21616 L
159.24756 430.21616 L
159.15373 430.30998 L
159.05962 430.40381 L
158.96551 430.49820 L
158.96551 430.49820 L
158.87169 430.49820 L
158.77786 430.40381 L
158.68403 430.30998 L
158.68403 430.21616 L
158.68403 430.12233 L
158.68403 430.02822 L
158.77786 429.93439 L
158.87169 429.93439 L
158.96551 429.93439 L
159.05962 429.93439 L
@c
F
@rax %Note: Object
157.55669 429.93439 158.12050 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
157.93228 429.93439 m
157.93228 430.02822 L
158.02639 430.12233 L
158.12050 430.21616 L
158.12050 430.21616 L
158.02639 430.30998 L
157.93228 430.40381 L
157.83846 430.49820 L
157.83846 430.49820 L
157.74463 430.49820 L
157.65080 430.40381 L
157.55669 430.30998 L
157.55669 430.21616 L
157.55669 430.12233 L
157.55669 430.02822 L
157.65080 429.93439 L
157.74463 429.93439 L
157.83846 429.93439 L
157.93228 429.93439 L
@c
F
@rax %Note: Object
156.42935 429.93439 156.99317 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
156.80494 429.93439 m
156.80494 430.02822 L
156.89906 430.12233 L
156.99317 430.21616 L
156.99317 430.21616 L
156.89906 430.30998 L
156.80494 430.40381 L
156.71112 430.49820 L
156.71112 430.49820 L
156.61729 430.49820 L
156.52318 430.40381 L
156.42935 430.30998 L
156.42935 430.21616 L
156.42935 430.12233 L
156.42935 430.02822 L
156.52318 429.93439 L
156.61729 429.93439 L
156.71112 429.93439 L
156.80494 429.93439 L
@c
F
@rax %Note: Object
155.30202 429.93439 155.86583 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
155.67789 429.93439 m
155.67789 430.02822 L
155.77143 430.12233 L
155.86583 430.21616 L
155.86583 430.21616 L
155.77143 430.30998 L
155.67789 430.40381 L
155.58406 430.49820 L
155.58406 430.49820 L
155.48995 430.49820 L
155.39613 430.40381 L
155.30202 430.30998 L
155.30202 430.21616 L
155.30202 430.12233 L
155.30202 430.02822 L
155.39613 429.93439 L
155.48995 429.93439 L
155.58406 429.93439 L
155.67789 429.93439 L
@c
F
@rax %Note: Object
154.17468 429.93439 154.73820 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
154.55055 429.93439 m
154.55055 430.02822 L
154.64438 430.12233 L
154.73820 430.21616 L
154.73820 430.21616 L
154.64438 430.30998 L
154.55055 430.40381 L
154.45672 430.49820 L
154.45672 430.49820 L
154.36261 430.49820 L
154.26879 430.40381 L
154.17468 430.30998 L
154.17468 430.21616 L
154.17468 430.12233 L
154.17468 430.02822 L
154.26879 429.93439 L
154.36261 429.93439 L
154.45672 429.93439 L
154.55055 429.93439 L
@c
F
@rax %Note: Object
153.04734 429.93439 153.61087 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
153.42321 429.93439 m
153.42321 430.02822 L
153.51704 430.12233 L
153.61087 430.21616 L
153.61087 430.21616 L
153.51704 430.30998 L
153.42321 430.40381 L
153.32910 430.49820 L
153.32910 430.49820 L
153.23528 430.49820 L
153.14145 430.40381 L
153.04734 430.30998 L
153.04734 430.21616 L
153.04734 430.12233 L
153.04734 430.02822 L
153.14145 429.93439 L
153.23528 429.93439 L
153.32910 429.93439 L
153.42321 429.93439 L
@c
F
@rax %Note: Object
151.92000 429.93439 152.48381 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
152.29587 429.93439 m
152.29587 430.02822 L
152.38998 430.12233 L
152.48381 430.21616 L
152.48381 430.21616 L
152.38998 430.30998 L
152.29587 430.40381 L
152.20205 430.49820 L
152.20205 430.49820 L
152.10822 430.49820 L
152.01411 430.40381 L
151.92000 430.30998 L
151.92000 430.21616 L
151.92000 430.12233 L
151.92000 430.02822 L
152.01411 429.93439 L
152.10822 429.93439 L
152.20205 429.93439 L
152.29587 429.93439 L
@c
F
@rax %Note: Object
150.79266 429.93439 151.35647 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
151.16854 429.93439 m
151.16854 430.02822 L
151.26265 430.12233 L
151.35647 430.21616 L
151.35647 430.21616 L
151.26265 430.30998 L
151.16854 430.40381 L
151.07471 430.49820 L
151.07471 430.49820 L
150.98088 430.49820 L
150.88649 430.40381 L
150.79266 430.30998 L
150.79266 430.21616 L
150.79266 430.12233 L
150.79266 430.02822 L
150.88649 429.93439 L
150.98088 429.93439 L
151.07471 429.93439 L
151.16854 429.93439 L
@c
F
@rax %Note: Object
149.66561 429.93439 150.22913 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
150.04120 429.93439 m
150.04120 430.02822 L
150.13502 430.12233 L
150.22913 430.21616 L
150.22913 430.21616 L
150.13502 430.30998 L
150.04120 430.40381 L
149.94737 430.49820 L
149.94737 430.49820 L
149.85354 430.49820 L
149.75943 430.40381 L
149.66561 430.30998 L
149.66561 430.21616 L
149.66561 430.12233 L
149.66561 430.02822 L
149.75943 429.93439 L
149.85354 429.93439 L
149.94737 429.93439 L
150.04120 429.93439 L
@c
F
@rax %Note: Object
148.53827 429.93439 149.10180 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
148.91414 429.93439 m
148.91414 430.02822 L
149.00797 430.12233 L
149.10180 430.21616 L
149.10180 430.21616 L
149.00797 430.30998 L
148.91414 430.40381 L
148.82031 430.49820 L
148.82031 430.49820 L
148.72620 430.49820 L
148.63209 430.40381 L
148.53827 430.30998 L
148.53827 430.21616 L
148.53827 430.12233 L
148.53827 430.02822 L
148.63209 429.93439 L
148.72620 429.93439 L
148.82031 429.93439 L
148.91414 429.93439 L
@c
F
@rax %Note: Object
147.41093 429.93439 147.97446 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
147.78680 429.93439 m
147.78680 430.02822 L
147.88063 430.12233 L
147.97446 430.21616 L
147.97446 430.21616 L
147.88063 430.30998 L
147.78680 430.40381 L
147.69269 430.49820 L
147.69269 430.49820 L
147.59858 430.49820 L
147.50476 430.40381 L
147.41093 430.30998 L
147.41093 430.21616 L
147.41093 430.12233 L
147.41093 430.02822 L
147.50476 429.93439 L
147.59858 429.93439 L
147.69269 429.93439 L
147.78680 429.93439 L
@c
F
@rax %Note: Object
146.28359 429.93439 146.84740 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
146.65946 429.93439 m
146.65946 430.02822 L
146.75357 430.12233 L
146.84740 430.21616 L
146.84740 430.21616 L
146.75357 430.30998 L
146.65946 430.40381 L
146.56564 430.49820 L
146.56564 430.49820 L
146.47153 430.49820 L
146.37770 430.40381 L
146.28359 430.30998 L
146.28359 430.21616 L
146.28359 430.12233 L
146.28359 430.02822 L
146.37770 429.93439 L
146.47153 429.93439 L
146.56564 429.93439 L
146.65946 429.93439 L
@c
F
@rax %Note: Object
145.15625 429.93439 145.72006 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
145.53213 429.93439 m
145.53213 430.02822 L
145.62624 430.12233 L
145.72006 430.21616 L
145.72006 430.21616 L
145.62624 430.30998 L
145.53213 430.40381 L
145.43830 430.49820 L
145.43830 430.49820 L
145.34419 430.49820 L
145.25008 430.40381 L
145.15625 430.30998 L
145.15625 430.21616 L
145.15625 430.12233 L
145.15625 430.02822 L
145.25008 429.93439 L
145.34419 429.93439 L
145.43830 429.93439 L
145.53213 429.93439 L
@c
F
@rax %Note: Object
144.02920 429.93439 144.59272 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
144.40479 429.93439 m
144.40479 430.02822 L
144.49861 430.12233 L
144.59272 430.21616 L
144.59272 430.21616 L
144.49861 430.30998 L
144.40479 430.40381 L
144.31068 430.49820 L
144.31068 430.49820 L
144.21685 430.49820 L
144.12274 430.40381 L
144.02920 430.30998 L
144.02920 430.21616 L
144.02920 430.12233 L
144.02920 430.02822 L
144.12274 429.93439 L
144.21685 429.93439 L
144.31068 429.93439 L
144.40479 429.93439 L
@c
F
@rax %Note: Object
142.90186 429.93439 143.46539 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
143.27773 429.93439 m
143.27773 430.02822 L
143.37156 430.12233 L
143.46539 430.21616 L
143.46539 430.21616 L
143.37156 430.30998 L
143.27773 430.40381 L
143.18362 430.49820 L
143.18362 430.49820 L
143.08951 430.49820 L
142.99569 430.40381 L
142.90186 430.30998 L
142.90186 430.21616 L
142.90186 430.12233 L
142.90186 430.02822 L
142.99569 429.93439 L
143.08951 429.93439 L
143.18362 429.93439 L
143.27773 429.93439 L
@c
F
@rax %Note: Object
141.77452 429.93439 142.33805 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
142.15011 429.93439 m
142.15011 430.02822 L
142.24422 430.12233 L
142.33805 430.21616 L
142.33805 430.21616 L
142.24422 430.30998 L
142.15011 430.40381 L
142.05600 430.49820 L
142.05600 430.49820 L
141.96217 430.49820 L
141.86835 430.40381 L
141.77452 430.30998 L
141.77452 430.21616 L
141.77452 430.12233 L
141.77452 430.02822 L
141.86835 429.93439 L
141.96217 429.93439 L
142.05600 429.93439 L
142.15011 429.93439 L
@c
F
@rax %Note: Object
140.64718 429.93439 141.21071 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
141.02277 429.93439 m
141.02277 430.02822 L
141.11717 430.12233 L
141.21071 430.21616 L
141.21071 430.21616 L
141.11717 430.30998 L
141.02277 430.40381 L
140.92894 430.49820 L
140.92894 430.49820 L
140.83512 430.49820 L
140.74129 430.40381 L
140.64718 430.30998 L
140.64718 430.21616 L
140.64718 430.12233 L
140.64718 430.02822 L
140.74129 429.93439 L
140.83512 429.93439 L
140.92894 429.93439 L
141.02277 429.93439 L
@c
F
@rax %Note: Object
139.51984 429.93439 140.08365 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
139.89543 429.93439 m
139.89543 430.02822 L
139.98983 430.12233 L
140.08365 430.21616 L
140.08365 430.21616 L
139.98983 430.30998 L
139.89543 430.40381 L
139.80161 430.49820 L
139.80161 430.49820 L
139.70778 430.49820 L
139.61395 430.40381 L
139.51984 430.30998 L
139.51984 430.21616 L
139.51984 430.12233 L
139.51984 430.02822 L
139.61395 429.93439 L
139.70778 429.93439 L
139.80161 429.93439 L
139.89543 429.93439 L
@c
F
@rax %Note: Object
138.39250 429.93439 138.95631 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
138.76809 429.93439 m
138.76809 430.02822 L
138.86220 430.12233 L
138.95631 430.21616 L
138.95631 430.21616 L
138.86220 430.30998 L
138.76809 430.40381 L
138.67427 430.49820 L
138.67427 430.49820 L
138.58044 430.49820 L
138.48633 430.40381 L
138.39250 430.30998 L
138.39250 430.21616 L
138.39250 430.12233 L
138.39250 430.02822 L
138.48633 429.93439 L
138.58044 429.93439 L
138.67427 429.93439 L
138.76809 429.93439 L
@c
F
@rax %Note: Object
137.26545 429.93439 137.82898 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
137.64104 429.93439 m
137.64104 430.02822 L
137.73487 430.12233 L
137.82898 430.21616 L
137.82898 430.21616 L
137.73487 430.30998 L
137.64104 430.40381 L
137.54721 430.49820 L
137.54721 430.49820 L
137.45310 430.49820 L
137.35928 430.40381 L
137.26545 430.30998 L
137.26545 430.21616 L
137.26545 430.12233 L
137.26545 430.02822 L
137.35928 429.93439 L
137.45310 429.93439 L
137.54721 429.93439 L
137.64104 429.93439 L
@c
F
@rax %Note: Object
136.13811 429.93439 136.70164 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
136.51370 429.93439 m
136.51370 430.02822 L
136.60753 430.12233 L
136.70164 430.21616 L
136.70164 430.21616 L
136.60753 430.30998 L
136.51370 430.40381 L
136.41959 430.49820 L
136.41959 430.49820 L
136.32576 430.49820 L
136.23194 430.40381 L
136.13811 430.30998 L
136.13811 430.21616 L
136.13811 430.12233 L
136.13811 430.02822 L
136.23194 429.93439 L
136.32576 429.93439 L
136.41959 429.93439 L
136.51370 429.93439 L
@c
F
@rax %Note: Object
135.01049 429.93439 135.57430 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
135.38636 429.93439 m
135.38636 430.02822 L
135.48019 430.12233 L
135.57430 430.21616 L
135.57430 430.21616 L
135.48019 430.30998 L
135.38636 430.40381 L
135.29254 430.49820 L
135.29254 430.49820 L
135.19871 430.49820 L
135.10488 430.40381 L
135.01049 430.30998 L
135.01049 430.21616 L
135.01049 430.12233 L
135.01049 430.02822 L
135.10488 429.93439 L
135.19871 429.93439 L
135.29254 429.93439 L
135.38636 429.93439 L
@c
F
@rax %Note: Object
133.88315 429.93439 134.44696 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
134.25902 429.93439 m
134.25902 430.02822 L
134.35313 430.12233 L
134.44696 430.21616 L
134.44696 430.21616 L
134.35313 430.30998 L
134.25902 430.40381 L
134.16520 430.49820 L
134.16520 430.49820 L
134.07137 430.49820 L
133.97754 430.40381 L
133.88315 430.30998 L
133.88315 430.21616 L
133.88315 430.12233 L
133.88315 430.02822 L
133.97754 429.93439 L
134.07137 429.93439 L
134.16520 429.93439 L
134.25902 429.93439 L
@c
F
@rax %Note: Object
132.75581 429.93439 133.31962 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
133.13169 429.93439 m
133.13169 430.02822 L
133.22551 430.12233 L
133.31962 430.21616 L
133.31962 430.21616 L
133.22551 430.30998 L
133.13169 430.40381 L
133.03786 430.49820 L
133.03786 430.49820 L
132.94403 430.49820 L
132.84992 430.40381 L
132.75581 430.30998 L
132.75581 430.21616 L
132.75581 430.12233 L
132.75581 430.02822 L
132.84992 429.93439 L
132.94403 429.93439 L
133.03786 429.93439 L
133.13169 429.93439 L
@c
F
@rax %Note: Object
131.62876 429.93439 132.19228 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
132.00463 429.93439 m
132.00463 430.02822 L
132.09846 430.12233 L
132.19228 430.21616 L
132.19228 430.21616 L
132.09846 430.30998 L
132.00463 430.40381 L
131.91080 430.49820 L
131.91080 430.49820 L
131.81669 430.49820 L
131.72258 430.40381 L
131.62876 430.30998 L
131.62876 430.21616 L
131.62876 430.12233 L
131.62876 430.02822 L
131.72258 429.93439 L
131.81669 429.93439 L
131.91080 429.93439 L
132.00463 429.93439 L
@c
F
@rax %Note: Object
130.50142 429.93439 131.06494 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
130.87729 429.93439 m
130.87729 430.02822 L
130.97112 430.12233 L
131.06494 430.21616 L
131.06494 430.21616 L
130.97112 430.30998 L
130.87729 430.40381 L
130.78318 430.49820 L
130.78318 430.49820 L
130.68935 430.49820 L
130.59524 430.40381 L
130.50142 430.30998 L
130.50142 430.21616 L
130.50142 430.12233 L
130.50142 430.02822 L
130.59524 429.93439 L
130.68935 429.93439 L
130.78318 429.93439 L
130.87729 429.93439 L
@c
F
@rax %Note: Object
129.37408 429.93439 129.93761 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
129.74995 429.93439 m
129.74995 430.02822 L
129.84378 430.12233 L
129.93761 430.21616 L
129.93761 430.21616 L
129.84378 430.30998 L
129.74995 430.40381 L
129.65584 430.49820 L
129.65584 430.49820 L
129.56230 430.49820 L
129.46819 430.40381 L
129.37408 430.30998 L
129.37408 430.21616 L
129.37408 430.12233 L
129.37408 430.02822 L
129.46819 429.93439 L
129.56230 429.93439 L
129.65584 429.93439 L
129.74995 429.93439 L
@c
F
@rax %Note: Object
128.24674 429.93439 128.81055 430.49820 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 430.12233 m
128.81055 430.21616 L
128.71672 430.30998 L
128.62261 430.40381 L
128.52879 430.49820 L
128.52879 430.49820 L
128.43468 430.40381 L
128.34085 430.30998 L
128.24674 430.21616 L
128.24674 430.21616 L
128.24674 430.21616 L
128.34085 430.12233 L
128.43468 430.02822 L
128.52879 429.93439 L
128.52879 429.93439 L
128.62261 430.02822 L
128.71672 430.12233 L
128.81055 430.12233 L
@c
F
@rax %Note: Object
128.24674 428.80734 128.81055 429.37087 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 428.99499 m
128.81055 429.08882 L
128.71672 429.18293 L
128.62261 429.27676 L
128.52879 429.37087 L
128.52879 429.37087 L
128.43468 429.27676 L
128.34085 429.18293 L
128.24674 429.08882 L
128.24674 429.08882 L
128.24674 429.08882 L
128.34085 428.99499 L
128.43468 428.90117 L
128.52879 428.80734 L
128.52879 428.80734 L
128.62261 428.90117 L
128.71672 428.99499 L
128.81055 428.99499 L
@c
F
@rax %Note: Object
128.24674 427.67972 128.81055 428.24353 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 427.86765 m
128.81055 427.96148 L
128.71672 428.05559 L
128.62261 428.14942 L
128.52879 428.24353 L
128.52879 428.24353 L
128.43468 428.14942 L
128.34085 428.05559 L
128.24674 427.96148 L
128.24674 427.96148 L
128.24674 427.96148 L
128.34085 427.86765 L
128.43468 427.77383 L
128.52879 427.67972 L
128.52879 427.67972 L
128.62261 427.77383 L
128.71672 427.86765 L
128.81055 427.86765 L
@c
F
@rax %Note: Object
128.24674 426.55238 128.81055 427.11591 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 426.74060 m
128.81055 426.83443 L
128.71672 426.92797 L
128.62261 427.02208 L
128.52879 427.11591 L
128.52879 427.11591 L
128.43468 427.02208 L
128.34085 426.92797 L
128.24674 426.83443 L
128.24674 426.83443 L
128.24674 426.83443 L
128.34085 426.74060 L
128.43468 426.64649 L
128.52879 426.55238 L
128.52879 426.55238 L
128.62261 426.64649 L
128.71672 426.74060 L
128.81055 426.74060 L
@c
F
@rax %Note: Object
128.24674 425.42504 128.81055 425.98885 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 425.61326 m
128.81055 425.70709 L
128.71672 425.80091 L
128.62261 425.89474 L
128.52879 425.98885 L
128.52879 425.98885 L
128.43468 425.89474 L
128.34085 425.80091 L
128.24674 425.70709 L
128.24674 425.70709 L
128.24674 425.70709 L
128.34085 425.61326 L
128.43468 425.51915 L
128.52879 425.42504 L
128.52879 425.42504 L
128.62261 425.51915 L
128.71672 425.61326 L
128.81055 425.61326 L
@c
F
@rax %Note: Object
128.24674 424.29770 128.81055 424.86151 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 424.48592 m
128.81055 424.57975 L
128.71672 424.67357 L
128.62261 424.76740 L
128.52879 424.86151 L
128.52879 424.86151 L
128.43468 424.76740 L
128.34085 424.67357 L
128.24674 424.57975 L
128.24674 424.57975 L
128.24674 424.57975 L
128.34085 424.48592 L
128.43468 424.39181 L
128.52879 424.29770 L
128.52879 424.29770 L
128.62261 424.39181 L
128.71672 424.48592 L
128.81055 424.48592 L
@c
F
@rax %Note: Object
128.24674 423.17065 128.81055 423.73417 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 423.35858 m
128.81055 423.45241 L
128.71672 423.54652 L
128.62261 423.64035 L
128.52879 423.73417 L
128.52879 423.73417 L
128.43468 423.64035 L
128.34085 423.54652 L
128.24674 423.45241 L
128.24674 423.45241 L
128.24674 423.45241 L
128.34085 423.35858 L
128.43468 423.26447 L
128.52879 423.17065 L
128.52879 423.17065 L
128.62261 423.26447 L
128.71672 423.35858 L
128.81055 423.35858 L
@c
F
@rax %Note: Object
128.24674 422.04331 128.81055 422.60683 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 422.23124 m
128.81055 422.32507 L
128.71672 422.41918 L
128.62261 422.51301 L
128.52879 422.60683 L
128.52879 422.60683 L
128.43468 422.51301 L
128.34085 422.41918 L
128.24674 422.32507 L
128.24674 422.32507 L
128.24674 422.32507 L
128.34085 422.23124 L
128.43468 422.13713 L
128.52879 422.04331 L
128.52879 422.04331 L
128.62261 422.13713 L
128.71672 422.23124 L
128.81055 422.23124 L
@c
F
@rax %Note: Object
128.24674 420.91597 128.81055 421.47950 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 421.10362 m
128.81055 421.19773 L
128.71672 421.29156 L
128.62261 421.38567 L
128.52879 421.47950 L
128.52879 421.47950 L
128.43468 421.38567 L
128.34085 421.29156 L
128.24674 421.19773 L
128.24674 421.19773 L
128.24674 421.19773 L
128.34085 421.10362 L
128.43468 421.01008 L
128.52879 420.91597 L
128.52879 420.91597 L
128.62261 421.01008 L
128.71672 421.10362 L
128.81055 421.10362 L
@c
F
@rax %Note: Object
128.24674 419.78863 128.81055 420.35244 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 419.97657 m
128.81055 420.07068 L
128.71672 420.16450 L
128.62261 420.25833 L
128.52879 420.35244 L
128.52879 420.35244 L
128.43468 420.25833 L
128.34085 420.16450 L
128.24674 420.07068 L
128.24674 420.07068 L
128.24674 420.07068 L
128.34085 419.97657 L
128.43468 419.88246 L
128.52879 419.78863 L
128.52879 419.78863 L
128.62261 419.88246 L
128.71672 419.97657 L
128.81055 419.97657 L
@c
F
@rax %Note: Object
128.24674 418.66129 128.81055 419.22510 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 418.84923 m
128.81055 418.94334 L
128.71672 419.03717 L
128.62261 419.13099 L
128.52879 419.22510 L
128.52879 419.22510 L
128.43468 419.13099 L
128.34085 419.03717 L
128.24674 418.94334 L
128.24674 418.94334 L
128.24674 418.94334 L
128.34085 418.84923 L
128.43468 418.75512 L
128.52879 418.66129 L
128.52879 418.66129 L
128.62261 418.75512 L
128.71672 418.84923 L
128.81055 418.84923 L
@c
F
@rax %Note: Object
128.24674 417.53424 128.81055 418.09776 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 417.72189 m
128.81055 417.81572 L
128.71672 417.91011 L
128.62261 418.00394 L
128.52879 418.09776 L
128.52879 418.09776 L
128.43468 418.00394 L
128.34085 417.91011 L
128.24674 417.81572 L
128.24674 417.81572 L
128.24674 417.81572 L
128.34085 417.72189 L
128.43468 417.62806 L
128.52879 417.53424 L
128.52879 417.53424 L
128.62261 417.62806 L
128.71672 417.72189 L
128.81055 417.72189 L
@c
F
@rax %Note: Object
128.24674 416.40690 128.81055 416.97043 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 416.59455 m
128.81055 416.68838 L
128.71672 416.78277 L
128.62261 416.87660 L
128.52879 416.97043 L
128.52879 416.97043 L
128.43468 416.87660 L
128.34085 416.78277 L
128.24674 416.68838 L
128.24674 416.68838 L
128.24674 416.68838 L
128.34085 416.59455 L
128.43468 416.50072 L
128.52879 416.40690 L
128.52879 416.40690 L
128.62261 416.50072 L
128.71672 416.59455 L
128.81055 416.59455 L
@c
F
@rax %Note: Object
128.24674 415.27928 128.81055 415.84309 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 415.46721 m
128.81055 415.56104 L
128.71672 415.65543 L
128.62261 415.74926 L
128.52879 415.84309 L
128.52879 415.84309 L
128.43468 415.74926 L
128.34085 415.65543 L
128.24674 415.56104 L
128.24674 415.56104 L
128.24674 415.56104 L
128.34085 415.46721 L
128.43468 415.37339 L
128.52879 415.27928 L
128.52879 415.27928 L
128.62261 415.37339 L
128.71672 415.46721 L
128.81055 415.46721 L
@c
F
@rax %Note: Object
128.24674 414.15222 128.81055 414.71603 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 414.34016 m
128.81055 414.43398 L
128.71672 414.52781 L
128.62261 414.62192 L
128.52879 414.71603 L
128.52879 414.71603 L
128.43468 414.62192 L
128.34085 414.52781 L
128.24674 414.43398 L
128.24674 414.43398 L
128.24674 414.43398 L
128.34085 414.34016 L
128.43468 414.24605 L
128.52879 414.15222 L
128.52879 414.15222 L
128.62261 414.24605 L
128.71672 414.34016 L
128.81055 414.34016 L
@c
F
@rax %Note: Object
128.24674 413.02488 128.81055 413.58869 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 413.21282 m
128.81055 413.30665 L
128.71672 413.40047 L
128.62261 413.49458 L
128.52879 413.58869 L
128.52879 413.58869 L
128.43468 413.49458 L
128.34085 413.40047 L
128.24674 413.30665 L
128.24674 413.30665 L
128.24674 413.30665 L
128.34085 413.21282 L
128.43468 413.11871 L
128.52879 413.02488 L
128.52879 413.02488 L
128.62261 413.11871 L
128.71672 413.21282 L
128.81055 413.21282 L
@c
F
@rax %Note: Object
128.24674 411.89783 128.81055 412.46107 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 412.08548 m
128.81055 412.17931 L
128.71672 412.27342 L
128.62261 412.36724 L
128.52879 412.46107 L
128.52879 412.46107 L
128.43468 412.36724 L
128.34085 412.27342 L
128.24674 412.17931 L
128.24674 412.17931 L
128.24674 412.17931 L
128.34085 412.08548 L
128.43468 411.99165 L
128.52879 411.89783 L
128.52879 411.89783 L
128.62261 411.99165 L
128.71672 412.08548 L
128.81055 412.08548 L
@c
F
@rax %Note: Object
128.24674 410.77049 128.81055 411.33402 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 410.95814 m
128.81055 411.05197 L
128.71672 411.14608 L
128.62261 411.23991 L
128.52879 411.33402 L
128.52879 411.33402 L
128.43468 411.23991 L
128.34085 411.14608 L
128.24674 411.05197 L
128.24674 411.05197 L
128.24674 411.05197 L
128.34085 410.95814 L
128.43468 410.86431 L
128.52879 410.77049 L
128.52879 410.77049 L
128.62261 410.86431 L
128.71672 410.95814 L
128.81055 410.95814 L
@c
F
@rax %Note: Object
128.24674 409.64287 128.81055 410.20668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 409.83080 m
128.81055 409.92463 L
128.71672 410.01874 L
128.62261 410.11257 L
128.52879 410.20668 L
128.52879 410.20668 L
128.43468 410.11257 L
128.34085 410.01874 L
128.24674 409.92463 L
128.24674 409.92463 L
128.24674 409.92463 L
128.34085 409.83080 L
128.43468 409.73698 L
128.52879 409.64287 L
128.52879 409.64287 L
128.62261 409.73698 L
128.71672 409.83080 L
128.81055 409.83080 L
@c
F
@rax %Note: Object
128.24674 408.51581 128.81055 409.07962 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.81055 408.70375 m
128.81055 408.79757 L
128.71672 408.89140 L
128.62261 408.98523 L
128.52879 409.07962 L
128.52879 409.07962 L
128.43468 408.98523 L
128.34085 408.89140 L
128.24674 408.79757 L
128.24674 408.79757 L
128.24674 408.79757 L
128.34085 408.70375 L
128.43468 408.60964 L
128.52879 408.51581 L
128.52879 408.51581 L
128.62261 408.60964 L
128.71672 408.70375 L
128.81055 408.70375 L
@c
F
@rax %Note: Object
212.88841 427.21002 218.71276 433.12819 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
212.88841 427.21002 m
218.71276 430.21616 L
212.88841 433.12819 L
212.88841 427.21002 L
@c
F
@rax %Note: Object
268.03191 556.19206 268.59572 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
268.40778 556.19206 m
268.40778 556.28589 L
268.50189 556.37972 L
268.59572 556.47383 L
268.59572 556.47383 L
268.50189 556.56794 L
268.40778 556.66176 L
268.31395 556.75559 L
268.31395 556.75559 L
268.22013 556.75559 L
268.12602 556.66176 L
268.03191 556.56794 L
268.03191 556.47383 L
268.03191 556.37972 L
268.03191 556.28589 L
268.12602 556.19206 L
268.22013 556.19206 L
268.31395 556.19206 L
268.40778 556.19206 L
@c
F
@rax %Note: Object
266.90457 556.19206 267.46838 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
267.28044 556.19206 m
267.28044 556.28589 L
267.37455 556.37972 L
267.46838 556.47383 L
267.46838 556.47383 L
267.37455 556.56794 L
267.28044 556.66176 L
267.18661 556.75559 L
267.18661 556.75559 L
267.09279 556.75559 L
266.99868 556.66176 L
266.90457 556.56794 L
266.90457 556.47383 L
266.90457 556.37972 L
266.90457 556.28589 L
266.99868 556.19206 L
267.09279 556.19206 L
267.18661 556.19206 L
267.28044 556.19206 L
@c
F
@rax %Note: Object
265.77751 556.19206 266.34104 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
266.15310 556.19206 m
266.15310 556.28589 L
266.24693 556.37972 L
266.34104 556.47383 L
266.34104 556.47383 L
266.24693 556.56794 L
266.15310 556.66176 L
266.05956 556.75559 L
266.05956 556.75559 L
265.96517 556.75559 L
265.87134 556.66176 L
265.77751 556.56794 L
265.77751 556.47383 L
265.77751 556.37972 L
265.77751 556.28589 L
265.87134 556.19206 L
265.96517 556.19206 L
266.05956 556.19206 L
266.15310 556.19206 L
@c
F
@rax %Note: Object
264.65017 556.19206 265.21370 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
265.02605 556.19206 m
265.02605 556.28589 L
265.11987 556.37972 L
265.21370 556.47383 L
265.21370 556.47383 L
265.11987 556.56794 L
265.02605 556.66176 L
264.93222 556.75559 L
264.93222 556.75559 L
264.83783 556.75559 L
264.74400 556.66176 L
264.65017 556.56794 L
264.65017 556.47383 L
264.65017 556.37972 L
264.65017 556.28589 L
264.74400 556.19206 L
264.83783 556.19206 L
264.93222 556.19206 L
265.02605 556.19206 L
@c
F
@rax %Note: Object
263.52283 556.19206 264.08636 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
263.89871 556.19206 m
263.89871 556.28589 L
263.99254 556.37972 L
264.08636 556.47383 L
264.08636 556.47383 L
263.99254 556.56794 L
263.89871 556.66176 L
263.80460 556.75559 L
263.80460 556.75559 L
263.71049 556.75559 L
263.61666 556.66176 L
263.52283 556.56794 L
263.52283 556.47383 L
263.52283 556.37972 L
263.52283 556.28589 L
263.61666 556.19206 L
263.71049 556.19206 L
263.80460 556.19206 L
263.89871 556.19206 L
@c
F
@rax %Note: Object
262.39550 556.19206 262.95931 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
262.77137 556.19206 m
262.77137 556.28589 L
262.86548 556.37972 L
262.95931 556.47383 L
262.95931 556.47383 L
262.86548 556.56794 L
262.77137 556.66176 L
262.67726 556.75559 L
262.67726 556.75559 L
262.58343 556.75559 L
262.48961 556.66176 L
262.39550 556.56794 L
262.39550 556.47383 L
262.39550 556.37972 L
262.39550 556.28589 L
262.48961 556.19206 L
262.58343 556.19206 L
262.67726 556.19206 L
262.77137 556.19206 L
@c
F
@rax %Note: Object
261.26816 556.19206 261.83197 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
261.64403 556.19206 m
261.64403 556.28589 L
261.73814 556.37972 L
261.83197 556.47383 L
261.83197 556.47383 L
261.73814 556.56794 L
261.64403 556.66176 L
261.54992 556.75559 L
261.54992 556.75559 L
261.45609 556.75559 L
261.36227 556.66176 L
261.26816 556.56794 L
261.26816 556.47383 L
261.26816 556.37972 L
261.26816 556.28589 L
261.36227 556.19206 L
261.45609 556.19206 L
261.54992 556.19206 L
261.64403 556.19206 L
@c
F
@rax %Note: Object
260.14110 556.19206 260.70463 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
260.51669 556.19206 m
260.51669 556.28589 L
260.61052 556.37972 L
260.70463 556.47383 L
260.70463 556.47383 L
260.61052 556.56794 L
260.51669 556.66176 L
260.42258 556.75559 L
260.42258 556.75559 L
260.32876 556.75559 L
260.23493 556.66176 L
260.14110 556.56794 L
260.14110 556.47383 L
260.14110 556.37972 L
260.14110 556.28589 L
260.23493 556.19206 L
260.32876 556.19206 L
260.42258 556.19206 L
260.51669 556.19206 L
@c
F
@rax %Note: Object
259.01376 556.19206 259.57729 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
259.38935 556.19206 m
259.38935 556.28589 L
259.48346 556.37972 L
259.57729 556.47383 L
259.57729 556.47383 L
259.48346 556.56794 L
259.38935 556.66176 L
259.29553 556.75559 L
259.29553 556.75559 L
259.20142 556.75559 L
259.10759 556.66176 L
259.01376 556.56794 L
259.01376 556.47383 L
259.01376 556.37972 L
259.01376 556.28589 L
259.10759 556.19206 L
259.20142 556.19206 L
259.29553 556.19206 L
259.38935 556.19206 L
@c
F
@rax %Note: Object
257.88643 556.19206 258.44995 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
258.26202 556.19206 m
258.26202 556.28589 L
258.35613 556.37972 L
258.44995 556.47383 L
258.44995 556.47383 L
258.35613 556.56794 L
258.26202 556.66176 L
258.16819 556.75559 L
258.16819 556.75559 L
258.07408 556.75559 L
257.98025 556.66176 L
257.88643 556.56794 L
257.88643 556.47383 L
257.88643 556.37972 L
257.88643 556.28589 L
257.98025 556.19206 L
258.07408 556.19206 L
258.16819 556.19206 L
258.26202 556.19206 L
@c
F
@rax %Note: Object
256.75909 556.19206 257.32290 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
257.13468 556.19206 m
257.13468 556.28589 L
257.22907 556.37972 L
257.32290 556.47383 L
257.32290 556.47383 L
257.22907 556.56794 L
257.13468 556.66176 L
257.04085 556.75559 L
257.04085 556.75559 L
256.94702 556.75559 L
256.85320 556.66176 L
256.75909 556.56794 L
256.75909 556.47383 L
256.75909 556.37972 L
256.75909 556.28589 L
256.85320 556.19206 L
256.94702 556.19206 L
257.04085 556.19206 L
257.13468 556.19206 L
@c
F
@rax %Note: Object
255.63175 556.19206 256.19556 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
256.00734 556.19206 m
256.00734 556.28589 L
256.10145 556.37972 L
256.19556 556.47383 L
256.19556 556.47383 L
256.10145 556.56794 L
256.00734 556.66176 L
255.91351 556.75559 L
255.91351 556.75559 L
255.81969 556.75559 L
255.72586 556.66176 L
255.63175 556.56794 L
255.63175 556.47383 L
255.63175 556.37972 L
255.63175 556.28589 L
255.72586 556.19206 L
255.81969 556.19206 L
255.91351 556.19206 L
256.00734 556.19206 L
@c
F
@rax %Note: Object
254.50441 556.19206 255.06822 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
254.88000 556.19206 m
254.88000 556.28589 L
254.97383 556.37972 L
255.06822 556.47383 L
255.06822 556.47383 L
254.97383 556.56794 L
254.88000 556.66176 L
254.78617 556.75559 L
254.78617 556.75559 L
254.69235 556.75559 L
254.59824 556.66176 L
254.50441 556.56794 L
254.50441 556.47383 L
254.50441 556.37972 L
254.50441 556.28589 L
254.59824 556.19206 L
254.69235 556.19206 L
254.78617 556.19206 L
254.88000 556.19206 L
@c
F
@rax %Note: Object
253.37735 556.19206 253.94088 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
253.75294 556.19206 m
253.75294 556.28589 L
253.84677 556.37972 L
253.94088 556.47383 L
253.94088 556.47383 L
253.84677 556.56794 L
253.75294 556.66176 L
253.65912 556.75559 L
253.65912 556.75559 L
253.56501 556.75559 L
253.47118 556.66176 L
253.37735 556.56794 L
253.37735 556.47383 L
253.37735 556.37972 L
253.37735 556.28589 L
253.47118 556.19206 L
253.56501 556.19206 L
253.65912 556.19206 L
253.75294 556.19206 L
@c
F
@rax %Note: Object
252.24973 556.19206 252.81354 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
252.62561 556.19206 m
252.62561 556.28589 L
252.71943 556.37972 L
252.81354 556.47383 L
252.81354 556.47383 L
252.71943 556.56794 L
252.62561 556.66176 L
252.53178 556.75559 L
252.53178 556.75559 L
252.43767 556.75559 L
252.34384 556.66176 L
252.24973 556.56794 L
252.24973 556.47383 L
252.24973 556.37972 L
252.24973 556.28589 L
252.34384 556.19206 L
252.43767 556.19206 L
252.53178 556.19206 L
252.62561 556.19206 L
@c
F
@rax %Note: Object
251.12239 556.19206 251.68592 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
251.49827 556.19206 m
251.49827 556.28589 L
251.59209 556.37972 L
251.68592 556.47383 L
251.68592 556.47383 L
251.59209 556.56794 L
251.49827 556.66176 L
251.40444 556.75559 L
251.40444 556.75559 L
251.31061 556.75559 L
251.21679 556.66176 L
251.12239 556.56794 L
251.12239 556.47383 L
251.12239 556.37972 L
251.12239 556.28589 L
251.21679 556.19206 L
251.31061 556.19206 L
251.40444 556.19206 L
251.49827 556.19206 L
@c
F
@rax %Note: Object
249.99506 556.19206 250.55887 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
250.37093 556.19206 m
250.37093 556.28589 L
250.46504 556.37972 L
250.55887 556.47383 L
250.55887 556.47383 L
250.46504 556.56794 L
250.37093 556.66176 L
250.27710 556.75559 L
250.27710 556.75559 L
250.18328 556.75559 L
250.08917 556.66176 L
249.99506 556.56794 L
249.99506 556.47383 L
249.99506 556.37972 L
249.99506 556.28589 L
250.08917 556.19206 L
250.18328 556.19206 L
250.27710 556.19206 L
250.37093 556.19206 L
@c
F
@rax %Note: Object
248.86772 556.19206 249.43153 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
249.24359 556.19206 m
249.24359 556.28589 L
249.33742 556.37972 L
249.43153 556.47383 L
249.43153 556.47383 L
249.33742 556.56794 L
249.24359 556.66176 L
249.14976 556.75559 L
249.14976 556.75559 L
249.05594 556.75559 L
248.96154 556.66176 L
248.86772 556.56794 L
248.86772 556.47383 L
248.86772 556.37972 L
248.86772 556.28589 L
248.96154 556.19206 L
249.05594 556.19206 L
249.14976 556.19206 L
249.24359 556.19206 L
@c
F
@rax %Note: Object
247.74066 556.19206 248.30419 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
248.11654 556.19206 m
248.11654 556.28589 L
248.21036 556.37972 L
248.30419 556.47383 L
248.30419 556.47383 L
248.21036 556.56794 L
248.11654 556.66176 L
248.02271 556.75559 L
248.02271 556.75559 L
247.92860 556.75559 L
247.83449 556.66176 L
247.74066 556.56794 L
247.74066 556.47383 L
247.74066 556.37972 L
247.74066 556.28589 L
247.83449 556.19206 L
247.92860 556.19206 L
248.02271 556.19206 L
248.11654 556.19206 L
@c
F
@rax %Note: Object
246.61332 556.19206 247.17685 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
246.98920 556.19206 m
246.98920 556.28589 L
247.08302 556.37972 L
247.17685 556.47383 L
247.17685 556.47383 L
247.08302 556.56794 L
246.98920 556.66176 L
246.89537 556.75559 L
246.89537 556.75559 L
246.80126 556.75559 L
246.70715 556.66176 L
246.61332 556.56794 L
246.61332 556.47383 L
246.61332 556.37972 L
246.61332 556.28589 L
246.70715 556.19206 L
246.80126 556.19206 L
246.89537 556.19206 L
246.98920 556.19206 L
@c
F
@rax %Note: Object
245.48598 556.19206 246.04951 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
245.86186 556.19206 m
245.86186 556.28589 L
245.95569 556.37972 L
246.04951 556.47383 L
246.04951 556.47383 L
245.95569 556.56794 L
245.86186 556.66176 L
245.76775 556.75559 L
245.76775 556.75559 L
245.67392 556.75559 L
245.58009 556.66176 L
245.48598 556.56794 L
245.48598 556.47383 L
245.48598 556.37972 L
245.48598 556.28589 L
245.58009 556.19206 L
245.67392 556.19206 L
245.76775 556.19206 L
245.86186 556.19206 L
@c
F
@rax %Note: Object
244.35865 556.19206 244.92246 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
244.73452 556.19206 m
244.73452 556.28589 L
244.82863 556.37972 L
244.92246 556.47383 L
244.92246 556.47383 L
244.82863 556.56794 L
244.73452 556.66176 L
244.64069 556.75559 L
244.64069 556.75559 L
244.54658 556.75559 L
244.45276 556.66176 L
244.35865 556.56794 L
244.35865 556.47383 L
244.35865 556.37972 L
244.35865 556.28589 L
244.45276 556.19206 L
244.54658 556.19206 L
244.64069 556.19206 L
244.73452 556.19206 L
@c
F
@rax %Note: Object
243.23131 556.19206 243.79512 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
243.60718 556.19206 m
243.60718 556.28589 L
243.70129 556.37972 L
243.79512 556.47383 L
243.79512 556.47383 L
243.70129 556.56794 L
243.60718 556.66176 L
243.51335 556.75559 L
243.51335 556.75559 L
243.41924 556.75559 L
243.32513 556.66176 L
243.23131 556.56794 L
243.23131 556.47383 L
243.23131 556.37972 L
243.23131 556.28589 L
243.32513 556.19206 L
243.41924 556.19206 L
243.51335 556.19206 L
243.60718 556.19206 L
@c
F
@rax %Note: Object
242.10425 556.19206 242.66778 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
242.48013 556.19206 m
242.48013 556.28589 L
242.57395 556.37972 L
242.66778 556.47383 L
242.66778 556.47383 L
242.57395 556.56794 L
242.48013 556.66176 L
242.38602 556.75559 L
242.38602 556.75559 L
242.29191 556.75559 L
242.19808 556.66176 L
242.10425 556.56794 L
242.10425 556.47383 L
242.10425 556.37972 L
242.10425 556.28589 L
242.19808 556.19206 L
242.29191 556.19206 L
242.38602 556.19206 L
242.48013 556.19206 L
@c
F
@rax %Note: Object
240.97691 556.19206 241.54044 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
241.35279 556.19206 m
241.35279 556.28589 L
241.44661 556.37972 L
241.54044 556.47383 L
241.54044 556.47383 L
241.44661 556.56794 L
241.35279 556.66176 L
241.25868 556.75559 L
241.25868 556.75559 L
241.16457 556.75559 L
241.07074 556.66176 L
240.97691 556.56794 L
240.97691 556.47383 L
240.97691 556.37972 L
240.97691 556.28589 L
241.07074 556.19206 L
241.16457 556.19206 L
241.25868 556.19206 L
241.35279 556.19206 L
@c
F
@rax %Note: Object
239.84957 556.19206 240.41310 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
240.22545 556.19206 m
240.22545 556.28589 L
240.31928 556.37972 L
240.41310 556.47383 L
240.41310 556.47383 L
240.31928 556.56794 L
240.22545 556.66176 L
240.13106 556.75559 L
240.13106 556.75559 L
240.03723 556.75559 L
239.94340 556.66176 L
239.84957 556.56794 L
239.84957 556.47383 L
239.84957 556.37972 L
239.84957 556.28589 L
239.94340 556.19206 L
240.03723 556.19206 L
240.13106 556.19206 L
240.22545 556.19206 L
@c
F
@rax %Note: Object
238.72224 556.19206 239.28605 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
239.09783 556.19206 m
239.09783 556.28589 L
239.19222 556.37972 L
239.28605 556.47383 L
239.28605 556.47383 L
239.19222 556.56794 L
239.09783 556.66176 L
239.00400 556.75559 L
239.00400 556.75559 L
238.91017 556.75559 L
238.81635 556.66176 L
238.72224 556.56794 L
238.72224 556.47383 L
238.72224 556.37972 L
238.72224 556.28589 L
238.81635 556.19206 L
238.91017 556.19206 L
239.00400 556.19206 L
239.09783 556.19206 L
@c
F
@rax %Note: Object
237.59490 556.19206 238.15871 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
237.97049 556.19206 m
237.97049 556.28589 L
238.06488 556.37972 L
238.15871 556.47383 L
238.15871 556.47383 L
238.06488 556.56794 L
237.97049 556.66176 L
237.87666 556.75559 L
237.87666 556.75559 L
237.78283 556.75559 L
237.68872 556.66176 L
237.59490 556.56794 L
237.59490 556.47383 L
237.59490 556.37972 L
237.59490 556.28589 L
237.68872 556.19206 L
237.78283 556.19206 L
237.87666 556.19206 L
237.97049 556.19206 L
@c
F
@rax %Note: Object
236.46784 556.19206 237.03137 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
236.84343 556.19206 m
236.84343 556.28589 L
236.93754 556.37972 L
237.03137 556.47383 L
237.03137 556.47383 L
236.93754 556.56794 L
236.84343 556.66176 L
236.74961 556.75559 L
236.74961 556.75559 L
236.65550 556.75559 L
236.56167 556.66176 L
236.46784 556.56794 L
236.46784 556.47383 L
236.46784 556.37972 L
236.46784 556.28589 L
236.56167 556.19206 L
236.65550 556.19206 L
236.74961 556.19206 L
236.84343 556.19206 L
@c
F
@rax %Note: Object
235.34050 556.19206 235.90403 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
235.71609 556.19206 m
235.71609 556.28589 L
235.80992 556.37972 L
235.90403 556.47383 L
235.90403 556.47383 L
235.80992 556.56794 L
235.71609 556.66176 L
235.62227 556.75559 L
235.62227 556.75559 L
235.52816 556.75559 L
235.43433 556.66176 L
235.34050 556.56794 L
235.34050 556.47383 L
235.34050 556.37972 L
235.34050 556.28589 L
235.43433 556.19206 L
235.52816 556.19206 L
235.62227 556.19206 L
235.71609 556.19206 L
@c
F
@rax %Note: Object
234.21317 556.19206 234.77669 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
234.58876 556.19206 m
234.58876 556.28589 L
234.68258 556.37972 L
234.77669 556.47383 L
234.77669 556.47383 L
234.68258 556.56794 L
234.58876 556.66176 L
234.49465 556.75559 L
234.49465 556.75559 L
234.40082 556.75559 L
234.30699 556.66176 L
234.21317 556.56794 L
234.21317 556.47383 L
234.21317 556.37972 L
234.21317 556.28589 L
234.30699 556.19206 L
234.40082 556.19206 L
234.49465 556.19206 L
234.58876 556.19206 L
@c
F
@rax %Note: Object
233.08554 556.19206 233.64935 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
233.46142 556.19206 m
233.46142 556.28589 L
233.55553 556.37972 L
233.64935 556.47383 L
233.64935 556.47383 L
233.55553 556.56794 L
233.46142 556.66176 L
233.36759 556.75559 L
233.36759 556.75559 L
233.27376 556.75559 L
233.17994 556.66176 L
233.08554 556.56794 L
233.08554 556.47383 L
233.08554 556.37972 L
233.08554 556.28589 L
233.17994 556.19206 L
233.27376 556.19206 L
233.36759 556.19206 L
233.46142 556.19206 L
@c
F
@rax %Note: Object
231.95820 556.19206 232.52202 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
232.33408 556.19206 m
232.33408 556.28589 L
232.42819 556.37972 L
232.52202 556.47383 L
232.52202 556.47383 L
232.42819 556.56794 L
232.33408 556.66176 L
232.24025 556.75559 L
232.24025 556.75559 L
232.14643 556.75559 L
232.05260 556.66176 L
231.95820 556.56794 L
231.95820 556.47383 L
231.95820 556.37972 L
231.95820 556.28589 L
232.05260 556.19206 L
232.14643 556.19206 L
232.24025 556.19206 L
232.33408 556.19206 L
@c
F
@rax %Note: Object
230.83115 556.19206 231.39468 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
231.20702 556.19206 m
231.20702 556.28589 L
231.30057 556.37972 L
231.39468 556.47383 L
231.39468 556.47383 L
231.30057 556.56794 L
231.20702 556.66176 L
231.11320 556.75559 L
231.11320 556.75559 L
231.01909 556.75559 L
230.92526 556.66176 L
230.83115 556.56794 L
230.83115 556.47383 L
230.83115 556.37972 L
230.83115 556.28589 L
230.92526 556.19206 L
231.01909 556.19206 L
231.11320 556.19206 L
231.20702 556.19206 L
@c
F
@rax %Note: Object
229.70381 556.19206 230.26734 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
230.07969 556.19206 m
230.07969 556.28589 L
230.17351 556.37972 L
230.26734 556.47383 L
230.26734 556.47383 L
230.17351 556.56794 L
230.07969 556.66176 L
229.98586 556.75559 L
229.98586 556.75559 L
229.89175 556.75559 L
229.79764 556.66176 L
229.70381 556.56794 L
229.70381 556.47383 L
229.70381 556.37972 L
229.70381 556.28589 L
229.79764 556.19206 L
229.89175 556.19206 L
229.98586 556.19206 L
230.07969 556.19206 L
@c
F
@rax %Note: Object
228.57647 556.19206 229.14000 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
228.95235 556.19206 m
228.95235 556.28589 L
229.04617 556.37972 L
229.14000 556.47383 L
229.14000 556.47383 L
229.04617 556.56794 L
228.95235 556.66176 L
228.85824 556.75559 L
228.85824 556.75559 L
228.76441 556.75559 L
228.67030 556.66176 L
228.57647 556.56794 L
228.57647 556.47383 L
228.57647 556.37972 L
228.57647 556.28589 L
228.67030 556.19206 L
228.76441 556.19206 L
228.85824 556.19206 L
228.95235 556.19206 L
@c
F
@rax %Note: Object
227.44913 556.19206 228.01294 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
227.82501 556.19206 m
227.82501 556.28589 L
227.91912 556.37972 L
228.01294 556.47383 L
228.01294 556.47383 L
227.91912 556.56794 L
227.82501 556.66176 L
227.73118 556.75559 L
227.73118 556.75559 L
227.63735 556.75559 L
227.54324 556.66176 L
227.44913 556.56794 L
227.44913 556.47383 L
227.44913 556.37972 L
227.44913 556.28589 L
227.54324 556.19206 L
227.63735 556.19206 L
227.73118 556.19206 L
227.82501 556.19206 L
@c
F
@rax %Note: Object
226.32180 556.19206 226.88561 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
226.69767 556.19206 m
226.69767 556.28589 L
226.79178 556.37972 L
226.88561 556.47383 L
226.88561 556.47383 L
226.79178 556.56794 L
226.69767 556.66176 L
226.60384 556.75559 L
226.60384 556.75559 L
226.50973 556.75559 L
226.41591 556.66176 L
226.32180 556.56794 L
226.32180 556.47383 L
226.32180 556.37972 L
226.32180 556.28589 L
226.41591 556.19206 L
226.50973 556.19206 L
226.60384 556.19206 L
226.69767 556.19206 L
@c
F
@rax %Note: Object
225.19474 556.19206 225.75827 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
225.57033 556.19206 m
225.57033 556.28589 L
225.66416 556.37972 L
225.75827 556.47383 L
225.75827 556.47383 L
225.66416 556.56794 L
225.57033 556.66176 L
225.47650 556.75559 L
225.47650 556.75559 L
225.38239 556.75559 L
225.28857 556.66176 L
225.19474 556.56794 L
225.19474 556.47383 L
225.19474 556.37972 L
225.19474 556.28589 L
225.28857 556.19206 L
225.38239 556.19206 L
225.47650 556.19206 L
225.57033 556.19206 L
@c
F
@rax %Note: Object
224.06740 556.19206 224.63093 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
224.44328 556.19206 m
224.44328 556.28589 L
224.53710 556.37972 L
224.63093 556.47383 L
224.63093 556.47383 L
224.53710 556.56794 L
224.44328 556.66176 L
224.34945 556.75559 L
224.34945 556.75559 L
224.25506 556.75559 L
224.16123 556.66176 L
224.06740 556.56794 L
224.06740 556.47383 L
224.06740 556.37972 L
224.06740 556.28589 L
224.16123 556.19206 L
224.25506 556.19206 L
224.34945 556.19206 L
224.44328 556.19206 L
@c
F
@rax %Note: Object
222.94006 556.19206 223.50359 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
223.31594 556.19206 m
223.31594 556.28589 L
223.40976 556.37972 L
223.50359 556.47383 L
223.50359 556.47383 L
223.40976 556.56794 L
223.31594 556.66176 L
223.22183 556.75559 L
223.22183 556.75559 L
223.12772 556.75559 L
223.03389 556.66176 L
222.94006 556.56794 L
222.94006 556.47383 L
222.94006 556.37972 L
222.94006 556.28589 L
223.03389 556.19206 L
223.12772 556.19206 L
223.22183 556.19206 L
223.31594 556.19206 L
@c
F
@rax %Note: Object
221.81272 556.19206 222.37654 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
222.18860 556.19206 m
222.18860 556.28589 L
222.28271 556.37972 L
222.37654 556.47383 L
222.37654 556.47383 L
222.28271 556.56794 L
222.18860 556.66176 L
222.09449 556.75559 L
222.09449 556.75559 L
222.00066 556.75559 L
221.90683 556.66176 L
221.81272 556.56794 L
221.81272 556.47383 L
221.81272 556.37972 L
221.81272 556.28589 L
221.90683 556.19206 L
222.00066 556.19206 L
222.09449 556.19206 L
222.18860 556.19206 L
@c
F
@rax %Note: Object
220.68539 556.19206 221.24920 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
221.06126 556.19206 m
221.06126 556.28589 L
221.15537 556.37972 L
221.24920 556.47383 L
221.24920 556.47383 L
221.15537 556.56794 L
221.06126 556.66176 L
220.96715 556.75559 L
220.96715 556.75559 L
220.87332 556.75559 L
220.77950 556.66176 L
220.68539 556.56794 L
220.68539 556.47383 L
220.68539 556.37972 L
220.68539 556.28589 L
220.77950 556.19206 L
220.87332 556.19206 L
220.96715 556.19206 L
221.06126 556.19206 L
@c
F
@rax %Note: Object
219.55833 556.19206 220.12186 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
219.93392 556.19206 m
219.93392 556.28589 L
220.02775 556.37972 L
220.12186 556.47383 L
220.12186 556.47383 L
220.02775 556.56794 L
219.93392 556.66176 L
219.83981 556.75559 L
219.83981 556.75559 L
219.74598 556.75559 L
219.65187 556.66176 L
219.55833 556.56794 L
219.55833 556.47383 L
219.55833 556.37972 L
219.55833 556.28589 L
219.65187 556.19206 L
219.74598 556.19206 L
219.83981 556.19206 L
219.93392 556.19206 L
@c
F
@rax %Note: Object
218.43099 556.19206 218.99452 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
218.80658 556.19206 m
218.80658 556.28589 L
218.90069 556.37972 L
218.99452 556.47383 L
218.99452 556.47383 L
218.90069 556.56794 L
218.80658 556.66176 L
218.71276 556.75559 L
218.71276 556.75559 L
218.61865 556.75559 L
218.52482 556.66176 L
218.43099 556.56794 L
218.43099 556.47383 L
218.43099 556.37972 L
218.43099 556.28589 L
218.52482 556.19206 L
218.61865 556.19206 L
218.71276 556.19206 L
218.80658 556.19206 L
@c
F
@rax %Note: Object
217.30365 556.19206 217.86718 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
217.67924 556.19206 m
217.67924 556.28589 L
217.77335 556.37972 L
217.86718 556.47383 L
217.86718 556.47383 L
217.77335 556.56794 L
217.67924 556.66176 L
217.58542 556.75559 L
217.58542 556.75559 L
217.49131 556.75559 L
217.39748 556.66176 L
217.30365 556.56794 L
217.30365 556.47383 L
217.30365 556.37972 L
217.30365 556.28589 L
217.39748 556.19206 L
217.49131 556.19206 L
217.58542 556.19206 L
217.67924 556.19206 L
@c
F
@rax %Note: Object
216.17631 556.19206 216.73984 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
216.55191 556.19206 m
216.55191 556.28589 L
216.64602 556.37972 L
216.73984 556.47383 L
216.73984 556.47383 L
216.64602 556.56794 L
216.55191 556.66176 L
216.45808 556.75559 L
216.45808 556.75559 L
216.36425 556.75559 L
216.27043 556.66176 L
216.17631 556.56794 L
216.17631 556.47383 L
216.17631 556.37972 L
216.17631 556.28589 L
216.27043 556.19206 L
216.36425 556.19206 L
216.45808 556.19206 L
216.55191 556.19206 L
@c
F
@rax %Note: Object
215.04898 556.19206 215.61279 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
215.42457 556.19206 m
215.42457 556.28589 L
215.51868 556.37972 L
215.61279 556.47383 L
215.61279 556.47383 L
215.51868 556.56794 L
215.42457 556.66176 L
215.33074 556.75559 L
215.33074 556.75559 L
215.23691 556.75559 L
215.14309 556.66176 L
215.04898 556.56794 L
215.04898 556.47383 L
215.04898 556.37972 L
215.04898 556.28589 L
215.14309 556.19206 L
215.23691 556.19206 L
215.33074 556.19206 L
215.42457 556.19206 L
@c
F
@rax %Note: Object
213.92164 556.19206 214.48545 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
214.29723 556.19206 m
214.29723 556.28589 L
214.39106 556.37972 L
214.48545 556.47383 L
214.48545 556.47383 L
214.39106 556.56794 L
214.29723 556.66176 L
214.20340 556.75559 L
214.20340 556.75559 L
214.10957 556.75559 L
214.01546 556.66176 L
213.92164 556.56794 L
213.92164 556.47383 L
213.92164 556.37972 L
213.92164 556.28589 L
214.01546 556.19206 L
214.10957 556.19206 L
214.20340 556.19206 L
214.29723 556.19206 L
@c
F
@rax %Note: Object
212.79430 556.19206 213.35783 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
213.17017 556.19206 m
213.17017 556.28589 L
213.26400 556.37972 L
213.35783 556.47383 L
213.35783 556.47383 L
213.26400 556.56794 L
213.17017 556.66176 L
213.07635 556.75559 L
213.07635 556.75559 L
212.98224 556.75559 L
212.88841 556.66176 L
212.79430 556.56794 L
212.79430 556.47383 L
212.79430 556.37972 L
212.79430 556.28589 L
212.88841 556.19206 L
212.98224 556.19206 L
213.07635 556.19206 L
213.17017 556.19206 L
@c
F
@rax %Note: Object
211.66696 556.19206 212.23049 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
212.04283 556.19206 m
212.04283 556.28589 L
212.13666 556.37972 L
212.23049 556.47383 L
212.23049 556.47383 L
212.13666 556.56794 L
212.04283 556.66176 L
211.94901 556.75559 L
211.94901 556.75559 L
211.85490 556.75559 L
211.76107 556.66176 L
211.66696 556.56794 L
211.66696 556.47383 L
211.66696 556.37972 L
211.66696 556.28589 L
211.76107 556.19206 L
211.85490 556.19206 L
211.94901 556.19206 L
212.04283 556.19206 L
@c
F
@rax %Note: Object
210.53962 556.19206 211.10315 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
210.91550 556.19206 m
210.91550 556.28589 L
211.00932 556.37972 L
211.10315 556.47383 L
211.10315 556.47383 L
211.00932 556.56794 L
210.91550 556.66176 L
210.82167 556.75559 L
210.82167 556.75559 L
210.72784 556.75559 L
210.63373 556.66176 L
210.53962 556.56794 L
210.53962 556.47383 L
210.53962 556.37972 L
210.53962 556.28589 L
210.63373 556.19206 L
210.72784 556.19206 L
210.82167 556.19206 L
210.91550 556.19206 L
@c
F
@rax %Note: Object
209.41228 556.19206 209.97609 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
209.78816 556.19206 m
209.78816 556.28589 L
209.88227 556.37972 L
209.97609 556.47383 L
209.97609 556.47383 L
209.88227 556.56794 L
209.78816 556.66176 L
209.69433 556.75559 L
209.69433 556.75559 L
209.60050 556.75559 L
209.50639 556.66176 L
209.41228 556.56794 L
209.41228 556.47383 L
209.41228 556.37972 L
209.41228 556.28589 L
209.50639 556.19206 L
209.60050 556.19206 L
209.69433 556.19206 L
209.78816 556.19206 L
@c
F
@rax %Note: Object
208.28494 556.19206 208.84876 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
208.66082 556.19206 m
208.66082 556.28589 L
208.75465 556.37972 L
208.84876 556.47383 L
208.84876 556.47383 L
208.75465 556.56794 L
208.66082 556.66176 L
208.56699 556.75559 L
208.56699 556.75559 L
208.47317 556.75559 L
208.37877 556.66176 L
208.28494 556.56794 L
208.28494 556.47383 L
208.28494 556.37972 L
208.28494 556.28589 L
208.37877 556.19206 L
208.47317 556.19206 L
208.56699 556.19206 L
208.66082 556.19206 L
@c
F
@rax %Note: Object
207.15789 556.19206 207.72142 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
207.53376 556.19206 m
207.53376 556.28589 L
207.62759 556.37972 L
207.72142 556.47383 L
207.72142 556.47383 L
207.62759 556.56794 L
207.53376 556.66176 L
207.43994 556.75559 L
207.43994 556.75559 L
207.34583 556.75559 L
207.25172 556.66176 L
207.15789 556.56794 L
207.15789 556.47383 L
207.15789 556.37972 L
207.15789 556.28589 L
207.25172 556.19206 L
207.34583 556.19206 L
207.43994 556.19206 L
207.53376 556.19206 L
@c
F
@rax %Note: Object
206.03055 556.19206 206.59408 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
206.40643 556.19206 m
206.40643 556.28589 L
206.50025 556.37972 L
206.59408 556.47383 L
206.59408 556.47383 L
206.50025 556.56794 L
206.40643 556.66176 L
206.31260 556.75559 L
206.31260 556.75559 L
206.21820 556.75559 L
206.12438 556.66176 L
206.03055 556.56794 L
206.03055 556.47383 L
206.03055 556.37972 L
206.03055 556.28589 L
206.12438 556.19206 L
206.21820 556.19206 L
206.31260 556.19206 L
206.40643 556.19206 L
@c
F
@rax %Note: Object
204.90321 556.19206 205.46674 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
205.27909 556.19206 m
205.27909 556.28589 L
205.37291 556.37972 L
205.46674 556.47383 L
205.46674 556.47383 L
205.37291 556.56794 L
205.27909 556.66176 L
205.18498 556.75559 L
205.18498 556.75559 L
205.09087 556.75559 L
204.99732 556.66176 L
204.90321 556.56794 L
204.90321 556.47383 L
204.90321 556.37972 L
204.90321 556.28589 L
204.99732 556.19206 L
205.09087 556.19206 L
205.18498 556.19206 L
205.27909 556.19206 L
@c
F
@rax %Note: Object
203.77587 556.19206 204.33969 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
204.15175 556.19206 m
204.15175 556.28589 L
204.24586 556.37972 L
204.33969 556.47383 L
204.33969 556.47383 L
204.24586 556.56794 L
204.15175 556.66176 L
204.05764 556.75559 L
204.05764 556.75559 L
203.96381 556.75559 L
203.86998 556.66176 L
203.77587 556.56794 L
203.77587 556.47383 L
203.77587 556.37972 L
203.77587 556.28589 L
203.86998 556.19206 L
203.96381 556.19206 L
204.05764 556.19206 L
204.15175 556.19206 L
@c
F
@rax %Note: Object
202.64854 556.19206 203.21235 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
203.02441 556.19206 m
203.02441 556.28589 L
203.11852 556.37972 L
203.21235 556.47383 L
203.21235 556.47383 L
203.11852 556.56794 L
203.02441 556.66176 L
202.93030 556.75559 L
202.93030 556.75559 L
202.83647 556.75559 L
202.74236 556.66176 L
202.64854 556.56794 L
202.64854 556.47383 L
202.64854 556.37972 L
202.64854 556.28589 L
202.74236 556.19206 L
202.83647 556.19206 L
202.93030 556.19206 L
203.02441 556.19206 L
@c
F
@rax %Note: Object
201.52148 556.19206 202.08501 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
201.89735 556.19206 m
201.89735 556.28589 L
201.99118 556.37972 L
202.08501 556.47383 L
202.08501 556.47383 L
201.99118 556.56794 L
201.89735 556.66176 L
201.80324 556.75559 L
201.80324 556.75559 L
201.70913 556.75559 L
201.61531 556.66176 L
201.52148 556.56794 L
201.52148 556.47383 L
201.52148 556.37972 L
201.52148 556.28589 L
201.61531 556.19206 L
201.70913 556.19206 L
201.80324 556.19206 L
201.89735 556.19206 L
@c
F
@rax %Note: Object
200.39414 556.19206 200.95767 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
200.76973 556.19206 m
200.76973 556.28589 L
200.86384 556.37972 L
200.95767 556.47383 L
200.95767 556.47383 L
200.86384 556.56794 L
200.76973 556.66176 L
200.67591 556.75559 L
200.67591 556.75559 L
200.58180 556.75559 L
200.48797 556.66176 L
200.39414 556.56794 L
200.39414 556.47383 L
200.39414 556.37972 L
200.39414 556.28589 L
200.48797 556.19206 L
200.58180 556.19206 L
200.67591 556.19206 L
200.76973 556.19206 L
@c
F
@rax %Note: Object
199.26680 556.19206 199.83033 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
199.64239 556.19206 m
199.64239 556.28589 L
199.73650 556.37972 L
199.83033 556.47383 L
199.83033 556.47383 L
199.73650 556.56794 L
199.64239 556.66176 L
199.54828 556.75559 L
199.54828 556.75559 L
199.45446 556.75559 L
199.36063 556.66176 L
199.26680 556.56794 L
199.26680 556.47383 L
199.26680 556.37972 L
199.26680 556.28589 L
199.36063 556.19206 L
199.45446 556.19206 L
199.54828 556.19206 L
199.64239 556.19206 L
@c
F
@rax %Note: Object
198.13946 556.19206 198.70328 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
198.51506 556.19206 m
198.51506 556.28589 L
198.60945 556.37972 L
198.70328 556.47383 L
198.70328 556.47383 L
198.60945 556.56794 L
198.51506 556.66176 L
198.42123 556.75559 L
198.42123 556.75559 L
198.32740 556.75559 L
198.23357 556.66176 L
198.13946 556.56794 L
198.13946 556.47383 L
198.13946 556.37972 L
198.13946 556.28589 L
198.23357 556.19206 L
198.32740 556.19206 L
198.42123 556.19206 L
198.51506 556.19206 L
@c
F
@rax %Note: Object
197.01213 556.19206 197.57594 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
197.38772 556.19206 m
197.38772 556.28589 L
197.48183 556.37972 L
197.57594 556.47383 L
197.57594 556.47383 L
197.48183 556.56794 L
197.38772 556.66176 L
197.29389 556.75559 L
197.29389 556.75559 L
197.20006 556.75559 L
197.10595 556.66176 L
197.01213 556.56794 L
197.01213 556.47383 L
197.01213 556.37972 L
197.01213 556.28589 L
197.10595 556.19206 L
197.20006 556.19206 L
197.29389 556.19206 L
197.38772 556.19206 L
@c
F
@rax %Note: Object
195.88507 556.19206 196.44860 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
196.26066 556.19206 m
196.26066 556.28589 L
196.35449 556.37972 L
196.44860 556.47383 L
196.44860 556.47383 L
196.35449 556.56794 L
196.26066 556.66176 L
196.16683 556.75559 L
196.16683 556.75559 L
196.07272 556.75559 L
195.97890 556.66176 L
195.88507 556.56794 L
195.88507 556.47383 L
195.88507 556.37972 L
195.88507 556.28589 L
195.97890 556.19206 L
196.07272 556.19206 L
196.16683 556.19206 L
196.26066 556.19206 L
@c
F
@rax %Note: Object
194.75773 556.19206 195.32126 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
195.13332 556.19206 m
195.13332 556.28589 L
195.22715 556.37972 L
195.32126 556.47383 L
195.32126 556.47383 L
195.22715 556.56794 L
195.13332 556.66176 L
195.03950 556.75559 L
195.03950 556.75559 L
194.94539 556.75559 L
194.85156 556.66176 L
194.75773 556.56794 L
194.75773 556.47383 L
194.75773 556.37972 L
194.75773 556.28589 L
194.85156 556.19206 L
194.94539 556.19206 L
195.03950 556.19206 L
195.13332 556.19206 L
@c
F
@rax %Note: Object
193.63011 556.19206 194.19392 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
194.00598 556.19206 m
194.00598 556.28589 L
194.09981 556.37972 L
194.19392 556.47383 L
194.19392 556.47383 L
194.09981 556.56794 L
194.00598 556.66176 L
193.91187 556.75559 L
193.91187 556.75559 L
193.81805 556.75559 L
193.72422 556.66176 L
193.63011 556.56794 L
193.63011 556.47383 L
193.63011 556.37972 L
193.63011 556.28589 L
193.72422 556.19206 L
193.81805 556.19206 L
193.91187 556.19206 L
194.00598 556.19206 L
@c
F
@rax %Note: Object
192.50277 556.19206 193.06658 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
192.87865 556.19206 m
192.87865 556.28589 L
192.97276 556.37972 L
193.06658 556.47383 L
193.06658 556.47383 L
192.97276 556.56794 L
192.87865 556.66176 L
192.78482 556.75559 L
192.78482 556.75559 L
192.69099 556.75559 L
192.59717 556.66176 L
192.50277 556.56794 L
192.50277 556.47383 L
192.50277 556.37972 L
192.50277 556.28589 L
192.59717 556.19206 L
192.69099 556.19206 L
192.78482 556.19206 L
192.87865 556.19206 L
@c
F
@rax %Note: Object
191.37543 556.19206 191.93924 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
191.75131 556.19206 m
191.75131 556.28589 L
191.84542 556.37972 L
191.93924 556.47383 L
191.93924 556.47383 L
191.84542 556.56794 L
191.75131 556.66176 L
191.65748 556.75559 L
191.65748 556.75559 L
191.56365 556.75559 L
191.46954 556.66176 L
191.37543 556.56794 L
191.37543 556.47383 L
191.37543 556.37972 L
191.37543 556.28589 L
191.46954 556.19206 L
191.56365 556.19206 L
191.65748 556.19206 L
191.75131 556.19206 L
@c
F
@rax %Note: Object
190.24838 556.19206 190.81191 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
190.62397 556.19206 m
190.62397 556.28589 L
190.71780 556.37972 L
190.81191 556.47383 L
190.81191 556.47383 L
190.71780 556.56794 L
190.62397 556.66176 L
190.53043 556.75559 L
190.53043 556.75559 L
190.43631 556.75559 L
190.34220 556.66176 L
190.24838 556.56794 L
190.24838 556.47383 L
190.24838 556.37972 L
190.24838 556.28589 L
190.34220 556.19206 L
190.43631 556.19206 L
190.53043 556.19206 L
190.62397 556.19206 L
@c
F
@rax %Note: Object
189.12104 556.19206 189.68457 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
189.49691 556.19206 m
189.49691 556.28589 L
189.59074 556.37972 L
189.68457 556.47383 L
189.68457 556.47383 L
189.59074 556.56794 L
189.49691 556.66176 L
189.40309 556.75559 L
189.40309 556.75559 L
189.30898 556.75559 L
189.21487 556.66176 L
189.12104 556.56794 L
189.12104 556.47383 L
189.12104 556.37972 L
189.12104 556.28589 L
189.21487 556.19206 L
189.30898 556.19206 L
189.40309 556.19206 L
189.49691 556.19206 L
@c
F
@rax %Note: Object
187.99370 556.19206 188.55723 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
188.36957 556.19206 m
188.36957 556.28589 L
188.46340 556.37972 L
188.55723 556.47383 L
188.55723 556.47383 L
188.46340 556.56794 L
188.36957 556.66176 L
188.27546 556.75559 L
188.27546 556.75559 L
188.18164 556.75559 L
188.08753 556.66176 L
187.99370 556.56794 L
187.99370 556.47383 L
187.99370 556.37972 L
187.99370 556.28589 L
188.08753 556.19206 L
188.18164 556.19206 L
188.27546 556.19206 L
188.36957 556.19206 L
@c
F
@rax %Note: Object
186.86636 556.19206 187.43017 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
187.24224 556.19206 m
187.24224 556.28589 L
187.33635 556.37972 L
187.43017 556.47383 L
187.43017 556.47383 L
187.33635 556.56794 L
187.24224 556.66176 L
187.14841 556.75559 L
187.14841 556.75559 L
187.05430 556.75559 L
186.96047 556.66176 L
186.86636 556.56794 L
186.86636 556.47383 L
186.86636 556.37972 L
186.86636 556.28589 L
186.96047 556.19206 L
187.05430 556.19206 L
187.14841 556.19206 L
187.24224 556.19206 L
@c
F
@rax %Note: Object
185.73902 556.19206 186.30283 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
186.11490 556.19206 m
186.11490 556.28589 L
186.20901 556.37972 L
186.30283 556.47383 L
186.30283 556.47383 L
186.20901 556.56794 L
186.11490 556.66176 L
186.02107 556.75559 L
186.02107 556.75559 L
185.92696 556.75559 L
185.83313 556.66176 L
185.73902 556.56794 L
185.73902 556.47383 L
185.73902 556.37972 L
185.73902 556.28589 L
185.83313 556.19206 L
185.92696 556.19206 L
186.02107 556.19206 L
186.11490 556.19206 L
@c
F
@rax %Note: Object
184.61197 556.19206 185.17550 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
184.98756 556.19206 m
184.98756 556.28589 L
185.08139 556.37972 L
185.17550 556.47383 L
185.17550 556.47383 L
185.08139 556.56794 L
184.98756 556.66176 L
184.89373 556.75559 L
184.89373 556.75559 L
184.79962 556.75559 L
184.70580 556.66176 L
184.61197 556.56794 L
184.61197 556.47383 L
184.61197 556.37972 L
184.61197 556.28589 L
184.70580 556.19206 L
184.79962 556.19206 L
184.89373 556.19206 L
184.98756 556.19206 L
@c
F
@rax %Note: Object
183.48463 556.19206 184.04816 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
183.86050 556.19206 m
183.86050 556.28589 L
183.95433 556.37972 L
184.04816 556.47383 L
184.04816 556.47383 L
183.95433 556.56794 L
183.86050 556.66176 L
183.76639 556.75559 L
183.76639 556.75559 L
183.67228 556.75559 L
183.57846 556.66176 L
183.48463 556.56794 L
183.48463 556.47383 L
183.48463 556.37972 L
183.48463 556.28589 L
183.57846 556.19206 L
183.67228 556.19206 L
183.76639 556.19206 L
183.86050 556.19206 L
@c
F
@rax %Note: Object
182.35729 556.19206 182.92082 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
182.73317 556.19206 m
182.73317 556.28589 L
182.82699 556.37972 L
182.92082 556.47383 L
182.92082 556.47383 L
182.82699 556.56794 L
182.73317 556.66176 L
182.63877 556.75559 L
182.63877 556.75559 L
182.54494 556.75559 L
182.45112 556.66176 L
182.35729 556.56794 L
182.35729 556.47383 L
182.35729 556.37972 L
182.35729 556.28589 L
182.45112 556.19206 L
182.54494 556.19206 L
182.63877 556.19206 L
182.73317 556.19206 L
@c
F
@rax %Note: Object
181.22995 556.19206 181.79376 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
181.60583 556.19206 m
181.60583 556.28589 L
181.69994 556.37972 L
181.79376 556.47383 L
181.79376 556.47383 L
181.69994 556.56794 L
181.60583 556.66176 L
181.51172 556.75559 L
181.51172 556.75559 L
181.41789 556.75559 L
181.32406 556.66176 L
181.22995 556.56794 L
181.22995 556.47383 L
181.22995 556.37972 L
181.22995 556.28589 L
181.32406 556.19206 L
181.41789 556.19206 L
181.51172 556.19206 L
181.60583 556.19206 L
@c
F
@rax %Note: Object
180.10261 556.19206 180.66643 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
180.47820 556.19206 m
180.47820 556.28589 L
180.57260 556.37972 L
180.66643 556.47383 L
180.66643 556.47383 L
180.57260 556.56794 L
180.47820 556.66176 L
180.38438 556.75559 L
180.38438 556.75559 L
180.29055 556.75559 L
180.19672 556.66176 L
180.10261 556.56794 L
180.10261 556.47383 L
180.10261 556.37972 L
180.10261 556.28589 L
180.19672 556.19206 L
180.29055 556.19206 L
180.38438 556.19206 L
180.47820 556.19206 L
@c
F
@rax %Note: Object
178.97528 556.19206 179.53909 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
179.35087 556.19206 m
179.35087 556.28589 L
179.44498 556.37972 L
179.53909 556.47383 L
179.53909 556.47383 L
179.44498 556.56794 L
179.35087 556.66176 L
179.25704 556.75559 L
179.25704 556.75559 L
179.16321 556.75559 L
179.06910 556.66176 L
178.97528 556.56794 L
178.97528 556.47383 L
178.97528 556.37972 L
178.97528 556.28589 L
179.06910 556.19206 L
179.16321 556.19206 L
179.25704 556.19206 L
179.35087 556.19206 L
@c
F
@rax %Note: Object
177.84822 556.19206 178.41175 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
178.22381 556.19206 m
178.22381 556.28589 L
178.31792 556.37972 L
178.41175 556.47383 L
178.41175 556.47383 L
178.31792 556.56794 L
178.22381 556.66176 L
178.12998 556.75559 L
178.12998 556.75559 L
178.03587 556.75559 L
177.94205 556.66176 L
177.84822 556.56794 L
177.84822 556.47383 L
177.84822 556.37972 L
177.84822 556.28589 L
177.94205 556.19206 L
178.03587 556.19206 L
178.12998 556.19206 L
178.22381 556.19206 L
@c
F
@rax %Note: Object
176.72088 556.19206 177.28441 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
177.09647 556.19206 m
177.09647 556.28589 L
177.19030 556.37972 L
177.28441 556.47383 L
177.28441 556.47383 L
177.19030 556.56794 L
177.09647 556.66176 L
177.00236 556.75559 L
177.00236 556.75559 L
176.90854 556.75559 L
176.81471 556.66176 L
176.72088 556.56794 L
176.72088 556.47383 L
176.72088 556.37972 L
176.72088 556.28589 L
176.81471 556.19206 L
176.90854 556.19206 L
177.00236 556.19206 L
177.09647 556.19206 L
@c
F
@rax %Note: Object
175.59354 556.19206 176.15707 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
175.96913 556.19206 m
175.96913 556.28589 L
176.06296 556.37972 L
176.15707 556.47383 L
176.15707 556.47383 L
176.06296 556.56794 L
175.96913 556.66176 L
175.87531 556.75559 L
175.87531 556.75559 L
175.78148 556.75559 L
175.68765 556.66176 L
175.59354 556.56794 L
175.59354 556.47383 L
175.59354 556.37972 L
175.59354 556.28589 L
175.68765 556.19206 L
175.78148 556.19206 L
175.87531 556.19206 L
175.96913 556.19206 L
@c
F
@rax %Note: Object
174.46620 556.19206 175.03002 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
174.84180 556.19206 m
174.84180 556.28589 L
174.93591 556.37972 L
175.03002 556.47383 L
175.03002 556.47383 L
174.93591 556.56794 L
174.84180 556.66176 L
174.74797 556.75559 L
174.74797 556.75559 L
174.65414 556.75559 L
174.56031 556.66176 L
174.46620 556.56794 L
174.46620 556.47383 L
174.46620 556.37972 L
174.46620 556.28589 L
174.56031 556.19206 L
174.65414 556.19206 L
174.74797 556.19206 L
174.84180 556.19206 L
@c
F
@rax %Note: Object
173.33858 556.19206 173.90239 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
173.71446 556.19206 m
173.71446 556.28589 L
173.80828 556.37972 L
173.90239 556.47383 L
173.90239 556.47383 L
173.80828 556.56794 L
173.71446 556.66176 L
173.62063 556.75559 L
173.62063 556.75559 L
173.52680 556.75559 L
173.43269 556.66176 L
173.33858 556.56794 L
173.33858 556.47383 L
173.33858 556.37972 L
173.33858 556.28589 L
173.43269 556.19206 L
173.52680 556.19206 L
173.62063 556.19206 L
173.71446 556.19206 L
@c
F
@rax %Note: Object
172.21153 556.19206 172.77506 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
172.58740 556.19206 m
172.58740 556.28589 L
172.68123 556.37972 L
172.77506 556.47383 L
172.77506 556.47383 L
172.68123 556.56794 L
172.58740 556.66176 L
172.49357 556.75559 L
172.49357 556.75559 L
172.39946 556.75559 L
172.30564 556.66176 L
172.21153 556.56794 L
172.21153 556.47383 L
172.21153 556.37972 L
172.21153 556.28589 L
172.30564 556.19206 L
172.39946 556.19206 L
172.49357 556.19206 L
172.58740 556.19206 L
@c
F
@rax %Note: Object
171.08419 556.19206 171.64772 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
171.46006 556.19206 m
171.46006 556.28589 L
171.55389 556.37972 L
171.64772 556.47383 L
171.64772 556.47383 L
171.55389 556.56794 L
171.46006 556.66176 L
171.36624 556.75559 L
171.36624 556.75559 L
171.27213 556.75559 L
171.17802 556.66176 L
171.08419 556.56794 L
171.08419 556.47383 L
171.08419 556.37972 L
171.08419 556.28589 L
171.17802 556.19206 L
171.27213 556.19206 L
171.36624 556.19206 L
171.46006 556.19206 L
@c
F
@rax %Note: Object
169.95685 556.19206 170.52038 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
170.33272 556.19206 m
170.33272 556.28589 L
170.42655 556.37972 L
170.52038 556.47383 L
170.52038 556.47383 L
170.42655 556.56794 L
170.33272 556.66176 L
170.23861 556.75559 L
170.23861 556.75559 L
170.14507 556.75559 L
170.05096 556.66176 L
169.95685 556.56794 L
169.95685 556.47383 L
169.95685 556.37972 L
169.95685 556.28589 L
170.05096 556.19206 L
170.14507 556.19206 L
170.23861 556.19206 L
170.33272 556.19206 L
@c
F
@rax %Note: Object
168.82951 556.19206 169.39332 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
169.20539 556.19206 m
169.20539 556.28589 L
169.29950 556.37972 L
169.39332 556.47383 L
169.39332 556.47383 L
169.29950 556.56794 L
169.20539 556.66176 L
169.11156 556.75559 L
169.11156 556.75559 L
169.01773 556.75559 L
168.92362 556.66176 L
168.82951 556.56794 L
168.82951 556.47383 L
168.82951 556.37972 L
168.82951 556.28589 L
168.92362 556.19206 L
169.01773 556.19206 L
169.11156 556.19206 L
169.20539 556.19206 L
@c
F
@rax %Note: Object
167.70217 556.19206 168.26598 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
168.07805 556.19206 m
168.07805 556.28589 L
168.17187 556.37972 L
168.26598 556.47383 L
168.26598 556.47383 L
168.17187 556.56794 L
168.07805 556.66176 L
167.98422 556.75559 L
167.98422 556.75559 L
167.89011 556.75559 L
167.79600 556.66176 L
167.70217 556.56794 L
167.70217 556.47383 L
167.70217 556.37972 L
167.70217 556.28589 L
167.79600 556.19206 L
167.89011 556.19206 L
167.98422 556.19206 L
168.07805 556.19206 L
@c
F
@rax %Note: Object
166.57512 556.19206 167.13865 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
166.95099 556.19206 m
166.95099 556.28589 L
167.04482 556.37972 L
167.13865 556.47383 L
167.13865 556.47383 L
167.04482 556.56794 L
166.95099 556.66176 L
166.85717 556.75559 L
166.85717 556.75559 L
166.76277 556.75559 L
166.66894 556.66176 L
166.57512 556.56794 L
166.57512 556.47383 L
166.57512 556.37972 L
166.57512 556.28589 L
166.66894 556.19206 L
166.76277 556.19206 L
166.85717 556.19206 L
166.95099 556.19206 L
@c
F
@rax %Note: Object
165.44778 556.19206 166.01131 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
165.82365 556.19206 m
165.82365 556.28589 L
165.91748 556.37972 L
166.01131 556.47383 L
166.01131 556.47383 L
165.91748 556.56794 L
165.82365 556.66176 L
165.72983 556.75559 L
165.72983 556.75559 L
165.63543 556.75559 L
165.54161 556.66176 L
165.44778 556.56794 L
165.44778 556.47383 L
165.44778 556.37972 L
165.44778 556.28589 L
165.54161 556.19206 L
165.63543 556.19206 L
165.72983 556.19206 L
165.82365 556.19206 L
@c
F
@rax %Note: Object
164.32044 556.19206 164.88397 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
164.69631 556.19206 m
164.69631 556.28589 L
164.79014 556.37972 L
164.88397 556.47383 L
164.88397 556.47383 L
164.79014 556.56794 L
164.69631 556.66176 L
164.60220 556.75559 L
164.60220 556.75559 L
164.50809 556.75559 L
164.41455 556.66176 L
164.32044 556.56794 L
164.32044 556.47383 L
164.32044 556.37972 L
164.32044 556.28589 L
164.41455 556.19206 L
164.50809 556.19206 L
164.60220 556.19206 L
164.69631 556.19206 L
@c
F
@rax %Note: Object
163.19310 556.19206 163.75691 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
163.56898 556.19206 m
163.56898 556.28589 L
163.66309 556.37972 L
163.75691 556.47383 L
163.75691 556.47383 L
163.66309 556.56794 L
163.56898 556.66176 L
163.47487 556.75559 L
163.47487 556.75559 L
163.38104 556.75559 L
163.28721 556.66176 L
163.19310 556.56794 L
163.19310 556.47383 L
163.19310 556.37972 L
163.19310 556.28589 L
163.28721 556.19206 L
163.38104 556.19206 L
163.47487 556.19206 L
163.56898 556.19206 L
@c
F
@rax %Note: Object
162.06576 556.19206 162.62957 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
162.44164 556.19206 m
162.44164 556.28589 L
162.53546 556.37972 L
162.62957 556.47383 L
162.62957 556.47383 L
162.53546 556.56794 L
162.44164 556.66176 L
162.34753 556.75559 L
162.34753 556.75559 L
162.25370 556.75559 L
162.15959 556.66176 L
162.06576 556.56794 L
162.06576 556.47383 L
162.06576 556.37972 L
162.06576 556.28589 L
162.15959 556.19206 L
162.25370 556.19206 L
162.34753 556.19206 L
162.44164 556.19206 L
@c
F
@rax %Note: Object
160.93871 556.19206 161.50224 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
161.31430 556.19206 m
161.31430 556.28589 L
161.40841 556.37972 L
161.50224 556.47383 L
161.50224 556.47383 L
161.40841 556.56794 L
161.31430 556.66176 L
161.22047 556.75559 L
161.22047 556.75559 L
161.12636 556.75559 L
161.03254 556.66176 L
160.93871 556.56794 L
160.93871 556.47383 L
160.93871 556.37972 L
160.93871 556.28589 L
161.03254 556.19206 L
161.12636 556.19206 L
161.22047 556.19206 L
161.31430 556.19206 L
@c
F
@rax %Note: Object
159.81137 556.19206 160.37490 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
160.18696 556.19206 m
160.18696 556.28589 L
160.28107 556.37972 L
160.37490 556.47383 L
160.37490 556.47383 L
160.28107 556.56794 L
160.18696 556.66176 L
160.09313 556.75559 L
160.09313 556.75559 L
159.99902 556.75559 L
159.90520 556.66176 L
159.81137 556.56794 L
159.81137 556.47383 L
159.81137 556.37972 L
159.81137 556.28589 L
159.90520 556.19206 L
159.99902 556.19206 L
160.09313 556.19206 L
160.18696 556.19206 L
@c
F
@rax %Note: Object
158.68403 556.19206 159.24756 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
159.05962 556.19206 m
159.05962 556.28589 L
159.15373 556.37972 L
159.24756 556.47383 L
159.24756 556.47383 L
159.15373 556.56794 L
159.05962 556.66176 L
158.96551 556.75559 L
158.96551 556.75559 L
158.87169 556.75559 L
158.77786 556.66176 L
158.68403 556.56794 L
158.68403 556.47383 L
158.68403 556.37972 L
158.68403 556.28589 L
158.77786 556.19206 L
158.87169 556.19206 L
158.96551 556.19206 L
159.05962 556.19206 L
@c
F
@rax %Note: Object
157.55669 556.19206 158.12050 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
157.93228 556.19206 m
157.93228 556.28589 L
158.02639 556.37972 L
158.12050 556.47383 L
158.12050 556.47383 L
158.02639 556.56794 L
157.93228 556.66176 L
157.83846 556.75559 L
157.83846 556.75559 L
157.74463 556.75559 L
157.65080 556.66176 L
157.55669 556.56794 L
157.55669 556.47383 L
157.55669 556.37972 L
157.55669 556.28589 L
157.65080 556.19206 L
157.74463 556.19206 L
157.83846 556.19206 L
157.93228 556.19206 L
@c
F
@rax %Note: Object
156.42935 556.19206 156.99317 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
156.80494 556.19206 m
156.80494 556.28589 L
156.89906 556.37972 L
156.99317 556.47383 L
156.99317 556.47383 L
156.89906 556.56794 L
156.80494 556.66176 L
156.71112 556.75559 L
156.71112 556.75559 L
156.61729 556.75559 L
156.52318 556.66176 L
156.42935 556.56794 L
156.42935 556.47383 L
156.42935 556.37972 L
156.42935 556.28589 L
156.52318 556.19206 L
156.61729 556.19206 L
156.71112 556.19206 L
156.80494 556.19206 L
@c
F
@rax %Note: Object
155.30202 556.19206 155.86583 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
155.67789 556.19206 m
155.67789 556.28589 L
155.77143 556.37972 L
155.86583 556.47383 L
155.86583 556.47383 L
155.77143 556.56794 L
155.67789 556.66176 L
155.58406 556.75559 L
155.58406 556.75559 L
155.48995 556.75559 L
155.39613 556.66176 L
155.30202 556.56794 L
155.30202 556.47383 L
155.30202 556.37972 L
155.30202 556.28589 L
155.39613 556.19206 L
155.48995 556.19206 L
155.58406 556.19206 L
155.67789 556.19206 L
@c
F
@rax %Note: Object
154.17468 556.19206 154.73820 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
154.55055 556.19206 m
154.55055 556.28589 L
154.64438 556.37972 L
154.73820 556.47383 L
154.73820 556.47383 L
154.64438 556.56794 L
154.55055 556.66176 L
154.45672 556.75559 L
154.45672 556.75559 L
154.36261 556.75559 L
154.26879 556.66176 L
154.17468 556.56794 L
154.17468 556.47383 L
154.17468 556.37972 L
154.17468 556.28589 L
154.26879 556.19206 L
154.36261 556.19206 L
154.45672 556.19206 L
154.55055 556.19206 L
@c
F
@rax %Note: Object
153.04734 556.19206 153.61087 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
153.42321 556.19206 m
153.42321 556.28589 L
153.51704 556.37972 L
153.61087 556.47383 L
153.61087 556.47383 L
153.51704 556.56794 L
153.42321 556.66176 L
153.32910 556.75559 L
153.32910 556.75559 L
153.23528 556.75559 L
153.14145 556.66176 L
153.04734 556.56794 L
153.04734 556.47383 L
153.04734 556.37972 L
153.04734 556.28589 L
153.14145 556.19206 L
153.23528 556.19206 L
153.32910 556.19206 L
153.42321 556.19206 L
@c
F
@rax %Note: Object
151.92000 556.19206 152.48381 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
152.29587 556.19206 m
152.29587 556.28589 L
152.38998 556.37972 L
152.48381 556.47383 L
152.48381 556.47383 L
152.38998 556.56794 L
152.29587 556.66176 L
152.20205 556.75559 L
152.20205 556.75559 L
152.10822 556.75559 L
152.01411 556.66176 L
151.92000 556.56794 L
151.92000 556.47383 L
151.92000 556.37972 L
151.92000 556.28589 L
152.01411 556.19206 L
152.10822 556.19206 L
152.20205 556.19206 L
152.29587 556.19206 L
@c
F
@rax %Note: Object
150.79266 556.19206 151.35647 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
151.16854 556.19206 m
151.16854 556.28589 L
151.26265 556.37972 L
151.35647 556.47383 L
151.35647 556.47383 L
151.26265 556.56794 L
151.16854 556.66176 L
151.07471 556.75559 L
151.07471 556.75559 L
150.98088 556.75559 L
150.88649 556.66176 L
150.79266 556.56794 L
150.79266 556.47383 L
150.79266 556.37972 L
150.79266 556.28589 L
150.88649 556.19206 L
150.98088 556.19206 L
151.07471 556.19206 L
151.16854 556.19206 L
@c
F
@rax %Note: Object
149.66561 556.19206 150.22913 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
150.04120 556.19206 m
150.04120 556.28589 L
150.13502 556.37972 L
150.22913 556.47383 L
150.22913 556.47383 L
150.13502 556.56794 L
150.04120 556.66176 L
149.94737 556.75559 L
149.94737 556.75559 L
149.85354 556.75559 L
149.75943 556.66176 L
149.66561 556.56794 L
149.66561 556.47383 L
149.66561 556.37972 L
149.66561 556.28589 L
149.75943 556.19206 L
149.85354 556.19206 L
149.94737 556.19206 L
150.04120 556.19206 L
@c
F
@rax %Note: Object
148.53827 556.19206 149.10180 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
148.91414 556.19206 m
148.91414 556.28589 L
149.00797 556.37972 L
149.10180 556.47383 L
149.10180 556.47383 L
149.00797 556.56794 L
148.91414 556.66176 L
148.82031 556.75559 L
148.82031 556.75559 L
148.72620 556.75559 L
148.63209 556.66176 L
148.53827 556.56794 L
148.53827 556.47383 L
148.53827 556.37972 L
148.53827 556.28589 L
148.63209 556.19206 L
148.72620 556.19206 L
148.82031 556.19206 L
148.91414 556.19206 L
@c
F
@rax %Note: Object
147.41093 556.19206 147.97446 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
147.78680 556.19206 m
147.78680 556.28589 L
147.88063 556.37972 L
147.97446 556.47383 L
147.97446 556.47383 L
147.88063 556.56794 L
147.78680 556.66176 L
147.69269 556.75559 L
147.69269 556.75559 L
147.59858 556.75559 L
147.50476 556.66176 L
147.41093 556.56794 L
147.41093 556.47383 L
147.41093 556.37972 L
147.41093 556.28589 L
147.50476 556.19206 L
147.59858 556.19206 L
147.69269 556.19206 L
147.78680 556.19206 L
@c
F
@rax %Note: Object
146.28359 556.19206 146.84740 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
146.65946 556.19206 m
146.65946 556.28589 L
146.75357 556.37972 L
146.84740 556.47383 L
146.84740 556.47383 L
146.75357 556.56794 L
146.65946 556.66176 L
146.56564 556.75559 L
146.56564 556.75559 L
146.47153 556.75559 L
146.37770 556.66176 L
146.28359 556.56794 L
146.28359 556.47383 L
146.28359 556.37972 L
146.28359 556.28589 L
146.37770 556.19206 L
146.47153 556.19206 L
146.56564 556.19206 L
146.65946 556.19206 L
@c
F
@rax %Note: Object
145.15625 556.19206 145.72006 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
145.53213 556.19206 m
145.53213 556.28589 L
145.62624 556.37972 L
145.72006 556.47383 L
145.72006 556.47383 L
145.62624 556.56794 L
145.53213 556.66176 L
145.43830 556.75559 L
145.43830 556.75559 L
145.34419 556.75559 L
145.25008 556.66176 L
145.15625 556.56794 L
145.15625 556.47383 L
145.15625 556.37972 L
145.15625 556.28589 L
145.25008 556.19206 L
145.34419 556.19206 L
145.43830 556.19206 L
145.53213 556.19206 L
@c
F
@rax %Note: Object
144.02920 556.19206 144.59272 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
144.40479 556.19206 m
144.40479 556.28589 L
144.49861 556.37972 L
144.59272 556.47383 L
144.59272 556.47383 L
144.49861 556.56794 L
144.40479 556.66176 L
144.31068 556.75559 L
144.31068 556.75559 L
144.21685 556.75559 L
144.12274 556.66176 L
144.02920 556.56794 L
144.02920 556.47383 L
144.02920 556.37972 L
144.02920 556.28589 L
144.12274 556.19206 L
144.21685 556.19206 L
144.31068 556.19206 L
144.40479 556.19206 L
@c
F
@rax %Note: Object
142.90186 556.19206 143.46539 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
143.27773 556.19206 m
143.27773 556.28589 L
143.37156 556.37972 L
143.46539 556.47383 L
143.46539 556.47383 L
143.37156 556.56794 L
143.27773 556.66176 L
143.18362 556.75559 L
143.18362 556.75559 L
143.08951 556.75559 L
142.99569 556.66176 L
142.90186 556.56794 L
142.90186 556.47383 L
142.90186 556.37972 L
142.90186 556.28589 L
142.99569 556.19206 L
143.08951 556.19206 L
143.18362 556.19206 L
143.27773 556.19206 L
@c
F
@rax %Note: Object
141.77452 556.19206 142.33805 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
142.15011 556.19206 m
142.15011 556.28589 L
142.24422 556.37972 L
142.33805 556.47383 L
142.33805 556.47383 L
142.24422 556.56794 L
142.15011 556.66176 L
142.05600 556.75559 L
142.05600 556.75559 L
141.96217 556.75559 L
141.86835 556.66176 L
141.77452 556.56794 L
141.77452 556.47383 L
141.77452 556.37972 L
141.77452 556.28589 L
141.86835 556.19206 L
141.96217 556.19206 L
142.05600 556.19206 L
142.15011 556.19206 L
@c
F
@rax %Note: Object
140.64718 556.19206 141.21071 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
141.02277 556.19206 m
141.02277 556.28589 L
141.11717 556.37972 L
141.21071 556.47383 L
141.21071 556.47383 L
141.11717 556.56794 L
141.02277 556.66176 L
140.92894 556.75559 L
140.92894 556.75559 L
140.83512 556.75559 L
140.74129 556.66176 L
140.64718 556.56794 L
140.64718 556.47383 L
140.64718 556.37972 L
140.64718 556.28589 L
140.74129 556.19206 L
140.83512 556.19206 L
140.92894 556.19206 L
141.02277 556.19206 L
@c
F
@rax %Note: Object
139.51984 556.19206 140.08365 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
139.89543 556.19206 m
139.89543 556.28589 L
139.98983 556.37972 L
140.08365 556.47383 L
140.08365 556.47383 L
139.98983 556.56794 L
139.89543 556.66176 L
139.80161 556.75559 L
139.80161 556.75559 L
139.70778 556.75559 L
139.61395 556.66176 L
139.51984 556.56794 L
139.51984 556.47383 L
139.51984 556.37972 L
139.51984 556.28589 L
139.61395 556.19206 L
139.70778 556.19206 L
139.80161 556.19206 L
139.89543 556.19206 L
@c
F
@rax %Note: Object
138.39250 556.19206 138.95631 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
138.76809 556.19206 m
138.76809 556.28589 L
138.86220 556.37972 L
138.95631 556.47383 L
138.95631 556.47383 L
138.86220 556.56794 L
138.76809 556.66176 L
138.67427 556.75559 L
138.67427 556.75559 L
138.58044 556.75559 L
138.48633 556.66176 L
138.39250 556.56794 L
138.39250 556.47383 L
138.39250 556.37972 L
138.39250 556.28589 L
138.48633 556.19206 L
138.58044 556.19206 L
138.67427 556.19206 L
138.76809 556.19206 L
@c
F
@rax %Note: Object
137.26545 556.19206 137.82898 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
137.64104 556.19206 m
137.64104 556.28589 L
137.73487 556.37972 L
137.82898 556.47383 L
137.82898 556.47383 L
137.73487 556.56794 L
137.64104 556.66176 L
137.54721 556.75559 L
137.54721 556.75559 L
137.45310 556.75559 L
137.35928 556.66176 L
137.26545 556.56794 L
137.26545 556.47383 L
137.26545 556.37972 L
137.26545 556.28589 L
137.35928 556.19206 L
137.45310 556.19206 L
137.54721 556.19206 L
137.64104 556.19206 L
@c
F
@rax %Note: Object
136.13811 556.19206 136.70164 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
136.51370 556.19206 m
136.51370 556.28589 L
136.60753 556.37972 L
136.70164 556.47383 L
136.70164 556.47383 L
136.60753 556.56794 L
136.51370 556.66176 L
136.41959 556.75559 L
136.41959 556.75559 L
136.32576 556.75559 L
136.23194 556.66176 L
136.13811 556.56794 L
136.13811 556.47383 L
136.13811 556.37972 L
136.13811 556.28589 L
136.23194 556.19206 L
136.32576 556.19206 L
136.41959 556.19206 L
136.51370 556.19206 L
@c
F
@rax %Note: Object
135.01049 556.19206 135.57430 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
135.38636 556.19206 m
135.38636 556.28589 L
135.48019 556.37972 L
135.57430 556.47383 L
135.57430 556.47383 L
135.48019 556.56794 L
135.38636 556.66176 L
135.29254 556.75559 L
135.29254 556.75559 L
135.19871 556.75559 L
135.10488 556.66176 L
135.01049 556.56794 L
135.01049 556.47383 L
135.01049 556.37972 L
135.01049 556.28589 L
135.10488 556.19206 L
135.19871 556.19206 L
135.29254 556.19206 L
135.38636 556.19206 L
@c
F
@rax %Note: Object
133.88315 556.19206 134.44696 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
134.25902 556.19206 m
134.25902 556.28589 L
134.35313 556.37972 L
134.44696 556.47383 L
134.44696 556.47383 L
134.35313 556.56794 L
134.25902 556.66176 L
134.16520 556.75559 L
134.16520 556.75559 L
134.07137 556.75559 L
133.97754 556.66176 L
133.88315 556.56794 L
133.88315 556.47383 L
133.88315 556.37972 L
133.88315 556.28589 L
133.97754 556.19206 L
134.07137 556.19206 L
134.16520 556.19206 L
134.25902 556.19206 L
@c
F
@rax %Note: Object
132.75581 556.19206 133.31962 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
133.13169 556.19206 m
133.13169 556.28589 L
133.22551 556.37972 L
133.31962 556.47383 L
133.31962 556.47383 L
133.22551 556.56794 L
133.13169 556.66176 L
133.03786 556.75559 L
133.03786 556.75559 L
132.94403 556.75559 L
132.84992 556.66176 L
132.75581 556.56794 L
132.75581 556.47383 L
132.75581 556.37972 L
132.75581 556.28589 L
132.84992 556.19206 L
132.94403 556.19206 L
133.03786 556.19206 L
133.13169 556.19206 L
@c
F
@rax %Note: Object
131.62876 556.19206 132.19228 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
132.00463 556.19206 m
132.00463 556.28589 L
132.09846 556.37972 L
132.19228 556.47383 L
132.19228 556.47383 L
132.09846 556.56794 L
132.00463 556.66176 L
131.91080 556.75559 L
131.91080 556.75559 L
131.81669 556.75559 L
131.72258 556.66176 L
131.62876 556.56794 L
131.62876 556.47383 L
131.62876 556.37972 L
131.62876 556.28589 L
131.72258 556.19206 L
131.81669 556.19206 L
131.91080 556.19206 L
132.00463 556.19206 L
@c
F
@rax %Note: Object
130.50142 556.19206 131.06494 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
130.87729 556.19206 m
130.87729 556.28589 L
130.97112 556.37972 L
131.06494 556.47383 L
131.06494 556.47383 L
130.97112 556.56794 L
130.87729 556.66176 L
130.78318 556.75559 L
130.78318 556.75559 L
130.68935 556.75559 L
130.59524 556.66176 L
130.50142 556.56794 L
130.50142 556.47383 L
130.50142 556.37972 L
130.50142 556.28589 L
130.59524 556.19206 L
130.68935 556.19206 L
130.78318 556.19206 L
130.87729 556.19206 L
@c
F
@rax %Note: Object
129.37408 556.19206 129.93761 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
129.74995 556.19206 m
129.74995 556.28589 L
129.84378 556.37972 L
129.93761 556.47383 L
129.93761 556.47383 L
129.84378 556.56794 L
129.74995 556.66176 L
129.65584 556.75559 L
129.65584 556.75559 L
129.56230 556.75559 L
129.46819 556.66176 L
129.37408 556.56794 L
129.37408 556.47383 L
129.37408 556.37972 L
129.37408 556.28589 L
129.46819 556.19206 L
129.56230 556.19206 L
129.65584 556.19206 L
129.74995 556.19206 L
@c
F
@rax %Note: Object
128.24674 556.19206 128.81055 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.62261 556.19206 m
128.62261 556.28589 L
128.71672 556.37972 L
128.81055 556.47383 L
128.81055 556.47383 L
128.71672 556.56794 L
128.62261 556.66176 L
128.52879 556.75559 L
128.52879 556.75559 L
128.43468 556.75559 L
128.34085 556.66176 L
128.24674 556.56794 L
128.24674 556.47383 L
128.24674 556.37972 L
128.24674 556.28589 L
128.34085 556.19206 L
128.43468 556.19206 L
128.52879 556.19206 L
128.62261 556.19206 L
@c
F
@rax %Note: Object
127.11940 556.19206 127.68321 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
127.49528 556.19206 m
127.49528 556.28589 L
127.58910 556.37972 L
127.68321 556.47383 L
127.68321 556.47383 L
127.58910 556.56794 L
127.49528 556.66176 L
127.40145 556.75559 L
127.40145 556.75559 L
127.30734 556.75559 L
127.21323 556.66176 L
127.11940 556.56794 L
127.11940 556.47383 L
127.11940 556.37972 L
127.11940 556.28589 L
127.21323 556.19206 L
127.30734 556.19206 L
127.40145 556.19206 L
127.49528 556.19206 L
@c
F
@rax %Note: Object
125.99235 556.19206 126.55587 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
126.36822 556.19206 m
126.36822 556.28589 L
126.46205 556.37972 L
126.55587 556.47383 L
126.55587 556.47383 L
126.46205 556.56794 L
126.36822 556.66176 L
126.27411 556.75559 L
126.27411 556.75559 L
126.18000 556.75559 L
126.08617 556.66176 L
125.99235 556.56794 L
125.99235 556.47383 L
125.99235 556.37972 L
125.99235 556.28589 L
126.08617 556.19206 L
126.18000 556.19206 L
126.27411 556.19206 L
126.36822 556.19206 L
@c
F
@rax %Note: Object
124.86501 556.19206 125.42854 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
125.24088 556.19206 m
125.24088 556.28589 L
125.33471 556.37972 L
125.42854 556.47383 L
125.42854 556.47383 L
125.33471 556.56794 L
125.24088 556.66176 L
125.14677 556.75559 L
125.14677 556.75559 L
125.05266 556.75559 L
124.95883 556.66176 L
124.86501 556.56794 L
124.86501 556.47383 L
124.86501 556.37972 L
124.86501 556.28589 L
124.95883 556.19206 L
125.05266 556.19206 L
125.14677 556.19206 L
125.24088 556.19206 L
@c
F
@rax %Note: Object
123.73767 556.19206 124.30120 556.75559 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 556.47383 m
123.83150 556.37972 L
123.92532 556.28589 L
124.01915 556.19206 L
124.11354 556.19206 L
124.20737 556.28589 L
124.30120 556.37972 L
124.30120 556.47383 L
124.30120 556.56794 L
124.30120 556.56794 L
124.30120 556.66176 L
124.20737 556.75559 L
124.11354 556.75559 L
124.01915 556.75559 L
123.92532 556.75559 L
123.83150 556.66176 L
123.73767 556.56794 L
123.73767 556.47383 L
@c
F
@rax %Note: Object
123.73767 557.31940 124.30120 557.88293 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 557.60117 m
123.83150 557.50706 L
123.92532 557.41323 L
124.01915 557.31940 L
124.11354 557.31940 L
124.20737 557.41323 L
124.30120 557.50706 L
124.30120 557.60117 L
124.30120 557.69499 L
124.30120 557.69499 L
124.30120 557.78882 L
124.20737 557.88293 L
124.11354 557.88293 L
124.01915 557.88293 L
123.92532 557.88293 L
123.83150 557.78882 L
123.73767 557.69499 L
123.73767 557.60117 L
@c
F
@rax %Note: Object
123.73767 558.44646 124.30120 559.01027 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 558.72850 m
123.83150 558.63439 L
123.92532 558.54028 L
124.01915 558.44646 L
124.11354 558.44646 L
124.20737 558.54028 L
124.30120 558.63439 L
124.30120 558.72850 L
124.30120 558.82233 L
124.30120 558.82233 L
124.30120 558.91616 L
124.20737 559.01027 L
124.11354 559.01027 L
124.01915 559.01027 L
123.92532 559.01027 L
123.83150 558.91616 L
123.73767 558.82233 L
123.73767 558.72850 L
@c
F
@rax %Note: Object
123.73767 559.57380 124.30120 560.13761 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 559.85584 m
123.83150 559.76202 L
123.92532 559.66762 L
124.01915 559.57380 L
124.11354 559.57380 L
124.20737 559.66762 L
124.30120 559.76202 L
124.30120 559.85584 L
124.30120 559.94967 L
124.30120 559.94967 L
124.30120 560.04378 L
124.20737 560.13761 L
124.11354 560.13761 L
124.01915 560.13761 L
123.92532 560.13761 L
123.83150 560.04378 L
123.73767 559.94967 L
123.73767 559.85584 L
@c
F
@rax %Note: Object
123.73767 560.70113 124.30120 561.26466 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 560.98290 m
123.83150 560.88907 L
123.92532 560.79496 L
124.01915 560.70113 L
124.11354 560.70113 L
124.20737 560.79496 L
124.30120 560.88907 L
124.30120 560.98290 L
124.30120 561.07701 L
124.30120 561.07701 L
124.30120 561.17083 L
124.20737 561.26466 L
124.11354 561.26466 L
124.01915 561.26466 L
123.92532 561.26466 L
123.83150 561.17083 L
123.73767 561.07701 L
123.73767 560.98290 L
@c
F
@rax %Note: Object
123.73767 561.82847 124.30120 562.39200 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 562.11024 m
123.83150 562.01641 L
123.92532 561.92230 L
124.01915 561.82847 L
124.11354 561.82847 L
124.20737 561.92230 L
124.30120 562.01641 L
124.30120 562.11024 L
124.30120 562.20435 L
124.30120 562.20435 L
124.30120 562.29817 L
124.20737 562.39200 L
124.11354 562.39200 L
124.01915 562.39200 L
123.92532 562.39200 L
123.83150 562.29817 L
123.73767 562.20435 L
123.73767 562.11024 L
@c
F
@rax %Note: Object
123.73767 562.95581 124.30120 563.51934 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 563.23786 m
123.83150 563.14375 L
123.92532 563.04992 L
124.01915 562.95581 L
124.11354 562.95581 L
124.20737 563.04992 L
124.30120 563.14375 L
124.30120 563.23786 L
124.30120 563.33169 L
124.30120 563.33169 L
124.30120 563.42523 L
124.20737 563.51934 L
124.11354 563.51934 L
124.01915 563.51934 L
123.92532 563.51934 L
123.83150 563.42523 L
123.73767 563.33169 L
123.73767 563.23786 L
@c
F
@rax %Note: Object
123.73767 564.08287 124.30120 564.64668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 564.36491 m
123.83150 564.27109 L
123.92532 564.17698 L
124.01915 564.08287 L
124.11354 564.08287 L
124.20737 564.17698 L
124.30120 564.27109 L
124.30120 564.36491 L
124.30120 564.45874 L
124.30120 564.45874 L
124.30120 564.55257 L
124.20737 564.64668 L
124.11354 564.64668 L
124.01915 564.64668 L
123.92532 564.64668 L
123.83150 564.55257 L
123.73767 564.45874 L
123.73767 564.36491 L
@c
F
@rax %Note: Object
123.73767 565.21049 124.30120 565.77430 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 565.49225 m
123.83150 565.39843 L
123.92532 565.30431 L
124.01915 565.21049 L
124.11354 565.21049 L
124.20737 565.30431 L
124.30120 565.39843 L
124.30120 565.49225 L
124.30120 565.58608 L
124.30120 565.58608 L
124.30120 565.68019 L
124.20737 565.77430 L
124.11354 565.77430 L
124.01915 565.77430 L
123.92532 565.77430 L
123.83150 565.68019 L
123.73767 565.58608 L
123.73767 565.49225 L
@c
F
@rax %Note: Object
123.73767 566.33783 124.30120 566.90135 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 566.61931 m
123.83150 566.52548 L
123.92532 566.43165 L
124.01915 566.33783 L
124.11354 566.33783 L
124.20737 566.43165 L
124.30120 566.52548 L
124.30120 566.61931 L
124.30120 566.71342 L
124.30120 566.71342 L
124.30120 566.80724 L
124.20737 566.90135 L
124.11354 566.90135 L
124.01915 566.90135 L
123.92532 566.90135 L
123.83150 566.80724 L
123.73767 566.71342 L
123.73767 566.61931 L
@c
F
@rax %Note: Object
123.73767 567.46517 124.30120 568.02869 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 567.74665 m
123.83150 567.65282 L
123.92532 567.55899 L
124.01915 567.46517 L
124.11354 567.46517 L
124.20737 567.55899 L
124.30120 567.65282 L
124.30120 567.74665 L
124.30120 567.84076 L
124.30120 567.84076 L
124.30120 567.93458 L
124.20737 568.02869 L
124.11354 568.02869 L
124.01915 568.02869 L
123.92532 568.02869 L
123.83150 567.93458 L
123.73767 567.84076 L
123.73767 567.74665 L
@c
F
@rax %Note: Object
123.73767 568.59250 124.30120 569.15603 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 568.87427 m
123.83150 568.78016 L
123.92532 568.68633 L
124.01915 568.59250 L
124.11354 568.59250 L
124.20737 568.68633 L
124.30120 568.78016 L
124.30120 568.87427 L
124.30120 568.96809 L
124.30120 568.96809 L
124.30120 569.06220 L
124.20737 569.15603 L
124.11354 569.15603 L
124.01915 569.15603 L
123.92532 569.15603 L
123.83150 569.06220 L
123.73767 568.96809 L
123.73767 568.87427 L
@c
F
@rax %Note: Object
123.73767 569.71956 124.30120 570.28337 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 570.00132 m
123.83150 569.90750 L
123.92532 569.81339 L
124.01915 569.71956 L
124.11354 569.71956 L
124.20737 569.81339 L
124.30120 569.90750 L
124.30120 570.00132 L
124.30120 570.09515 L
124.30120 570.09515 L
124.30120 570.18926 L
124.20737 570.28337 L
124.11354 570.28337 L
124.01915 570.28337 L
123.92532 570.28337 L
123.83150 570.18926 L
123.73767 570.09515 L
123.73767 570.00132 L
@c
F
@rax %Note: Object
123.73767 570.84690 124.30120 571.41071 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 571.12866 m
123.83150 571.03483 L
123.92532 570.94072 L
124.01915 570.84690 L
124.11354 570.84690 L
124.20737 570.94072 L
124.30120 571.03483 L
124.30120 571.12866 L
124.30120 571.22249 L
124.30120 571.22249 L
124.30120 571.31688 L
124.20737 571.41071 L
124.11354 571.41071 L
124.01915 571.41071 L
123.92532 571.41071 L
123.83150 571.31688 L
123.73767 571.22249 L
123.73767 571.12866 L
@c
F
@rax %Note: Object
123.73767 571.97424 124.30120 572.53776 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 572.25572 m
123.83150 572.16189 L
123.92532 572.06806 L
124.01915 571.97424 L
124.11354 571.97424 L
124.20737 572.06806 L
124.30120 572.16189 L
124.30120 572.25572 L
124.30120 572.35011 L
124.30120 572.35011 L
124.30120 572.44394 L
124.20737 572.53776 L
124.11354 572.53776 L
124.01915 572.53776 L
123.92532 572.53776 L
123.83150 572.44394 L
123.73767 572.35011 L
123.73767 572.25572 L
@c
F
@rax %Note: Object
121.10712 573.10157 127.02557 579.01975 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
127.02557 573.10157 m
124.01915 579.01975 L
121.10712 573.10157 L
127.02557 573.10157 L
@c
F
@rax %Note: Object
262.39550 547.17364 262.95931 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
262.77137 547.17364 m
262.77137 547.26746 L
262.86548 547.36157 L
262.95931 547.45540 L
262.95931 547.45540 L
262.86548 547.54923 L
262.77137 547.64306 L
262.67726 547.73745 L
262.67726 547.73745 L
262.58343 547.73745 L
262.48961 547.64306 L
262.39550 547.54923 L
262.39550 547.45540 L
262.39550 547.36157 L
262.39550 547.26746 L
262.48961 547.17364 L
262.58343 547.17364 L
262.67726 547.17364 L
262.77137 547.17364 L
@c
F
@rax %Note: Object
261.26816 547.17364 261.83197 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
261.64403 547.17364 m
261.64403 547.26746 L
261.73814 547.36157 L
261.83197 547.45540 L
261.83197 547.45540 L
261.73814 547.54923 L
261.64403 547.64306 L
261.54992 547.73745 L
261.54992 547.73745 L
261.45609 547.73745 L
261.36227 547.64306 L
261.26816 547.54923 L
261.26816 547.45540 L
261.26816 547.36157 L
261.26816 547.26746 L
261.36227 547.17364 L
261.45609 547.17364 L
261.54992 547.17364 L
261.64403 547.17364 L
@c
F
@rax %Note: Object
260.14110 547.17364 260.70463 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
260.51669 547.17364 m
260.51669 547.26746 L
260.61052 547.36157 L
260.70463 547.45540 L
260.70463 547.45540 L
260.61052 547.54923 L
260.51669 547.64306 L
260.42258 547.73745 L
260.42258 547.73745 L
260.32876 547.73745 L
260.23493 547.64306 L
260.14110 547.54923 L
260.14110 547.45540 L
260.14110 547.36157 L
260.14110 547.26746 L
260.23493 547.17364 L
260.32876 547.17364 L
260.42258 547.17364 L
260.51669 547.17364 L
@c
F
@rax %Note: Object
259.01376 547.17364 259.57729 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
259.38935 547.17364 m
259.38935 547.26746 L
259.48346 547.36157 L
259.57729 547.45540 L
259.57729 547.45540 L
259.48346 547.54923 L
259.38935 547.64306 L
259.29553 547.73745 L
259.29553 547.73745 L
259.20142 547.73745 L
259.10759 547.64306 L
259.01376 547.54923 L
259.01376 547.45540 L
259.01376 547.36157 L
259.01376 547.26746 L
259.10759 547.17364 L
259.20142 547.17364 L
259.29553 547.17364 L
259.38935 547.17364 L
@c
F
@rax %Note: Object
257.88643 547.17364 258.44995 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
258.26202 547.17364 m
258.26202 547.26746 L
258.35613 547.36157 L
258.44995 547.45540 L
258.44995 547.45540 L
258.35613 547.54923 L
258.26202 547.64306 L
258.16819 547.73745 L
258.16819 547.73745 L
258.07408 547.73745 L
257.98025 547.64306 L
257.88643 547.54923 L
257.88643 547.45540 L
257.88643 547.36157 L
257.88643 547.26746 L
257.98025 547.17364 L
258.07408 547.17364 L
258.16819 547.17364 L
258.26202 547.17364 L
@c
F
@rax %Note: Object
256.75909 547.17364 257.32290 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
257.13468 547.17364 m
257.13468 547.26746 L
257.22907 547.36157 L
257.32290 547.45540 L
257.32290 547.45540 L
257.22907 547.54923 L
257.13468 547.64306 L
257.04085 547.73745 L
257.04085 547.73745 L
256.94702 547.73745 L
256.85320 547.64306 L
256.75909 547.54923 L
256.75909 547.45540 L
256.75909 547.36157 L
256.75909 547.26746 L
256.85320 547.17364 L
256.94702 547.17364 L
257.04085 547.17364 L
257.13468 547.17364 L
@c
F
@rax %Note: Object
255.63175 547.17364 256.19556 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
256.00734 547.17364 m
256.00734 547.26746 L
256.10145 547.36157 L
256.19556 547.45540 L
256.19556 547.45540 L
256.10145 547.54923 L
256.00734 547.64306 L
255.91351 547.73745 L
255.91351 547.73745 L
255.81969 547.73745 L
255.72586 547.64306 L
255.63175 547.54923 L
255.63175 547.45540 L
255.63175 547.36157 L
255.63175 547.26746 L
255.72586 547.17364 L
255.81969 547.17364 L
255.91351 547.17364 L
256.00734 547.17364 L
@c
F
@rax %Note: Object
254.50441 547.17364 255.06822 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
254.88000 547.17364 m
254.88000 547.26746 L
254.97383 547.36157 L
255.06822 547.45540 L
255.06822 547.45540 L
254.97383 547.54923 L
254.88000 547.64306 L
254.78617 547.73745 L
254.78617 547.73745 L
254.69235 547.73745 L
254.59824 547.64306 L
254.50441 547.54923 L
254.50441 547.45540 L
254.50441 547.36157 L
254.50441 547.26746 L
254.59824 547.17364 L
254.69235 547.17364 L
254.78617 547.17364 L
254.88000 547.17364 L
@c
F
@rax %Note: Object
253.37735 547.17364 253.94088 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
253.75294 547.17364 m
253.75294 547.26746 L
253.84677 547.36157 L
253.94088 547.45540 L
253.94088 547.45540 L
253.84677 547.54923 L
253.75294 547.64306 L
253.65912 547.73745 L
253.65912 547.73745 L
253.56501 547.73745 L
253.47118 547.64306 L
253.37735 547.54923 L
253.37735 547.45540 L
253.37735 547.36157 L
253.37735 547.26746 L
253.47118 547.17364 L
253.56501 547.17364 L
253.65912 547.17364 L
253.75294 547.17364 L
@c
F
@rax %Note: Object
252.24973 547.17364 252.81354 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
252.62561 547.17364 m
252.62561 547.26746 L
252.71943 547.36157 L
252.81354 547.45540 L
252.81354 547.45540 L
252.71943 547.54923 L
252.62561 547.64306 L
252.53178 547.73745 L
252.53178 547.73745 L
252.43767 547.73745 L
252.34384 547.64306 L
252.24973 547.54923 L
252.24973 547.45540 L
252.24973 547.36157 L
252.24973 547.26746 L
252.34384 547.17364 L
252.43767 547.17364 L
252.53178 547.17364 L
252.62561 547.17364 L
@c
F
@rax %Note: Object
251.12239 547.17364 251.68592 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
251.49827 547.17364 m
251.49827 547.26746 L
251.59209 547.36157 L
251.68592 547.45540 L
251.68592 547.45540 L
251.59209 547.54923 L
251.49827 547.64306 L
251.40444 547.73745 L
251.40444 547.73745 L
251.31061 547.73745 L
251.21679 547.64306 L
251.12239 547.54923 L
251.12239 547.45540 L
251.12239 547.36157 L
251.12239 547.26746 L
251.21679 547.17364 L
251.31061 547.17364 L
251.40444 547.17364 L
251.49827 547.17364 L
@c
F
@rax %Note: Object
249.99506 547.17364 250.55887 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
250.37093 547.17364 m
250.37093 547.26746 L
250.46504 547.36157 L
250.55887 547.45540 L
250.55887 547.45540 L
250.46504 547.54923 L
250.37093 547.64306 L
250.27710 547.73745 L
250.27710 547.73745 L
250.18328 547.73745 L
250.08917 547.64306 L
249.99506 547.54923 L
249.99506 547.45540 L
249.99506 547.36157 L
249.99506 547.26746 L
250.08917 547.17364 L
250.18328 547.17364 L
250.27710 547.17364 L
250.37093 547.17364 L
@c
F
@rax %Note: Object
248.86772 547.17364 249.43153 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
249.24359 547.17364 m
249.24359 547.26746 L
249.33742 547.36157 L
249.43153 547.45540 L
249.43153 547.45540 L
249.33742 547.54923 L
249.24359 547.64306 L
249.14976 547.73745 L
249.14976 547.73745 L
249.05594 547.73745 L
248.96154 547.64306 L
248.86772 547.54923 L
248.86772 547.45540 L
248.86772 547.36157 L
248.86772 547.26746 L
248.96154 547.17364 L
249.05594 547.17364 L
249.14976 547.17364 L
249.24359 547.17364 L
@c
F
@rax %Note: Object
247.74066 547.17364 248.30419 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
248.11654 547.17364 m
248.11654 547.26746 L
248.21036 547.36157 L
248.30419 547.45540 L
248.30419 547.45540 L
248.21036 547.54923 L
248.11654 547.64306 L
248.02271 547.73745 L
248.02271 547.73745 L
247.92860 547.73745 L
247.83449 547.64306 L
247.74066 547.54923 L
247.74066 547.45540 L
247.74066 547.36157 L
247.74066 547.26746 L
247.83449 547.17364 L
247.92860 547.17364 L
248.02271 547.17364 L
248.11654 547.17364 L
@c
F
@rax %Note: Object
246.61332 547.17364 247.17685 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
246.98920 547.17364 m
246.98920 547.26746 L
247.08302 547.36157 L
247.17685 547.45540 L
247.17685 547.45540 L
247.08302 547.54923 L
246.98920 547.64306 L
246.89537 547.73745 L
246.89537 547.73745 L
246.80126 547.73745 L
246.70715 547.64306 L
246.61332 547.54923 L
246.61332 547.45540 L
246.61332 547.36157 L
246.61332 547.26746 L
246.70715 547.17364 L
246.80126 547.17364 L
246.89537 547.17364 L
246.98920 547.17364 L
@c
F
@rax %Note: Object
245.48598 547.17364 246.04951 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
245.86186 547.17364 m
245.86186 547.26746 L
245.95569 547.36157 L
246.04951 547.45540 L
246.04951 547.45540 L
245.95569 547.54923 L
245.86186 547.64306 L
245.76775 547.73745 L
245.76775 547.73745 L
245.67392 547.73745 L
245.58009 547.64306 L
245.48598 547.54923 L
245.48598 547.45540 L
245.48598 547.36157 L
245.48598 547.26746 L
245.58009 547.17364 L
245.67392 547.17364 L
245.76775 547.17364 L
245.86186 547.17364 L
@c
F
@rax %Note: Object
244.35865 547.17364 244.92246 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
244.73452 547.17364 m
244.73452 547.26746 L
244.82863 547.36157 L
244.92246 547.45540 L
244.92246 547.45540 L
244.82863 547.54923 L
244.73452 547.64306 L
244.64069 547.73745 L
244.64069 547.73745 L
244.54658 547.73745 L
244.45276 547.64306 L
244.35865 547.54923 L
244.35865 547.45540 L
244.35865 547.36157 L
244.35865 547.26746 L
244.45276 547.17364 L
244.54658 547.17364 L
244.64069 547.17364 L
244.73452 547.17364 L
@c
F
@rax %Note: Object
243.23131 547.17364 243.79512 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
243.60718 547.17364 m
243.60718 547.26746 L
243.70129 547.36157 L
243.79512 547.45540 L
243.79512 547.45540 L
243.70129 547.54923 L
243.60718 547.64306 L
243.51335 547.73745 L
243.51335 547.73745 L
243.41924 547.73745 L
243.32513 547.64306 L
243.23131 547.54923 L
243.23131 547.45540 L
243.23131 547.36157 L
243.23131 547.26746 L
243.32513 547.17364 L
243.41924 547.17364 L
243.51335 547.17364 L
243.60718 547.17364 L
@c
F
@rax %Note: Object
242.10425 547.17364 242.66778 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
242.48013 547.17364 m
242.48013 547.26746 L
242.57395 547.36157 L
242.66778 547.45540 L
242.66778 547.45540 L
242.57395 547.54923 L
242.48013 547.64306 L
242.38602 547.73745 L
242.38602 547.73745 L
242.29191 547.73745 L
242.19808 547.64306 L
242.10425 547.54923 L
242.10425 547.45540 L
242.10425 547.36157 L
242.10425 547.26746 L
242.19808 547.17364 L
242.29191 547.17364 L
242.38602 547.17364 L
242.48013 547.17364 L
@c
F
@rax %Note: Object
240.97691 547.17364 241.54044 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
241.35279 547.17364 m
241.35279 547.26746 L
241.44661 547.36157 L
241.54044 547.45540 L
241.54044 547.45540 L
241.44661 547.54923 L
241.35279 547.64306 L
241.25868 547.73745 L
241.25868 547.73745 L
241.16457 547.73745 L
241.07074 547.64306 L
240.97691 547.54923 L
240.97691 547.45540 L
240.97691 547.36157 L
240.97691 547.26746 L
241.07074 547.17364 L
241.16457 547.17364 L
241.25868 547.17364 L
241.35279 547.17364 L
@c
F
@rax %Note: Object
239.84957 547.17364 240.41310 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
240.22545 547.17364 m
240.22545 547.26746 L
240.31928 547.36157 L
240.41310 547.45540 L
240.41310 547.45540 L
240.31928 547.54923 L
240.22545 547.64306 L
240.13106 547.73745 L
240.13106 547.73745 L
240.03723 547.73745 L
239.94340 547.64306 L
239.84957 547.54923 L
239.84957 547.45540 L
239.84957 547.36157 L
239.84957 547.26746 L
239.94340 547.17364 L
240.03723 547.17364 L
240.13106 547.17364 L
240.22545 547.17364 L
@c
F
@rax %Note: Object
238.72224 547.17364 239.28605 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
239.09783 547.17364 m
239.09783 547.26746 L
239.19222 547.36157 L
239.28605 547.45540 L
239.28605 547.45540 L
239.19222 547.54923 L
239.09783 547.64306 L
239.00400 547.73745 L
239.00400 547.73745 L
238.91017 547.73745 L
238.81635 547.64306 L
238.72224 547.54923 L
238.72224 547.45540 L
238.72224 547.36157 L
238.72224 547.26746 L
238.81635 547.17364 L
238.91017 547.17364 L
239.00400 547.17364 L
239.09783 547.17364 L
@c
F
@rax %Note: Object
237.59490 547.17364 238.15871 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
237.97049 547.17364 m
237.97049 547.26746 L
238.06488 547.36157 L
238.15871 547.45540 L
238.15871 547.45540 L
238.06488 547.54923 L
237.97049 547.64306 L
237.87666 547.73745 L
237.87666 547.73745 L
237.78283 547.73745 L
237.68872 547.64306 L
237.59490 547.54923 L
237.59490 547.45540 L
237.59490 547.36157 L
237.59490 547.26746 L
237.68872 547.17364 L
237.78283 547.17364 L
237.87666 547.17364 L
237.97049 547.17364 L
@c
F
@rax %Note: Object
236.46784 547.17364 237.03137 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
236.84343 547.17364 m
236.84343 547.26746 L
236.93754 547.36157 L
237.03137 547.45540 L
237.03137 547.45540 L
236.93754 547.54923 L
236.84343 547.64306 L
236.74961 547.73745 L
236.74961 547.73745 L
236.65550 547.73745 L
236.56167 547.64306 L
236.46784 547.54923 L
236.46784 547.45540 L
236.46784 547.36157 L
236.46784 547.26746 L
236.56167 547.17364 L
236.65550 547.17364 L
236.74961 547.17364 L
236.84343 547.17364 L
@c
F
@rax %Note: Object
235.34050 547.17364 235.90403 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
235.71609 547.17364 m
235.71609 547.26746 L
235.80992 547.36157 L
235.90403 547.45540 L
235.90403 547.45540 L
235.80992 547.54923 L
235.71609 547.64306 L
235.62227 547.73745 L
235.62227 547.73745 L
235.52816 547.73745 L
235.43433 547.64306 L
235.34050 547.54923 L
235.34050 547.45540 L
235.34050 547.36157 L
235.34050 547.26746 L
235.43433 547.17364 L
235.52816 547.17364 L
235.62227 547.17364 L
235.71609 547.17364 L
@c
F
@rax %Note: Object
234.21317 547.17364 234.77669 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
234.58876 547.17364 m
234.58876 547.26746 L
234.68258 547.36157 L
234.77669 547.45540 L
234.77669 547.45540 L
234.68258 547.54923 L
234.58876 547.64306 L
234.49465 547.73745 L
234.49465 547.73745 L
234.40082 547.73745 L
234.30699 547.64306 L
234.21317 547.54923 L
234.21317 547.45540 L
234.21317 547.36157 L
234.21317 547.26746 L
234.30699 547.17364 L
234.40082 547.17364 L
234.49465 547.17364 L
234.58876 547.17364 L
@c
F
@rax %Note: Object
233.08554 547.17364 233.64935 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
233.46142 547.17364 m
233.46142 547.26746 L
233.55553 547.36157 L
233.64935 547.45540 L
233.64935 547.45540 L
233.55553 547.54923 L
233.46142 547.64306 L
233.36759 547.73745 L
233.36759 547.73745 L
233.27376 547.73745 L
233.17994 547.64306 L
233.08554 547.54923 L
233.08554 547.45540 L
233.08554 547.36157 L
233.08554 547.26746 L
233.17994 547.17364 L
233.27376 547.17364 L
233.36759 547.17364 L
233.46142 547.17364 L
@c
F
@rax %Note: Object
231.95820 547.17364 232.52202 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
232.33408 547.17364 m
232.33408 547.26746 L
232.42819 547.36157 L
232.52202 547.45540 L
232.52202 547.45540 L
232.42819 547.54923 L
232.33408 547.64306 L
232.24025 547.73745 L
232.24025 547.73745 L
232.14643 547.73745 L
232.05260 547.64306 L
231.95820 547.54923 L
231.95820 547.45540 L
231.95820 547.36157 L
231.95820 547.26746 L
232.05260 547.17364 L
232.14643 547.17364 L
232.24025 547.17364 L
232.33408 547.17364 L
@c
F
@rax %Note: Object
230.83115 547.17364 231.39468 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
231.20702 547.17364 m
231.20702 547.26746 L
231.30057 547.36157 L
231.39468 547.45540 L
231.39468 547.45540 L
231.30057 547.54923 L
231.20702 547.64306 L
231.11320 547.73745 L
231.11320 547.73745 L
231.01909 547.73745 L
230.92526 547.64306 L
230.83115 547.54923 L
230.83115 547.45540 L
230.83115 547.36157 L
230.83115 547.26746 L
230.92526 547.17364 L
231.01909 547.17364 L
231.11320 547.17364 L
231.20702 547.17364 L
@c
F
@rax %Note: Object
229.70381 547.17364 230.26734 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
230.07969 547.17364 m
230.07969 547.26746 L
230.17351 547.36157 L
230.26734 547.45540 L
230.26734 547.45540 L
230.17351 547.54923 L
230.07969 547.64306 L
229.98586 547.73745 L
229.98586 547.73745 L
229.89175 547.73745 L
229.79764 547.64306 L
229.70381 547.54923 L
229.70381 547.45540 L
229.70381 547.36157 L
229.70381 547.26746 L
229.79764 547.17364 L
229.89175 547.17364 L
229.98586 547.17364 L
230.07969 547.17364 L
@c
F
@rax %Note: Object
228.57647 547.17364 229.14000 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
228.95235 547.17364 m
228.95235 547.26746 L
229.04617 547.36157 L
229.14000 547.45540 L
229.14000 547.45540 L
229.04617 547.54923 L
228.95235 547.64306 L
228.85824 547.73745 L
228.85824 547.73745 L
228.76441 547.73745 L
228.67030 547.64306 L
228.57647 547.54923 L
228.57647 547.45540 L
228.57647 547.36157 L
228.57647 547.26746 L
228.67030 547.17364 L
228.76441 547.17364 L
228.85824 547.17364 L
228.95235 547.17364 L
@c
F
@rax %Note: Object
227.44913 547.17364 228.01294 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
227.82501 547.17364 m
227.82501 547.26746 L
227.91912 547.36157 L
228.01294 547.45540 L
228.01294 547.45540 L
227.91912 547.54923 L
227.82501 547.64306 L
227.73118 547.73745 L
227.73118 547.73745 L
227.63735 547.73745 L
227.54324 547.64306 L
227.44913 547.54923 L
227.44913 547.45540 L
227.44913 547.36157 L
227.44913 547.26746 L
227.54324 547.17364 L
227.63735 547.17364 L
227.73118 547.17364 L
227.82501 547.17364 L
@c
F
@rax %Note: Object
226.32180 547.17364 226.88561 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
226.69767 547.17364 m
226.69767 547.26746 L
226.79178 547.36157 L
226.88561 547.45540 L
226.88561 547.45540 L
226.79178 547.54923 L
226.69767 547.64306 L
226.60384 547.73745 L
226.60384 547.73745 L
226.50973 547.73745 L
226.41591 547.64306 L
226.32180 547.54923 L
226.32180 547.45540 L
226.32180 547.36157 L
226.32180 547.26746 L
226.41591 547.17364 L
226.50973 547.17364 L
226.60384 547.17364 L
226.69767 547.17364 L
@c
F
@rax %Note: Object
225.19474 547.17364 225.75827 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
225.57033 547.17364 m
225.57033 547.26746 L
225.66416 547.36157 L
225.75827 547.45540 L
225.75827 547.45540 L
225.66416 547.54923 L
225.57033 547.64306 L
225.47650 547.73745 L
225.47650 547.73745 L
225.38239 547.73745 L
225.28857 547.64306 L
225.19474 547.54923 L
225.19474 547.45540 L
225.19474 547.36157 L
225.19474 547.26746 L
225.28857 547.17364 L
225.38239 547.17364 L
225.47650 547.17364 L
225.57033 547.17364 L
@c
F
@rax %Note: Object
224.06740 547.17364 224.63093 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
224.44328 547.17364 m
224.44328 547.26746 L
224.53710 547.36157 L
224.63093 547.45540 L
224.63093 547.45540 L
224.53710 547.54923 L
224.44328 547.64306 L
224.34945 547.73745 L
224.34945 547.73745 L
224.25506 547.73745 L
224.16123 547.64306 L
224.06740 547.54923 L
224.06740 547.45540 L
224.06740 547.36157 L
224.06740 547.26746 L
224.16123 547.17364 L
224.25506 547.17364 L
224.34945 547.17364 L
224.44328 547.17364 L
@c
F
@rax %Note: Object
222.94006 547.17364 223.50359 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
223.31594 547.17364 m
223.31594 547.26746 L
223.40976 547.36157 L
223.50359 547.45540 L
223.50359 547.45540 L
223.40976 547.54923 L
223.31594 547.64306 L
223.22183 547.73745 L
223.22183 547.73745 L
223.12772 547.73745 L
223.03389 547.64306 L
222.94006 547.54923 L
222.94006 547.45540 L
222.94006 547.36157 L
222.94006 547.26746 L
223.03389 547.17364 L
223.12772 547.17364 L
223.22183 547.17364 L
223.31594 547.17364 L
@c
F
@rax %Note: Object
221.81272 547.17364 222.37654 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
222.18860 547.17364 m
222.18860 547.26746 L
222.28271 547.36157 L
222.37654 547.45540 L
222.37654 547.45540 L
222.28271 547.54923 L
222.18860 547.64306 L
222.09449 547.73745 L
222.09449 547.73745 L
222.00066 547.73745 L
221.90683 547.64306 L
221.81272 547.54923 L
221.81272 547.45540 L
221.81272 547.36157 L
221.81272 547.26746 L
221.90683 547.17364 L
222.00066 547.17364 L
222.09449 547.17364 L
222.18860 547.17364 L
@c
F
@rax %Note: Object
220.68539 547.17364 221.24920 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
221.06126 547.17364 m
221.06126 547.26746 L
221.15537 547.36157 L
221.24920 547.45540 L
221.24920 547.45540 L
221.15537 547.54923 L
221.06126 547.64306 L
220.96715 547.73745 L
220.96715 547.73745 L
220.87332 547.73745 L
220.77950 547.64306 L
220.68539 547.54923 L
220.68539 547.45540 L
220.68539 547.36157 L
220.68539 547.26746 L
220.77950 547.17364 L
220.87332 547.17364 L
220.96715 547.17364 L
221.06126 547.17364 L
@c
F
@rax %Note: Object
219.55833 547.17364 220.12186 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
219.93392 547.17364 m
219.93392 547.26746 L
220.02775 547.36157 L
220.12186 547.45540 L
220.12186 547.45540 L
220.02775 547.54923 L
219.93392 547.64306 L
219.83981 547.73745 L
219.83981 547.73745 L
219.74598 547.73745 L
219.65187 547.64306 L
219.55833 547.54923 L
219.55833 547.45540 L
219.55833 547.36157 L
219.55833 547.26746 L
219.65187 547.17364 L
219.74598 547.17364 L
219.83981 547.17364 L
219.93392 547.17364 L
@c
F
@rax %Note: Object
218.43099 547.17364 218.99452 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
218.80658 547.17364 m
218.80658 547.26746 L
218.90069 547.36157 L
218.99452 547.45540 L
218.99452 547.45540 L
218.90069 547.54923 L
218.80658 547.64306 L
218.71276 547.73745 L
218.71276 547.73745 L
218.61865 547.73745 L
218.52482 547.64306 L
218.43099 547.54923 L
218.43099 547.45540 L
218.43099 547.36157 L
218.43099 547.26746 L
218.52482 547.17364 L
218.61865 547.17364 L
218.71276 547.17364 L
218.80658 547.17364 L
@c
F
@rax %Note: Object
217.30365 547.17364 217.86718 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
217.67924 547.17364 m
217.67924 547.26746 L
217.77335 547.36157 L
217.86718 547.45540 L
217.86718 547.45540 L
217.77335 547.54923 L
217.67924 547.64306 L
217.58542 547.73745 L
217.58542 547.73745 L
217.49131 547.73745 L
217.39748 547.64306 L
217.30365 547.54923 L
217.30365 547.45540 L
217.30365 547.36157 L
217.30365 547.26746 L
217.39748 547.17364 L
217.49131 547.17364 L
217.58542 547.17364 L
217.67924 547.17364 L
@c
F
@rax %Note: Object
216.17631 547.17364 216.73984 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
216.55191 547.17364 m
216.55191 547.26746 L
216.64602 547.36157 L
216.73984 547.45540 L
216.73984 547.45540 L
216.64602 547.54923 L
216.55191 547.64306 L
216.45808 547.73745 L
216.45808 547.73745 L
216.36425 547.73745 L
216.27043 547.64306 L
216.17631 547.54923 L
216.17631 547.45540 L
216.17631 547.36157 L
216.17631 547.26746 L
216.27043 547.17364 L
216.36425 547.17364 L
216.45808 547.17364 L
216.55191 547.17364 L
@c
F
@rax %Note: Object
215.04898 547.17364 215.61279 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
215.42457 547.17364 m
215.42457 547.26746 L
215.51868 547.36157 L
215.61279 547.45540 L
215.61279 547.45540 L
215.51868 547.54923 L
215.42457 547.64306 L
215.33074 547.73745 L
215.33074 547.73745 L
215.23691 547.73745 L
215.14309 547.64306 L
215.04898 547.54923 L
215.04898 547.45540 L
215.04898 547.36157 L
215.04898 547.26746 L
215.14309 547.17364 L
215.23691 547.17364 L
215.33074 547.17364 L
215.42457 547.17364 L
@c
F
@rax %Note: Object
213.92164 547.17364 214.48545 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
214.29723 547.17364 m
214.29723 547.26746 L
214.39106 547.36157 L
214.48545 547.45540 L
214.48545 547.45540 L
214.39106 547.54923 L
214.29723 547.64306 L
214.20340 547.73745 L
214.20340 547.73745 L
214.10957 547.73745 L
214.01546 547.64306 L
213.92164 547.54923 L
213.92164 547.45540 L
213.92164 547.36157 L
213.92164 547.26746 L
214.01546 547.17364 L
214.10957 547.17364 L
214.20340 547.17364 L
214.29723 547.17364 L
@c
F
@rax %Note: Object
212.79430 547.17364 213.35783 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
213.17017 547.17364 m
213.17017 547.26746 L
213.26400 547.36157 L
213.35783 547.45540 L
213.35783 547.45540 L
213.26400 547.54923 L
213.17017 547.64306 L
213.07635 547.73745 L
213.07635 547.73745 L
212.98224 547.73745 L
212.88841 547.64306 L
212.79430 547.54923 L
212.79430 547.45540 L
212.79430 547.36157 L
212.79430 547.26746 L
212.88841 547.17364 L
212.98224 547.17364 L
213.07635 547.17364 L
213.17017 547.17364 L
@c
F
@rax %Note: Object
211.66696 547.17364 212.23049 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
212.04283 547.17364 m
212.04283 547.26746 L
212.13666 547.36157 L
212.23049 547.45540 L
212.23049 547.45540 L
212.13666 547.54923 L
212.04283 547.64306 L
211.94901 547.73745 L
211.94901 547.73745 L
211.85490 547.73745 L
211.76107 547.64306 L
211.66696 547.54923 L
211.66696 547.45540 L
211.66696 547.36157 L
211.66696 547.26746 L
211.76107 547.17364 L
211.85490 547.17364 L
211.94901 547.17364 L
212.04283 547.17364 L
@c
F
@rax %Note: Object
210.53962 547.17364 211.10315 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
210.91550 547.17364 m
210.91550 547.26746 L
211.00932 547.36157 L
211.10315 547.45540 L
211.10315 547.45540 L
211.00932 547.54923 L
210.91550 547.64306 L
210.82167 547.73745 L
210.82167 547.73745 L
210.72784 547.73745 L
210.63373 547.64306 L
210.53962 547.54923 L
210.53962 547.45540 L
210.53962 547.36157 L
210.53962 547.26746 L
210.63373 547.17364 L
210.72784 547.17364 L
210.82167 547.17364 L
210.91550 547.17364 L
@c
F
@rax %Note: Object
209.41228 547.17364 209.97609 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
209.78816 547.17364 m
209.78816 547.26746 L
209.88227 547.36157 L
209.97609 547.45540 L
209.97609 547.45540 L
209.88227 547.54923 L
209.78816 547.64306 L
209.69433 547.73745 L
209.69433 547.73745 L
209.60050 547.73745 L
209.50639 547.64306 L
209.41228 547.54923 L
209.41228 547.45540 L
209.41228 547.36157 L
209.41228 547.26746 L
209.50639 547.17364 L
209.60050 547.17364 L
209.69433 547.17364 L
209.78816 547.17364 L
@c
F
@rax %Note: Object
208.28494 547.17364 208.84876 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
208.66082 547.17364 m
208.66082 547.26746 L
208.75465 547.36157 L
208.84876 547.45540 L
208.84876 547.45540 L
208.75465 547.54923 L
208.66082 547.64306 L
208.56699 547.73745 L
208.56699 547.73745 L
208.47317 547.73745 L
208.37877 547.64306 L
208.28494 547.54923 L
208.28494 547.45540 L
208.28494 547.36157 L
208.28494 547.26746 L
208.37877 547.17364 L
208.47317 547.17364 L
208.56699 547.17364 L
208.66082 547.17364 L
@c
F
@rax %Note: Object
207.15789 547.17364 207.72142 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
207.53376 547.17364 m
207.53376 547.26746 L
207.62759 547.36157 L
207.72142 547.45540 L
207.72142 547.45540 L
207.62759 547.54923 L
207.53376 547.64306 L
207.43994 547.73745 L
207.43994 547.73745 L
207.34583 547.73745 L
207.25172 547.64306 L
207.15789 547.54923 L
207.15789 547.45540 L
207.15789 547.36157 L
207.15789 547.26746 L
207.25172 547.17364 L
207.34583 547.17364 L
207.43994 547.17364 L
207.53376 547.17364 L
@c
F
@rax %Note: Object
206.03055 547.17364 206.59408 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
206.40643 547.17364 m
206.40643 547.26746 L
206.50025 547.36157 L
206.59408 547.45540 L
206.59408 547.45540 L
206.50025 547.54923 L
206.40643 547.64306 L
206.31260 547.73745 L
206.31260 547.73745 L
206.21820 547.73745 L
206.12438 547.64306 L
206.03055 547.54923 L
206.03055 547.45540 L
206.03055 547.36157 L
206.03055 547.26746 L
206.12438 547.17364 L
206.21820 547.17364 L
206.31260 547.17364 L
206.40643 547.17364 L
@c
F
@rax %Note: Object
204.90321 547.17364 205.46674 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
205.27909 547.17364 m
205.27909 547.26746 L
205.37291 547.36157 L
205.46674 547.45540 L
205.46674 547.45540 L
205.37291 547.54923 L
205.27909 547.64306 L
205.18498 547.73745 L
205.18498 547.73745 L
205.09087 547.73745 L
204.99732 547.64306 L
204.90321 547.54923 L
204.90321 547.45540 L
204.90321 547.36157 L
204.90321 547.26746 L
204.99732 547.17364 L
205.09087 547.17364 L
205.18498 547.17364 L
205.27909 547.17364 L
@c
F
@rax %Note: Object
203.77587 547.17364 204.33969 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
204.15175 547.17364 m
204.15175 547.26746 L
204.24586 547.36157 L
204.33969 547.45540 L
204.33969 547.45540 L
204.24586 547.54923 L
204.15175 547.64306 L
204.05764 547.73745 L
204.05764 547.73745 L
203.96381 547.73745 L
203.86998 547.64306 L
203.77587 547.54923 L
203.77587 547.45540 L
203.77587 547.36157 L
203.77587 547.26746 L
203.86998 547.17364 L
203.96381 547.17364 L
204.05764 547.17364 L
204.15175 547.17364 L
@c
F
@rax %Note: Object
202.64854 547.17364 203.21235 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
203.02441 547.17364 m
203.02441 547.26746 L
203.11852 547.36157 L
203.21235 547.45540 L
203.21235 547.45540 L
203.11852 547.54923 L
203.02441 547.64306 L
202.93030 547.73745 L
202.93030 547.73745 L
202.83647 547.73745 L
202.74236 547.64306 L
202.64854 547.54923 L
202.64854 547.45540 L
202.64854 547.36157 L
202.64854 547.26746 L
202.74236 547.17364 L
202.83647 547.17364 L
202.93030 547.17364 L
203.02441 547.17364 L
@c
F
@rax %Note: Object
201.52148 547.17364 202.08501 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
201.89735 547.17364 m
201.89735 547.26746 L
201.99118 547.36157 L
202.08501 547.45540 L
202.08501 547.45540 L
201.99118 547.54923 L
201.89735 547.64306 L
201.80324 547.73745 L
201.80324 547.73745 L
201.70913 547.73745 L
201.61531 547.64306 L
201.52148 547.54923 L
201.52148 547.45540 L
201.52148 547.36157 L
201.52148 547.26746 L
201.61531 547.17364 L
201.70913 547.17364 L
201.80324 547.17364 L
201.89735 547.17364 L
@c
F
@rax %Note: Object
200.39414 547.17364 200.95767 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
200.76973 547.17364 m
200.76973 547.26746 L
200.86384 547.36157 L
200.95767 547.45540 L
200.95767 547.45540 L
200.86384 547.54923 L
200.76973 547.64306 L
200.67591 547.73745 L
200.67591 547.73745 L
200.58180 547.73745 L
200.48797 547.64306 L
200.39414 547.54923 L
200.39414 547.45540 L
200.39414 547.36157 L
200.39414 547.26746 L
200.48797 547.17364 L
200.58180 547.17364 L
200.67591 547.17364 L
200.76973 547.17364 L
@c
F
@rax %Note: Object
199.26680 547.17364 199.83033 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
199.64239 547.17364 m
199.64239 547.26746 L
199.73650 547.36157 L
199.83033 547.45540 L
199.83033 547.45540 L
199.73650 547.54923 L
199.64239 547.64306 L
199.54828 547.73745 L
199.54828 547.73745 L
199.45446 547.73745 L
199.36063 547.64306 L
199.26680 547.54923 L
199.26680 547.45540 L
199.26680 547.36157 L
199.26680 547.26746 L
199.36063 547.17364 L
199.45446 547.17364 L
199.54828 547.17364 L
199.64239 547.17364 L
@c
F
@rax %Note: Object
198.13946 547.17364 198.70328 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
198.51506 547.17364 m
198.51506 547.26746 L
198.60945 547.36157 L
198.70328 547.45540 L
198.70328 547.45540 L
198.60945 547.54923 L
198.51506 547.64306 L
198.42123 547.73745 L
198.42123 547.73745 L
198.32740 547.73745 L
198.23357 547.64306 L
198.13946 547.54923 L
198.13946 547.45540 L
198.13946 547.36157 L
198.13946 547.26746 L
198.23357 547.17364 L
198.32740 547.17364 L
198.42123 547.17364 L
198.51506 547.17364 L
@c
F
@rax %Note: Object
197.01213 547.17364 197.57594 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
197.38772 547.17364 m
197.38772 547.26746 L
197.48183 547.36157 L
197.57594 547.45540 L
197.57594 547.45540 L
197.48183 547.54923 L
197.38772 547.64306 L
197.29389 547.73745 L
197.29389 547.73745 L
197.20006 547.73745 L
197.10595 547.64306 L
197.01213 547.54923 L
197.01213 547.45540 L
197.01213 547.36157 L
197.01213 547.26746 L
197.10595 547.17364 L
197.20006 547.17364 L
197.29389 547.17364 L
197.38772 547.17364 L
@c
F
@rax %Note: Object
195.88507 547.17364 196.44860 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
196.26066 547.17364 m
196.26066 547.26746 L
196.35449 547.36157 L
196.44860 547.45540 L
196.44860 547.45540 L
196.35449 547.54923 L
196.26066 547.64306 L
196.16683 547.73745 L
196.16683 547.73745 L
196.07272 547.73745 L
195.97890 547.64306 L
195.88507 547.54923 L
195.88507 547.45540 L
195.88507 547.36157 L
195.88507 547.26746 L
195.97890 547.17364 L
196.07272 547.17364 L
196.16683 547.17364 L
196.26066 547.17364 L
@c
F
@rax %Note: Object
194.75773 547.17364 195.32126 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
195.13332 547.17364 m
195.13332 547.26746 L
195.22715 547.36157 L
195.32126 547.45540 L
195.32126 547.45540 L
195.22715 547.54923 L
195.13332 547.64306 L
195.03950 547.73745 L
195.03950 547.73745 L
194.94539 547.73745 L
194.85156 547.64306 L
194.75773 547.54923 L
194.75773 547.45540 L
194.75773 547.36157 L
194.75773 547.26746 L
194.85156 547.17364 L
194.94539 547.17364 L
195.03950 547.17364 L
195.13332 547.17364 L
@c
F
@rax %Note: Object
193.63011 547.17364 194.19392 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
194.00598 547.17364 m
194.00598 547.26746 L
194.09981 547.36157 L
194.19392 547.45540 L
194.19392 547.45540 L
194.09981 547.54923 L
194.00598 547.64306 L
193.91187 547.73745 L
193.91187 547.73745 L
193.81805 547.73745 L
193.72422 547.64306 L
193.63011 547.54923 L
193.63011 547.45540 L
193.63011 547.36157 L
193.63011 547.26746 L
193.72422 547.17364 L
193.81805 547.17364 L
193.91187 547.17364 L
194.00598 547.17364 L
@c
F
@rax %Note: Object
192.50277 547.17364 193.06658 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
192.87865 547.17364 m
192.87865 547.26746 L
192.97276 547.36157 L
193.06658 547.45540 L
193.06658 547.45540 L
192.97276 547.54923 L
192.87865 547.64306 L
192.78482 547.73745 L
192.78482 547.73745 L
192.69099 547.73745 L
192.59717 547.64306 L
192.50277 547.54923 L
192.50277 547.45540 L
192.50277 547.36157 L
192.50277 547.26746 L
192.59717 547.17364 L
192.69099 547.17364 L
192.78482 547.17364 L
192.87865 547.17364 L
@c
F
@rax %Note: Object
191.37543 547.17364 191.93924 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
191.75131 547.17364 m
191.75131 547.26746 L
191.84542 547.36157 L
191.93924 547.45540 L
191.93924 547.45540 L
191.84542 547.54923 L
191.75131 547.64306 L
191.65748 547.73745 L
191.65748 547.73745 L
191.56365 547.73745 L
191.46954 547.64306 L
191.37543 547.54923 L
191.37543 547.45540 L
191.37543 547.36157 L
191.37543 547.26746 L
191.46954 547.17364 L
191.56365 547.17364 L
191.65748 547.17364 L
191.75131 547.17364 L
@c
F
@rax %Note: Object
190.24838 547.17364 190.81191 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
190.62397 547.17364 m
190.62397 547.26746 L
190.71780 547.36157 L
190.81191 547.45540 L
190.81191 547.45540 L
190.71780 547.54923 L
190.62397 547.64306 L
190.53043 547.73745 L
190.53043 547.73745 L
190.43631 547.73745 L
190.34220 547.64306 L
190.24838 547.54923 L
190.24838 547.45540 L
190.24838 547.36157 L
190.24838 547.26746 L
190.34220 547.17364 L
190.43631 547.17364 L
190.53043 547.17364 L
190.62397 547.17364 L
@c
F
@rax %Note: Object
189.12104 547.17364 189.68457 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
189.49691 547.17364 m
189.49691 547.26746 L
189.59074 547.36157 L
189.68457 547.45540 L
189.68457 547.45540 L
189.59074 547.54923 L
189.49691 547.64306 L
189.40309 547.73745 L
189.40309 547.73745 L
189.30898 547.73745 L
189.21487 547.64306 L
189.12104 547.54923 L
189.12104 547.45540 L
189.12104 547.36157 L
189.12104 547.26746 L
189.21487 547.17364 L
189.30898 547.17364 L
189.40309 547.17364 L
189.49691 547.17364 L
@c
F
@rax %Note: Object
187.99370 547.17364 188.55723 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
188.36957 547.17364 m
188.36957 547.26746 L
188.46340 547.36157 L
188.55723 547.45540 L
188.55723 547.45540 L
188.46340 547.54923 L
188.36957 547.64306 L
188.27546 547.73745 L
188.27546 547.73745 L
188.18164 547.73745 L
188.08753 547.64306 L
187.99370 547.54923 L
187.99370 547.45540 L
187.99370 547.36157 L
187.99370 547.26746 L
188.08753 547.17364 L
188.18164 547.17364 L
188.27546 547.17364 L
188.36957 547.17364 L
@c
F
@rax %Note: Object
186.86636 547.17364 187.43017 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
187.24224 547.17364 m
187.24224 547.26746 L
187.33635 547.36157 L
187.43017 547.45540 L
187.43017 547.45540 L
187.33635 547.54923 L
187.24224 547.64306 L
187.14841 547.73745 L
187.14841 547.73745 L
187.05430 547.73745 L
186.96047 547.64306 L
186.86636 547.54923 L
186.86636 547.45540 L
186.86636 547.36157 L
186.86636 547.26746 L
186.96047 547.17364 L
187.05430 547.17364 L
187.14841 547.17364 L
187.24224 547.17364 L
@c
F
@rax %Note: Object
185.73902 547.17364 186.30283 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
186.11490 547.17364 m
186.11490 547.26746 L
186.20901 547.36157 L
186.30283 547.45540 L
186.30283 547.45540 L
186.20901 547.54923 L
186.11490 547.64306 L
186.02107 547.73745 L
186.02107 547.73745 L
185.92696 547.73745 L
185.83313 547.64306 L
185.73902 547.54923 L
185.73902 547.45540 L
185.73902 547.36157 L
185.73902 547.26746 L
185.83313 547.17364 L
185.92696 547.17364 L
186.02107 547.17364 L
186.11490 547.17364 L
@c
F
@rax %Note: Object
184.61197 547.17364 185.17550 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
184.98756 547.17364 m
184.98756 547.26746 L
185.08139 547.36157 L
185.17550 547.45540 L
185.17550 547.45540 L
185.08139 547.54923 L
184.98756 547.64306 L
184.89373 547.73745 L
184.89373 547.73745 L
184.79962 547.73745 L
184.70580 547.64306 L
184.61197 547.54923 L
184.61197 547.45540 L
184.61197 547.36157 L
184.61197 547.26746 L
184.70580 547.17364 L
184.79962 547.17364 L
184.89373 547.17364 L
184.98756 547.17364 L
@c
F
@rax %Note: Object
183.48463 547.17364 184.04816 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
183.86050 547.17364 m
183.86050 547.26746 L
183.95433 547.36157 L
184.04816 547.45540 L
184.04816 547.45540 L
183.95433 547.54923 L
183.86050 547.64306 L
183.76639 547.73745 L
183.76639 547.73745 L
183.67228 547.73745 L
183.57846 547.64306 L
183.48463 547.54923 L
183.48463 547.45540 L
183.48463 547.36157 L
183.48463 547.26746 L
183.57846 547.17364 L
183.67228 547.17364 L
183.76639 547.17364 L
183.86050 547.17364 L
@c
F
@rax %Note: Object
182.35729 547.17364 182.92082 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
182.73317 547.17364 m
182.73317 547.26746 L
182.82699 547.36157 L
182.92082 547.45540 L
182.92082 547.45540 L
182.82699 547.54923 L
182.73317 547.64306 L
182.63877 547.73745 L
182.63877 547.73745 L
182.54494 547.73745 L
182.45112 547.64306 L
182.35729 547.54923 L
182.35729 547.45540 L
182.35729 547.36157 L
182.35729 547.26746 L
182.45112 547.17364 L
182.54494 547.17364 L
182.63877 547.17364 L
182.73317 547.17364 L
@c
F
@rax %Note: Object
181.22995 547.17364 181.79376 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
181.60583 547.17364 m
181.60583 547.26746 L
181.69994 547.36157 L
181.79376 547.45540 L
181.79376 547.45540 L
181.69994 547.54923 L
181.60583 547.64306 L
181.51172 547.73745 L
181.51172 547.73745 L
181.41789 547.73745 L
181.32406 547.64306 L
181.22995 547.54923 L
181.22995 547.45540 L
181.22995 547.36157 L
181.22995 547.26746 L
181.32406 547.17364 L
181.41789 547.17364 L
181.51172 547.17364 L
181.60583 547.17364 L
@c
F
@rax %Note: Object
180.10261 547.17364 180.66643 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
180.47820 547.17364 m
180.47820 547.26746 L
180.57260 547.36157 L
180.66643 547.45540 L
180.66643 547.45540 L
180.57260 547.54923 L
180.47820 547.64306 L
180.38438 547.73745 L
180.38438 547.73745 L
180.29055 547.73745 L
180.19672 547.64306 L
180.10261 547.54923 L
180.10261 547.45540 L
180.10261 547.36157 L
180.10261 547.26746 L
180.19672 547.17364 L
180.29055 547.17364 L
180.38438 547.17364 L
180.47820 547.17364 L
@c
F
@rax %Note: Object
178.97528 547.17364 179.53909 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
179.35087 547.17364 m
179.35087 547.26746 L
179.44498 547.36157 L
179.53909 547.45540 L
179.53909 547.45540 L
179.44498 547.54923 L
179.35087 547.64306 L
179.25704 547.73745 L
179.25704 547.73745 L
179.16321 547.73745 L
179.06910 547.64306 L
178.97528 547.54923 L
178.97528 547.45540 L
178.97528 547.36157 L
178.97528 547.26746 L
179.06910 547.17364 L
179.16321 547.17364 L
179.25704 547.17364 L
179.35087 547.17364 L
@c
F
@rax %Note: Object
177.84822 547.17364 178.41175 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
178.22381 547.17364 m
178.22381 547.26746 L
178.31792 547.36157 L
178.41175 547.45540 L
178.41175 547.45540 L
178.31792 547.54923 L
178.22381 547.64306 L
178.12998 547.73745 L
178.12998 547.73745 L
178.03587 547.73745 L
177.94205 547.64306 L
177.84822 547.54923 L
177.84822 547.45540 L
177.84822 547.36157 L
177.84822 547.26746 L
177.94205 547.17364 L
178.03587 547.17364 L
178.12998 547.17364 L
178.22381 547.17364 L
@c
F
@rax %Note: Object
176.72088 547.17364 177.28441 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
177.09647 547.17364 m
177.09647 547.26746 L
177.19030 547.36157 L
177.28441 547.45540 L
177.28441 547.45540 L
177.19030 547.54923 L
177.09647 547.64306 L
177.00236 547.73745 L
177.00236 547.73745 L
176.90854 547.73745 L
176.81471 547.64306 L
176.72088 547.54923 L
176.72088 547.45540 L
176.72088 547.36157 L
176.72088 547.26746 L
176.81471 547.17364 L
176.90854 547.17364 L
177.00236 547.17364 L
177.09647 547.17364 L
@c
F
@rax %Note: Object
175.59354 547.17364 176.15707 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
175.96913 547.17364 m
175.96913 547.26746 L
176.06296 547.36157 L
176.15707 547.45540 L
176.15707 547.45540 L
176.06296 547.54923 L
175.96913 547.64306 L
175.87531 547.73745 L
175.87531 547.73745 L
175.78148 547.73745 L
175.68765 547.64306 L
175.59354 547.54923 L
175.59354 547.45540 L
175.59354 547.36157 L
175.59354 547.26746 L
175.68765 547.17364 L
175.78148 547.17364 L
175.87531 547.17364 L
175.96913 547.17364 L
@c
F
@rax %Note: Object
174.46620 547.17364 175.03002 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
174.84180 547.17364 m
174.84180 547.26746 L
174.93591 547.36157 L
175.03002 547.45540 L
175.03002 547.45540 L
174.93591 547.54923 L
174.84180 547.64306 L
174.74797 547.73745 L
174.74797 547.73745 L
174.65414 547.73745 L
174.56031 547.64306 L
174.46620 547.54923 L
174.46620 547.45540 L
174.46620 547.36157 L
174.46620 547.26746 L
174.56031 547.17364 L
174.65414 547.17364 L
174.74797 547.17364 L
174.84180 547.17364 L
@c
F
@rax %Note: Object
173.33858 547.17364 173.90239 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
173.71446 547.17364 m
173.71446 547.26746 L
173.80828 547.36157 L
173.90239 547.45540 L
173.90239 547.45540 L
173.80828 547.54923 L
173.71446 547.64306 L
173.62063 547.73745 L
173.62063 547.73745 L
173.52680 547.73745 L
173.43269 547.64306 L
173.33858 547.54923 L
173.33858 547.45540 L
173.33858 547.36157 L
173.33858 547.26746 L
173.43269 547.17364 L
173.52680 547.17364 L
173.62063 547.17364 L
173.71446 547.17364 L
@c
F
@rax %Note: Object
172.21153 547.17364 172.77506 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
172.58740 547.17364 m
172.58740 547.26746 L
172.68123 547.36157 L
172.77506 547.45540 L
172.77506 547.45540 L
172.68123 547.54923 L
172.58740 547.64306 L
172.49357 547.73745 L
172.49357 547.73745 L
172.39946 547.73745 L
172.30564 547.64306 L
172.21153 547.54923 L
172.21153 547.45540 L
172.21153 547.36157 L
172.21153 547.26746 L
172.30564 547.17364 L
172.39946 547.17364 L
172.49357 547.17364 L
172.58740 547.17364 L
@c
F
@rax %Note: Object
171.08419 547.17364 171.64772 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
171.46006 547.17364 m
171.46006 547.26746 L
171.55389 547.36157 L
171.64772 547.45540 L
171.64772 547.45540 L
171.55389 547.54923 L
171.46006 547.64306 L
171.36624 547.73745 L
171.36624 547.73745 L
171.27213 547.73745 L
171.17802 547.64306 L
171.08419 547.54923 L
171.08419 547.45540 L
171.08419 547.36157 L
171.08419 547.26746 L
171.17802 547.17364 L
171.27213 547.17364 L
171.36624 547.17364 L
171.46006 547.17364 L
@c
F
@rax %Note: Object
169.95685 547.17364 170.52038 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
170.33272 547.17364 m
170.33272 547.26746 L
170.42655 547.36157 L
170.52038 547.45540 L
170.52038 547.45540 L
170.42655 547.54923 L
170.33272 547.64306 L
170.23861 547.73745 L
170.23861 547.73745 L
170.14507 547.73745 L
170.05096 547.64306 L
169.95685 547.54923 L
169.95685 547.45540 L
169.95685 547.36157 L
169.95685 547.26746 L
170.05096 547.17364 L
170.14507 547.17364 L
170.23861 547.17364 L
170.33272 547.17364 L
@c
F
@rax %Note: Object
168.82951 547.17364 169.39332 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
169.20539 547.17364 m
169.20539 547.26746 L
169.29950 547.36157 L
169.39332 547.45540 L
169.39332 547.45540 L
169.29950 547.54923 L
169.20539 547.64306 L
169.11156 547.73745 L
169.11156 547.73745 L
169.01773 547.73745 L
168.92362 547.64306 L
168.82951 547.54923 L
168.82951 547.45540 L
168.82951 547.36157 L
168.82951 547.26746 L
168.92362 547.17364 L
169.01773 547.17364 L
169.11156 547.17364 L
169.20539 547.17364 L
@c
F
@rax %Note: Object
167.70217 547.17364 168.26598 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
168.07805 547.17364 m
168.07805 547.26746 L
168.17187 547.36157 L
168.26598 547.45540 L
168.26598 547.45540 L
168.17187 547.54923 L
168.07805 547.64306 L
167.98422 547.73745 L
167.98422 547.73745 L
167.89011 547.73745 L
167.79600 547.64306 L
167.70217 547.54923 L
167.70217 547.45540 L
167.70217 547.36157 L
167.70217 547.26746 L
167.79600 547.17364 L
167.89011 547.17364 L
167.98422 547.17364 L
168.07805 547.17364 L
@c
F
@rax %Note: Object
166.57512 547.17364 167.13865 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
166.95099 547.17364 m
166.95099 547.26746 L
167.04482 547.36157 L
167.13865 547.45540 L
167.13865 547.45540 L
167.04482 547.54923 L
166.95099 547.64306 L
166.85717 547.73745 L
166.85717 547.73745 L
166.76277 547.73745 L
166.66894 547.64306 L
166.57512 547.54923 L
166.57512 547.45540 L
166.57512 547.36157 L
166.57512 547.26746 L
166.66894 547.17364 L
166.76277 547.17364 L
166.85717 547.17364 L
166.95099 547.17364 L
@c
F
@rax %Note: Object
165.44778 547.17364 166.01131 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
165.82365 547.17364 m
165.82365 547.26746 L
165.91748 547.36157 L
166.01131 547.45540 L
166.01131 547.45540 L
165.91748 547.54923 L
165.82365 547.64306 L
165.72983 547.73745 L
165.72983 547.73745 L
165.63543 547.73745 L
165.54161 547.64306 L
165.44778 547.54923 L
165.44778 547.45540 L
165.44778 547.36157 L
165.44778 547.26746 L
165.54161 547.17364 L
165.63543 547.17364 L
165.72983 547.17364 L
165.82365 547.17364 L
@c
F
@rax %Note: Object
164.32044 547.17364 164.88397 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
164.69631 547.17364 m
164.69631 547.26746 L
164.79014 547.36157 L
164.88397 547.45540 L
164.88397 547.45540 L
164.79014 547.54923 L
164.69631 547.64306 L
164.60220 547.73745 L
164.60220 547.73745 L
164.50809 547.73745 L
164.41455 547.64306 L
164.32044 547.54923 L
164.32044 547.45540 L
164.32044 547.36157 L
164.32044 547.26746 L
164.41455 547.17364 L
164.50809 547.17364 L
164.60220 547.17364 L
164.69631 547.17364 L
@c
F
@rax %Note: Object
163.19310 547.17364 163.75691 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
163.56898 547.17364 m
163.56898 547.26746 L
163.66309 547.36157 L
163.75691 547.45540 L
163.75691 547.45540 L
163.66309 547.54923 L
163.56898 547.64306 L
163.47487 547.73745 L
163.47487 547.73745 L
163.38104 547.73745 L
163.28721 547.64306 L
163.19310 547.54923 L
163.19310 547.45540 L
163.19310 547.36157 L
163.19310 547.26746 L
163.28721 547.17364 L
163.38104 547.17364 L
163.47487 547.17364 L
163.56898 547.17364 L
@c
F
@rax %Note: Object
162.06576 547.17364 162.62957 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
162.44164 547.17364 m
162.44164 547.26746 L
162.53546 547.36157 L
162.62957 547.45540 L
162.62957 547.45540 L
162.53546 547.54923 L
162.44164 547.64306 L
162.34753 547.73745 L
162.34753 547.73745 L
162.25370 547.73745 L
162.15959 547.64306 L
162.06576 547.54923 L
162.06576 547.45540 L
162.06576 547.36157 L
162.06576 547.26746 L
162.15959 547.17364 L
162.25370 547.17364 L
162.34753 547.17364 L
162.44164 547.17364 L
@c
F
@rax %Note: Object
160.93871 547.17364 161.50224 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
161.31430 547.17364 m
161.31430 547.26746 L
161.40841 547.36157 L
161.50224 547.45540 L
161.50224 547.45540 L
161.40841 547.54923 L
161.31430 547.64306 L
161.22047 547.73745 L
161.22047 547.73745 L
161.12636 547.73745 L
161.03254 547.64306 L
160.93871 547.54923 L
160.93871 547.45540 L
160.93871 547.36157 L
160.93871 547.26746 L
161.03254 547.17364 L
161.12636 547.17364 L
161.22047 547.17364 L
161.31430 547.17364 L
@c
F
@rax %Note: Object
159.81137 547.17364 160.37490 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
160.18696 547.17364 m
160.18696 547.26746 L
160.28107 547.36157 L
160.37490 547.45540 L
160.37490 547.45540 L
160.28107 547.54923 L
160.18696 547.64306 L
160.09313 547.73745 L
160.09313 547.73745 L
159.99902 547.73745 L
159.90520 547.64306 L
159.81137 547.54923 L
159.81137 547.45540 L
159.81137 547.36157 L
159.81137 547.26746 L
159.90520 547.17364 L
159.99902 547.17364 L
160.09313 547.17364 L
160.18696 547.17364 L
@c
F
@rax %Note: Object
158.68403 547.17364 159.24756 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
159.05962 547.17364 m
159.05962 547.26746 L
159.15373 547.36157 L
159.24756 547.45540 L
159.24756 547.45540 L
159.15373 547.54923 L
159.05962 547.64306 L
158.96551 547.73745 L
158.96551 547.73745 L
158.87169 547.73745 L
158.77786 547.64306 L
158.68403 547.54923 L
158.68403 547.45540 L
158.68403 547.36157 L
158.68403 547.26746 L
158.77786 547.17364 L
158.87169 547.17364 L
158.96551 547.17364 L
159.05962 547.17364 L
@c
F
@rax %Note: Object
157.55669 547.17364 158.12050 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
157.93228 547.17364 m
157.93228 547.26746 L
158.02639 547.36157 L
158.12050 547.45540 L
158.12050 547.45540 L
158.02639 547.54923 L
157.93228 547.64306 L
157.83846 547.73745 L
157.83846 547.73745 L
157.74463 547.73745 L
157.65080 547.64306 L
157.55669 547.54923 L
157.55669 547.45540 L
157.55669 547.36157 L
157.55669 547.26746 L
157.65080 547.17364 L
157.74463 547.17364 L
157.83846 547.17364 L
157.93228 547.17364 L
@c
F
@rax %Note: Object
156.42935 547.17364 156.99317 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
156.80494 547.17364 m
156.80494 547.26746 L
156.89906 547.36157 L
156.99317 547.45540 L
156.99317 547.45540 L
156.89906 547.54923 L
156.80494 547.64306 L
156.71112 547.73745 L
156.71112 547.73745 L
156.61729 547.73745 L
156.52318 547.64306 L
156.42935 547.54923 L
156.42935 547.45540 L
156.42935 547.36157 L
156.42935 547.26746 L
156.52318 547.17364 L
156.61729 547.17364 L
156.71112 547.17364 L
156.80494 547.17364 L
@c
F
@rax %Note: Object
155.30202 547.17364 155.86583 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
155.67789 547.17364 m
155.67789 547.26746 L
155.77143 547.36157 L
155.86583 547.45540 L
155.86583 547.45540 L
155.77143 547.54923 L
155.67789 547.64306 L
155.58406 547.73745 L
155.58406 547.73745 L
155.48995 547.73745 L
155.39613 547.64306 L
155.30202 547.54923 L
155.30202 547.45540 L
155.30202 547.36157 L
155.30202 547.26746 L
155.39613 547.17364 L
155.48995 547.17364 L
155.58406 547.17364 L
155.67789 547.17364 L
@c
F
@rax %Note: Object
154.17468 547.17364 154.73820 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
154.55055 547.17364 m
154.55055 547.26746 L
154.64438 547.36157 L
154.73820 547.45540 L
154.73820 547.45540 L
154.64438 547.54923 L
154.55055 547.64306 L
154.45672 547.73745 L
154.45672 547.73745 L
154.36261 547.73745 L
154.26879 547.64306 L
154.17468 547.54923 L
154.17468 547.45540 L
154.17468 547.36157 L
154.17468 547.26746 L
154.26879 547.17364 L
154.36261 547.17364 L
154.45672 547.17364 L
154.55055 547.17364 L
@c
F
@rax %Note: Object
153.04734 547.17364 153.61087 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
153.42321 547.17364 m
153.42321 547.26746 L
153.51704 547.36157 L
153.61087 547.45540 L
153.61087 547.45540 L
153.51704 547.54923 L
153.42321 547.64306 L
153.32910 547.73745 L
153.32910 547.73745 L
153.23528 547.73745 L
153.14145 547.64306 L
153.04734 547.54923 L
153.04734 547.45540 L
153.04734 547.36157 L
153.04734 547.26746 L
153.14145 547.17364 L
153.23528 547.17364 L
153.32910 547.17364 L
153.42321 547.17364 L
@c
F
@rax %Note: Object
151.92000 547.17364 152.48381 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
152.29587 547.17364 m
152.29587 547.26746 L
152.38998 547.36157 L
152.48381 547.45540 L
152.48381 547.45540 L
152.38998 547.54923 L
152.29587 547.64306 L
152.20205 547.73745 L
152.20205 547.73745 L
152.10822 547.73745 L
152.01411 547.64306 L
151.92000 547.54923 L
151.92000 547.45540 L
151.92000 547.36157 L
151.92000 547.26746 L
152.01411 547.17364 L
152.10822 547.17364 L
152.20205 547.17364 L
152.29587 547.17364 L
@c
F
@rax %Note: Object
150.79266 547.17364 151.35647 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
151.16854 547.17364 m
151.16854 547.26746 L
151.26265 547.36157 L
151.35647 547.45540 L
151.35647 547.45540 L
151.26265 547.54923 L
151.16854 547.64306 L
151.07471 547.73745 L
151.07471 547.73745 L
150.98088 547.73745 L
150.88649 547.64306 L
150.79266 547.54923 L
150.79266 547.45540 L
150.79266 547.36157 L
150.79266 547.26746 L
150.88649 547.17364 L
150.98088 547.17364 L
151.07471 547.17364 L
151.16854 547.17364 L
@c
F
@rax %Note: Object
149.66561 547.17364 150.22913 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
150.04120 547.17364 m
150.04120 547.26746 L
150.13502 547.36157 L
150.22913 547.45540 L
150.22913 547.45540 L
150.13502 547.54923 L
150.04120 547.64306 L
149.94737 547.73745 L
149.94737 547.73745 L
149.85354 547.73745 L
149.75943 547.64306 L
149.66561 547.54923 L
149.66561 547.45540 L
149.66561 547.36157 L
149.66561 547.26746 L
149.75943 547.17364 L
149.85354 547.17364 L
149.94737 547.17364 L
150.04120 547.17364 L
@c
F
@rax %Note: Object
148.53827 547.17364 149.10180 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
148.91414 547.17364 m
148.91414 547.26746 L
149.00797 547.36157 L
149.10180 547.45540 L
149.10180 547.45540 L
149.00797 547.54923 L
148.91414 547.64306 L
148.82031 547.73745 L
148.82031 547.73745 L
148.72620 547.73745 L
148.63209 547.64306 L
148.53827 547.54923 L
148.53827 547.45540 L
148.53827 547.36157 L
148.53827 547.26746 L
148.63209 547.17364 L
148.72620 547.17364 L
148.82031 547.17364 L
148.91414 547.17364 L
@c
F
@rax %Note: Object
147.41093 547.17364 147.97446 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
147.78680 547.17364 m
147.78680 547.26746 L
147.88063 547.36157 L
147.97446 547.45540 L
147.97446 547.45540 L
147.88063 547.54923 L
147.78680 547.64306 L
147.69269 547.73745 L
147.69269 547.73745 L
147.59858 547.73745 L
147.50476 547.64306 L
147.41093 547.54923 L
147.41093 547.45540 L
147.41093 547.36157 L
147.41093 547.26746 L
147.50476 547.17364 L
147.59858 547.17364 L
147.69269 547.17364 L
147.78680 547.17364 L
@c
F
@rax %Note: Object
146.28359 547.17364 146.84740 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
146.65946 547.17364 m
146.65946 547.26746 L
146.75357 547.36157 L
146.84740 547.45540 L
146.84740 547.45540 L
146.75357 547.54923 L
146.65946 547.64306 L
146.56564 547.73745 L
146.56564 547.73745 L
146.47153 547.73745 L
146.37770 547.64306 L
146.28359 547.54923 L
146.28359 547.45540 L
146.28359 547.36157 L
146.28359 547.26746 L
146.37770 547.17364 L
146.47153 547.17364 L
146.56564 547.17364 L
146.65946 547.17364 L
@c
F
@rax %Note: Object
145.15625 547.17364 145.72006 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
145.53213 547.17364 m
145.53213 547.26746 L
145.62624 547.36157 L
145.72006 547.45540 L
145.72006 547.45540 L
145.62624 547.54923 L
145.53213 547.64306 L
145.43830 547.73745 L
145.43830 547.73745 L
145.34419 547.73745 L
145.25008 547.64306 L
145.15625 547.54923 L
145.15625 547.45540 L
145.15625 547.36157 L
145.15625 547.26746 L
145.25008 547.17364 L
145.34419 547.17364 L
145.43830 547.17364 L
145.53213 547.17364 L
@c
F
@rax %Note: Object
144.02920 547.17364 144.59272 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
144.40479 547.17364 m
144.40479 547.26746 L
144.49861 547.36157 L
144.59272 547.45540 L
144.59272 547.45540 L
144.49861 547.54923 L
144.40479 547.64306 L
144.31068 547.73745 L
144.31068 547.73745 L
144.21685 547.73745 L
144.12274 547.64306 L
144.02920 547.54923 L
144.02920 547.45540 L
144.02920 547.36157 L
144.02920 547.26746 L
144.12274 547.17364 L
144.21685 547.17364 L
144.31068 547.17364 L
144.40479 547.17364 L
@c
F
@rax %Note: Object
142.90186 547.17364 143.46539 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
143.27773 547.17364 m
143.27773 547.26746 L
143.37156 547.36157 L
143.46539 547.45540 L
143.46539 547.45540 L
143.37156 547.54923 L
143.27773 547.64306 L
143.18362 547.73745 L
143.18362 547.73745 L
143.08951 547.73745 L
142.99569 547.64306 L
142.90186 547.54923 L
142.90186 547.45540 L
142.90186 547.36157 L
142.90186 547.26746 L
142.99569 547.17364 L
143.08951 547.17364 L
143.18362 547.17364 L
143.27773 547.17364 L
@c
F
@rax %Note: Object
141.77452 547.17364 142.33805 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
142.15011 547.17364 m
142.15011 547.26746 L
142.24422 547.36157 L
142.33805 547.45540 L
142.33805 547.45540 L
142.24422 547.54923 L
142.15011 547.64306 L
142.05600 547.73745 L
142.05600 547.73745 L
141.96217 547.73745 L
141.86835 547.64306 L
141.77452 547.54923 L
141.77452 547.45540 L
141.77452 547.36157 L
141.77452 547.26746 L
141.86835 547.17364 L
141.96217 547.17364 L
142.05600 547.17364 L
142.15011 547.17364 L
@c
F
@rax %Note: Object
140.64718 547.17364 141.21071 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
141.02277 547.17364 m
141.02277 547.26746 L
141.11717 547.36157 L
141.21071 547.45540 L
141.21071 547.45540 L
141.11717 547.54923 L
141.02277 547.64306 L
140.92894 547.73745 L
140.92894 547.73745 L
140.83512 547.73745 L
140.74129 547.64306 L
140.64718 547.54923 L
140.64718 547.45540 L
140.64718 547.36157 L
140.64718 547.26746 L
140.74129 547.17364 L
140.83512 547.17364 L
140.92894 547.17364 L
141.02277 547.17364 L
@c
F
@rax %Note: Object
139.51984 547.17364 140.08365 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
139.89543 547.17364 m
139.89543 547.26746 L
139.98983 547.36157 L
140.08365 547.45540 L
140.08365 547.45540 L
139.98983 547.54923 L
139.89543 547.64306 L
139.80161 547.73745 L
139.80161 547.73745 L
139.70778 547.73745 L
139.61395 547.64306 L
139.51984 547.54923 L
139.51984 547.45540 L
139.51984 547.36157 L
139.51984 547.26746 L
139.61395 547.17364 L
139.70778 547.17364 L
139.80161 547.17364 L
139.89543 547.17364 L
@c
F
@rax %Note: Object
138.39250 547.17364 138.95631 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
138.76809 547.17364 m
138.76809 547.26746 L
138.86220 547.36157 L
138.95631 547.45540 L
138.95631 547.45540 L
138.86220 547.54923 L
138.76809 547.64306 L
138.67427 547.73745 L
138.67427 547.73745 L
138.58044 547.73745 L
138.48633 547.64306 L
138.39250 547.54923 L
138.39250 547.45540 L
138.39250 547.36157 L
138.39250 547.26746 L
138.48633 547.17364 L
138.58044 547.17364 L
138.67427 547.17364 L
138.76809 547.17364 L
@c
F
@rax %Note: Object
137.26545 547.17364 137.82898 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
137.64104 547.17364 m
137.64104 547.26746 L
137.73487 547.36157 L
137.82898 547.45540 L
137.82898 547.45540 L
137.73487 547.54923 L
137.64104 547.64306 L
137.54721 547.73745 L
137.54721 547.73745 L
137.45310 547.73745 L
137.35928 547.64306 L
137.26545 547.54923 L
137.26545 547.45540 L
137.26545 547.36157 L
137.26545 547.26746 L
137.35928 547.17364 L
137.45310 547.17364 L
137.54721 547.17364 L
137.64104 547.17364 L
@c
F
@rax %Note: Object
136.13811 547.17364 136.70164 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
136.51370 547.17364 m
136.51370 547.26746 L
136.60753 547.36157 L
136.70164 547.45540 L
136.70164 547.45540 L
136.60753 547.54923 L
136.51370 547.64306 L
136.41959 547.73745 L
136.41959 547.73745 L
136.32576 547.73745 L
136.23194 547.64306 L
136.13811 547.54923 L
136.13811 547.45540 L
136.13811 547.36157 L
136.13811 547.26746 L
136.23194 547.17364 L
136.32576 547.17364 L
136.41959 547.17364 L
136.51370 547.17364 L
@c
F
@rax %Note: Object
135.01049 547.17364 135.57430 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
135.38636 547.17364 m
135.38636 547.26746 L
135.48019 547.36157 L
135.57430 547.45540 L
135.57430 547.45540 L
135.48019 547.54923 L
135.38636 547.64306 L
135.29254 547.73745 L
135.29254 547.73745 L
135.19871 547.73745 L
135.10488 547.64306 L
135.01049 547.54923 L
135.01049 547.45540 L
135.01049 547.36157 L
135.01049 547.26746 L
135.10488 547.17364 L
135.19871 547.17364 L
135.29254 547.17364 L
135.38636 547.17364 L
@c
F
@rax %Note: Object
133.88315 547.17364 134.44696 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
134.25902 547.17364 m
134.25902 547.26746 L
134.35313 547.36157 L
134.44696 547.45540 L
134.44696 547.45540 L
134.35313 547.54923 L
134.25902 547.64306 L
134.16520 547.73745 L
134.16520 547.73745 L
134.07137 547.73745 L
133.97754 547.64306 L
133.88315 547.54923 L
133.88315 547.45540 L
133.88315 547.36157 L
133.88315 547.26746 L
133.97754 547.17364 L
134.07137 547.17364 L
134.16520 547.17364 L
134.25902 547.17364 L
@c
F
@rax %Note: Object
132.75581 547.17364 133.31962 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
133.13169 547.17364 m
133.13169 547.26746 L
133.22551 547.36157 L
133.31962 547.45540 L
133.31962 547.45540 L
133.22551 547.54923 L
133.13169 547.64306 L
133.03786 547.73745 L
133.03786 547.73745 L
132.94403 547.73745 L
132.84992 547.64306 L
132.75581 547.54923 L
132.75581 547.45540 L
132.75581 547.36157 L
132.75581 547.26746 L
132.84992 547.17364 L
132.94403 547.17364 L
133.03786 547.17364 L
133.13169 547.17364 L
@c
F
@rax %Note: Object
131.62876 547.17364 132.19228 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
132.00463 547.17364 m
132.00463 547.26746 L
132.09846 547.36157 L
132.19228 547.45540 L
132.19228 547.45540 L
132.09846 547.54923 L
132.00463 547.64306 L
131.91080 547.73745 L
131.91080 547.73745 L
131.81669 547.73745 L
131.72258 547.64306 L
131.62876 547.54923 L
131.62876 547.45540 L
131.62876 547.36157 L
131.62876 547.26746 L
131.72258 547.17364 L
131.81669 547.17364 L
131.91080 547.17364 L
132.00463 547.17364 L
@c
F
@rax %Note: Object
130.50142 547.17364 131.06494 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
130.87729 547.17364 m
130.87729 547.26746 L
130.97112 547.36157 L
131.06494 547.45540 L
131.06494 547.45540 L
130.97112 547.54923 L
130.87729 547.64306 L
130.78318 547.73745 L
130.78318 547.73745 L
130.68935 547.73745 L
130.59524 547.64306 L
130.50142 547.54923 L
130.50142 547.45540 L
130.50142 547.36157 L
130.50142 547.26746 L
130.59524 547.17364 L
130.68935 547.17364 L
130.78318 547.17364 L
130.87729 547.17364 L
@c
F
@rax %Note: Object
129.37408 547.17364 129.93761 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
129.74995 547.17364 m
129.74995 547.26746 L
129.84378 547.36157 L
129.93761 547.45540 L
129.93761 547.45540 L
129.84378 547.54923 L
129.74995 547.64306 L
129.65584 547.73745 L
129.65584 547.73745 L
129.56230 547.73745 L
129.46819 547.64306 L
129.37408 547.54923 L
129.37408 547.45540 L
129.37408 547.36157 L
129.37408 547.26746 L
129.46819 547.17364 L
129.56230 547.17364 L
129.65584 547.17364 L
129.74995 547.17364 L
@c
F
@rax %Note: Object
128.24674 547.17364 128.81055 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.62261 547.17364 m
128.62261 547.26746 L
128.71672 547.36157 L
128.81055 547.45540 L
128.81055 547.45540 L
128.71672 547.54923 L
128.62261 547.64306 L
128.52879 547.73745 L
128.52879 547.73745 L
128.43468 547.73745 L
128.34085 547.64306 L
128.24674 547.54923 L
128.24674 547.45540 L
128.24674 547.36157 L
128.24674 547.26746 L
128.34085 547.17364 L
128.43468 547.17364 L
128.52879 547.17364 L
128.62261 547.17364 L
@c
F
@rax %Note: Object
127.11940 547.17364 127.68321 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
127.49528 547.17364 m
127.49528 547.26746 L
127.58910 547.36157 L
127.68321 547.45540 L
127.68321 547.45540 L
127.58910 547.54923 L
127.49528 547.64306 L
127.40145 547.73745 L
127.40145 547.73745 L
127.30734 547.73745 L
127.21323 547.64306 L
127.11940 547.54923 L
127.11940 547.45540 L
127.11940 547.36157 L
127.11940 547.26746 L
127.21323 547.17364 L
127.30734 547.17364 L
127.40145 547.17364 L
127.49528 547.17364 L
@c
F
@rax %Note: Object
125.99235 547.17364 126.55587 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
126.36822 547.17364 m
126.36822 547.26746 L
126.46205 547.36157 L
126.55587 547.45540 L
126.55587 547.45540 L
126.46205 547.54923 L
126.36822 547.64306 L
126.27411 547.73745 L
126.27411 547.73745 L
126.18000 547.73745 L
126.08617 547.64306 L
125.99235 547.54923 L
125.99235 547.45540 L
125.99235 547.36157 L
125.99235 547.26746 L
126.08617 547.17364 L
126.18000 547.17364 L
126.27411 547.17364 L
126.36822 547.17364 L
@c
F
@rax %Note: Object
124.86501 547.17364 125.42854 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
125.24088 547.17364 m
125.24088 547.26746 L
125.33471 547.36157 L
125.42854 547.45540 L
125.42854 547.45540 L
125.33471 547.54923 L
125.24088 547.64306 L
125.14677 547.73745 L
125.14677 547.73745 L
125.05266 547.73745 L
124.95883 547.64306 L
124.86501 547.54923 L
124.86501 547.45540 L
124.86501 547.36157 L
124.86501 547.26746 L
124.95883 547.17364 L
125.05266 547.17364 L
125.14677 547.17364 L
125.24088 547.17364 L
@c
F
@rax %Note: Object
123.73767 547.17364 124.30120 547.73745 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 547.36157 m
124.30120 547.45540 L
124.20737 547.54923 L
124.11354 547.64306 L
124.01915 547.73745 L
124.01915 547.73745 L
123.92532 547.64306 L
123.83150 547.54923 L
123.73767 547.45540 L
123.73767 547.45540 L
123.73767 547.45540 L
123.83150 547.36157 L
123.92532 547.26746 L
124.01915 547.17364 L
124.01915 547.17364 L
124.11354 547.26746 L
124.20737 547.36157 L
124.30120 547.36157 L
@c
F
@rax %Note: Object
123.73767 546.04630 124.30120 546.61011 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 546.23424 m
124.30120 546.32806 L
124.20737 546.42189 L
124.11354 546.51572 L
124.01915 546.61011 L
124.01915 546.61011 L
123.92532 546.51572 L
123.83150 546.42189 L
123.73767 546.32806 L
123.73767 546.32806 L
123.73767 546.32806 L
123.83150 546.23424 L
123.92532 546.14013 L
124.01915 546.04630 L
124.01915 546.04630 L
124.11354 546.14013 L
124.20737 546.23424 L
124.30120 546.23424 L
@c
F
@rax %Note: Object
123.73767 544.91896 124.30120 545.48249 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 545.10690 m
124.30120 545.20072 L
124.20737 545.29483 L
124.11354 545.38866 L
124.01915 545.48249 L
124.01915 545.48249 L
123.92532 545.38866 L
123.83150 545.29483 L
123.73767 545.20072 L
123.73767 545.20072 L
123.73767 545.20072 L
123.83150 545.10690 L
123.92532 545.01307 L
124.01915 544.91896 L
124.01915 544.91896 L
124.11354 545.01307 L
124.20737 545.10690 L
124.30120 545.10690 L
@c
F
@rax %Note: Object
123.73767 543.79162 124.30120 544.35515 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 543.97956 m
124.30120 544.07339 L
124.20737 544.16750 L
124.11354 544.26132 L
124.01915 544.35515 L
124.01915 544.35515 L
123.92532 544.26132 L
123.83150 544.16750 L
123.73767 544.07339 L
123.73767 544.07339 L
123.73767 544.07339 L
123.83150 543.97956 L
123.92532 543.88573 L
124.01915 543.79162 L
124.01915 543.79162 L
124.11354 543.88573 L
124.20737 543.97956 L
124.30120 543.97956 L
@c
F
@rax %Note: Object
123.73767 542.66428 124.30120 543.22781 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 542.85250 m
124.30120 542.94633 L
124.20737 543.04016 L
124.11354 543.13398 L
124.01915 543.22781 L
124.01915 543.22781 L
123.92532 543.13398 L
123.83150 543.04016 L
123.73767 542.94633 L
123.73767 542.94633 L
123.73767 542.94633 L
123.83150 542.85250 L
123.92532 542.75839 L
124.01915 542.66428 L
124.01915 542.66428 L
124.11354 542.75839 L
124.20737 542.85250 L
124.30120 542.85250 L
@c
F
@rax %Note: Object
123.73767 541.53694 124.30120 542.10076 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 541.72517 m
124.30120 541.81899 L
124.20737 541.91282 L
124.11354 542.00665 L
124.01915 542.10076 L
124.01915 542.10076 L
123.92532 542.00665 L
123.83150 541.91282 L
123.73767 541.81899 L
123.73767 541.81899 L
123.73767 541.81899 L
123.83150 541.72517 L
123.92532 541.63077 L
124.01915 541.53694 L
124.01915 541.53694 L
124.11354 541.63077 L
124.20737 541.72517 L
124.30120 541.72517 L
@c
F
@rax %Note: Object
123.73767 540.40961 124.30120 540.97342 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 540.59783 m
124.30120 540.69165 L
124.20737 540.78548 L
124.11354 540.87931 L
124.01915 540.97342 L
124.01915 540.97342 L
123.92532 540.87931 L
123.83150 540.78548 L
123.73767 540.69165 L
123.73767 540.69165 L
123.73767 540.69165 L
123.83150 540.59783 L
123.92532 540.50343 L
124.01915 540.40961 L
124.01915 540.40961 L
124.11354 540.50343 L
124.20737 540.59783 L
124.30120 540.59783 L
@c
F
@rax %Note: Object
123.73767 539.28255 124.30120 539.84608 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 539.47049 m
124.30120 539.56460 L
124.20737 539.65843 L
124.11354 539.75225 L
124.01915 539.84608 L
124.01915 539.84608 L
123.92532 539.75225 L
123.83150 539.65843 L
123.73767 539.56460 L
123.73767 539.56460 L
123.73767 539.56460 L
123.83150 539.47049 L
123.92532 539.37638 L
124.01915 539.28255 L
124.01915 539.28255 L
124.11354 539.37638 L
124.20737 539.47049 L
124.30120 539.47049 L
@c
F
@rax %Note: Object
123.73767 538.15521 124.30120 538.71874 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 538.34287 m
124.30120 538.43698 L
124.20737 538.53109 L
124.11354 538.62491 L
124.01915 538.71874 L
124.01915 538.71874 L
123.92532 538.62491 L
123.83150 538.53109 L
123.73767 538.43698 L
123.73767 538.43698 L
123.73767 538.43698 L
123.83150 538.34287 L
123.92532 538.24904 L
124.01915 538.15521 L
124.01915 538.15521 L
124.11354 538.24904 L
124.20737 538.34287 L
124.30120 538.34287 L
@c
F
@rax %Note: Object
123.73767 537.02787 124.30120 537.59140 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 537.21553 m
124.30120 537.30964 L
124.20737 537.40375 L
124.11354 537.49757 L
124.01915 537.59140 L
124.01915 537.59140 L
123.92532 537.49757 L
123.83150 537.40375 L
123.73767 537.30964 L
123.73767 537.30964 L
123.73767 537.30964 L
123.83150 537.21553 L
123.92532 537.12198 L
124.01915 537.02787 L
124.01915 537.02787 L
124.11354 537.12198 L
124.20737 537.21553 L
124.30120 537.21553 L
@c
F
@rax %Note: Object
123.73767 535.90054 124.30120 536.46435 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 536.08847 m
124.30120 536.18258 L
124.20737 536.27641 L
124.11354 536.37024 L
124.01915 536.46435 L
124.01915 536.46435 L
123.92532 536.37024 L
123.83150 536.27641 L
123.73767 536.18258 L
123.73767 536.18258 L
123.73767 536.18258 L
123.83150 536.08847 L
123.92532 535.99436 L
124.01915 535.90054 L
124.01915 535.90054 L
124.11354 535.99436 L
124.20737 536.08847 L
124.30120 536.08847 L
@c
F
@rax %Note: Object
123.73767 534.77320 124.30120 535.33701 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 534.96113 m
124.30120 535.05496 L
124.20737 535.14907 L
124.11354 535.24290 L
124.01915 535.33701 L
124.01915 535.33701 L
123.92532 535.24290 L
123.83150 535.14907 L
123.73767 535.05496 L
123.73767 535.05496 L
123.73767 535.05496 L
123.83150 534.96113 L
123.92532 534.86702 L
124.01915 534.77320 L
124.01915 534.77320 L
124.11354 534.86702 L
124.20737 534.96113 L
124.30120 534.96113 L
@c
F
@rax %Note: Object
123.73767 533.64614 124.30120 534.20967 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 533.83380 m
124.30120 533.92791 L
124.20737 534.02202 L
124.11354 534.11584 L
124.01915 534.20967 L
124.01915 534.20967 L
123.92532 534.11584 L
123.83150 534.02202 L
123.73767 533.92791 L
123.73767 533.92791 L
123.73767 533.92791 L
123.83150 533.83380 L
123.92532 533.73997 L
124.01915 533.64614 L
124.01915 533.64614 L
124.11354 533.73997 L
124.20737 533.83380 L
124.30120 533.83380 L
@c
F
@rax %Note: Object
123.73767 532.51880 124.30120 533.08233 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 532.70646 m
124.30120 532.80028 L
124.20737 532.89468 L
124.11354 532.98850 L
124.01915 533.08233 L
124.01915 533.08233 L
123.92532 532.98850 L
123.83150 532.89468 L
123.73767 532.80028 L
123.73767 532.80028 L
123.73767 532.80028 L
123.83150 532.70646 L
123.92532 532.61263 L
124.01915 532.51880 L
124.01915 532.51880 L
124.11354 532.61263 L
124.20737 532.70646 L
124.30120 532.70646 L
@c
F
@rax %Note: Object
123.73767 531.39146 124.30120 531.95499 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 531.57912 m
124.30120 531.67294 L
124.20737 531.76706 L
124.11354 531.86117 L
124.01915 531.95499 L
124.01915 531.95499 L
123.92532 531.86117 L
123.83150 531.76706 L
123.73767 531.67294 L
123.73767 531.67294 L
123.73767 531.67294 L
123.83150 531.57912 L
123.92532 531.48529 L
124.01915 531.39146 L
124.01915 531.39146 L
124.11354 531.48529 L
124.20737 531.57912 L
124.30120 531.57912 L
@c
F
@rax %Note: Object
123.73767 530.26413 124.30120 530.82794 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 530.45206 m
124.30120 530.54589 L
124.20737 530.63972 L
124.11354 530.73383 L
124.01915 530.82794 L
124.01915 530.82794 L
123.92532 530.73383 L
123.83150 530.63972 L
123.73767 530.54589 L
123.73767 530.54589 L
123.73767 530.54589 L
123.83150 530.45206 L
123.92532 530.35795 L
124.01915 530.26413 L
124.01915 530.26413 L
124.11354 530.35795 L
124.20737 530.45206 L
124.30120 530.45206 L
@c
F
@rax %Note: Object
123.73767 529.13679 124.30120 529.70060 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 529.32472 m
124.30120 529.41855 L
124.20737 529.51238 L
124.11354 529.60649 L
124.01915 529.70060 L
124.01915 529.70060 L
123.92532 529.60649 L
123.83150 529.51238 L
123.73767 529.41855 L
123.73767 529.41855 L
123.73767 529.41855 L
123.83150 529.32472 L
123.92532 529.23061 L
124.01915 529.13679 L
124.01915 529.13679 L
124.11354 529.23061 L
124.20737 529.32472 L
124.30120 529.32472 L
@c
F
@rax %Note: Object
123.73767 528.00973 124.30120 528.57326 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 528.19739 m
124.30120 528.29150 L
124.20737 528.38532 L
124.11354 528.47915 L
124.01915 528.57326 L
124.01915 528.57326 L
123.92532 528.47915 L
123.83150 528.38532 L
123.73767 528.29150 L
123.73767 528.29150 L
123.73767 528.29150 L
123.83150 528.19739 L
123.92532 528.10356 L
124.01915 528.00973 L
124.01915 528.00973 L
124.11354 528.10356 L
124.20737 528.19739 L
124.30120 528.19739 L
@c
F
@rax %Note: Object
123.73767 526.88239 124.30120 527.44592 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 527.07005 m
124.30120 527.16387 L
124.20737 527.25798 L
124.11354 527.35181 L
124.01915 527.44592 L
124.01915 527.44592 L
123.92532 527.35181 L
123.83150 527.25798 L
123.73767 527.16387 L
123.73767 527.16387 L
123.73767 527.16387 L
123.83150 527.07005 L
123.92532 526.97622 L
124.01915 526.88239 L
124.01915 526.88239 L
124.11354 526.97622 L
124.20737 527.07005 L
124.30120 527.07005 L
@c
F
@rax %Note: Object
123.73767 525.75477 124.30120 526.31858 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 525.94271 m
124.30120 526.03654 L
124.20737 526.13065 L
124.11354 526.22447 L
124.01915 526.31858 L
124.01915 526.31858 L
123.92532 526.22447 L
123.83150 526.13065 L
123.73767 526.03654 L
123.73767 526.03654 L
123.73767 526.03654 L
123.83150 525.94271 L
123.92532 525.84888 L
124.01915 525.75477 L
124.01915 525.75477 L
124.11354 525.84888 L
124.20737 525.94271 L
124.30120 525.94271 L
@c
F
@rax %Note: Object
123.73767 524.62743 124.30120 525.19124 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 524.81565 m
124.30120 524.90948 L
124.20737 525.00331 L
124.11354 525.09742 L
124.01915 525.19124 L
124.01915 525.19124 L
123.92532 525.09742 L
123.83150 525.00331 L
123.73767 524.90948 L
123.73767 524.90948 L
123.73767 524.90948 L
123.83150 524.81565 L
123.92532 524.72154 L
124.01915 524.62743 L
124.01915 524.62743 L
124.11354 524.72154 L
124.20737 524.81565 L
124.30120 524.81565 L
@c
F
@rax %Note: Object
123.73767 523.50009 124.30120 524.06391 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 523.68831 m
124.30120 523.78214 L
124.20737 523.87597 L
124.11354 523.96980 L
124.01915 524.06391 L
124.01915 524.06391 L
123.92532 523.96980 L
123.83150 523.87597 L
123.73767 523.78214 L
123.73767 523.78214 L
123.73767 523.78214 L
123.83150 523.68831 L
123.92532 523.59420 L
124.01915 523.50009 L
124.01915 523.50009 L
124.11354 523.59420 L
124.20737 523.68831 L
124.30120 523.68831 L
@c
F
@rax %Note: Object
123.73767 522.37304 124.30120 522.93657 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 522.56098 m
124.30120 522.65509 L
124.20737 522.74863 L
124.11354 522.84246 L
124.01915 522.93657 L
124.01915 522.93657 L
123.92532 522.84246 L
123.83150 522.74863 L
123.73767 522.65509 L
123.73767 522.65509 L
123.73767 522.65509 L
123.83150 522.56098 L
123.92532 522.46687 L
124.01915 522.37304 L
124.01915 522.37304 L
124.11354 522.46687 L
124.20737 522.56098 L
124.30120 522.56098 L
@c
F
@rax %Note: Object
123.73767 521.24570 124.30120 521.80923 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 521.43364 m
124.30120 521.52746 L
124.20737 521.62157 L
124.11354 521.71540 L
124.01915 521.80923 L
124.01915 521.80923 L
123.92532 521.71540 L
123.83150 521.62157 L
123.73767 521.52746 L
123.73767 521.52746 L
123.73767 521.52746 L
123.83150 521.43364 L
123.92532 521.33953 L
124.01915 521.24570 L
124.01915 521.24570 L
124.11354 521.33953 L
124.20737 521.43364 L
124.30120 521.43364 L
@c
F
@rax %Note: Object
123.73767 520.11836 124.30120 520.68189 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 520.30630 m
124.30120 520.40013 L
124.20737 520.49424 L
124.11354 520.58806 L
124.01915 520.68189 L
124.01915 520.68189 L
123.92532 520.58806 L
123.83150 520.49424 L
123.73767 520.40013 L
123.73767 520.40013 L
123.73767 520.40013 L
123.83150 520.30630 L
123.92532 520.21219 L
124.01915 520.11836 L
124.01915 520.11836 L
124.11354 520.21219 L
124.20737 520.30630 L
124.30120 520.30630 L
@c
F
@rax %Note: Object
123.73767 518.99102 124.30120 519.55483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 519.17896 m
124.30120 519.27307 L
124.20737 519.36690 L
124.11354 519.46101 L
124.01915 519.55483 L
124.01915 519.55483 L
123.92532 519.46101 L
123.83150 519.36690 L
123.73767 519.27307 L
123.73767 519.27307 L
123.73767 519.27307 L
123.83150 519.17896 L
123.92532 519.08485 L
124.01915 518.99102 L
124.01915 518.99102 L
124.11354 519.08485 L
124.20737 519.17896 L
124.30120 519.17896 L
@c
F
@rax %Note: Object
123.73767 517.86369 124.30120 518.42750 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 518.05162 m
124.30120 518.14573 L
124.20737 518.23956 L
124.11354 518.33339 L
124.01915 518.42750 L
124.01915 518.42750 L
123.92532 518.33339 L
123.83150 518.23956 L
123.73767 518.14573 L
123.73767 518.14573 L
123.73767 518.14573 L
123.83150 518.05162 L
123.92532 517.95751 L
124.01915 517.86369 L
124.01915 517.86369 L
124.11354 517.95751 L
124.20737 518.05162 L
124.30120 518.05162 L
@c
F
@rax %Note: Object
123.73767 516.73663 124.30120 517.30016 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 516.92428 m
124.30120 517.01839 L
124.20737 517.11222 L
124.11354 517.20605 L
124.01915 517.30016 L
124.01915 517.30016 L
123.92532 517.20605 L
123.83150 517.11222 L
123.73767 517.01839 L
123.73767 517.01839 L
123.73767 517.01839 L
123.83150 516.92428 L
123.92532 516.83046 L
124.01915 516.73663 L
124.01915 516.73663 L
124.11354 516.83046 L
124.20737 516.92428 L
124.30120 516.92428 L
@c
F
@rax %Note: Object
123.73767 515.60929 124.30120 516.17282 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 515.79694 m
124.30120 515.89106 L
124.20737 515.98517 L
124.11354 516.07899 L
124.01915 516.17282 L
124.01915 516.17282 L
123.92532 516.07899 L
123.83150 515.98517 L
123.73767 515.89106 L
123.73767 515.89106 L
123.73767 515.89106 L
123.83150 515.79694 L
123.92532 515.70312 L
124.01915 515.60929 L
124.01915 515.60929 L
124.11354 515.70312 L
124.20737 515.79694 L
124.30120 515.79694 L
@c
F
@rax %Note: Object
123.73767 514.48195 124.30120 515.04548 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 514.66961 m
124.30120 514.76343 L
124.20737 514.85783 L
124.11354 514.95165 L
124.01915 515.04548 L
124.01915 515.04548 L
123.92532 514.95165 L
123.83150 514.85783 L
123.73767 514.76343 L
123.73767 514.76343 L
123.73767 514.76343 L
123.83150 514.66961 L
123.92532 514.57578 L
124.01915 514.48195 L
124.01915 514.48195 L
124.11354 514.57578 L
124.20737 514.66961 L
124.30120 514.66961 L
@c
F
@rax %Note: Object
123.73767 513.35461 124.30120 513.91843 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 513.54255 m
124.30120 513.63638 L
124.20737 513.73049 L
124.11354 513.82460 L
124.01915 513.91843 L
124.01915 513.91843 L
123.92532 513.82460 L
123.83150 513.73049 L
123.73767 513.63638 L
123.73767 513.63638 L
123.73767 513.63638 L
123.83150 513.54255 L
123.92532 513.44844 L
124.01915 513.35461 L
124.01915 513.35461 L
124.11354 513.44844 L
124.20737 513.54255 L
124.30120 513.54255 L
@c
F
@rax %Note: Object
123.73767 512.22728 124.30120 512.79109 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 512.41521 m
124.30120 512.50904 L
124.20737 512.60287 L
124.11354 512.69698 L
124.01915 512.79109 L
124.01915 512.79109 L
123.92532 512.69698 L
123.83150 512.60287 L
123.73767 512.50904 L
123.73767 512.50904 L
123.73767 512.50904 L
123.83150 512.41521 L
123.92532 512.32110 L
124.01915 512.22728 L
124.01915 512.22728 L
124.11354 512.32110 L
124.20737 512.41521 L
124.30120 512.41521 L
@c
F
@rax %Note: Object
262.48961 544.44926 268.31395 550.36743 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
262.48961 544.44926 m
268.31395 547.45540 L
262.48961 550.36743 L
262.48961 544.44926 L
@c
F
@rax %Note: Object
236.46784 673.43131 237.03137 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
236.84343 673.43131 m
236.84343 673.52513 L
236.93754 673.61896 L
237.03137 673.71307 L
237.03137 673.71307 L
236.93754 673.80690 L
236.84343 673.90072 L
236.74961 673.99483 L
236.74961 673.99483 L
236.65550 673.99483 L
236.56167 673.90072 L
236.46784 673.80690 L
236.46784 673.71307 L
236.46784 673.61896 L
236.46784 673.52513 L
236.56167 673.43131 L
236.65550 673.43131 L
236.74961 673.43131 L
236.84343 673.43131 L
@c
F
@rax %Note: Object
235.34050 673.43131 235.90403 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
235.71609 673.43131 m
235.71609 673.52513 L
235.80992 673.61896 L
235.90403 673.71307 L
235.90403 673.71307 L
235.80992 673.80690 L
235.71609 673.90072 L
235.62227 673.99483 L
235.62227 673.99483 L
235.52816 673.99483 L
235.43433 673.90072 L
235.34050 673.80690 L
235.34050 673.71307 L
235.34050 673.61896 L
235.34050 673.52513 L
235.43433 673.43131 L
235.52816 673.43131 L
235.62227 673.43131 L
235.71609 673.43131 L
@c
F
@rax %Note: Object
234.21317 673.43131 234.77669 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
234.58876 673.43131 m
234.58876 673.52513 L
234.68258 673.61896 L
234.77669 673.71307 L
234.77669 673.71307 L
234.68258 673.80690 L
234.58876 673.90072 L
234.49465 673.99483 L
234.49465 673.99483 L
234.40082 673.99483 L
234.30699 673.90072 L
234.21317 673.80690 L
234.21317 673.71307 L
234.21317 673.61896 L
234.21317 673.52513 L
234.30699 673.43131 L
234.40082 673.43131 L
234.49465 673.43131 L
234.58876 673.43131 L
@c
F
@rax %Note: Object
233.08554 673.43131 233.64935 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
233.46142 673.43131 m
233.46142 673.52513 L
233.55553 673.61896 L
233.64935 673.71307 L
233.64935 673.71307 L
233.55553 673.80690 L
233.46142 673.90072 L
233.36759 673.99483 L
233.36759 673.99483 L
233.27376 673.99483 L
233.17994 673.90072 L
233.08554 673.80690 L
233.08554 673.71307 L
233.08554 673.61896 L
233.08554 673.52513 L
233.17994 673.43131 L
233.27376 673.43131 L
233.36759 673.43131 L
233.46142 673.43131 L
@c
F
@rax %Note: Object
231.95820 673.43131 232.52202 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
232.33408 673.43131 m
232.33408 673.52513 L
232.42819 673.61896 L
232.52202 673.71307 L
232.52202 673.71307 L
232.42819 673.80690 L
232.33408 673.90072 L
232.24025 673.99483 L
232.24025 673.99483 L
232.14643 673.99483 L
232.05260 673.90072 L
231.95820 673.80690 L
231.95820 673.71307 L
231.95820 673.61896 L
231.95820 673.52513 L
232.05260 673.43131 L
232.14643 673.43131 L
232.24025 673.43131 L
232.33408 673.43131 L
@c
F
@rax %Note: Object
230.83115 673.43131 231.39468 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
231.20702 673.43131 m
231.20702 673.52513 L
231.30057 673.61896 L
231.39468 673.71307 L
231.39468 673.71307 L
231.30057 673.80690 L
231.20702 673.90072 L
231.11320 673.99483 L
231.11320 673.99483 L
231.01909 673.99483 L
230.92526 673.90072 L
230.83115 673.80690 L
230.83115 673.71307 L
230.83115 673.61896 L
230.83115 673.52513 L
230.92526 673.43131 L
231.01909 673.43131 L
231.11320 673.43131 L
231.20702 673.43131 L
@c
F
@rax %Note: Object
229.70381 673.43131 230.26734 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
230.07969 673.43131 m
230.07969 673.52513 L
230.17351 673.61896 L
230.26734 673.71307 L
230.26734 673.71307 L
230.17351 673.80690 L
230.07969 673.90072 L
229.98586 673.99483 L
229.98586 673.99483 L
229.89175 673.99483 L
229.79764 673.90072 L
229.70381 673.80690 L
229.70381 673.71307 L
229.70381 673.61896 L
229.70381 673.52513 L
229.79764 673.43131 L
229.89175 673.43131 L
229.98586 673.43131 L
230.07969 673.43131 L
@c
F
@rax %Note: Object
228.57647 673.43131 229.14000 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
228.95235 673.43131 m
228.95235 673.52513 L
229.04617 673.61896 L
229.14000 673.71307 L
229.14000 673.71307 L
229.04617 673.80690 L
228.95235 673.90072 L
228.85824 673.99483 L
228.85824 673.99483 L
228.76441 673.99483 L
228.67030 673.90072 L
228.57647 673.80690 L
228.57647 673.71307 L
228.57647 673.61896 L
228.57647 673.52513 L
228.67030 673.43131 L
228.76441 673.43131 L
228.85824 673.43131 L
228.95235 673.43131 L
@c
F
@rax %Note: Object
227.44913 673.43131 228.01294 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
227.82501 673.43131 m
227.82501 673.52513 L
227.91912 673.61896 L
228.01294 673.71307 L
228.01294 673.71307 L
227.91912 673.80690 L
227.82501 673.90072 L
227.73118 673.99483 L
227.73118 673.99483 L
227.63735 673.99483 L
227.54324 673.90072 L
227.44913 673.80690 L
227.44913 673.71307 L
227.44913 673.61896 L
227.44913 673.52513 L
227.54324 673.43131 L
227.63735 673.43131 L
227.73118 673.43131 L
227.82501 673.43131 L
@c
F
@rax %Note: Object
226.32180 673.43131 226.88561 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
226.69767 673.43131 m
226.69767 673.52513 L
226.79178 673.61896 L
226.88561 673.71307 L
226.88561 673.71307 L
226.79178 673.80690 L
226.69767 673.90072 L
226.60384 673.99483 L
226.60384 673.99483 L
226.50973 673.99483 L
226.41591 673.90072 L
226.32180 673.80690 L
226.32180 673.71307 L
226.32180 673.61896 L
226.32180 673.52513 L
226.41591 673.43131 L
226.50973 673.43131 L
226.60384 673.43131 L
226.69767 673.43131 L
@c
F
@rax %Note: Object
225.19474 673.43131 225.75827 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
225.57033 673.43131 m
225.57033 673.52513 L
225.66416 673.61896 L
225.75827 673.71307 L
225.75827 673.71307 L
225.66416 673.80690 L
225.57033 673.90072 L
225.47650 673.99483 L
225.47650 673.99483 L
225.38239 673.99483 L
225.28857 673.90072 L
225.19474 673.80690 L
225.19474 673.71307 L
225.19474 673.61896 L
225.19474 673.52513 L
225.28857 673.43131 L
225.38239 673.43131 L
225.47650 673.43131 L
225.57033 673.43131 L
@c
F
@rax %Note: Object
224.06740 673.43131 224.63093 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
224.44328 673.43131 m
224.44328 673.52513 L
224.53710 673.61896 L
224.63093 673.71307 L
224.63093 673.71307 L
224.53710 673.80690 L
224.44328 673.90072 L
224.34945 673.99483 L
224.34945 673.99483 L
224.25506 673.99483 L
224.16123 673.90072 L
224.06740 673.80690 L
224.06740 673.71307 L
224.06740 673.61896 L
224.06740 673.52513 L
224.16123 673.43131 L
224.25506 673.43131 L
224.34945 673.43131 L
224.44328 673.43131 L
@c
F
@rax %Note: Object
222.94006 673.43131 223.50359 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
223.31594 673.43131 m
223.31594 673.52513 L
223.40976 673.61896 L
223.50359 673.71307 L
223.50359 673.71307 L
223.40976 673.80690 L
223.31594 673.90072 L
223.22183 673.99483 L
223.22183 673.99483 L
223.12772 673.99483 L
223.03389 673.90072 L
222.94006 673.80690 L
222.94006 673.71307 L
222.94006 673.61896 L
222.94006 673.52513 L
223.03389 673.43131 L
223.12772 673.43131 L
223.22183 673.43131 L
223.31594 673.43131 L
@c
F
@rax %Note: Object
221.81272 673.43131 222.37654 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
222.18860 673.43131 m
222.18860 673.52513 L
222.28271 673.61896 L
222.37654 673.71307 L
222.37654 673.71307 L
222.28271 673.80690 L
222.18860 673.90072 L
222.09449 673.99483 L
222.09449 673.99483 L
222.00066 673.99483 L
221.90683 673.90072 L
221.81272 673.80690 L
221.81272 673.71307 L
221.81272 673.61896 L
221.81272 673.52513 L
221.90683 673.43131 L
222.00066 673.43131 L
222.09449 673.43131 L
222.18860 673.43131 L
@c
F
@rax %Note: Object
220.68539 673.43131 221.24920 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
221.06126 673.43131 m
221.06126 673.52513 L
221.15537 673.61896 L
221.24920 673.71307 L
221.24920 673.71307 L
221.15537 673.80690 L
221.06126 673.90072 L
220.96715 673.99483 L
220.96715 673.99483 L
220.87332 673.99483 L
220.77950 673.90072 L
220.68539 673.80690 L
220.68539 673.71307 L
220.68539 673.61896 L
220.68539 673.52513 L
220.77950 673.43131 L
220.87332 673.43131 L
220.96715 673.43131 L
221.06126 673.43131 L
@c
F
@rax %Note: Object
219.55833 673.43131 220.12186 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
219.93392 673.43131 m
219.93392 673.52513 L
220.02775 673.61896 L
220.12186 673.71307 L
220.12186 673.71307 L
220.02775 673.80690 L
219.93392 673.90072 L
219.83981 673.99483 L
219.83981 673.99483 L
219.74598 673.99483 L
219.65187 673.90072 L
219.55833 673.80690 L
219.55833 673.71307 L
219.55833 673.61896 L
219.55833 673.52513 L
219.65187 673.43131 L
219.74598 673.43131 L
219.83981 673.43131 L
219.93392 673.43131 L
@c
F
@rax %Note: Object
218.43099 673.43131 218.99452 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
218.80658 673.43131 m
218.80658 673.52513 L
218.90069 673.61896 L
218.99452 673.71307 L
218.99452 673.71307 L
218.90069 673.80690 L
218.80658 673.90072 L
218.71276 673.99483 L
218.71276 673.99483 L
218.61865 673.99483 L
218.52482 673.90072 L
218.43099 673.80690 L
218.43099 673.71307 L
218.43099 673.61896 L
218.43099 673.52513 L
218.52482 673.43131 L
218.61865 673.43131 L
218.71276 673.43131 L
218.80658 673.43131 L
@c
F
@rax %Note: Object
217.30365 673.43131 217.86718 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
217.67924 673.43131 m
217.67924 673.52513 L
217.77335 673.61896 L
217.86718 673.71307 L
217.86718 673.71307 L
217.77335 673.80690 L
217.67924 673.90072 L
217.58542 673.99483 L
217.58542 673.99483 L
217.49131 673.99483 L
217.39748 673.90072 L
217.30365 673.80690 L
217.30365 673.71307 L
217.30365 673.61896 L
217.30365 673.52513 L
217.39748 673.43131 L
217.49131 673.43131 L
217.58542 673.43131 L
217.67924 673.43131 L
@c
F
@rax %Note: Object
216.17631 673.43131 216.73984 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
216.55191 673.43131 m
216.55191 673.52513 L
216.64602 673.61896 L
216.73984 673.71307 L
216.73984 673.71307 L
216.64602 673.80690 L
216.55191 673.90072 L
216.45808 673.99483 L
216.45808 673.99483 L
216.36425 673.99483 L
216.27043 673.90072 L
216.17631 673.80690 L
216.17631 673.71307 L
216.17631 673.61896 L
216.17631 673.52513 L
216.27043 673.43131 L
216.36425 673.43131 L
216.45808 673.43131 L
216.55191 673.43131 L
@c
F
@rax %Note: Object
215.04898 673.43131 215.61279 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
215.42457 673.43131 m
215.42457 673.52513 L
215.51868 673.61896 L
215.61279 673.71307 L
215.61279 673.71307 L
215.51868 673.80690 L
215.42457 673.90072 L
215.33074 673.99483 L
215.33074 673.99483 L
215.23691 673.99483 L
215.14309 673.90072 L
215.04898 673.80690 L
215.04898 673.71307 L
215.04898 673.61896 L
215.04898 673.52513 L
215.14309 673.43131 L
215.23691 673.43131 L
215.33074 673.43131 L
215.42457 673.43131 L
@c
F
@rax %Note: Object
213.92164 673.43131 214.48545 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
214.29723 673.43131 m
214.29723 673.52513 L
214.39106 673.61896 L
214.48545 673.71307 L
214.48545 673.71307 L
214.39106 673.80690 L
214.29723 673.90072 L
214.20340 673.99483 L
214.20340 673.99483 L
214.10957 673.99483 L
214.01546 673.90072 L
213.92164 673.80690 L
213.92164 673.71307 L
213.92164 673.61896 L
213.92164 673.52513 L
214.01546 673.43131 L
214.10957 673.43131 L
214.20340 673.43131 L
214.29723 673.43131 L
@c
F
@rax %Note: Object
212.79430 673.43131 213.35783 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
213.17017 673.43131 m
213.17017 673.52513 L
213.26400 673.61896 L
213.35783 673.71307 L
213.35783 673.71307 L
213.26400 673.80690 L
213.17017 673.90072 L
213.07635 673.99483 L
213.07635 673.99483 L
212.98224 673.99483 L
212.88841 673.90072 L
212.79430 673.80690 L
212.79430 673.71307 L
212.79430 673.61896 L
212.79430 673.52513 L
212.88841 673.43131 L
212.98224 673.43131 L
213.07635 673.43131 L
213.17017 673.43131 L
@c
F
@rax %Note: Object
211.66696 673.43131 212.23049 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
212.04283 673.43131 m
212.04283 673.52513 L
212.13666 673.61896 L
212.23049 673.71307 L
212.23049 673.71307 L
212.13666 673.80690 L
212.04283 673.90072 L
211.94901 673.99483 L
211.94901 673.99483 L
211.85490 673.99483 L
211.76107 673.90072 L
211.66696 673.80690 L
211.66696 673.71307 L
211.66696 673.61896 L
211.66696 673.52513 L
211.76107 673.43131 L
211.85490 673.43131 L
211.94901 673.43131 L
212.04283 673.43131 L
@c
F
@rax %Note: Object
210.53962 673.43131 211.10315 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
210.91550 673.43131 m
210.91550 673.52513 L
211.00932 673.61896 L
211.10315 673.71307 L
211.10315 673.71307 L
211.00932 673.80690 L
210.91550 673.90072 L
210.82167 673.99483 L
210.82167 673.99483 L
210.72784 673.99483 L
210.63373 673.90072 L
210.53962 673.80690 L
210.53962 673.71307 L
210.53962 673.61896 L
210.53962 673.52513 L
210.63373 673.43131 L
210.72784 673.43131 L
210.82167 673.43131 L
210.91550 673.43131 L
@c
F
@rax %Note: Object
209.41228 673.43131 209.97609 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
209.78816 673.43131 m
209.78816 673.52513 L
209.88227 673.61896 L
209.97609 673.71307 L
209.97609 673.71307 L
209.88227 673.80690 L
209.78816 673.90072 L
209.69433 673.99483 L
209.69433 673.99483 L
209.60050 673.99483 L
209.50639 673.90072 L
209.41228 673.80690 L
209.41228 673.71307 L
209.41228 673.61896 L
209.41228 673.52513 L
209.50639 673.43131 L
209.60050 673.43131 L
209.69433 673.43131 L
209.78816 673.43131 L
@c
F
@rax %Note: Object
208.28494 673.43131 208.84876 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
208.66082 673.43131 m
208.66082 673.52513 L
208.75465 673.61896 L
208.84876 673.71307 L
208.84876 673.71307 L
208.75465 673.80690 L
208.66082 673.90072 L
208.56699 673.99483 L
208.56699 673.99483 L
208.47317 673.99483 L
208.37877 673.90072 L
208.28494 673.80690 L
208.28494 673.71307 L
208.28494 673.61896 L
208.28494 673.52513 L
208.37877 673.43131 L
208.47317 673.43131 L
208.56699 673.43131 L
208.66082 673.43131 L
@c
F
@rax %Note: Object
207.15789 673.43131 207.72142 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
207.53376 673.43131 m
207.53376 673.52513 L
207.62759 673.61896 L
207.72142 673.71307 L
207.72142 673.71307 L
207.62759 673.80690 L
207.53376 673.90072 L
207.43994 673.99483 L
207.43994 673.99483 L
207.34583 673.99483 L
207.25172 673.90072 L
207.15789 673.80690 L
207.15789 673.71307 L
207.15789 673.61896 L
207.15789 673.52513 L
207.25172 673.43131 L
207.34583 673.43131 L
207.43994 673.43131 L
207.53376 673.43131 L
@c
F
@rax %Note: Object
206.03055 673.43131 206.59408 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
206.40643 673.43131 m
206.40643 673.52513 L
206.50025 673.61896 L
206.59408 673.71307 L
206.59408 673.71307 L
206.50025 673.80690 L
206.40643 673.90072 L
206.31260 673.99483 L
206.31260 673.99483 L
206.21820 673.99483 L
206.12438 673.90072 L
206.03055 673.80690 L
206.03055 673.71307 L
206.03055 673.61896 L
206.03055 673.52513 L
206.12438 673.43131 L
206.21820 673.43131 L
206.31260 673.43131 L
206.40643 673.43131 L
@c
F
@rax %Note: Object
204.90321 673.43131 205.46674 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
205.27909 673.43131 m
205.27909 673.52513 L
205.37291 673.61896 L
205.46674 673.71307 L
205.46674 673.71307 L
205.37291 673.80690 L
205.27909 673.90072 L
205.18498 673.99483 L
205.18498 673.99483 L
205.09087 673.99483 L
204.99732 673.90072 L
204.90321 673.80690 L
204.90321 673.71307 L
204.90321 673.61896 L
204.90321 673.52513 L
204.99732 673.43131 L
205.09087 673.43131 L
205.18498 673.43131 L
205.27909 673.43131 L
@c
F
@rax %Note: Object
203.77587 673.43131 204.33969 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
204.15175 673.43131 m
204.15175 673.52513 L
204.24586 673.61896 L
204.33969 673.71307 L
204.33969 673.71307 L
204.24586 673.80690 L
204.15175 673.90072 L
204.05764 673.99483 L
204.05764 673.99483 L
203.96381 673.99483 L
203.86998 673.90072 L
203.77587 673.80690 L
203.77587 673.71307 L
203.77587 673.61896 L
203.77587 673.52513 L
203.86998 673.43131 L
203.96381 673.43131 L
204.05764 673.43131 L
204.15175 673.43131 L
@c
F
@rax %Note: Object
202.64854 673.43131 203.21235 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
203.02441 673.43131 m
203.02441 673.52513 L
203.11852 673.61896 L
203.21235 673.71307 L
203.21235 673.71307 L
203.11852 673.80690 L
203.02441 673.90072 L
202.93030 673.99483 L
202.93030 673.99483 L
202.83647 673.99483 L
202.74236 673.90072 L
202.64854 673.80690 L
202.64854 673.71307 L
202.64854 673.61896 L
202.64854 673.52513 L
202.74236 673.43131 L
202.83647 673.43131 L
202.93030 673.43131 L
203.02441 673.43131 L
@c
F
@rax %Note: Object
201.52148 673.43131 202.08501 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
201.89735 673.43131 m
201.89735 673.52513 L
201.99118 673.61896 L
202.08501 673.71307 L
202.08501 673.71307 L
201.99118 673.80690 L
201.89735 673.90072 L
201.80324 673.99483 L
201.80324 673.99483 L
201.70913 673.99483 L
201.61531 673.90072 L
201.52148 673.80690 L
201.52148 673.71307 L
201.52148 673.61896 L
201.52148 673.52513 L
201.61531 673.43131 L
201.70913 673.43131 L
201.80324 673.43131 L
201.89735 673.43131 L
@c
F
@rax %Note: Object
200.39414 673.43131 200.95767 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
200.76973 673.43131 m
200.76973 673.52513 L
200.86384 673.61896 L
200.95767 673.71307 L
200.95767 673.71307 L
200.86384 673.80690 L
200.76973 673.90072 L
200.67591 673.99483 L
200.67591 673.99483 L
200.58180 673.99483 L
200.48797 673.90072 L
200.39414 673.80690 L
200.39414 673.71307 L
200.39414 673.61896 L
200.39414 673.52513 L
200.48797 673.43131 L
200.58180 673.43131 L
200.67591 673.43131 L
200.76973 673.43131 L
@c
F
@rax %Note: Object
199.26680 673.43131 199.83033 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
199.64239 673.43131 m
199.64239 673.52513 L
199.73650 673.61896 L
199.83033 673.71307 L
199.83033 673.71307 L
199.73650 673.80690 L
199.64239 673.90072 L
199.54828 673.99483 L
199.54828 673.99483 L
199.45446 673.99483 L
199.36063 673.90072 L
199.26680 673.80690 L
199.26680 673.71307 L
199.26680 673.61896 L
199.26680 673.52513 L
199.36063 673.43131 L
199.45446 673.43131 L
199.54828 673.43131 L
199.64239 673.43131 L
@c
F
@rax %Note: Object
198.13946 673.43131 198.70328 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
198.51506 673.43131 m
198.51506 673.52513 L
198.60945 673.61896 L
198.70328 673.71307 L
198.70328 673.71307 L
198.60945 673.80690 L
198.51506 673.90072 L
198.42123 673.99483 L
198.42123 673.99483 L
198.32740 673.99483 L
198.23357 673.90072 L
198.13946 673.80690 L
198.13946 673.71307 L
198.13946 673.61896 L
198.13946 673.52513 L
198.23357 673.43131 L
198.32740 673.43131 L
198.42123 673.43131 L
198.51506 673.43131 L
@c
F
@rax %Note: Object
197.01213 673.43131 197.57594 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
197.38772 673.43131 m
197.38772 673.52513 L
197.48183 673.61896 L
197.57594 673.71307 L
197.57594 673.71307 L
197.48183 673.80690 L
197.38772 673.90072 L
197.29389 673.99483 L
197.29389 673.99483 L
197.20006 673.99483 L
197.10595 673.90072 L
197.01213 673.80690 L
197.01213 673.71307 L
197.01213 673.61896 L
197.01213 673.52513 L
197.10595 673.43131 L
197.20006 673.43131 L
197.29389 673.43131 L
197.38772 673.43131 L
@c
F
@rax %Note: Object
195.88507 673.43131 196.44860 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
196.26066 673.43131 m
196.26066 673.52513 L
196.35449 673.61896 L
196.44860 673.71307 L
196.44860 673.71307 L
196.35449 673.80690 L
196.26066 673.90072 L
196.16683 673.99483 L
196.16683 673.99483 L
196.07272 673.99483 L
195.97890 673.90072 L
195.88507 673.80690 L
195.88507 673.71307 L
195.88507 673.61896 L
195.88507 673.52513 L
195.97890 673.43131 L
196.07272 673.43131 L
196.16683 673.43131 L
196.26066 673.43131 L
@c
F
@rax %Note: Object
194.75773 673.43131 195.32126 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
195.13332 673.43131 m
195.13332 673.52513 L
195.22715 673.61896 L
195.32126 673.71307 L
195.32126 673.71307 L
195.22715 673.80690 L
195.13332 673.90072 L
195.03950 673.99483 L
195.03950 673.99483 L
194.94539 673.99483 L
194.85156 673.90072 L
194.75773 673.80690 L
194.75773 673.71307 L
194.75773 673.61896 L
194.75773 673.52513 L
194.85156 673.43131 L
194.94539 673.43131 L
195.03950 673.43131 L
195.13332 673.43131 L
@c
F
@rax %Note: Object
193.63011 673.43131 194.19392 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
194.00598 673.43131 m
194.00598 673.52513 L
194.09981 673.61896 L
194.19392 673.71307 L
194.19392 673.71307 L
194.09981 673.80690 L
194.00598 673.90072 L
193.91187 673.99483 L
193.91187 673.99483 L
193.81805 673.99483 L
193.72422 673.90072 L
193.63011 673.80690 L
193.63011 673.71307 L
193.63011 673.61896 L
193.63011 673.52513 L
193.72422 673.43131 L
193.81805 673.43131 L
193.91187 673.43131 L
194.00598 673.43131 L
@c
F
@rax %Note: Object
192.50277 673.43131 193.06658 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
192.87865 673.43131 m
192.87865 673.52513 L
192.97276 673.61896 L
193.06658 673.71307 L
193.06658 673.71307 L
192.97276 673.80690 L
192.87865 673.90072 L
192.78482 673.99483 L
192.78482 673.99483 L
192.69099 673.99483 L
192.59717 673.90072 L
192.50277 673.80690 L
192.50277 673.71307 L
192.50277 673.61896 L
192.50277 673.52513 L
192.59717 673.43131 L
192.69099 673.43131 L
192.78482 673.43131 L
192.87865 673.43131 L
@c
F
@rax %Note: Object
191.37543 673.43131 191.93924 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
191.75131 673.43131 m
191.75131 673.52513 L
191.84542 673.61896 L
191.93924 673.71307 L
191.93924 673.71307 L
191.84542 673.80690 L
191.75131 673.90072 L
191.65748 673.99483 L
191.65748 673.99483 L
191.56365 673.99483 L
191.46954 673.90072 L
191.37543 673.80690 L
191.37543 673.71307 L
191.37543 673.61896 L
191.37543 673.52513 L
191.46954 673.43131 L
191.56365 673.43131 L
191.65748 673.43131 L
191.75131 673.43131 L
@c
F
@rax %Note: Object
190.24838 673.43131 190.81191 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
190.62397 673.43131 m
190.62397 673.52513 L
190.71780 673.61896 L
190.81191 673.71307 L
190.81191 673.71307 L
190.71780 673.80690 L
190.62397 673.90072 L
190.53043 673.99483 L
190.53043 673.99483 L
190.43631 673.99483 L
190.34220 673.90072 L
190.24838 673.80690 L
190.24838 673.71307 L
190.24838 673.61896 L
190.24838 673.52513 L
190.34220 673.43131 L
190.43631 673.43131 L
190.53043 673.43131 L
190.62397 673.43131 L
@c
F
@rax %Note: Object
189.12104 673.43131 189.68457 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
189.49691 673.43131 m
189.49691 673.52513 L
189.59074 673.61896 L
189.68457 673.71307 L
189.68457 673.71307 L
189.59074 673.80690 L
189.49691 673.90072 L
189.40309 673.99483 L
189.40309 673.99483 L
189.30898 673.99483 L
189.21487 673.90072 L
189.12104 673.80690 L
189.12104 673.71307 L
189.12104 673.61896 L
189.12104 673.52513 L
189.21487 673.43131 L
189.30898 673.43131 L
189.40309 673.43131 L
189.49691 673.43131 L
@c
F
@rax %Note: Object
187.99370 673.43131 188.55723 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
188.36957 673.43131 m
188.36957 673.52513 L
188.46340 673.61896 L
188.55723 673.71307 L
188.55723 673.71307 L
188.46340 673.80690 L
188.36957 673.90072 L
188.27546 673.99483 L
188.27546 673.99483 L
188.18164 673.99483 L
188.08753 673.90072 L
187.99370 673.80690 L
187.99370 673.71307 L
187.99370 673.61896 L
187.99370 673.52513 L
188.08753 673.43131 L
188.18164 673.43131 L
188.27546 673.43131 L
188.36957 673.43131 L
@c
F
@rax %Note: Object
186.86636 673.43131 187.43017 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
187.24224 673.43131 m
187.24224 673.52513 L
187.33635 673.61896 L
187.43017 673.71307 L
187.43017 673.71307 L
187.33635 673.80690 L
187.24224 673.90072 L
187.14841 673.99483 L
187.14841 673.99483 L
187.05430 673.99483 L
186.96047 673.90072 L
186.86636 673.80690 L
186.86636 673.71307 L
186.86636 673.61896 L
186.86636 673.52513 L
186.96047 673.43131 L
187.05430 673.43131 L
187.14841 673.43131 L
187.24224 673.43131 L
@c
F
@rax %Note: Object
185.73902 673.43131 186.30283 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
186.11490 673.43131 m
186.11490 673.52513 L
186.20901 673.61896 L
186.30283 673.71307 L
186.30283 673.71307 L
186.20901 673.80690 L
186.11490 673.90072 L
186.02107 673.99483 L
186.02107 673.99483 L
185.92696 673.99483 L
185.83313 673.90072 L
185.73902 673.80690 L
185.73902 673.71307 L
185.73902 673.61896 L
185.73902 673.52513 L
185.83313 673.43131 L
185.92696 673.43131 L
186.02107 673.43131 L
186.11490 673.43131 L
@c
F
@rax %Note: Object
184.61197 673.43131 185.17550 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
184.98756 673.43131 m
184.98756 673.52513 L
185.08139 673.61896 L
185.17550 673.71307 L
185.17550 673.71307 L
185.08139 673.80690 L
184.98756 673.90072 L
184.89373 673.99483 L
184.89373 673.99483 L
184.79962 673.99483 L
184.70580 673.90072 L
184.61197 673.80690 L
184.61197 673.71307 L
184.61197 673.61896 L
184.61197 673.52513 L
184.70580 673.43131 L
184.79962 673.43131 L
184.89373 673.43131 L
184.98756 673.43131 L
@c
F
@rax %Note: Object
183.48463 673.43131 184.04816 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
183.86050 673.43131 m
183.86050 673.52513 L
183.95433 673.61896 L
184.04816 673.71307 L
184.04816 673.71307 L
183.95433 673.80690 L
183.86050 673.90072 L
183.76639 673.99483 L
183.76639 673.99483 L
183.67228 673.99483 L
183.57846 673.90072 L
183.48463 673.80690 L
183.48463 673.71307 L
183.48463 673.61896 L
183.48463 673.52513 L
183.57846 673.43131 L
183.67228 673.43131 L
183.76639 673.43131 L
183.86050 673.43131 L
@c
F
@rax %Note: Object
182.35729 673.43131 182.92082 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
182.73317 673.43131 m
182.73317 673.52513 L
182.82699 673.61896 L
182.92082 673.71307 L
182.92082 673.71307 L
182.82699 673.80690 L
182.73317 673.90072 L
182.63877 673.99483 L
182.63877 673.99483 L
182.54494 673.99483 L
182.45112 673.90072 L
182.35729 673.80690 L
182.35729 673.71307 L
182.35729 673.61896 L
182.35729 673.52513 L
182.45112 673.43131 L
182.54494 673.43131 L
182.63877 673.43131 L
182.73317 673.43131 L
@c
F
@rax %Note: Object
181.22995 673.43131 181.79376 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
181.60583 673.43131 m
181.60583 673.52513 L
181.69994 673.61896 L
181.79376 673.71307 L
181.79376 673.71307 L
181.69994 673.80690 L
181.60583 673.90072 L
181.51172 673.99483 L
181.51172 673.99483 L
181.41789 673.99483 L
181.32406 673.90072 L
181.22995 673.80690 L
181.22995 673.71307 L
181.22995 673.61896 L
181.22995 673.52513 L
181.32406 673.43131 L
181.41789 673.43131 L
181.51172 673.43131 L
181.60583 673.43131 L
@c
F
@rax %Note: Object
180.10261 673.43131 180.66643 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
180.47820 673.43131 m
180.47820 673.52513 L
180.57260 673.61896 L
180.66643 673.71307 L
180.66643 673.71307 L
180.57260 673.80690 L
180.47820 673.90072 L
180.38438 673.99483 L
180.38438 673.99483 L
180.29055 673.99483 L
180.19672 673.90072 L
180.10261 673.80690 L
180.10261 673.71307 L
180.10261 673.61896 L
180.10261 673.52513 L
180.19672 673.43131 L
180.29055 673.43131 L
180.38438 673.43131 L
180.47820 673.43131 L
@c
F
@rax %Note: Object
178.97528 673.43131 179.53909 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
179.35087 673.43131 m
179.35087 673.52513 L
179.44498 673.61896 L
179.53909 673.71307 L
179.53909 673.71307 L
179.44498 673.80690 L
179.35087 673.90072 L
179.25704 673.99483 L
179.25704 673.99483 L
179.16321 673.99483 L
179.06910 673.90072 L
178.97528 673.80690 L
178.97528 673.71307 L
178.97528 673.61896 L
178.97528 673.52513 L
179.06910 673.43131 L
179.16321 673.43131 L
179.25704 673.43131 L
179.35087 673.43131 L
@c
F
@rax %Note: Object
177.84822 673.43131 178.41175 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
178.22381 673.43131 m
178.22381 673.52513 L
178.31792 673.61896 L
178.41175 673.71307 L
178.41175 673.71307 L
178.31792 673.80690 L
178.22381 673.90072 L
178.12998 673.99483 L
178.12998 673.99483 L
178.03587 673.99483 L
177.94205 673.90072 L
177.84822 673.80690 L
177.84822 673.71307 L
177.84822 673.61896 L
177.84822 673.52513 L
177.94205 673.43131 L
178.03587 673.43131 L
178.12998 673.43131 L
178.22381 673.43131 L
@c
F
@rax %Note: Object
176.72088 673.43131 177.28441 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
177.09647 673.43131 m
177.09647 673.52513 L
177.19030 673.61896 L
177.28441 673.71307 L
177.28441 673.71307 L
177.19030 673.80690 L
177.09647 673.90072 L
177.00236 673.99483 L
177.00236 673.99483 L
176.90854 673.99483 L
176.81471 673.90072 L
176.72088 673.80690 L
176.72088 673.71307 L
176.72088 673.61896 L
176.72088 673.52513 L
176.81471 673.43131 L
176.90854 673.43131 L
177.00236 673.43131 L
177.09647 673.43131 L
@c
F
@rax %Note: Object
175.59354 673.43131 176.15707 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
175.96913 673.43131 m
175.96913 673.52513 L
176.06296 673.61896 L
176.15707 673.71307 L
176.15707 673.71307 L
176.06296 673.80690 L
175.96913 673.90072 L
175.87531 673.99483 L
175.87531 673.99483 L
175.78148 673.99483 L
175.68765 673.90072 L
175.59354 673.80690 L
175.59354 673.71307 L
175.59354 673.61896 L
175.59354 673.52513 L
175.68765 673.43131 L
175.78148 673.43131 L
175.87531 673.43131 L
175.96913 673.43131 L
@c
F
@rax %Note: Object
174.46620 673.43131 175.03002 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
174.84180 673.43131 m
174.84180 673.52513 L
174.93591 673.61896 L
175.03002 673.71307 L
175.03002 673.71307 L
174.93591 673.80690 L
174.84180 673.90072 L
174.74797 673.99483 L
174.74797 673.99483 L
174.65414 673.99483 L
174.56031 673.90072 L
174.46620 673.80690 L
174.46620 673.71307 L
174.46620 673.61896 L
174.46620 673.52513 L
174.56031 673.43131 L
174.65414 673.43131 L
174.74797 673.43131 L
174.84180 673.43131 L
@c
F
@rax %Note: Object
173.33858 673.43131 173.90239 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
173.71446 673.43131 m
173.71446 673.52513 L
173.80828 673.61896 L
173.90239 673.71307 L
173.90239 673.71307 L
173.80828 673.80690 L
173.71446 673.90072 L
173.62063 673.99483 L
173.62063 673.99483 L
173.52680 673.99483 L
173.43269 673.90072 L
173.33858 673.80690 L
173.33858 673.71307 L
173.33858 673.61896 L
173.33858 673.52513 L
173.43269 673.43131 L
173.52680 673.43131 L
173.62063 673.43131 L
173.71446 673.43131 L
@c
F
@rax %Note: Object
172.21153 673.43131 172.77506 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
172.58740 673.43131 m
172.58740 673.52513 L
172.68123 673.61896 L
172.77506 673.71307 L
172.77506 673.71307 L
172.68123 673.80690 L
172.58740 673.90072 L
172.49357 673.99483 L
172.49357 673.99483 L
172.39946 673.99483 L
172.30564 673.90072 L
172.21153 673.80690 L
172.21153 673.71307 L
172.21153 673.61896 L
172.21153 673.52513 L
172.30564 673.43131 L
172.39946 673.43131 L
172.49357 673.43131 L
172.58740 673.43131 L
@c
F
@rax %Note: Object
171.08419 673.43131 171.64772 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
171.46006 673.43131 m
171.46006 673.52513 L
171.55389 673.61896 L
171.64772 673.71307 L
171.64772 673.71307 L
171.55389 673.80690 L
171.46006 673.90072 L
171.36624 673.99483 L
171.36624 673.99483 L
171.27213 673.99483 L
171.17802 673.90072 L
171.08419 673.80690 L
171.08419 673.71307 L
171.08419 673.61896 L
171.08419 673.52513 L
171.17802 673.43131 L
171.27213 673.43131 L
171.36624 673.43131 L
171.46006 673.43131 L
@c
F
@rax %Note: Object
169.95685 673.43131 170.52038 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
170.33272 673.43131 m
170.33272 673.52513 L
170.42655 673.61896 L
170.52038 673.71307 L
170.52038 673.71307 L
170.42655 673.80690 L
170.33272 673.90072 L
170.23861 673.99483 L
170.23861 673.99483 L
170.14507 673.99483 L
170.05096 673.90072 L
169.95685 673.80690 L
169.95685 673.71307 L
169.95685 673.61896 L
169.95685 673.52513 L
170.05096 673.43131 L
170.14507 673.43131 L
170.23861 673.43131 L
170.33272 673.43131 L
@c
F
@rax %Note: Object
168.82951 673.43131 169.39332 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
169.20539 673.43131 m
169.20539 673.52513 L
169.29950 673.61896 L
169.39332 673.71307 L
169.39332 673.71307 L
169.29950 673.80690 L
169.20539 673.90072 L
169.11156 673.99483 L
169.11156 673.99483 L
169.01773 673.99483 L
168.92362 673.90072 L
168.82951 673.80690 L
168.82951 673.71307 L
168.82951 673.61896 L
168.82951 673.52513 L
168.92362 673.43131 L
169.01773 673.43131 L
169.11156 673.43131 L
169.20539 673.43131 L
@c
F
@rax %Note: Object
167.70217 673.43131 168.26598 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
168.07805 673.43131 m
168.07805 673.52513 L
168.17187 673.61896 L
168.26598 673.71307 L
168.26598 673.71307 L
168.17187 673.80690 L
168.07805 673.90072 L
167.98422 673.99483 L
167.98422 673.99483 L
167.89011 673.99483 L
167.79600 673.90072 L
167.70217 673.80690 L
167.70217 673.71307 L
167.70217 673.61896 L
167.70217 673.52513 L
167.79600 673.43131 L
167.89011 673.43131 L
167.98422 673.43131 L
168.07805 673.43131 L
@c
F
@rax %Note: Object
166.57512 673.43131 167.13865 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
166.95099 673.43131 m
166.95099 673.52513 L
167.04482 673.61896 L
167.13865 673.71307 L
167.13865 673.71307 L
167.04482 673.80690 L
166.95099 673.90072 L
166.85717 673.99483 L
166.85717 673.99483 L
166.76277 673.99483 L
166.66894 673.90072 L
166.57512 673.80690 L
166.57512 673.71307 L
166.57512 673.61896 L
166.57512 673.52513 L
166.66894 673.43131 L
166.76277 673.43131 L
166.85717 673.43131 L
166.95099 673.43131 L
@c
F
@rax %Note: Object
165.44778 673.43131 166.01131 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
165.82365 673.43131 m
165.82365 673.52513 L
165.91748 673.61896 L
166.01131 673.71307 L
166.01131 673.71307 L
165.91748 673.80690 L
165.82365 673.90072 L
165.72983 673.99483 L
165.72983 673.99483 L
165.63543 673.99483 L
165.54161 673.90072 L
165.44778 673.80690 L
165.44778 673.71307 L
165.44778 673.61896 L
165.44778 673.52513 L
165.54161 673.43131 L
165.63543 673.43131 L
165.72983 673.43131 L
165.82365 673.43131 L
@c
F
@rax %Note: Object
164.32044 673.43131 164.88397 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
164.69631 673.43131 m
164.69631 673.52513 L
164.79014 673.61896 L
164.88397 673.71307 L
164.88397 673.71307 L
164.79014 673.80690 L
164.69631 673.90072 L
164.60220 673.99483 L
164.60220 673.99483 L
164.50809 673.99483 L
164.41455 673.90072 L
164.32044 673.80690 L
164.32044 673.71307 L
164.32044 673.61896 L
164.32044 673.52513 L
164.41455 673.43131 L
164.50809 673.43131 L
164.60220 673.43131 L
164.69631 673.43131 L
@c
F
@rax %Note: Object
163.19310 673.43131 163.75691 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
163.56898 673.43131 m
163.56898 673.52513 L
163.66309 673.61896 L
163.75691 673.71307 L
163.75691 673.71307 L
163.66309 673.80690 L
163.56898 673.90072 L
163.47487 673.99483 L
163.47487 673.99483 L
163.38104 673.99483 L
163.28721 673.90072 L
163.19310 673.80690 L
163.19310 673.71307 L
163.19310 673.61896 L
163.19310 673.52513 L
163.28721 673.43131 L
163.38104 673.43131 L
163.47487 673.43131 L
163.56898 673.43131 L
@c
F
@rax %Note: Object
162.06576 673.43131 162.62957 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
162.44164 673.43131 m
162.44164 673.52513 L
162.53546 673.61896 L
162.62957 673.71307 L
162.62957 673.71307 L
162.53546 673.80690 L
162.44164 673.90072 L
162.34753 673.99483 L
162.34753 673.99483 L
162.25370 673.99483 L
162.15959 673.90072 L
162.06576 673.80690 L
162.06576 673.71307 L
162.06576 673.61896 L
162.06576 673.52513 L
162.15959 673.43131 L
162.25370 673.43131 L
162.34753 673.43131 L
162.44164 673.43131 L
@c
F
@rax %Note: Object
160.93871 673.43131 161.50224 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
161.31430 673.43131 m
161.31430 673.52513 L
161.40841 673.61896 L
161.50224 673.71307 L
161.50224 673.71307 L
161.40841 673.80690 L
161.31430 673.90072 L
161.22047 673.99483 L
161.22047 673.99483 L
161.12636 673.99483 L
161.03254 673.90072 L
160.93871 673.80690 L
160.93871 673.71307 L
160.93871 673.61896 L
160.93871 673.52513 L
161.03254 673.43131 L
161.12636 673.43131 L
161.22047 673.43131 L
161.31430 673.43131 L
@c
F
@rax %Note: Object
159.81137 673.43131 160.37490 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
160.18696 673.43131 m
160.18696 673.52513 L
160.28107 673.61896 L
160.37490 673.71307 L
160.37490 673.71307 L
160.28107 673.80690 L
160.18696 673.90072 L
160.09313 673.99483 L
160.09313 673.99483 L
159.99902 673.99483 L
159.90520 673.90072 L
159.81137 673.80690 L
159.81137 673.71307 L
159.81137 673.61896 L
159.81137 673.52513 L
159.90520 673.43131 L
159.99902 673.43131 L
160.09313 673.43131 L
160.18696 673.43131 L
@c
F
@rax %Note: Object
158.68403 673.43131 159.24756 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
159.05962 673.43131 m
159.05962 673.52513 L
159.15373 673.61896 L
159.24756 673.71307 L
159.24756 673.71307 L
159.15373 673.80690 L
159.05962 673.90072 L
158.96551 673.99483 L
158.96551 673.99483 L
158.87169 673.99483 L
158.77786 673.90072 L
158.68403 673.80690 L
158.68403 673.71307 L
158.68403 673.61896 L
158.68403 673.52513 L
158.77786 673.43131 L
158.87169 673.43131 L
158.96551 673.43131 L
159.05962 673.43131 L
@c
F
@rax %Note: Object
157.55669 673.43131 158.12050 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
157.93228 673.43131 m
157.93228 673.52513 L
158.02639 673.61896 L
158.12050 673.71307 L
158.12050 673.71307 L
158.02639 673.80690 L
157.93228 673.90072 L
157.83846 673.99483 L
157.83846 673.99483 L
157.74463 673.99483 L
157.65080 673.90072 L
157.55669 673.80690 L
157.55669 673.71307 L
157.55669 673.61896 L
157.55669 673.52513 L
157.65080 673.43131 L
157.74463 673.43131 L
157.83846 673.43131 L
157.93228 673.43131 L
@c
F
@rax %Note: Object
156.42935 673.43131 156.99317 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
156.80494 673.43131 m
156.80494 673.52513 L
156.89906 673.61896 L
156.99317 673.71307 L
156.99317 673.71307 L
156.89906 673.80690 L
156.80494 673.90072 L
156.71112 673.99483 L
156.71112 673.99483 L
156.61729 673.99483 L
156.52318 673.90072 L
156.42935 673.80690 L
156.42935 673.71307 L
156.42935 673.61896 L
156.42935 673.52513 L
156.52318 673.43131 L
156.61729 673.43131 L
156.71112 673.43131 L
156.80494 673.43131 L
@c
F
@rax %Note: Object
155.30202 673.43131 155.86583 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
155.67789 673.43131 m
155.67789 673.52513 L
155.77143 673.61896 L
155.86583 673.71307 L
155.86583 673.71307 L
155.77143 673.80690 L
155.67789 673.90072 L
155.58406 673.99483 L
155.58406 673.99483 L
155.48995 673.99483 L
155.39613 673.90072 L
155.30202 673.80690 L
155.30202 673.71307 L
155.30202 673.61896 L
155.30202 673.52513 L
155.39613 673.43131 L
155.48995 673.43131 L
155.58406 673.43131 L
155.67789 673.43131 L
@c
F
@rax %Note: Object
154.17468 673.43131 154.73820 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
154.55055 673.43131 m
154.55055 673.52513 L
154.64438 673.61896 L
154.73820 673.71307 L
154.73820 673.71307 L
154.64438 673.80690 L
154.55055 673.90072 L
154.45672 673.99483 L
154.45672 673.99483 L
154.36261 673.99483 L
154.26879 673.90072 L
154.17468 673.80690 L
154.17468 673.71307 L
154.17468 673.61896 L
154.17468 673.52513 L
154.26879 673.43131 L
154.36261 673.43131 L
154.45672 673.43131 L
154.55055 673.43131 L
@c
F
@rax %Note: Object
153.04734 673.43131 153.61087 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
153.42321 673.43131 m
153.42321 673.52513 L
153.51704 673.61896 L
153.61087 673.71307 L
153.61087 673.71307 L
153.51704 673.80690 L
153.42321 673.90072 L
153.32910 673.99483 L
153.32910 673.99483 L
153.23528 673.99483 L
153.14145 673.90072 L
153.04734 673.80690 L
153.04734 673.71307 L
153.04734 673.61896 L
153.04734 673.52513 L
153.14145 673.43131 L
153.23528 673.43131 L
153.32910 673.43131 L
153.42321 673.43131 L
@c
F
@rax %Note: Object
151.92000 673.43131 152.48381 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
152.29587 673.43131 m
152.29587 673.52513 L
152.38998 673.61896 L
152.48381 673.71307 L
152.48381 673.71307 L
152.38998 673.80690 L
152.29587 673.90072 L
152.20205 673.99483 L
152.20205 673.99483 L
152.10822 673.99483 L
152.01411 673.90072 L
151.92000 673.80690 L
151.92000 673.71307 L
151.92000 673.61896 L
151.92000 673.52513 L
152.01411 673.43131 L
152.10822 673.43131 L
152.20205 673.43131 L
152.29587 673.43131 L
@c
F
@rax %Note: Object
150.79266 673.43131 151.35647 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
151.16854 673.43131 m
151.16854 673.52513 L
151.26265 673.61896 L
151.35647 673.71307 L
151.35647 673.71307 L
151.26265 673.80690 L
151.16854 673.90072 L
151.07471 673.99483 L
151.07471 673.99483 L
150.98088 673.99483 L
150.88649 673.90072 L
150.79266 673.80690 L
150.79266 673.71307 L
150.79266 673.61896 L
150.79266 673.52513 L
150.88649 673.43131 L
150.98088 673.43131 L
151.07471 673.43131 L
151.16854 673.43131 L
@c
F
@rax %Note: Object
149.66561 673.43131 150.22913 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
150.04120 673.43131 m
150.04120 673.52513 L
150.13502 673.61896 L
150.22913 673.71307 L
150.22913 673.71307 L
150.13502 673.80690 L
150.04120 673.90072 L
149.94737 673.99483 L
149.94737 673.99483 L
149.85354 673.99483 L
149.75943 673.90072 L
149.66561 673.80690 L
149.66561 673.71307 L
149.66561 673.61896 L
149.66561 673.52513 L
149.75943 673.43131 L
149.85354 673.43131 L
149.94737 673.43131 L
150.04120 673.43131 L
@c
F
@rax %Note: Object
148.53827 673.43131 149.10180 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
148.91414 673.43131 m
148.91414 673.52513 L
149.00797 673.61896 L
149.10180 673.71307 L
149.10180 673.71307 L
149.00797 673.80690 L
148.91414 673.90072 L
148.82031 673.99483 L
148.82031 673.99483 L
148.72620 673.99483 L
148.63209 673.90072 L
148.53827 673.80690 L
148.53827 673.71307 L
148.53827 673.61896 L
148.53827 673.52513 L
148.63209 673.43131 L
148.72620 673.43131 L
148.82031 673.43131 L
148.91414 673.43131 L
@c
F
@rax %Note: Object
147.41093 673.43131 147.97446 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
147.78680 673.43131 m
147.78680 673.52513 L
147.88063 673.61896 L
147.97446 673.71307 L
147.97446 673.71307 L
147.88063 673.80690 L
147.78680 673.90072 L
147.69269 673.99483 L
147.69269 673.99483 L
147.59858 673.99483 L
147.50476 673.90072 L
147.41093 673.80690 L
147.41093 673.71307 L
147.41093 673.61896 L
147.41093 673.52513 L
147.50476 673.43131 L
147.59858 673.43131 L
147.69269 673.43131 L
147.78680 673.43131 L
@c
F
@rax %Note: Object
146.28359 673.43131 146.84740 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
146.65946 673.43131 m
146.65946 673.52513 L
146.75357 673.61896 L
146.84740 673.71307 L
146.84740 673.71307 L
146.75357 673.80690 L
146.65946 673.90072 L
146.56564 673.99483 L
146.56564 673.99483 L
146.47153 673.99483 L
146.37770 673.90072 L
146.28359 673.80690 L
146.28359 673.71307 L
146.28359 673.61896 L
146.28359 673.52513 L
146.37770 673.43131 L
146.47153 673.43131 L
146.56564 673.43131 L
146.65946 673.43131 L
@c
F
@rax %Note: Object
145.15625 673.43131 145.72006 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
145.53213 673.43131 m
145.53213 673.52513 L
145.62624 673.61896 L
145.72006 673.71307 L
145.72006 673.71307 L
145.62624 673.80690 L
145.53213 673.90072 L
145.43830 673.99483 L
145.43830 673.99483 L
145.34419 673.99483 L
145.25008 673.90072 L
145.15625 673.80690 L
145.15625 673.71307 L
145.15625 673.61896 L
145.15625 673.52513 L
145.25008 673.43131 L
145.34419 673.43131 L
145.43830 673.43131 L
145.53213 673.43131 L
@c
F
@rax %Note: Object
144.02920 673.43131 144.59272 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
144.40479 673.43131 m
144.40479 673.52513 L
144.49861 673.61896 L
144.59272 673.71307 L
144.59272 673.71307 L
144.49861 673.80690 L
144.40479 673.90072 L
144.31068 673.99483 L
144.31068 673.99483 L
144.21685 673.99483 L
144.12274 673.90072 L
144.02920 673.80690 L
144.02920 673.71307 L
144.02920 673.61896 L
144.02920 673.52513 L
144.12274 673.43131 L
144.21685 673.43131 L
144.31068 673.43131 L
144.40479 673.43131 L
@c
F
@rax %Note: Object
142.90186 673.43131 143.46539 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
143.27773 673.43131 m
143.27773 673.52513 L
143.37156 673.61896 L
143.46539 673.71307 L
143.46539 673.71307 L
143.37156 673.80690 L
143.27773 673.90072 L
143.18362 673.99483 L
143.18362 673.99483 L
143.08951 673.99483 L
142.99569 673.90072 L
142.90186 673.80690 L
142.90186 673.71307 L
142.90186 673.61896 L
142.90186 673.52513 L
142.99569 673.43131 L
143.08951 673.43131 L
143.18362 673.43131 L
143.27773 673.43131 L
@c
F
@rax %Note: Object
141.77452 673.43131 142.33805 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
142.15011 673.43131 m
142.15011 673.52513 L
142.24422 673.61896 L
142.33805 673.71307 L
142.33805 673.71307 L
142.24422 673.80690 L
142.15011 673.90072 L
142.05600 673.99483 L
142.05600 673.99483 L
141.96217 673.99483 L
141.86835 673.90072 L
141.77452 673.80690 L
141.77452 673.71307 L
141.77452 673.61896 L
141.77452 673.52513 L
141.86835 673.43131 L
141.96217 673.43131 L
142.05600 673.43131 L
142.15011 673.43131 L
@c
F
@rax %Note: Object
140.64718 673.43131 141.21071 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
141.02277 673.43131 m
141.02277 673.52513 L
141.11717 673.61896 L
141.21071 673.71307 L
141.21071 673.71307 L
141.11717 673.80690 L
141.02277 673.90072 L
140.92894 673.99483 L
140.92894 673.99483 L
140.83512 673.99483 L
140.74129 673.90072 L
140.64718 673.80690 L
140.64718 673.71307 L
140.64718 673.61896 L
140.64718 673.52513 L
140.74129 673.43131 L
140.83512 673.43131 L
140.92894 673.43131 L
141.02277 673.43131 L
@c
F
@rax %Note: Object
139.51984 673.43131 140.08365 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
139.89543 673.43131 m
139.89543 673.52513 L
139.98983 673.61896 L
140.08365 673.71307 L
140.08365 673.71307 L
139.98983 673.80690 L
139.89543 673.90072 L
139.80161 673.99483 L
139.80161 673.99483 L
139.70778 673.99483 L
139.61395 673.90072 L
139.51984 673.80690 L
139.51984 673.71307 L
139.51984 673.61896 L
139.51984 673.52513 L
139.61395 673.43131 L
139.70778 673.43131 L
139.80161 673.43131 L
139.89543 673.43131 L
@c
F
@rax %Note: Object
138.39250 673.43131 138.95631 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
138.76809 673.43131 m
138.76809 673.52513 L
138.86220 673.61896 L
138.95631 673.71307 L
138.95631 673.71307 L
138.86220 673.80690 L
138.76809 673.90072 L
138.67427 673.99483 L
138.67427 673.99483 L
138.58044 673.99483 L
138.48633 673.90072 L
138.39250 673.80690 L
138.39250 673.71307 L
138.39250 673.61896 L
138.39250 673.52513 L
138.48633 673.43131 L
138.58044 673.43131 L
138.67427 673.43131 L
138.76809 673.43131 L
@c
F
@rax %Note: Object
137.26545 673.43131 137.82898 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
137.64104 673.43131 m
137.64104 673.52513 L
137.73487 673.61896 L
137.82898 673.71307 L
137.82898 673.71307 L
137.73487 673.80690 L
137.64104 673.90072 L
137.54721 673.99483 L
137.54721 673.99483 L
137.45310 673.99483 L
137.35928 673.90072 L
137.26545 673.80690 L
137.26545 673.71307 L
137.26545 673.61896 L
137.26545 673.52513 L
137.35928 673.43131 L
137.45310 673.43131 L
137.54721 673.43131 L
137.64104 673.43131 L
@c
F
@rax %Note: Object
136.13811 673.43131 136.70164 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
136.51370 673.43131 m
136.51370 673.52513 L
136.60753 673.61896 L
136.70164 673.71307 L
136.70164 673.71307 L
136.60753 673.80690 L
136.51370 673.90072 L
136.41959 673.99483 L
136.41959 673.99483 L
136.32576 673.99483 L
136.23194 673.90072 L
136.13811 673.80690 L
136.13811 673.71307 L
136.13811 673.61896 L
136.13811 673.52513 L
136.23194 673.43131 L
136.32576 673.43131 L
136.41959 673.43131 L
136.51370 673.43131 L
@c
F
@rax %Note: Object
135.01049 673.43131 135.57430 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
135.38636 673.43131 m
135.38636 673.52513 L
135.48019 673.61896 L
135.57430 673.71307 L
135.57430 673.71307 L
135.48019 673.80690 L
135.38636 673.90072 L
135.29254 673.99483 L
135.29254 673.99483 L
135.19871 673.99483 L
135.10488 673.90072 L
135.01049 673.80690 L
135.01049 673.71307 L
135.01049 673.61896 L
135.01049 673.52513 L
135.10488 673.43131 L
135.19871 673.43131 L
135.29254 673.43131 L
135.38636 673.43131 L
@c
F
@rax %Note: Object
133.88315 673.43131 134.44696 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
134.25902 673.43131 m
134.25902 673.52513 L
134.35313 673.61896 L
134.44696 673.71307 L
134.44696 673.71307 L
134.35313 673.80690 L
134.25902 673.90072 L
134.16520 673.99483 L
134.16520 673.99483 L
134.07137 673.99483 L
133.97754 673.90072 L
133.88315 673.80690 L
133.88315 673.71307 L
133.88315 673.61896 L
133.88315 673.52513 L
133.97754 673.43131 L
134.07137 673.43131 L
134.16520 673.43131 L
134.25902 673.43131 L
@c
F
@rax %Note: Object
132.75581 673.43131 133.31962 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
133.13169 673.43131 m
133.13169 673.52513 L
133.22551 673.61896 L
133.31962 673.71307 L
133.31962 673.71307 L
133.22551 673.80690 L
133.13169 673.90072 L
133.03786 673.99483 L
133.03786 673.99483 L
132.94403 673.99483 L
132.84992 673.90072 L
132.75581 673.80690 L
132.75581 673.71307 L
132.75581 673.61896 L
132.75581 673.52513 L
132.84992 673.43131 L
132.94403 673.43131 L
133.03786 673.43131 L
133.13169 673.43131 L
@c
F
@rax %Note: Object
131.62876 673.43131 132.19228 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
132.00463 673.43131 m
132.00463 673.52513 L
132.09846 673.61896 L
132.19228 673.71307 L
132.19228 673.71307 L
132.09846 673.80690 L
132.00463 673.90072 L
131.91080 673.99483 L
131.91080 673.99483 L
131.81669 673.99483 L
131.72258 673.90072 L
131.62876 673.80690 L
131.62876 673.71307 L
131.62876 673.61896 L
131.62876 673.52513 L
131.72258 673.43131 L
131.81669 673.43131 L
131.91080 673.43131 L
132.00463 673.43131 L
@c
F
@rax %Note: Object
130.50142 673.43131 131.06494 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
130.87729 673.43131 m
130.87729 673.52513 L
130.97112 673.61896 L
131.06494 673.71307 L
131.06494 673.71307 L
130.97112 673.80690 L
130.87729 673.90072 L
130.78318 673.99483 L
130.78318 673.99483 L
130.68935 673.99483 L
130.59524 673.90072 L
130.50142 673.80690 L
130.50142 673.71307 L
130.50142 673.61896 L
130.50142 673.52513 L
130.59524 673.43131 L
130.68935 673.43131 L
130.78318 673.43131 L
130.87729 673.43131 L
@c
F
@rax %Note: Object
129.37408 673.43131 129.93761 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
129.74995 673.43131 m
129.74995 673.52513 L
129.84378 673.61896 L
129.93761 673.71307 L
129.93761 673.71307 L
129.84378 673.80690 L
129.74995 673.90072 L
129.65584 673.99483 L
129.65584 673.99483 L
129.56230 673.99483 L
129.46819 673.90072 L
129.37408 673.80690 L
129.37408 673.71307 L
129.37408 673.61896 L
129.37408 673.52513 L
129.46819 673.43131 L
129.56230 673.43131 L
129.65584 673.43131 L
129.74995 673.43131 L
@c
F
@rax %Note: Object
128.24674 673.43131 128.81055 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.62261 673.43131 m
128.62261 673.52513 L
128.71672 673.61896 L
128.81055 673.71307 L
128.81055 673.71307 L
128.71672 673.80690 L
128.62261 673.90072 L
128.52879 673.99483 L
128.52879 673.99483 L
128.43468 673.99483 L
128.34085 673.90072 L
128.24674 673.80690 L
128.24674 673.71307 L
128.24674 673.61896 L
128.24674 673.52513 L
128.34085 673.43131 L
128.43468 673.43131 L
128.52879 673.43131 L
128.62261 673.43131 L
@c
F
@rax %Note: Object
127.11940 673.43131 127.68321 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
127.49528 673.43131 m
127.49528 673.52513 L
127.58910 673.61896 L
127.68321 673.71307 L
127.68321 673.71307 L
127.58910 673.80690 L
127.49528 673.90072 L
127.40145 673.99483 L
127.40145 673.99483 L
127.30734 673.99483 L
127.21323 673.90072 L
127.11940 673.80690 L
127.11940 673.71307 L
127.11940 673.61896 L
127.11940 673.52513 L
127.21323 673.43131 L
127.30734 673.43131 L
127.40145 673.43131 L
127.49528 673.43131 L
@c
F
@rax %Note: Object
125.99235 673.43131 126.55587 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
126.36822 673.43131 m
126.36822 673.52513 L
126.46205 673.61896 L
126.55587 673.71307 L
126.55587 673.71307 L
126.46205 673.80690 L
126.36822 673.90072 L
126.27411 673.99483 L
126.27411 673.99483 L
126.18000 673.99483 L
126.08617 673.90072 L
125.99235 673.80690 L
125.99235 673.71307 L
125.99235 673.61896 L
125.99235 673.52513 L
126.08617 673.43131 L
126.18000 673.43131 L
126.27411 673.43131 L
126.36822 673.43131 L
@c
F
@rax %Note: Object
124.86501 673.43131 125.42854 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
125.24088 673.43131 m
125.24088 673.52513 L
125.33471 673.61896 L
125.42854 673.71307 L
125.42854 673.71307 L
125.33471 673.80690 L
125.24088 673.90072 L
125.14677 673.99483 L
125.14677 673.99483 L
125.05266 673.99483 L
124.95883 673.90072 L
124.86501 673.80690 L
124.86501 673.71307 L
124.86501 673.61896 L
124.86501 673.52513 L
124.95883 673.43131 L
125.05266 673.43131 L
125.14677 673.43131 L
125.24088 673.43131 L
@c
F
@rax %Note: Object
123.73767 673.43131 124.30120 673.99483 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 673.71307 m
123.83150 673.61896 L
123.92532 673.52513 L
124.01915 673.43131 L
124.11354 673.43131 L
124.20737 673.52513 L
124.30120 673.61896 L
124.30120 673.71307 L
124.30120 673.80690 L
124.30120 673.80690 L
124.30120 673.90072 L
124.20737 673.99483 L
124.11354 673.99483 L
124.01915 673.99483 L
123.92532 673.99483 L
123.83150 673.90072 L
123.73767 673.80690 L
123.73767 673.71307 L
@c
F
@rax %Note: Object
123.73767 674.55836 124.30120 675.12217 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 674.84041 m
123.83150 674.74630 L
123.92532 674.65219 L
124.01915 674.55836 L
124.11354 674.55836 L
124.20737 674.65219 L
124.30120 674.74630 L
124.30120 674.84041 L
124.30120 674.93424 L
124.30120 674.93424 L
124.30120 675.02806 L
124.20737 675.12217 L
124.11354 675.12217 L
124.01915 675.12217 L
123.92532 675.12217 L
123.83150 675.02806 L
123.73767 674.93424 L
123.73767 674.84041 L
@c
F
@rax %Note: Object
123.73767 675.68570 124.30120 676.24951 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 675.96775 m
123.83150 675.87364 L
123.92532 675.77981 L
124.01915 675.68570 L
124.11354 675.68570 L
124.20737 675.77981 L
124.30120 675.87364 L
124.30120 675.96775 L
124.30120 676.06157 L
124.30120 676.06157 L
124.30120 676.15569 L
124.20737 676.24951 L
124.11354 676.24951 L
124.01915 676.24951 L
123.92532 676.24951 L
123.83150 676.15569 L
123.73767 676.06157 L
123.73767 675.96775 L
@c
F
@rax %Note: Object
123.73767 676.81304 124.30120 677.37657 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 677.09480 m
123.83150 677.00098 L
123.92532 676.90687 L
124.01915 676.81304 L
124.11354 676.81304 L
124.20737 676.90687 L
124.30120 677.00098 L
124.30120 677.09480 L
124.30120 677.18891 L
124.30120 677.18891 L
124.30120 677.28274 L
124.20737 677.37657 L
124.11354 677.37657 L
124.01915 677.37657 L
123.92532 677.37657 L
123.83150 677.28274 L
123.73767 677.18891 L
123.73767 677.09480 L
@c
F
@rax %Note: Object
123.73767 677.94038 124.30120 678.50391 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 678.22214 m
123.83150 678.12831 L
123.92532 678.03420 L
124.01915 677.94038 L
124.11354 677.94038 L
124.20737 678.03420 L
124.30120 678.12831 L
124.30120 678.22214 L
124.30120 678.31625 L
124.30120 678.31625 L
124.30120 678.41008 L
124.20737 678.50391 L
124.11354 678.50391 L
124.01915 678.50391 L
123.92532 678.50391 L
123.83150 678.41008 L
123.73767 678.31625 L
123.73767 678.22214 L
@c
F
@rax %Note: Object
123.73767 679.06772 124.30120 679.63124 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 679.34976 m
123.83150 679.25565 L
123.92532 679.16154 L
124.01915 679.06772 L
124.11354 679.06772 L
124.20737 679.16154 L
124.30120 679.25565 L
124.30120 679.34976 L
124.30120 679.44359 L
124.30120 679.44359 L
124.30120 679.53713 L
124.20737 679.63124 L
124.11354 679.63124 L
124.01915 679.63124 L
123.92532 679.63124 L
123.83150 679.53713 L
123.73767 679.44359 L
123.73767 679.34976 L
@c
F
@rax %Note: Object
123.73767 680.19477 124.30120 680.75858 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 680.47682 m
123.83150 680.38299 L
123.92532 680.28888 L
124.01915 680.19477 L
124.11354 680.19477 L
124.20737 680.28888 L
124.30120 680.38299 L
124.30120 680.47682 L
124.30120 680.57065 L
124.30120 680.57065 L
124.30120 680.66447 L
124.20737 680.75858 L
124.11354 680.75858 L
124.01915 680.75858 L
123.92532 680.75858 L
123.83150 680.66447 L
123.73767 680.57065 L
123.73767 680.47682 L
@c
F
@rax %Note: Object
123.73767 681.32211 124.30120 681.88592 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 681.60416 m
123.83150 681.51033 L
123.92532 681.41650 L
124.01915 681.32211 L
124.11354 681.32211 L
124.20737 681.41650 L
124.30120 681.51033 L
124.30120 681.60416 L
124.30120 681.69798 L
124.30120 681.69798 L
124.30120 681.79209 L
124.20737 681.88592 L
124.11354 681.88592 L
124.01915 681.88592 L
123.92532 681.88592 L
123.83150 681.79209 L
123.73767 681.69798 L
123.73767 681.60416 L
@c
F
@rax %Note: Object
123.73767 682.44945 124.30120 683.01326 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 682.73121 m
123.83150 682.63739 L
123.92532 682.54356 L
124.01915 682.44945 L
124.11354 682.44945 L
124.20737 682.54356 L
124.30120 682.63739 L
124.30120 682.73121 L
124.30120 682.82532 L
124.30120 682.82532 L
124.30120 682.91915 L
124.20737 683.01326 L
124.11354 683.01326 L
124.01915 683.01326 L
123.92532 683.01326 L
123.83150 682.91915 L
123.73767 682.82532 L
123.73767 682.73121 L
@c
F
@rax %Note: Object
123.73767 683.57707 124.30120 684.14060 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 683.85855 m
123.83150 683.76472 L
123.92532 683.67090 L
124.01915 683.57707 L
124.11354 683.57707 L
124.20737 683.67090 L
124.30120 683.76472 L
124.30120 683.85855 L
124.30120 683.95266 L
124.30120 683.95266 L
124.30120 684.04649 L
124.20737 684.14060 L
124.11354 684.14060 L
124.01915 684.14060 L
123.92532 684.14060 L
123.83150 684.04649 L
123.73767 683.95266 L
123.73767 683.85855 L
@c
F
@rax %Note: Object
123.73767 684.70441 124.30120 685.26794 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 684.98617 m
123.83150 684.89206 L
123.92532 684.79824 L
124.01915 684.70441 L
124.11354 684.70441 L
124.20737 684.79824 L
124.30120 684.89206 L
124.30120 684.98617 L
124.30120 685.08000 L
124.30120 685.08000 L
124.30120 685.17383 L
124.20737 685.26794 L
124.11354 685.26794 L
124.01915 685.26794 L
123.92532 685.26794 L
123.83150 685.17383 L
123.73767 685.08000 L
123.73767 684.98617 L
@c
F
@rax %Note: Object
123.73767 685.83146 124.30120 686.39528 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 686.11323 m
123.83150 686.01940 L
123.92532 685.92529 L
124.01915 685.83146 L
124.11354 685.83146 L
124.20737 685.92529 L
124.30120 686.01940 L
124.30120 686.11323 L
124.30120 686.20706 L
124.30120 686.20706 L
124.30120 686.30117 L
124.20737 686.39528 L
124.11354 686.39528 L
124.01915 686.39528 L
123.92532 686.39528 L
123.83150 686.30117 L
123.73767 686.20706 L
123.73767 686.11323 L
@c
F
@rax %Note: Object
123.73767 686.95880 124.30120 687.52261 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 687.24057 m
123.83150 687.14674 L
123.92532 687.05291 L
124.01915 686.95880 L
124.11354 686.95880 L
124.20737 687.05291 L
124.30120 687.14674 L
124.30120 687.24057 L
124.30120 687.33439 L
124.30120 687.33439 L
124.30120 687.42879 L
124.20737 687.52261 L
124.11354 687.52261 L
124.01915 687.52261 L
123.92532 687.52261 L
123.83150 687.42879 L
123.73767 687.33439 L
123.73767 687.24057 L
@c
F
@rax %Note: Object
123.73767 688.08614 124.30120 688.64967 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 688.36762 m
123.83150 688.27380 L
123.92532 688.18025 L
124.01915 688.08614 L
124.11354 688.08614 L
124.20737 688.18025 L
124.30120 688.27380 L
124.30120 688.36762 L
124.30120 688.46173 L
124.30120 688.46173 L
124.30120 688.55584 L
124.20737 688.64967 L
124.11354 688.64967 L
124.01915 688.64967 L
123.92532 688.64967 L
123.83150 688.55584 L
123.73767 688.46173 L
123.73767 688.36762 L
@c
F
@rax %Note: Object
123.73767 689.21348 124.30120 689.77701 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 689.49496 m
123.83150 689.40113 L
123.92532 689.30731 L
124.01915 689.21348 L
124.11354 689.21348 L
124.20737 689.30731 L
124.30120 689.40113 L
124.30120 689.49496 L
124.30120 689.58935 L
124.30120 689.58935 L
124.30120 689.68318 L
124.20737 689.77701 L
124.11354 689.77701 L
124.01915 689.77701 L
123.92532 689.77701 L
123.83150 689.68318 L
123.73767 689.58935 L
123.73767 689.49496 L
@c
F
@rax %Note: Object
123.73767 690.34082 124.30120 690.90435 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 690.62258 m
123.83150 690.52847 L
123.92532 690.43465 L
124.01915 690.34082 L
124.11354 690.34082 L
124.20737 690.43465 L
124.30120 690.52847 L
124.30120 690.62258 L
124.30120 690.71669 L
124.30120 690.71669 L
124.30120 690.81052 L
124.20737 690.90435 L
124.11354 690.90435 L
124.01915 690.90435 L
123.92532 690.90435 L
123.83150 690.81052 L
123.73767 690.71669 L
123.73767 690.62258 L
@c
F
@rax %Note: Object
123.73767 691.46787 124.30120 692.03169 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 691.74964 m
123.83150 691.65581 L
123.92532 691.56170 L
124.01915 691.46787 L
124.11354 691.46787 L
124.20737 691.56170 L
124.30120 691.65581 L
124.30120 691.74964 L
124.30120 691.84375 L
124.30120 691.84375 L
124.30120 691.93757 L
124.20737 692.03169 L
124.11354 692.03169 L
124.01915 692.03169 L
123.92532 692.03169 L
123.83150 691.93757 L
123.73767 691.84375 L
123.73767 691.74964 L
@c
F
@rax %Note: Object
123.73767 692.59521 124.30120 693.15902 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 692.87726 m
123.83150 692.78315 L
123.92532 692.68904 L
124.01915 692.59521 L
124.11354 692.59521 L
124.20737 692.68904 L
124.30120 692.78315 L
124.30120 692.87726 L
124.30120 692.97109 L
124.30120 692.97109 L
124.30120 693.06520 L
124.20737 693.15902 L
124.11354 693.15902 L
124.01915 693.15902 L
123.92532 693.15902 L
123.83150 693.06520 L
123.73767 692.97109 L
123.73767 692.87726 L
@c
F
@rax %Note: Object
123.73767 693.72255 124.30120 694.28608 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 694.00460 m
123.83150 693.91049 L
123.92532 693.81666 L
124.01915 693.72255 L
124.11354 693.72255 L
124.20737 693.81666 L
124.30120 693.91049 L
124.30120 694.00460 L
124.30120 694.09843 L
124.30120 694.09843 L
124.30120 694.19225 L
124.20737 694.28608 L
124.11354 694.28608 L
124.01915 694.28608 L
123.92532 694.28608 L
123.83150 694.19225 L
123.73767 694.09843 L
123.73767 694.00460 L
@c
F
@rax %Note: Object
123.73767 694.84989 124.30120 695.41342 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 695.13165 m
123.83150 695.03754 L
123.92532 694.94372 L
124.01915 694.84989 L
124.11354 694.84989 L
124.20737 694.94372 L
124.30120 695.03754 L
124.30120 695.13165 L
124.30120 695.22576 L
124.30120 695.22576 L
124.30120 695.31959 L
124.20737 695.41342 L
124.11354 695.41342 L
124.01915 695.41342 L
123.92532 695.41342 L
123.83150 695.31959 L
123.73767 695.22576 L
123.73767 695.13165 L
@c
F
@rax %Note: Object
123.73767 695.97723 124.30120 696.54076 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 696.25928 m
123.83150 696.16517 L
123.92532 696.07106 L
124.01915 695.97723 L
124.11354 695.97723 L
124.20737 696.07106 L
124.30120 696.16517 L
124.30120 696.25928 L
124.30120 696.35310 L
124.30120 696.35310 L
124.30120 696.44693 L
124.20737 696.54076 L
124.11354 696.54076 L
124.01915 696.54076 L
123.92532 696.54076 L
123.83150 696.44693 L
123.73767 696.35310 L
123.73767 696.25928 L
@c
F
@rax %Note: Object
123.73767 697.10428 124.30120 697.66809 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 697.38633 m
123.83150 697.29250 L
123.92532 697.19811 L
124.01915 697.10428 L
124.11354 697.10428 L
124.20737 697.19811 L
124.30120 697.29250 L
124.30120 697.38633 L
124.30120 697.48016 L
124.30120 697.48016 L
124.30120 697.57398 L
124.20737 697.66809 L
124.11354 697.66809 L
124.01915 697.66809 L
123.92532 697.66809 L
123.83150 697.57398 L
123.73767 697.48016 L
123.73767 697.38633 L
@c
F
@rax %Note: Object
123.73767 698.23162 124.30120 698.79543 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
123.73767 698.51367 m
123.83150 698.41984 L
123.92532 698.32545 L
124.01915 698.23162 L
124.11354 698.23162 L
124.20737 698.32545 L
124.30120 698.41984 L
124.30120 698.51367 L
124.30120 698.60750 L
124.30120 698.60750 L
124.30120 698.70161 L
124.20737 698.79543 L
124.11354 698.79543 L
124.01915 698.79543 L
123.92532 698.79543 L
123.83150 698.70161 L
123.73767 698.60750 L
123.73767 698.51367 L
@c
F
@rax %Note: Object
121.10712 699.35896 127.02557 705.27742 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
127.02557 699.35896 m
124.01915 705.27742 L
121.10712 699.35896 L
127.02557 699.35896 L
@c
F
@rax %Note: Object
230.83115 664.41288 231.39468 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
231.20702 664.41288 m
231.20702 664.50699 L
231.30057 664.60082 L
231.39468 664.69465 L
231.39468 664.69465 L
231.30057 664.78847 L
231.20702 664.88258 L
231.11320 664.97669 L
231.11320 664.97669 L
231.01909 664.97669 L
230.92526 664.88258 L
230.83115 664.78847 L
230.83115 664.69465 L
230.83115 664.60082 L
230.83115 664.50699 L
230.92526 664.41288 L
231.01909 664.41288 L
231.11320 664.41288 L
231.20702 664.41288 L
@c
F
@rax %Note: Object
229.70381 664.41288 230.26734 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
230.07969 664.41288 m
230.07969 664.50699 L
230.17351 664.60082 L
230.26734 664.69465 L
230.26734 664.69465 L
230.17351 664.78847 L
230.07969 664.88258 L
229.98586 664.97669 L
229.98586 664.97669 L
229.89175 664.97669 L
229.79764 664.88258 L
229.70381 664.78847 L
229.70381 664.69465 L
229.70381 664.60082 L
229.70381 664.50699 L
229.79764 664.41288 L
229.89175 664.41288 L
229.98586 664.41288 L
230.07969 664.41288 L
@c
F
@rax %Note: Object
228.57647 664.41288 229.14000 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
228.95235 664.41288 m
228.95235 664.50699 L
229.04617 664.60082 L
229.14000 664.69465 L
229.14000 664.69465 L
229.04617 664.78847 L
228.95235 664.88258 L
228.85824 664.97669 L
228.85824 664.97669 L
228.76441 664.97669 L
228.67030 664.88258 L
228.57647 664.78847 L
228.57647 664.69465 L
228.57647 664.60082 L
228.57647 664.50699 L
228.67030 664.41288 L
228.76441 664.41288 L
228.85824 664.41288 L
228.95235 664.41288 L
@c
F
@rax %Note: Object
227.44913 664.41288 228.01294 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
227.82501 664.41288 m
227.82501 664.50699 L
227.91912 664.60082 L
228.01294 664.69465 L
228.01294 664.69465 L
227.91912 664.78847 L
227.82501 664.88258 L
227.73118 664.97669 L
227.73118 664.97669 L
227.63735 664.97669 L
227.54324 664.88258 L
227.44913 664.78847 L
227.44913 664.69465 L
227.44913 664.60082 L
227.44913 664.50699 L
227.54324 664.41288 L
227.63735 664.41288 L
227.73118 664.41288 L
227.82501 664.41288 L
@c
F
@rax %Note: Object
226.32180 664.41288 226.88561 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
226.69767 664.41288 m
226.69767 664.50699 L
226.79178 664.60082 L
226.88561 664.69465 L
226.88561 664.69465 L
226.79178 664.78847 L
226.69767 664.88258 L
226.60384 664.97669 L
226.60384 664.97669 L
226.50973 664.97669 L
226.41591 664.88258 L
226.32180 664.78847 L
226.32180 664.69465 L
226.32180 664.60082 L
226.32180 664.50699 L
226.41591 664.41288 L
226.50973 664.41288 L
226.60384 664.41288 L
226.69767 664.41288 L
@c
F
@rax %Note: Object
225.19474 664.41288 225.75827 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
225.57033 664.41288 m
225.57033 664.50699 L
225.66416 664.60082 L
225.75827 664.69465 L
225.75827 664.69465 L
225.66416 664.78847 L
225.57033 664.88258 L
225.47650 664.97669 L
225.47650 664.97669 L
225.38239 664.97669 L
225.28857 664.88258 L
225.19474 664.78847 L
225.19474 664.69465 L
225.19474 664.60082 L
225.19474 664.50699 L
225.28857 664.41288 L
225.38239 664.41288 L
225.47650 664.41288 L
225.57033 664.41288 L
@c
F
@rax %Note: Object
224.06740 664.41288 224.63093 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
224.44328 664.41288 m
224.44328 664.50699 L
224.53710 664.60082 L
224.63093 664.69465 L
224.63093 664.69465 L
224.53710 664.78847 L
224.44328 664.88258 L
224.34945 664.97669 L
224.34945 664.97669 L
224.25506 664.97669 L
224.16123 664.88258 L
224.06740 664.78847 L
224.06740 664.69465 L
224.06740 664.60082 L
224.06740 664.50699 L
224.16123 664.41288 L
224.25506 664.41288 L
224.34945 664.41288 L
224.44328 664.41288 L
@c
F
@rax %Note: Object
222.94006 664.41288 223.50359 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
223.31594 664.41288 m
223.31594 664.50699 L
223.40976 664.60082 L
223.50359 664.69465 L
223.50359 664.69465 L
223.40976 664.78847 L
223.31594 664.88258 L
223.22183 664.97669 L
223.22183 664.97669 L
223.12772 664.97669 L
223.03389 664.88258 L
222.94006 664.78847 L
222.94006 664.69465 L
222.94006 664.60082 L
222.94006 664.50699 L
223.03389 664.41288 L
223.12772 664.41288 L
223.22183 664.41288 L
223.31594 664.41288 L
@c
F
@rax %Note: Object
221.81272 664.41288 222.37654 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
222.18860 664.41288 m
222.18860 664.50699 L
222.28271 664.60082 L
222.37654 664.69465 L
222.37654 664.69465 L
222.28271 664.78847 L
222.18860 664.88258 L
222.09449 664.97669 L
222.09449 664.97669 L
222.00066 664.97669 L
221.90683 664.88258 L
221.81272 664.78847 L
221.81272 664.69465 L
221.81272 664.60082 L
221.81272 664.50699 L
221.90683 664.41288 L
222.00066 664.41288 L
222.09449 664.41288 L
222.18860 664.41288 L
@c
F
@rax %Note: Object
220.68539 664.41288 221.24920 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
221.06126 664.41288 m
221.06126 664.50699 L
221.15537 664.60082 L
221.24920 664.69465 L
221.24920 664.69465 L
221.15537 664.78847 L
221.06126 664.88258 L
220.96715 664.97669 L
220.96715 664.97669 L
220.87332 664.97669 L
220.77950 664.88258 L
220.68539 664.78847 L
220.68539 664.69465 L
220.68539 664.60082 L
220.68539 664.50699 L
220.77950 664.41288 L
220.87332 664.41288 L
220.96715 664.41288 L
221.06126 664.41288 L
@c
F
@rax %Note: Object
219.55833 664.41288 220.12186 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
219.93392 664.41288 m
219.93392 664.50699 L
220.02775 664.60082 L
220.12186 664.69465 L
220.12186 664.69465 L
220.02775 664.78847 L
219.93392 664.88258 L
219.83981 664.97669 L
219.83981 664.97669 L
219.74598 664.97669 L
219.65187 664.88258 L
219.55833 664.78847 L
219.55833 664.69465 L
219.55833 664.60082 L
219.55833 664.50699 L
219.65187 664.41288 L
219.74598 664.41288 L
219.83981 664.41288 L
219.93392 664.41288 L
@c
F
@rax %Note: Object
218.43099 664.41288 218.99452 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
218.80658 664.41288 m
218.80658 664.50699 L
218.90069 664.60082 L
218.99452 664.69465 L
218.99452 664.69465 L
218.90069 664.78847 L
218.80658 664.88258 L
218.71276 664.97669 L
218.71276 664.97669 L
218.61865 664.97669 L
218.52482 664.88258 L
218.43099 664.78847 L
218.43099 664.69465 L
218.43099 664.60082 L
218.43099 664.50699 L
218.52482 664.41288 L
218.61865 664.41288 L
218.71276 664.41288 L
218.80658 664.41288 L
@c
F
@rax %Note: Object
217.30365 664.41288 217.86718 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
217.67924 664.41288 m
217.67924 664.50699 L
217.77335 664.60082 L
217.86718 664.69465 L
217.86718 664.69465 L
217.77335 664.78847 L
217.67924 664.88258 L
217.58542 664.97669 L
217.58542 664.97669 L
217.49131 664.97669 L
217.39748 664.88258 L
217.30365 664.78847 L
217.30365 664.69465 L
217.30365 664.60082 L
217.30365 664.50699 L
217.39748 664.41288 L
217.49131 664.41288 L
217.58542 664.41288 L
217.67924 664.41288 L
@c
F
@rax %Note: Object
216.17631 664.41288 216.73984 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
216.55191 664.41288 m
216.55191 664.50699 L
216.64602 664.60082 L
216.73984 664.69465 L
216.73984 664.69465 L
216.64602 664.78847 L
216.55191 664.88258 L
216.45808 664.97669 L
216.45808 664.97669 L
216.36425 664.97669 L
216.27043 664.88258 L
216.17631 664.78847 L
216.17631 664.69465 L
216.17631 664.60082 L
216.17631 664.50699 L
216.27043 664.41288 L
216.36425 664.41288 L
216.45808 664.41288 L
216.55191 664.41288 L
@c
F
@rax %Note: Object
215.04898 664.41288 215.61279 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
215.42457 664.41288 m
215.42457 664.50699 L
215.51868 664.60082 L
215.61279 664.69465 L
215.61279 664.69465 L
215.51868 664.78847 L
215.42457 664.88258 L
215.33074 664.97669 L
215.33074 664.97669 L
215.23691 664.97669 L
215.14309 664.88258 L
215.04898 664.78847 L
215.04898 664.69465 L
215.04898 664.60082 L
215.04898 664.50699 L
215.14309 664.41288 L
215.23691 664.41288 L
215.33074 664.41288 L
215.42457 664.41288 L
@c
F
@rax %Note: Object
213.92164 664.41288 214.48545 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
214.29723 664.41288 m
214.29723 664.50699 L
214.39106 664.60082 L
214.48545 664.69465 L
214.48545 664.69465 L
214.39106 664.78847 L
214.29723 664.88258 L
214.20340 664.97669 L
214.20340 664.97669 L
214.10957 664.97669 L
214.01546 664.88258 L
213.92164 664.78847 L
213.92164 664.69465 L
213.92164 664.60082 L
213.92164 664.50699 L
214.01546 664.41288 L
214.10957 664.41288 L
214.20340 664.41288 L
214.29723 664.41288 L
@c
F
@rax %Note: Object
212.79430 664.41288 213.35783 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
213.17017 664.41288 m
213.17017 664.50699 L
213.26400 664.60082 L
213.35783 664.69465 L
213.35783 664.69465 L
213.26400 664.78847 L
213.17017 664.88258 L
213.07635 664.97669 L
213.07635 664.97669 L
212.98224 664.97669 L
212.88841 664.88258 L
212.79430 664.78847 L
212.79430 664.69465 L
212.79430 664.60082 L
212.79430 664.50699 L
212.88841 664.41288 L
212.98224 664.41288 L
213.07635 664.41288 L
213.17017 664.41288 L
@c
F
@rax %Note: Object
211.66696 664.41288 212.23049 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
212.04283 664.41288 m
212.04283 664.50699 L
212.13666 664.60082 L
212.23049 664.69465 L
212.23049 664.69465 L
212.13666 664.78847 L
212.04283 664.88258 L
211.94901 664.97669 L
211.94901 664.97669 L
211.85490 664.97669 L
211.76107 664.88258 L
211.66696 664.78847 L
211.66696 664.69465 L
211.66696 664.60082 L
211.66696 664.50699 L
211.76107 664.41288 L
211.85490 664.41288 L
211.94901 664.41288 L
212.04283 664.41288 L
@c
F
@rax %Note: Object
210.53962 664.41288 211.10315 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
210.91550 664.41288 m
210.91550 664.50699 L
211.00932 664.60082 L
211.10315 664.69465 L
211.10315 664.69465 L
211.00932 664.78847 L
210.91550 664.88258 L
210.82167 664.97669 L
210.82167 664.97669 L
210.72784 664.97669 L
210.63373 664.88258 L
210.53962 664.78847 L
210.53962 664.69465 L
210.53962 664.60082 L
210.53962 664.50699 L
210.63373 664.41288 L
210.72784 664.41288 L
210.82167 664.41288 L
210.91550 664.41288 L
@c
F
@rax %Note: Object
209.41228 664.41288 209.97609 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
209.78816 664.41288 m
209.78816 664.50699 L
209.88227 664.60082 L
209.97609 664.69465 L
209.97609 664.69465 L
209.88227 664.78847 L
209.78816 664.88258 L
209.69433 664.97669 L
209.69433 664.97669 L
209.60050 664.97669 L
209.50639 664.88258 L
209.41228 664.78847 L
209.41228 664.69465 L
209.41228 664.60082 L
209.41228 664.50699 L
209.50639 664.41288 L
209.60050 664.41288 L
209.69433 664.41288 L
209.78816 664.41288 L
@c
F
@rax %Note: Object
208.28494 664.41288 208.84876 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
208.66082 664.41288 m
208.66082 664.50699 L
208.75465 664.60082 L
208.84876 664.69465 L
208.84876 664.69465 L
208.75465 664.78847 L
208.66082 664.88258 L
208.56699 664.97669 L
208.56699 664.97669 L
208.47317 664.97669 L
208.37877 664.88258 L
208.28494 664.78847 L
208.28494 664.69465 L
208.28494 664.60082 L
208.28494 664.50699 L
208.37877 664.41288 L
208.47317 664.41288 L
208.56699 664.41288 L
208.66082 664.41288 L
@c
F
@rax %Note: Object
207.15789 664.41288 207.72142 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
207.53376 664.41288 m
207.53376 664.50699 L
207.62759 664.60082 L
207.72142 664.69465 L
207.72142 664.69465 L
207.62759 664.78847 L
207.53376 664.88258 L
207.43994 664.97669 L
207.43994 664.97669 L
207.34583 664.97669 L
207.25172 664.88258 L
207.15789 664.78847 L
207.15789 664.69465 L
207.15789 664.60082 L
207.15789 664.50699 L
207.25172 664.41288 L
207.34583 664.41288 L
207.43994 664.41288 L
207.53376 664.41288 L
@c
F
@rax %Note: Object
206.03055 664.41288 206.59408 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
206.40643 664.41288 m
206.40643 664.50699 L
206.50025 664.60082 L
206.59408 664.69465 L
206.59408 664.69465 L
206.50025 664.78847 L
206.40643 664.88258 L
206.31260 664.97669 L
206.31260 664.97669 L
206.21820 664.97669 L
206.12438 664.88258 L
206.03055 664.78847 L
206.03055 664.69465 L
206.03055 664.60082 L
206.03055 664.50699 L
206.12438 664.41288 L
206.21820 664.41288 L
206.31260 664.41288 L
206.40643 664.41288 L
@c
F
@rax %Note: Object
204.90321 664.41288 205.46674 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
205.27909 664.41288 m
205.27909 664.50699 L
205.37291 664.60082 L
205.46674 664.69465 L
205.46674 664.69465 L
205.37291 664.78847 L
205.27909 664.88258 L
205.18498 664.97669 L
205.18498 664.97669 L
205.09087 664.97669 L
204.99732 664.88258 L
204.90321 664.78847 L
204.90321 664.69465 L
204.90321 664.60082 L
204.90321 664.50699 L
204.99732 664.41288 L
205.09087 664.41288 L
205.18498 664.41288 L
205.27909 664.41288 L
@c
F
@rax %Note: Object
203.77587 664.41288 204.33969 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
204.15175 664.41288 m
204.15175 664.50699 L
204.24586 664.60082 L
204.33969 664.69465 L
204.33969 664.69465 L
204.24586 664.78847 L
204.15175 664.88258 L
204.05764 664.97669 L
204.05764 664.97669 L
203.96381 664.97669 L
203.86998 664.88258 L
203.77587 664.78847 L
203.77587 664.69465 L
203.77587 664.60082 L
203.77587 664.50699 L
203.86998 664.41288 L
203.96381 664.41288 L
204.05764 664.41288 L
204.15175 664.41288 L
@c
F
@rax %Note: Object
202.64854 664.41288 203.21235 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
203.02441 664.41288 m
203.02441 664.50699 L
203.11852 664.60082 L
203.21235 664.69465 L
203.21235 664.69465 L
203.11852 664.78847 L
203.02441 664.88258 L
202.93030 664.97669 L
202.93030 664.97669 L
202.83647 664.97669 L
202.74236 664.88258 L
202.64854 664.78847 L
202.64854 664.69465 L
202.64854 664.60082 L
202.64854 664.50699 L
202.74236 664.41288 L
202.83647 664.41288 L
202.93030 664.41288 L
203.02441 664.41288 L
@c
F
@rax %Note: Object
201.52148 664.41288 202.08501 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
201.89735 664.41288 m
201.89735 664.50699 L
201.99118 664.60082 L
202.08501 664.69465 L
202.08501 664.69465 L
201.99118 664.78847 L
201.89735 664.88258 L
201.80324 664.97669 L
201.80324 664.97669 L
201.70913 664.97669 L
201.61531 664.88258 L
201.52148 664.78847 L
201.52148 664.69465 L
201.52148 664.60082 L
201.52148 664.50699 L
201.61531 664.41288 L
201.70913 664.41288 L
201.80324 664.41288 L
201.89735 664.41288 L
@c
F
@rax %Note: Object
200.39414 664.41288 200.95767 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
200.76973 664.41288 m
200.76973 664.50699 L
200.86384 664.60082 L
200.95767 664.69465 L
200.95767 664.69465 L
200.86384 664.78847 L
200.76973 664.88258 L
200.67591 664.97669 L
200.67591 664.97669 L
200.58180 664.97669 L
200.48797 664.88258 L
200.39414 664.78847 L
200.39414 664.69465 L
200.39414 664.60082 L
200.39414 664.50699 L
200.48797 664.41288 L
200.58180 664.41288 L
200.67591 664.41288 L
200.76973 664.41288 L
@c
F
@rax %Note: Object
199.26680 664.41288 199.83033 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
199.64239 664.41288 m
199.64239 664.50699 L
199.73650 664.60082 L
199.83033 664.69465 L
199.83033 664.69465 L
199.73650 664.78847 L
199.64239 664.88258 L
199.54828 664.97669 L
199.54828 664.97669 L
199.45446 664.97669 L
199.36063 664.88258 L
199.26680 664.78847 L
199.26680 664.69465 L
199.26680 664.60082 L
199.26680 664.50699 L
199.36063 664.41288 L
199.45446 664.41288 L
199.54828 664.41288 L
199.64239 664.41288 L
@c
F
@rax %Note: Object
198.13946 664.41288 198.70328 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
198.51506 664.41288 m
198.51506 664.50699 L
198.60945 664.60082 L
198.70328 664.69465 L
198.70328 664.69465 L
198.60945 664.78847 L
198.51506 664.88258 L
198.42123 664.97669 L
198.42123 664.97669 L
198.32740 664.97669 L
198.23357 664.88258 L
198.13946 664.78847 L
198.13946 664.69465 L
198.13946 664.60082 L
198.13946 664.50699 L
198.23357 664.41288 L
198.32740 664.41288 L
198.42123 664.41288 L
198.51506 664.41288 L
@c
F
@rax %Note: Object
197.01213 664.41288 197.57594 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
197.38772 664.41288 m
197.38772 664.50699 L
197.48183 664.60082 L
197.57594 664.69465 L
197.57594 664.69465 L
197.48183 664.78847 L
197.38772 664.88258 L
197.29389 664.97669 L
197.29389 664.97669 L
197.20006 664.97669 L
197.10595 664.88258 L
197.01213 664.78847 L
197.01213 664.69465 L
197.01213 664.60082 L
197.01213 664.50699 L
197.10595 664.41288 L
197.20006 664.41288 L
197.29389 664.41288 L
197.38772 664.41288 L
@c
F
@rax %Note: Object
195.88507 664.41288 196.44860 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
196.26066 664.41288 m
196.26066 664.50699 L
196.35449 664.60082 L
196.44860 664.69465 L
196.44860 664.69465 L
196.35449 664.78847 L
196.26066 664.88258 L
196.16683 664.97669 L
196.16683 664.97669 L
196.07272 664.97669 L
195.97890 664.88258 L
195.88507 664.78847 L
195.88507 664.69465 L
195.88507 664.60082 L
195.88507 664.50699 L
195.97890 664.41288 L
196.07272 664.41288 L
196.16683 664.41288 L
196.26066 664.41288 L
@c
F
@rax %Note: Object
194.75773 664.41288 195.32126 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
195.13332 664.41288 m
195.13332 664.50699 L
195.22715 664.60082 L
195.32126 664.69465 L
195.32126 664.69465 L
195.22715 664.78847 L
195.13332 664.88258 L
195.03950 664.97669 L
195.03950 664.97669 L
194.94539 664.97669 L
194.85156 664.88258 L
194.75773 664.78847 L
194.75773 664.69465 L
194.75773 664.60082 L
194.75773 664.50699 L
194.85156 664.41288 L
194.94539 664.41288 L
195.03950 664.41288 L
195.13332 664.41288 L
@c
F
@rax %Note: Object
193.63011 664.41288 194.19392 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
194.00598 664.41288 m
194.00598 664.50699 L
194.09981 664.60082 L
194.19392 664.69465 L
194.19392 664.69465 L
194.09981 664.78847 L
194.00598 664.88258 L
193.91187 664.97669 L
193.91187 664.97669 L
193.81805 664.97669 L
193.72422 664.88258 L
193.63011 664.78847 L
193.63011 664.69465 L
193.63011 664.60082 L
193.63011 664.50699 L
193.72422 664.41288 L
193.81805 664.41288 L
193.91187 664.41288 L
194.00598 664.41288 L
@c
F
@rax %Note: Object
192.50277 664.41288 193.06658 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
192.87865 664.41288 m
192.87865 664.50699 L
192.97276 664.60082 L
193.06658 664.69465 L
193.06658 664.69465 L
192.97276 664.78847 L
192.87865 664.88258 L
192.78482 664.97669 L
192.78482 664.97669 L
192.69099 664.97669 L
192.59717 664.88258 L
192.50277 664.78847 L
192.50277 664.69465 L
192.50277 664.60082 L
192.50277 664.50699 L
192.59717 664.41288 L
192.69099 664.41288 L
192.78482 664.41288 L
192.87865 664.41288 L
@c
F
@rax %Note: Object
191.37543 664.41288 191.93924 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
191.75131 664.41288 m
191.75131 664.50699 L
191.84542 664.60082 L
191.93924 664.69465 L
191.93924 664.69465 L
191.84542 664.78847 L
191.75131 664.88258 L
191.65748 664.97669 L
191.65748 664.97669 L
191.56365 664.97669 L
191.46954 664.88258 L
191.37543 664.78847 L
191.37543 664.69465 L
191.37543 664.60082 L
191.37543 664.50699 L
191.46954 664.41288 L
191.56365 664.41288 L
191.65748 664.41288 L
191.75131 664.41288 L
@c
F
@rax %Note: Object
190.24838 664.41288 190.81191 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
190.62397 664.41288 m
190.62397 664.50699 L
190.71780 664.60082 L
190.81191 664.69465 L
190.81191 664.69465 L
190.71780 664.78847 L
190.62397 664.88258 L
190.53043 664.97669 L
190.53043 664.97669 L
190.43631 664.97669 L
190.34220 664.88258 L
190.24838 664.78847 L
190.24838 664.69465 L
190.24838 664.60082 L
190.24838 664.50699 L
190.34220 664.41288 L
190.43631 664.41288 L
190.53043 664.41288 L
190.62397 664.41288 L
@c
F
@rax %Note: Object
189.12104 664.41288 189.68457 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
189.49691 664.41288 m
189.49691 664.50699 L
189.59074 664.60082 L
189.68457 664.69465 L
189.68457 664.69465 L
189.59074 664.78847 L
189.49691 664.88258 L
189.40309 664.97669 L
189.40309 664.97669 L
189.30898 664.97669 L
189.21487 664.88258 L
189.12104 664.78847 L
189.12104 664.69465 L
189.12104 664.60082 L
189.12104 664.50699 L
189.21487 664.41288 L
189.30898 664.41288 L
189.40309 664.41288 L
189.49691 664.41288 L
@c
F
@rax %Note: Object
187.99370 664.41288 188.55723 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
188.36957 664.41288 m
188.36957 664.50699 L
188.46340 664.60082 L
188.55723 664.69465 L
188.55723 664.69465 L
188.46340 664.78847 L
188.36957 664.88258 L
188.27546 664.97669 L
188.27546 664.97669 L
188.18164 664.97669 L
188.08753 664.88258 L
187.99370 664.78847 L
187.99370 664.69465 L
187.99370 664.60082 L
187.99370 664.50699 L
188.08753 664.41288 L
188.18164 664.41288 L
188.27546 664.41288 L
188.36957 664.41288 L
@c
F
@rax %Note: Object
186.86636 664.41288 187.43017 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
187.24224 664.41288 m
187.24224 664.50699 L
187.33635 664.60082 L
187.43017 664.69465 L
187.43017 664.69465 L
187.33635 664.78847 L
187.24224 664.88258 L
187.14841 664.97669 L
187.14841 664.97669 L
187.05430 664.97669 L
186.96047 664.88258 L
186.86636 664.78847 L
186.86636 664.69465 L
186.86636 664.60082 L
186.86636 664.50699 L
186.96047 664.41288 L
187.05430 664.41288 L
187.14841 664.41288 L
187.24224 664.41288 L
@c
F
@rax %Note: Object
185.73902 664.41288 186.30283 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
186.11490 664.41288 m
186.11490 664.50699 L
186.20901 664.60082 L
186.30283 664.69465 L
186.30283 664.69465 L
186.20901 664.78847 L
186.11490 664.88258 L
186.02107 664.97669 L
186.02107 664.97669 L
185.92696 664.97669 L
185.83313 664.88258 L
185.73902 664.78847 L
185.73902 664.69465 L
185.73902 664.60082 L
185.73902 664.50699 L
185.83313 664.41288 L
185.92696 664.41288 L
186.02107 664.41288 L
186.11490 664.41288 L
@c
F
@rax %Note: Object
184.61197 664.41288 185.17550 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
184.98756 664.41288 m
184.98756 664.50699 L
185.08139 664.60082 L
185.17550 664.69465 L
185.17550 664.69465 L
185.08139 664.78847 L
184.98756 664.88258 L
184.89373 664.97669 L
184.89373 664.97669 L
184.79962 664.97669 L
184.70580 664.88258 L
184.61197 664.78847 L
184.61197 664.69465 L
184.61197 664.60082 L
184.61197 664.50699 L
184.70580 664.41288 L
184.79962 664.41288 L
184.89373 664.41288 L
184.98756 664.41288 L
@c
F
@rax %Note: Object
183.48463 664.41288 184.04816 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
183.86050 664.41288 m
183.86050 664.50699 L
183.95433 664.60082 L
184.04816 664.69465 L
184.04816 664.69465 L
183.95433 664.78847 L
183.86050 664.88258 L
183.76639 664.97669 L
183.76639 664.97669 L
183.67228 664.97669 L
183.57846 664.88258 L
183.48463 664.78847 L
183.48463 664.69465 L
183.48463 664.60082 L
183.48463 664.50699 L
183.57846 664.41288 L
183.67228 664.41288 L
183.76639 664.41288 L
183.86050 664.41288 L
@c
F
@rax %Note: Object
182.35729 664.41288 182.92082 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
182.73317 664.41288 m
182.73317 664.50699 L
182.82699 664.60082 L
182.92082 664.69465 L
182.92082 664.69465 L
182.82699 664.78847 L
182.73317 664.88258 L
182.63877 664.97669 L
182.63877 664.97669 L
182.54494 664.97669 L
182.45112 664.88258 L
182.35729 664.78847 L
182.35729 664.69465 L
182.35729 664.60082 L
182.35729 664.50699 L
182.45112 664.41288 L
182.54494 664.41288 L
182.63877 664.41288 L
182.73317 664.41288 L
@c
F
@rax %Note: Object
181.22995 664.41288 181.79376 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
181.60583 664.41288 m
181.60583 664.50699 L
181.69994 664.60082 L
181.79376 664.69465 L
181.79376 664.69465 L
181.69994 664.78847 L
181.60583 664.88258 L
181.51172 664.97669 L
181.51172 664.97669 L
181.41789 664.97669 L
181.32406 664.88258 L
181.22995 664.78847 L
181.22995 664.69465 L
181.22995 664.60082 L
181.22995 664.50699 L
181.32406 664.41288 L
181.41789 664.41288 L
181.51172 664.41288 L
181.60583 664.41288 L
@c
F
@rax %Note: Object
180.10261 664.41288 180.66643 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
180.47820 664.41288 m
180.47820 664.50699 L
180.57260 664.60082 L
180.66643 664.69465 L
180.66643 664.69465 L
180.57260 664.78847 L
180.47820 664.88258 L
180.38438 664.97669 L
180.38438 664.97669 L
180.29055 664.97669 L
180.19672 664.88258 L
180.10261 664.78847 L
180.10261 664.69465 L
180.10261 664.60082 L
180.10261 664.50699 L
180.19672 664.41288 L
180.29055 664.41288 L
180.38438 664.41288 L
180.47820 664.41288 L
@c
F
@rax %Note: Object
178.97528 664.41288 179.53909 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
179.35087 664.41288 m
179.35087 664.50699 L
179.44498 664.60082 L
179.53909 664.69465 L
179.53909 664.69465 L
179.44498 664.78847 L
179.35087 664.88258 L
179.25704 664.97669 L
179.25704 664.97669 L
179.16321 664.97669 L
179.06910 664.88258 L
178.97528 664.78847 L
178.97528 664.69465 L
178.97528 664.60082 L
178.97528 664.50699 L
179.06910 664.41288 L
179.16321 664.41288 L
179.25704 664.41288 L
179.35087 664.41288 L
@c
F
@rax %Note: Object
177.84822 664.41288 178.41175 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
178.22381 664.41288 m
178.22381 664.50699 L
178.31792 664.60082 L
178.41175 664.69465 L
178.41175 664.69465 L
178.31792 664.78847 L
178.22381 664.88258 L
178.12998 664.97669 L
178.12998 664.97669 L
178.03587 664.97669 L
177.94205 664.88258 L
177.84822 664.78847 L
177.84822 664.69465 L
177.84822 664.60082 L
177.84822 664.50699 L
177.94205 664.41288 L
178.03587 664.41288 L
178.12998 664.41288 L
178.22381 664.41288 L
@c
F
@rax %Note: Object
176.72088 664.41288 177.28441 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
177.09647 664.41288 m
177.09647 664.50699 L
177.19030 664.60082 L
177.28441 664.69465 L
177.28441 664.69465 L
177.19030 664.78847 L
177.09647 664.88258 L
177.00236 664.97669 L
177.00236 664.97669 L
176.90854 664.97669 L
176.81471 664.88258 L
176.72088 664.78847 L
176.72088 664.69465 L
176.72088 664.60082 L
176.72088 664.50699 L
176.81471 664.41288 L
176.90854 664.41288 L
177.00236 664.41288 L
177.09647 664.41288 L
@c
F
@rax %Note: Object
175.59354 664.41288 176.15707 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
175.96913 664.41288 m
175.96913 664.50699 L
176.06296 664.60082 L
176.15707 664.69465 L
176.15707 664.69465 L
176.06296 664.78847 L
175.96913 664.88258 L
175.87531 664.97669 L
175.87531 664.97669 L
175.78148 664.97669 L
175.68765 664.88258 L
175.59354 664.78847 L
175.59354 664.69465 L
175.59354 664.60082 L
175.59354 664.50699 L
175.68765 664.41288 L
175.78148 664.41288 L
175.87531 664.41288 L
175.96913 664.41288 L
@c
F
@rax %Note: Object
174.46620 664.41288 175.03002 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
174.84180 664.41288 m
174.84180 664.50699 L
174.93591 664.60082 L
175.03002 664.69465 L
175.03002 664.69465 L
174.93591 664.78847 L
174.84180 664.88258 L
174.74797 664.97669 L
174.74797 664.97669 L
174.65414 664.97669 L
174.56031 664.88258 L
174.46620 664.78847 L
174.46620 664.69465 L
174.46620 664.60082 L
174.46620 664.50699 L
174.56031 664.41288 L
174.65414 664.41288 L
174.74797 664.41288 L
174.84180 664.41288 L
@c
F
@rax %Note: Object
173.33858 664.41288 173.90239 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
173.71446 664.41288 m
173.71446 664.50699 L
173.80828 664.60082 L
173.90239 664.69465 L
173.90239 664.69465 L
173.80828 664.78847 L
173.71446 664.88258 L
173.62063 664.97669 L
173.62063 664.97669 L
173.52680 664.97669 L
173.43269 664.88258 L
173.33858 664.78847 L
173.33858 664.69465 L
173.33858 664.60082 L
173.33858 664.50699 L
173.43269 664.41288 L
173.52680 664.41288 L
173.62063 664.41288 L
173.71446 664.41288 L
@c
F
@rax %Note: Object
172.21153 664.41288 172.77506 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
172.58740 664.41288 m
172.58740 664.50699 L
172.68123 664.60082 L
172.77506 664.69465 L
172.77506 664.69465 L
172.68123 664.78847 L
172.58740 664.88258 L
172.49357 664.97669 L
172.49357 664.97669 L
172.39946 664.97669 L
172.30564 664.88258 L
172.21153 664.78847 L
172.21153 664.69465 L
172.21153 664.60082 L
172.21153 664.50699 L
172.30564 664.41288 L
172.39946 664.41288 L
172.49357 664.41288 L
172.58740 664.41288 L
@c
F
@rax %Note: Object
171.08419 664.41288 171.64772 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
171.46006 664.41288 m
171.46006 664.50699 L
171.55389 664.60082 L
171.64772 664.69465 L
171.64772 664.69465 L
171.55389 664.78847 L
171.46006 664.88258 L
171.36624 664.97669 L
171.36624 664.97669 L
171.27213 664.97669 L
171.17802 664.88258 L
171.08419 664.78847 L
171.08419 664.69465 L
171.08419 664.60082 L
171.08419 664.50699 L
171.17802 664.41288 L
171.27213 664.41288 L
171.36624 664.41288 L
171.46006 664.41288 L
@c
F
@rax %Note: Object
169.95685 664.41288 170.52038 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
170.33272 664.41288 m
170.33272 664.50699 L
170.42655 664.60082 L
170.52038 664.69465 L
170.52038 664.69465 L
170.42655 664.78847 L
170.33272 664.88258 L
170.23861 664.97669 L
170.23861 664.97669 L
170.14507 664.97669 L
170.05096 664.88258 L
169.95685 664.78847 L
169.95685 664.69465 L
169.95685 664.60082 L
169.95685 664.50699 L
170.05096 664.41288 L
170.14507 664.41288 L
170.23861 664.41288 L
170.33272 664.41288 L
@c
F
@rax %Note: Object
168.82951 664.41288 169.39332 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
169.20539 664.41288 m
169.20539 664.50699 L
169.29950 664.60082 L
169.39332 664.69465 L
169.39332 664.69465 L
169.29950 664.78847 L
169.20539 664.88258 L
169.11156 664.97669 L
169.11156 664.97669 L
169.01773 664.97669 L
168.92362 664.88258 L
168.82951 664.78847 L
168.82951 664.69465 L
168.82951 664.60082 L
168.82951 664.50699 L
168.92362 664.41288 L
169.01773 664.41288 L
169.11156 664.41288 L
169.20539 664.41288 L
@c
F
@rax %Note: Object
167.70217 664.41288 168.26598 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
168.07805 664.41288 m
168.07805 664.50699 L
168.17187 664.60082 L
168.26598 664.69465 L
168.26598 664.69465 L
168.17187 664.78847 L
168.07805 664.88258 L
167.98422 664.97669 L
167.98422 664.97669 L
167.89011 664.97669 L
167.79600 664.88258 L
167.70217 664.78847 L
167.70217 664.69465 L
167.70217 664.60082 L
167.70217 664.50699 L
167.79600 664.41288 L
167.89011 664.41288 L
167.98422 664.41288 L
168.07805 664.41288 L
@c
F
@rax %Note: Object
166.57512 664.41288 167.13865 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
166.95099 664.41288 m
166.95099 664.50699 L
167.04482 664.60082 L
167.13865 664.69465 L
167.13865 664.69465 L
167.04482 664.78847 L
166.95099 664.88258 L
166.85717 664.97669 L
166.85717 664.97669 L
166.76277 664.97669 L
166.66894 664.88258 L
166.57512 664.78847 L
166.57512 664.69465 L
166.57512 664.60082 L
166.57512 664.50699 L
166.66894 664.41288 L
166.76277 664.41288 L
166.85717 664.41288 L
166.95099 664.41288 L
@c
F
@rax %Note: Object
165.44778 664.41288 166.01131 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
165.82365 664.41288 m
165.82365 664.50699 L
165.91748 664.60082 L
166.01131 664.69465 L
166.01131 664.69465 L
165.91748 664.78847 L
165.82365 664.88258 L
165.72983 664.97669 L
165.72983 664.97669 L
165.63543 664.97669 L
165.54161 664.88258 L
165.44778 664.78847 L
165.44778 664.69465 L
165.44778 664.60082 L
165.44778 664.50699 L
165.54161 664.41288 L
165.63543 664.41288 L
165.72983 664.41288 L
165.82365 664.41288 L
@c
F
@rax %Note: Object
164.32044 664.41288 164.88397 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
164.69631 664.41288 m
164.69631 664.50699 L
164.79014 664.60082 L
164.88397 664.69465 L
164.88397 664.69465 L
164.79014 664.78847 L
164.69631 664.88258 L
164.60220 664.97669 L
164.60220 664.97669 L
164.50809 664.97669 L
164.41455 664.88258 L
164.32044 664.78847 L
164.32044 664.69465 L
164.32044 664.60082 L
164.32044 664.50699 L
164.41455 664.41288 L
164.50809 664.41288 L
164.60220 664.41288 L
164.69631 664.41288 L
@c
F
@rax %Note: Object
163.19310 664.41288 163.75691 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
163.56898 664.41288 m
163.56898 664.50699 L
163.66309 664.60082 L
163.75691 664.69465 L
163.75691 664.69465 L
163.66309 664.78847 L
163.56898 664.88258 L
163.47487 664.97669 L
163.47487 664.97669 L
163.38104 664.97669 L
163.28721 664.88258 L
163.19310 664.78847 L
163.19310 664.69465 L
163.19310 664.60082 L
163.19310 664.50699 L
163.28721 664.41288 L
163.38104 664.41288 L
163.47487 664.41288 L
163.56898 664.41288 L
@c
F
@rax %Note: Object
162.06576 664.41288 162.62957 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
162.44164 664.41288 m
162.44164 664.50699 L
162.53546 664.60082 L
162.62957 664.69465 L
162.62957 664.69465 L
162.53546 664.78847 L
162.44164 664.88258 L
162.34753 664.97669 L
162.34753 664.97669 L
162.25370 664.97669 L
162.15959 664.88258 L
162.06576 664.78847 L
162.06576 664.69465 L
162.06576 664.60082 L
162.06576 664.50699 L
162.15959 664.41288 L
162.25370 664.41288 L
162.34753 664.41288 L
162.44164 664.41288 L
@c
F
@rax %Note: Object
160.93871 664.41288 161.50224 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
161.31430 664.41288 m
161.31430 664.50699 L
161.40841 664.60082 L
161.50224 664.69465 L
161.50224 664.69465 L
161.40841 664.78847 L
161.31430 664.88258 L
161.22047 664.97669 L
161.22047 664.97669 L
161.12636 664.97669 L
161.03254 664.88258 L
160.93871 664.78847 L
160.93871 664.69465 L
160.93871 664.60082 L
160.93871 664.50699 L
161.03254 664.41288 L
161.12636 664.41288 L
161.22047 664.41288 L
161.31430 664.41288 L
@c
F
@rax %Note: Object
159.81137 664.41288 160.37490 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
160.18696 664.41288 m
160.18696 664.50699 L
160.28107 664.60082 L
160.37490 664.69465 L
160.37490 664.69465 L
160.28107 664.78847 L
160.18696 664.88258 L
160.09313 664.97669 L
160.09313 664.97669 L
159.99902 664.97669 L
159.90520 664.88258 L
159.81137 664.78847 L
159.81137 664.69465 L
159.81137 664.60082 L
159.81137 664.50699 L
159.90520 664.41288 L
159.99902 664.41288 L
160.09313 664.41288 L
160.18696 664.41288 L
@c
F
@rax %Note: Object
158.68403 664.41288 159.24756 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
159.05962 664.41288 m
159.05962 664.50699 L
159.15373 664.60082 L
159.24756 664.69465 L
159.24756 664.69465 L
159.15373 664.78847 L
159.05962 664.88258 L
158.96551 664.97669 L
158.96551 664.97669 L
158.87169 664.97669 L
158.77786 664.88258 L
158.68403 664.78847 L
158.68403 664.69465 L
158.68403 664.60082 L
158.68403 664.50699 L
158.77786 664.41288 L
158.87169 664.41288 L
158.96551 664.41288 L
159.05962 664.41288 L
@c
F
@rax %Note: Object
157.55669 664.41288 158.12050 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
157.93228 664.41288 m
157.93228 664.50699 L
158.02639 664.60082 L
158.12050 664.69465 L
158.12050 664.69465 L
158.02639 664.78847 L
157.93228 664.88258 L
157.83846 664.97669 L
157.83846 664.97669 L
157.74463 664.97669 L
157.65080 664.88258 L
157.55669 664.78847 L
157.55669 664.69465 L
157.55669 664.60082 L
157.55669 664.50699 L
157.65080 664.41288 L
157.74463 664.41288 L
157.83846 664.41288 L
157.93228 664.41288 L
@c
F
@rax %Note: Object
156.42935 664.41288 156.99317 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
156.80494 664.41288 m
156.80494 664.50699 L
156.89906 664.60082 L
156.99317 664.69465 L
156.99317 664.69465 L
156.89906 664.78847 L
156.80494 664.88258 L
156.71112 664.97669 L
156.71112 664.97669 L
156.61729 664.97669 L
156.52318 664.88258 L
156.42935 664.78847 L
156.42935 664.69465 L
156.42935 664.60082 L
156.42935 664.50699 L
156.52318 664.41288 L
156.61729 664.41288 L
156.71112 664.41288 L
156.80494 664.41288 L
@c
F
@rax %Note: Object
155.30202 664.41288 155.86583 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
155.67789 664.41288 m
155.67789 664.50699 L
155.77143 664.60082 L
155.86583 664.69465 L
155.86583 664.69465 L
155.77143 664.78847 L
155.67789 664.88258 L
155.58406 664.97669 L
155.58406 664.97669 L
155.48995 664.97669 L
155.39613 664.88258 L
155.30202 664.78847 L
155.30202 664.69465 L
155.30202 664.60082 L
155.30202 664.50699 L
155.39613 664.41288 L
155.48995 664.41288 L
155.58406 664.41288 L
155.67789 664.41288 L
@c
F
@rax %Note: Object
154.17468 664.41288 154.73820 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
154.55055 664.41288 m
154.55055 664.50699 L
154.64438 664.60082 L
154.73820 664.69465 L
154.73820 664.69465 L
154.64438 664.78847 L
154.55055 664.88258 L
154.45672 664.97669 L
154.45672 664.97669 L
154.36261 664.97669 L
154.26879 664.88258 L
154.17468 664.78847 L
154.17468 664.69465 L
154.17468 664.60082 L
154.17468 664.50699 L
154.26879 664.41288 L
154.36261 664.41288 L
154.45672 664.41288 L
154.55055 664.41288 L
@c
F
@rax %Note: Object
153.04734 664.41288 153.61087 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
153.42321 664.41288 m
153.42321 664.50699 L
153.51704 664.60082 L
153.61087 664.69465 L
153.61087 664.69465 L
153.51704 664.78847 L
153.42321 664.88258 L
153.32910 664.97669 L
153.32910 664.97669 L
153.23528 664.97669 L
153.14145 664.88258 L
153.04734 664.78847 L
153.04734 664.69465 L
153.04734 664.60082 L
153.04734 664.50699 L
153.14145 664.41288 L
153.23528 664.41288 L
153.32910 664.41288 L
153.42321 664.41288 L
@c
F
@rax %Note: Object
151.92000 664.41288 152.48381 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
152.29587 664.41288 m
152.29587 664.50699 L
152.38998 664.60082 L
152.48381 664.69465 L
152.48381 664.69465 L
152.38998 664.78847 L
152.29587 664.88258 L
152.20205 664.97669 L
152.20205 664.97669 L
152.10822 664.97669 L
152.01411 664.88258 L
151.92000 664.78847 L
151.92000 664.69465 L
151.92000 664.60082 L
151.92000 664.50699 L
152.01411 664.41288 L
152.10822 664.41288 L
152.20205 664.41288 L
152.29587 664.41288 L
@c
F
@rax %Note: Object
150.79266 664.41288 151.35647 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
151.16854 664.41288 m
151.16854 664.50699 L
151.26265 664.60082 L
151.35647 664.69465 L
151.35647 664.69465 L
151.26265 664.78847 L
151.16854 664.88258 L
151.07471 664.97669 L
151.07471 664.97669 L
150.98088 664.97669 L
150.88649 664.88258 L
150.79266 664.78847 L
150.79266 664.69465 L
150.79266 664.60082 L
150.79266 664.50699 L
150.88649 664.41288 L
150.98088 664.41288 L
151.07471 664.41288 L
151.16854 664.41288 L
@c
F
@rax %Note: Object
149.66561 664.41288 150.22913 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
150.04120 664.41288 m
150.04120 664.50699 L
150.13502 664.60082 L
150.22913 664.69465 L
150.22913 664.69465 L
150.13502 664.78847 L
150.04120 664.88258 L
149.94737 664.97669 L
149.94737 664.97669 L
149.85354 664.97669 L
149.75943 664.88258 L
149.66561 664.78847 L
149.66561 664.69465 L
149.66561 664.60082 L
149.66561 664.50699 L
149.75943 664.41288 L
149.85354 664.41288 L
149.94737 664.41288 L
150.04120 664.41288 L
@c
F
@rax %Note: Object
148.53827 664.41288 149.10180 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
148.91414 664.41288 m
148.91414 664.50699 L
149.00797 664.60082 L
149.10180 664.69465 L
149.10180 664.69465 L
149.00797 664.78847 L
148.91414 664.88258 L
148.82031 664.97669 L
148.82031 664.97669 L
148.72620 664.97669 L
148.63209 664.88258 L
148.53827 664.78847 L
148.53827 664.69465 L
148.53827 664.60082 L
148.53827 664.50699 L
148.63209 664.41288 L
148.72620 664.41288 L
148.82031 664.41288 L
148.91414 664.41288 L
@c
F
@rax %Note: Object
147.41093 664.41288 147.97446 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
147.78680 664.41288 m
147.78680 664.50699 L
147.88063 664.60082 L
147.97446 664.69465 L
147.97446 664.69465 L
147.88063 664.78847 L
147.78680 664.88258 L
147.69269 664.97669 L
147.69269 664.97669 L
147.59858 664.97669 L
147.50476 664.88258 L
147.41093 664.78847 L
147.41093 664.69465 L
147.41093 664.60082 L
147.41093 664.50699 L
147.50476 664.41288 L
147.59858 664.41288 L
147.69269 664.41288 L
147.78680 664.41288 L
@c
F
@rax %Note: Object
146.28359 664.41288 146.84740 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
146.65946 664.41288 m
146.65946 664.50699 L
146.75357 664.60082 L
146.84740 664.69465 L
146.84740 664.69465 L
146.75357 664.78847 L
146.65946 664.88258 L
146.56564 664.97669 L
146.56564 664.97669 L
146.47153 664.97669 L
146.37770 664.88258 L
146.28359 664.78847 L
146.28359 664.69465 L
146.28359 664.60082 L
146.28359 664.50699 L
146.37770 664.41288 L
146.47153 664.41288 L
146.56564 664.41288 L
146.65946 664.41288 L
@c
F
@rax %Note: Object
145.15625 664.41288 145.72006 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
145.53213 664.41288 m
145.53213 664.50699 L
145.62624 664.60082 L
145.72006 664.69465 L
145.72006 664.69465 L
145.62624 664.78847 L
145.53213 664.88258 L
145.43830 664.97669 L
145.43830 664.97669 L
145.34419 664.97669 L
145.25008 664.88258 L
145.15625 664.78847 L
145.15625 664.69465 L
145.15625 664.60082 L
145.15625 664.50699 L
145.25008 664.41288 L
145.34419 664.41288 L
145.43830 664.41288 L
145.53213 664.41288 L
@c
F
@rax %Note: Object
144.02920 664.41288 144.59272 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
144.40479 664.41288 m
144.40479 664.50699 L
144.49861 664.60082 L
144.59272 664.69465 L
144.59272 664.69465 L
144.49861 664.78847 L
144.40479 664.88258 L
144.31068 664.97669 L
144.31068 664.97669 L
144.21685 664.97669 L
144.12274 664.88258 L
144.02920 664.78847 L
144.02920 664.69465 L
144.02920 664.60082 L
144.02920 664.50699 L
144.12274 664.41288 L
144.21685 664.41288 L
144.31068 664.41288 L
144.40479 664.41288 L
@c
F
@rax %Note: Object
142.90186 664.41288 143.46539 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
143.27773 664.41288 m
143.27773 664.50699 L
143.37156 664.60082 L
143.46539 664.69465 L
143.46539 664.69465 L
143.37156 664.78847 L
143.27773 664.88258 L
143.18362 664.97669 L
143.18362 664.97669 L
143.08951 664.97669 L
142.99569 664.88258 L
142.90186 664.78847 L
142.90186 664.69465 L
142.90186 664.60082 L
142.90186 664.50699 L
142.99569 664.41288 L
143.08951 664.41288 L
143.18362 664.41288 L
143.27773 664.41288 L
@c
F
@rax %Note: Object
141.77452 664.41288 142.33805 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
142.15011 664.41288 m
142.15011 664.50699 L
142.24422 664.60082 L
142.33805 664.69465 L
142.33805 664.69465 L
142.24422 664.78847 L
142.15011 664.88258 L
142.05600 664.97669 L
142.05600 664.97669 L
141.96217 664.97669 L
141.86835 664.88258 L
141.77452 664.78847 L
141.77452 664.69465 L
141.77452 664.60082 L
141.77452 664.50699 L
141.86835 664.41288 L
141.96217 664.41288 L
142.05600 664.41288 L
142.15011 664.41288 L
@c
F
@rax %Note: Object
140.64718 664.41288 141.21071 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
141.02277 664.41288 m
141.02277 664.50699 L
141.11717 664.60082 L
141.21071 664.69465 L
141.21071 664.69465 L
141.11717 664.78847 L
141.02277 664.88258 L
140.92894 664.97669 L
140.92894 664.97669 L
140.83512 664.97669 L
140.74129 664.88258 L
140.64718 664.78847 L
140.64718 664.69465 L
140.64718 664.60082 L
140.64718 664.50699 L
140.74129 664.41288 L
140.83512 664.41288 L
140.92894 664.41288 L
141.02277 664.41288 L
@c
F
@rax %Note: Object
139.51984 664.41288 140.08365 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
139.89543 664.41288 m
139.89543 664.50699 L
139.98983 664.60082 L
140.08365 664.69465 L
140.08365 664.69465 L
139.98983 664.78847 L
139.89543 664.88258 L
139.80161 664.97669 L
139.80161 664.97669 L
139.70778 664.97669 L
139.61395 664.88258 L
139.51984 664.78847 L
139.51984 664.69465 L
139.51984 664.60082 L
139.51984 664.50699 L
139.61395 664.41288 L
139.70778 664.41288 L
139.80161 664.41288 L
139.89543 664.41288 L
@c
F
@rax %Note: Object
138.39250 664.41288 138.95631 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
138.76809 664.41288 m
138.76809 664.50699 L
138.86220 664.60082 L
138.95631 664.69465 L
138.95631 664.69465 L
138.86220 664.78847 L
138.76809 664.88258 L
138.67427 664.97669 L
138.67427 664.97669 L
138.58044 664.97669 L
138.48633 664.88258 L
138.39250 664.78847 L
138.39250 664.69465 L
138.39250 664.60082 L
138.39250 664.50699 L
138.48633 664.41288 L
138.58044 664.41288 L
138.67427 664.41288 L
138.76809 664.41288 L
@c
F
@rax %Note: Object
137.26545 664.41288 137.82898 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
137.64104 664.41288 m
137.64104 664.50699 L
137.73487 664.60082 L
137.82898 664.69465 L
137.82898 664.69465 L
137.73487 664.78847 L
137.64104 664.88258 L
137.54721 664.97669 L
137.54721 664.97669 L
137.45310 664.97669 L
137.35928 664.88258 L
137.26545 664.78847 L
137.26545 664.69465 L
137.26545 664.60082 L
137.26545 664.50699 L
137.35928 664.41288 L
137.45310 664.41288 L
137.54721 664.41288 L
137.64104 664.41288 L
@c
F
@rax %Note: Object
136.13811 664.41288 136.70164 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
136.51370 664.41288 m
136.51370 664.50699 L
136.60753 664.60082 L
136.70164 664.69465 L
136.70164 664.69465 L
136.60753 664.78847 L
136.51370 664.88258 L
136.41959 664.97669 L
136.41959 664.97669 L
136.32576 664.97669 L
136.23194 664.88258 L
136.13811 664.78847 L
136.13811 664.69465 L
136.13811 664.60082 L
136.13811 664.50699 L
136.23194 664.41288 L
136.32576 664.41288 L
136.41959 664.41288 L
136.51370 664.41288 L
@c
F
@rax %Note: Object
135.01049 664.41288 135.57430 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
135.38636 664.41288 m
135.38636 664.50699 L
135.48019 664.60082 L
135.57430 664.69465 L
135.57430 664.69465 L
135.48019 664.78847 L
135.38636 664.88258 L
135.29254 664.97669 L
135.29254 664.97669 L
135.19871 664.97669 L
135.10488 664.88258 L
135.01049 664.78847 L
135.01049 664.69465 L
135.01049 664.60082 L
135.01049 664.50699 L
135.10488 664.41288 L
135.19871 664.41288 L
135.29254 664.41288 L
135.38636 664.41288 L
@c
F
@rax %Note: Object
133.88315 664.41288 134.44696 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
134.25902 664.41288 m
134.25902 664.50699 L
134.35313 664.60082 L
134.44696 664.69465 L
134.44696 664.69465 L
134.35313 664.78847 L
134.25902 664.88258 L
134.16520 664.97669 L
134.16520 664.97669 L
134.07137 664.97669 L
133.97754 664.88258 L
133.88315 664.78847 L
133.88315 664.69465 L
133.88315 664.60082 L
133.88315 664.50699 L
133.97754 664.41288 L
134.07137 664.41288 L
134.16520 664.41288 L
134.25902 664.41288 L
@c
F
@rax %Note: Object
132.75581 664.41288 133.31962 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
133.13169 664.41288 m
133.13169 664.50699 L
133.22551 664.60082 L
133.31962 664.69465 L
133.31962 664.69465 L
133.22551 664.78847 L
133.13169 664.88258 L
133.03786 664.97669 L
133.03786 664.97669 L
132.94403 664.97669 L
132.84992 664.88258 L
132.75581 664.78847 L
132.75581 664.69465 L
132.75581 664.60082 L
132.75581 664.50699 L
132.84992 664.41288 L
132.94403 664.41288 L
133.03786 664.41288 L
133.13169 664.41288 L
@c
F
@rax %Note: Object
131.62876 664.41288 132.19228 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
132.00463 664.41288 m
132.00463 664.50699 L
132.09846 664.60082 L
132.19228 664.69465 L
132.19228 664.69465 L
132.09846 664.78847 L
132.00463 664.88258 L
131.91080 664.97669 L
131.91080 664.97669 L
131.81669 664.97669 L
131.72258 664.88258 L
131.62876 664.78847 L
131.62876 664.69465 L
131.62876 664.60082 L
131.62876 664.50699 L
131.72258 664.41288 L
131.81669 664.41288 L
131.91080 664.41288 L
132.00463 664.41288 L
@c
F
@rax %Note: Object
130.50142 664.41288 131.06494 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
130.87729 664.41288 m
130.87729 664.50699 L
130.97112 664.60082 L
131.06494 664.69465 L
131.06494 664.69465 L
130.97112 664.78847 L
130.87729 664.88258 L
130.78318 664.97669 L
130.78318 664.97669 L
130.68935 664.97669 L
130.59524 664.88258 L
130.50142 664.78847 L
130.50142 664.69465 L
130.50142 664.60082 L
130.50142 664.50699 L
130.59524 664.41288 L
130.68935 664.41288 L
130.78318 664.41288 L
130.87729 664.41288 L
@c
F
@rax %Note: Object
129.37408 664.41288 129.93761 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
129.74995 664.41288 m
129.74995 664.50699 L
129.84378 664.60082 L
129.93761 664.69465 L
129.93761 664.69465 L
129.84378 664.78847 L
129.74995 664.88258 L
129.65584 664.97669 L
129.65584 664.97669 L
129.56230 664.97669 L
129.46819 664.88258 L
129.37408 664.78847 L
129.37408 664.69465 L
129.37408 664.60082 L
129.37408 664.50699 L
129.46819 664.41288 L
129.56230 664.41288 L
129.65584 664.41288 L
129.74995 664.41288 L
@c
F
@rax %Note: Object
128.24674 664.41288 128.81055 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.62261 664.41288 m
128.62261 664.50699 L
128.71672 664.60082 L
128.81055 664.69465 L
128.81055 664.69465 L
128.71672 664.78847 L
128.62261 664.88258 L
128.52879 664.97669 L
128.52879 664.97669 L
128.43468 664.97669 L
128.34085 664.88258 L
128.24674 664.78847 L
128.24674 664.69465 L
128.24674 664.60082 L
128.24674 664.50699 L
128.34085 664.41288 L
128.43468 664.41288 L
128.52879 664.41288 L
128.62261 664.41288 L
@c
F
@rax %Note: Object
127.11940 664.41288 127.68321 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
127.49528 664.41288 m
127.49528 664.50699 L
127.58910 664.60082 L
127.68321 664.69465 L
127.68321 664.69465 L
127.58910 664.78847 L
127.49528 664.88258 L
127.40145 664.97669 L
127.40145 664.97669 L
127.30734 664.97669 L
127.21323 664.88258 L
127.11940 664.78847 L
127.11940 664.69465 L
127.11940 664.60082 L
127.11940 664.50699 L
127.21323 664.41288 L
127.30734 664.41288 L
127.40145 664.41288 L
127.49528 664.41288 L
@c
F
@rax %Note: Object
125.99235 664.41288 126.55587 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
126.36822 664.41288 m
126.36822 664.50699 L
126.46205 664.60082 L
126.55587 664.69465 L
126.55587 664.69465 L
126.46205 664.78847 L
126.36822 664.88258 L
126.27411 664.97669 L
126.27411 664.97669 L
126.18000 664.97669 L
126.08617 664.88258 L
125.99235 664.78847 L
125.99235 664.69465 L
125.99235 664.60082 L
125.99235 664.50699 L
126.08617 664.41288 L
126.18000 664.41288 L
126.27411 664.41288 L
126.36822 664.41288 L
@c
F
@rax %Note: Object
124.86501 664.41288 125.42854 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
125.24088 664.41288 m
125.24088 664.50699 L
125.33471 664.60082 L
125.42854 664.69465 L
125.42854 664.69465 L
125.33471 664.78847 L
125.24088 664.88258 L
125.14677 664.97669 L
125.14677 664.97669 L
125.05266 664.97669 L
124.95883 664.88258 L
124.86501 664.78847 L
124.86501 664.69465 L
124.86501 664.60082 L
124.86501 664.50699 L
124.95883 664.41288 L
125.05266 664.41288 L
125.14677 664.41288 L
125.24088 664.41288 L
@c
F
@rax %Note: Object
123.73767 664.41288 124.30120 664.97669 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 664.60082 m
124.30120 664.69465 L
124.20737 664.78847 L
124.11354 664.88258 L
124.01915 664.97669 L
124.01915 664.97669 L
123.92532 664.88258 L
123.83150 664.78847 L
123.73767 664.69465 L
123.73767 664.69465 L
123.73767 664.69465 L
123.83150 664.60082 L
123.92532 664.50699 L
124.01915 664.41288 L
124.01915 664.41288 L
124.11354 664.50699 L
124.20737 664.60082 L
124.30120 664.60082 L
@c
F
@rax %Note: Object
123.73767 663.28554 124.30120 663.84935 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 663.47348 m
124.30120 663.56731 L
124.20737 663.66113 L
124.11354 663.75496 L
124.01915 663.84935 L
124.01915 663.84935 L
123.92532 663.75496 L
123.83150 663.66113 L
123.73767 663.56731 L
123.73767 663.56731 L
123.73767 663.56731 L
123.83150 663.47348 L
123.92532 663.37937 L
124.01915 663.28554 L
124.01915 663.28554 L
124.11354 663.37937 L
124.20737 663.47348 L
124.30120 663.47348 L
@c
F
@rax %Note: Object
123.73767 662.15792 124.30120 662.72173 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 662.34614 m
124.30120 662.43997 L
124.20737 662.53380 L
124.11354 662.62762 L
124.01915 662.72173 L
124.01915 662.72173 L
123.92532 662.62762 L
123.83150 662.53380 L
123.73767 662.43997 L
123.73767 662.43997 L
123.73767 662.43997 L
123.83150 662.34614 L
123.92532 662.25203 L
124.01915 662.15792 L
124.01915 662.15792 L
124.11354 662.25203 L
124.20737 662.34614 L
124.30120 662.34614 L
@c
F
@rax %Note: Object
123.73767 661.03087 124.30120 661.59439 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 661.21880 m
124.30120 661.31291 L
124.20737 661.40674 L
124.11354 661.50057 L
124.01915 661.59439 L
124.01915 661.59439 L
123.92532 661.50057 L
123.83150 661.40674 L
123.73767 661.31291 L
123.73767 661.31291 L
123.73767 661.31291 L
123.83150 661.21880 L
123.92532 661.12498 L
124.01915 661.03087 L
124.01915 661.03087 L
124.11354 661.12498 L
124.20737 661.21880 L
124.30120 661.21880 L
@c
F
@rax %Note: Object
123.73767 659.90353 124.30120 660.46706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 660.09146 m
124.30120 660.18529 L
124.20737 660.27940 L
124.11354 660.37323 L
124.01915 660.46706 L
124.01915 660.46706 L
123.92532 660.37323 L
123.83150 660.27940 L
123.73767 660.18529 L
123.73767 660.18529 L
123.73767 660.18529 L
123.83150 660.09146 L
123.92532 659.99764 L
124.01915 659.90353 L
124.01915 659.90353 L
124.11354 659.99764 L
124.20737 660.09146 L
124.30120 660.09146 L
@c
F
@rax %Note: Object
123.73767 658.77619 124.30120 659.33972 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 658.96441 m
124.30120 659.05824 L
124.20737 659.15206 L
124.11354 659.24589 L
124.01915 659.33972 L
124.01915 659.33972 L
123.92532 659.24589 L
123.83150 659.15206 L
123.73767 659.05824 L
123.73767 659.05824 L
123.73767 659.05824 L
123.83150 658.96441 L
123.92532 658.87030 L
124.01915 658.77619 L
124.01915 658.77619 L
124.11354 658.87030 L
124.20737 658.96441 L
124.30120 658.96441 L
@c
F
@rax %Note: Object
123.73767 657.64885 124.30120 658.21266 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 657.83707 m
124.30120 657.93090 L
124.20737 658.02472 L
124.11354 658.11883 L
124.01915 658.21266 L
124.01915 658.21266 L
123.92532 658.11883 L
123.83150 658.02472 L
123.73767 657.93090 L
123.73767 657.93090 L
123.73767 657.93090 L
123.83150 657.83707 L
123.92532 657.74268 L
124.01915 657.64885 L
124.01915 657.64885 L
124.11354 657.74268 L
124.20737 657.83707 L
124.30120 657.83707 L
@c
F
@rax %Note: Object
123.73767 656.52151 124.30120 657.08532 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 656.70973 m
124.30120 656.80356 L
124.20737 656.89739 L
124.11354 656.99121 L
124.01915 657.08532 L
124.01915 657.08532 L
123.92532 656.99121 L
123.83150 656.89739 L
123.73767 656.80356 L
123.73767 656.80356 L
123.73767 656.80356 L
123.83150 656.70973 L
123.92532 656.61534 L
124.01915 656.52151 L
124.01915 656.52151 L
124.11354 656.61534 L
124.20737 656.70973 L
124.30120 656.70973 L
@c
F
@rax %Note: Object
123.73767 655.39446 124.30120 655.95798 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 655.58211 m
124.30120 655.67650 L
124.20737 655.77033 L
124.11354 655.86416 L
124.01915 655.95798 L
124.01915 655.95798 L
123.92532 655.86416 L
123.83150 655.77033 L
123.73767 655.67650 L
123.73767 655.67650 L
123.73767 655.67650 L
123.83150 655.58211 L
123.92532 655.48828 L
124.01915 655.39446 L
124.01915 655.39446 L
124.11354 655.48828 L
124.20737 655.58211 L
124.30120 655.58211 L
@c
F
@rax %Note: Object
123.73767 654.26712 124.30120 654.83065 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 654.45477 m
124.30120 654.54888 L
124.20737 654.64299 L
124.11354 654.73682 L
124.01915 654.83065 L
124.01915 654.83065 L
123.92532 654.73682 L
123.83150 654.64299 L
123.73767 654.54888 L
123.73767 654.54888 L
123.73767 654.54888 L
123.83150 654.45477 L
123.92532 654.36094 L
124.01915 654.26712 L
124.01915 654.26712 L
124.11354 654.36094 L
124.20737 654.45477 L
124.30120 654.45477 L
@c
F
@rax %Note: Object
123.73767 653.13978 124.30120 653.70331 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 653.32772 m
124.30120 653.42154 L
124.20737 653.51565 L
124.11354 653.60948 L
124.01915 653.70331 L
124.01915 653.70331 L
123.92532 653.60948 L
123.83150 653.51565 L
123.73767 653.42154 L
123.73767 653.42154 L
123.73767 653.42154 L
123.83150 653.32772 L
123.92532 653.23389 L
124.01915 653.13978 L
124.01915 653.13978 L
124.11354 653.23389 L
124.20737 653.32772 L
124.30120 653.32772 L
@c
F
@rax %Note: Object
123.73767 652.01244 124.30120 652.57625 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 652.20038 m
124.30120 652.29420 L
124.20737 652.38831 L
124.11354 652.48243 L
124.01915 652.57625 L
124.01915 652.57625 L
123.92532 652.48243 L
123.83150 652.38831 L
123.73767 652.29420 L
123.73767 652.29420 L
123.73767 652.29420 L
123.83150 652.20038 L
123.92532 652.10627 L
124.01915 652.01244 L
124.01915 652.01244 L
124.11354 652.10627 L
124.20737 652.20038 L
124.30120 652.20038 L
@c
F
@rax %Note: Object
123.73767 650.88510 124.30120 651.44891 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 651.07304 m
124.30120 651.16687 L
124.20737 651.26098 L
124.11354 651.35480 L
124.01915 651.44891 L
124.01915 651.44891 L
123.92532 651.35480 L
123.83150 651.26098 L
123.73767 651.16687 L
123.73767 651.16687 L
123.73767 651.16687 L
123.83150 651.07304 L
123.92532 650.97893 L
124.01915 650.88510 L
124.01915 650.88510 L
124.11354 650.97893 L
124.20737 651.07304 L
124.30120 651.07304 L
@c
F
@rax %Note: Object
123.73767 649.75805 124.30120 650.32157 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 649.94570 m
124.30120 650.03981 L
124.20737 650.13364 L
124.11354 650.22775 L
124.01915 650.32157 L
124.01915 650.32157 L
123.92532 650.22775 L
123.83150 650.13364 L
123.73767 650.03981 L
123.73767 650.03981 L
123.73767 650.03981 L
123.83150 649.94570 L
123.92532 649.85187 L
124.01915 649.75805 L
124.01915 649.75805 L
124.11354 649.85187 L
124.20737 649.94570 L
124.30120 649.94570 L
@c
F
@rax %Note: Object
123.73767 648.63071 124.30120 649.19424 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 648.81836 m
124.30120 648.91219 L
124.20737 649.00630 L
124.11354 649.10041 L
124.01915 649.19424 L
124.01915 649.19424 L
123.92532 649.10041 L
123.83150 649.00630 L
123.73767 648.91219 L
123.73767 648.91219 L
123.73767 648.91219 L
123.83150 648.81836 L
123.92532 648.72454 L
124.01915 648.63071 L
124.01915 648.63071 L
124.11354 648.72454 L
124.20737 648.81836 L
124.30120 648.81836 L
@c
F
@rax %Note: Object
123.73767 647.50337 124.30120 648.06690 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 647.69102 m
124.30120 647.78485 L
124.20737 647.87896 L
124.11354 647.97307 L
124.01915 648.06690 L
124.01915 648.06690 L
123.92532 647.97307 L
123.83150 647.87896 L
123.73767 647.78485 L
123.73767 647.78485 L
123.73767 647.78485 L
123.83150 647.69102 L
123.92532 647.59720 L
124.01915 647.50337 L
124.01915 647.50337 L
124.11354 647.59720 L
124.20737 647.69102 L
124.30120 647.69102 L
@c
F
@rax %Note: Object
123.73767 646.37603 124.30120 646.93984 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 646.56397 m
124.30120 646.65780 L
124.20737 646.75162 L
124.11354 646.84573 L
124.01915 646.93984 L
124.01915 646.93984 L
123.92532 646.84573 L
123.83150 646.75162 L
123.73767 646.65780 L
123.73767 646.65780 L
123.73767 646.65780 L
123.83150 646.56397 L
123.92532 646.47014 L
124.01915 646.37603 L
124.01915 646.37603 L
124.11354 646.47014 L
124.20737 646.56397 L
124.30120 646.56397 L
@c
F
@rax %Note: Object
123.73767 645.24869 124.30120 645.81250 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 645.43663 m
124.30120 645.53046 L
124.20737 645.62428 L
124.11354 645.71811 L
124.01915 645.81250 L
124.01915 645.81250 L
123.92532 645.71811 L
123.83150 645.62428 L
123.73767 645.53046 L
123.73767 645.53046 L
123.73767 645.53046 L
123.83150 645.43663 L
123.92532 645.34252 L
124.01915 645.24869 L
124.01915 645.24869 L
124.11354 645.34252 L
124.20737 645.43663 L
124.30120 645.43663 L
@c
F
@rax %Note: Object
123.73767 644.12164 124.30120 644.68517 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 644.30929 m
124.30120 644.40340 L
124.20737 644.49723 L
124.11354 644.59106 L
124.01915 644.68517 L
124.01915 644.68517 L
123.92532 644.59106 L
123.83150 644.49723 L
123.73767 644.40340 L
123.73767 644.40340 L
123.73767 644.40340 L
123.83150 644.30929 L
123.92532 644.21546 L
124.01915 644.12164 L
124.01915 644.12164 L
124.11354 644.21546 L
124.20737 644.30929 L
124.30120 644.30929 L
@c
F
@rax %Note: Object
123.73767 642.99402 124.30120 643.55783 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 643.18195 m
124.30120 643.27578 L
124.20737 643.36989 L
124.11354 643.46372 L
124.01915 643.55783 L
124.01915 643.55783 L
123.92532 643.46372 L
123.83150 643.36989 L
123.73767 643.27578 L
123.73767 643.27578 L
123.73767 643.27578 L
123.83150 643.18195 L
123.92532 643.08813 L
124.01915 642.99402 L
124.01915 642.99402 L
124.11354 643.08813 L
124.20737 643.18195 L
124.30120 643.18195 L
@c
F
@rax %Note: Object
123.73767 641.86668 124.30120 642.43020 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 642.05461 m
124.30120 642.14844 L
124.20737 642.24255 L
124.11354 642.33638 L
124.01915 642.43020 L
124.01915 642.43020 L
123.92532 642.33638 L
123.83150 642.24255 L
123.73767 642.14844 L
123.73767 642.14844 L
123.73767 642.14844 L
123.83150 642.05461 L
123.92532 641.96079 L
124.01915 641.86668 L
124.01915 641.86668 L
124.11354 641.96079 L
124.20737 642.05461 L
124.30120 642.05461 L
@c
F
@rax %Note: Object
123.73767 640.73934 124.30120 641.30315 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 640.92756 m
124.30120 641.02139 L
124.20737 641.11521 L
124.11354 641.20932 L
124.01915 641.30315 L
124.01915 641.30315 L
123.92532 641.20932 L
123.83150 641.11521 L
123.73767 641.02139 L
123.73767 641.02139 L
123.73767 641.02139 L
123.83150 640.92756 L
123.92532 640.83373 L
124.01915 640.73934 L
124.01915 640.73934 L
124.11354 640.83373 L
124.20737 640.92756 L
124.30120 640.92756 L
@c
F
@rax %Note: Object
123.73767 639.61200 124.30120 640.17581 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 639.80022 m
124.30120 639.89405 L
124.20737 639.98787 L
124.11354 640.08170 L
124.01915 640.17581 L
124.01915 640.17581 L
123.92532 640.08170 L
123.83150 639.98787 L
123.73767 639.89405 L
123.73767 639.89405 L
123.73767 639.89405 L
123.83150 639.80022 L
123.92532 639.70611 L
124.01915 639.61200 L
124.01915 639.61200 L
124.11354 639.70611 L
124.20737 639.80022 L
124.30120 639.80022 L
@c
F
@rax %Note: Object
123.73767 638.48494 124.30120 639.04847 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 638.67288 m
124.30120 638.76699 L
124.20737 638.86054 L
124.11354 638.95436 L
124.01915 639.04847 L
124.01915 639.04847 L
123.92532 638.95436 L
123.83150 638.86054 L
123.73767 638.76699 L
123.73767 638.76699 L
123.73767 638.76699 L
123.83150 638.67288 L
123.92532 638.57877 L
124.01915 638.48494 L
124.01915 638.48494 L
124.11354 638.57877 L
124.20737 638.67288 L
124.30120 638.67288 L
@c
F
@rax %Note: Object
123.73767 637.35761 124.30120 637.92113 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 637.54554 m
124.30120 637.63937 L
124.20737 637.73348 L
124.11354 637.82731 L
124.01915 637.92113 L
124.01915 637.92113 L
123.92532 637.82731 L
123.83150 637.73348 L
123.73767 637.63937 L
123.73767 637.63937 L
123.73767 637.63937 L
123.83150 637.54554 L
123.92532 637.45143 L
124.01915 637.35761 L
124.01915 637.35761 L
124.11354 637.45143 L
124.20737 637.54554 L
124.30120 637.54554 L
@c
F
@rax %Note: Object
123.73767 636.23027 124.30120 636.79380 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 636.41792 m
124.30120 636.51203 L
124.20737 636.60614 L
124.11354 636.69997 L
124.01915 636.79380 L
124.01915 636.79380 L
123.92532 636.69997 L
123.83150 636.60614 L
123.73767 636.51203 L
123.73767 636.51203 L
123.73767 636.51203 L
123.83150 636.41792 L
123.92532 636.32409 L
124.01915 636.23027 L
124.01915 636.23027 L
124.11354 636.32409 L
124.20737 636.41792 L
124.30120 636.41792 L
@c
F
@rax %Note: Object
123.73767 635.10293 124.30120 635.66674 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 635.29087 m
124.30120 635.38498 L
124.20737 635.47880 L
124.11354 635.57291 L
124.01915 635.66674 L
124.01915 635.66674 L
123.92532 635.57291 L
123.83150 635.47880 L
123.73767 635.38498 L
123.73767 635.38498 L
123.73767 635.38498 L
123.83150 635.29087 L
123.92532 635.19704 L
124.01915 635.10293 L
124.01915 635.10293 L
124.11354 635.19704 L
124.20737 635.29087 L
124.30120 635.29087 L
@c
F
@rax %Note: Object
123.73767 633.97559 124.30120 634.53940 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 634.16353 m
124.30120 634.25764 L
124.20737 634.35146 L
124.11354 634.44529 L
124.01915 634.53940 L
124.01915 634.53940 L
123.92532 634.44529 L
123.83150 634.35146 L
123.73767 634.25764 L
123.73767 634.25764 L
123.73767 634.25764 L
123.83150 634.16353 L
123.92532 634.06942 L
124.01915 633.97559 L
124.01915 633.97559 L
124.11354 634.06942 L
124.20737 634.16353 L
124.30120 634.16353 L
@c
F
@rax %Note: Object
123.73767 632.84854 124.30120 633.41206 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 633.03619 m
124.30120 633.13002 L
124.20737 633.22413 L
124.11354 633.31795 L
124.01915 633.41206 L
124.01915 633.41206 L
123.92532 633.31795 L
123.83150 633.22413 L
123.73767 633.13002 L
123.73767 633.13002 L
123.73767 633.13002 L
123.83150 633.03619 L
123.92532 632.94236 L
124.01915 632.84854 L
124.01915 632.84854 L
124.11354 632.94236 L
124.20737 633.03619 L
124.30120 633.03619 L
@c
F
@rax %Note: Object
123.73767 631.72120 124.30120 632.28472 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 631.90885 m
124.30120 632.00268 L
124.20737 632.09707 L
124.11354 632.19090 L
124.01915 632.28472 L
124.01915 632.28472 L
123.92532 632.19090 L
123.83150 632.09707 L
123.73767 632.00268 L
123.73767 632.00268 L
123.73767 632.00268 L
123.83150 631.90885 L
123.92532 631.81502 L
124.01915 631.72120 L
124.01915 631.72120 L
124.11354 631.81502 L
124.20737 631.90885 L
124.30120 631.90885 L
@c
F
@rax %Note: Object
123.73767 630.59386 124.30120 631.15739 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 630.78151 m
124.30120 630.87534 L
124.20737 630.96973 L
124.11354 631.06356 L
124.01915 631.15739 L
124.01915 631.15739 L
123.92532 631.06356 L
123.83150 630.96973 L
123.73767 630.87534 L
123.73767 630.87534 L
123.73767 630.87534 L
123.83150 630.78151 L
123.92532 630.68769 L
124.01915 630.59386 L
124.01915 630.59386 L
124.11354 630.68769 L
124.20737 630.78151 L
124.30120 630.78151 L
@c
F
@rax %Note: Object
123.73767 629.46652 124.30120 630.03033 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.30120 629.65446 m
124.30120 629.74828 L
124.20737 629.84211 L
124.11354 629.93650 L
124.01915 630.03033 L
124.01915 630.03033 L
123.92532 629.93650 L
123.83150 629.84211 L
123.73767 629.74828 L
123.73767 629.74828 L
123.73767 629.74828 L
123.83150 629.65446 L
123.92532 629.56063 L
124.01915 629.46652 L
124.01915 629.46652 L
124.11354 629.56063 L
124.20737 629.65446 L
124.30120 629.65446 L
@c
F
@rax %Note: Object
230.92526 661.68879 236.74961 667.60668 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
230.92526 661.68879 m
236.74961 664.69465 L
230.92526 667.60668 L
230.92526 661.68879 L
@c
F
@rax %Note: Object
185.73902 42.14324 186.30283 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
186.11490 42.14324 m
186.11490 42.23707 L
186.20901 42.33090 L
186.30283 42.42501 L
186.30283 42.42501 L
186.20901 42.51883 L
186.11490 42.61294 L
186.02107 42.70706 L
186.02107 42.70706 L
185.92696 42.70706 L
185.83313 42.61294 L
185.73902 42.51883 L
185.73902 42.42501 L
185.73902 42.33090 L
185.73902 42.23707 L
185.83313 42.14324 L
185.92696 42.14324 L
186.02107 42.14324 L
186.11490 42.14324 L
@c
F
@rax %Note: Object
184.61197 42.14324 185.17550 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
184.98756 42.14324 m
184.98756 42.23707 L
185.08139 42.33090 L
185.17550 42.42501 L
185.17550 42.42501 L
185.08139 42.51883 L
184.98756 42.61294 L
184.89373 42.70706 L
184.89373 42.70706 L
184.79962 42.70706 L
184.70580 42.61294 L
184.61197 42.51883 L
184.61197 42.42501 L
184.61197 42.33090 L
184.61197 42.23707 L
184.70580 42.14324 L
184.79962 42.14324 L
184.89373 42.14324 L
184.98756 42.14324 L
@c
F
@rax %Note: Object
183.48463 42.14324 184.04816 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
183.86050 42.14324 m
183.86050 42.23707 L
183.95433 42.33090 L
184.04816 42.42501 L
184.04816 42.42501 L
183.95433 42.51883 L
183.86050 42.61294 L
183.76639 42.70706 L
183.76639 42.70706 L
183.67228 42.70706 L
183.57846 42.61294 L
183.48463 42.51883 L
183.48463 42.42501 L
183.48463 42.33090 L
183.48463 42.23707 L
183.57846 42.14324 L
183.67228 42.14324 L
183.76639 42.14324 L
183.86050 42.14324 L
@c
F
@rax %Note: Object
182.35729 42.14324 182.92082 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
182.73317 42.14324 m
182.73317 42.23707 L
182.82699 42.33090 L
182.92082 42.42501 L
182.92082 42.42501 L
182.82699 42.51883 L
182.73317 42.61294 L
182.63877 42.70706 L
182.63877 42.70706 L
182.54494 42.70706 L
182.45112 42.61294 L
182.35729 42.51883 L
182.35729 42.42501 L
182.35729 42.33090 L
182.35729 42.23707 L
182.45112 42.14324 L
182.54494 42.14324 L
182.63877 42.14324 L
182.73317 42.14324 L
@c
F
@rax %Note: Object
181.22995 42.14324 181.79376 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
181.60583 42.14324 m
181.60583 42.23707 L
181.69994 42.33090 L
181.79376 42.42501 L
181.79376 42.42501 L
181.69994 42.51883 L
181.60583 42.61294 L
181.51172 42.70706 L
181.51172 42.70706 L
181.41789 42.70706 L
181.32406 42.61294 L
181.22995 42.51883 L
181.22995 42.42501 L
181.22995 42.33090 L
181.22995 42.23707 L
181.32406 42.14324 L
181.41789 42.14324 L
181.51172 42.14324 L
181.60583 42.14324 L
@c
F
@rax %Note: Object
180.10261 42.14324 180.66643 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
180.47820 42.14324 m
180.47820 42.23707 L
180.57260 42.33090 L
180.66643 42.42501 L
180.66643 42.42501 L
180.57260 42.51883 L
180.47820 42.61294 L
180.38438 42.70706 L
180.38438 42.70706 L
180.29055 42.70706 L
180.19672 42.61294 L
180.10261 42.51883 L
180.10261 42.42501 L
180.10261 42.33090 L
180.10261 42.23707 L
180.19672 42.14324 L
180.29055 42.14324 L
180.38438 42.14324 L
180.47820 42.14324 L
@c
F
@rax %Note: Object
178.97528 42.14324 179.53909 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
179.35087 42.14324 m
179.35087 42.23707 L
179.44498 42.33090 L
179.53909 42.42501 L
179.53909 42.42501 L
179.44498 42.51883 L
179.35087 42.61294 L
179.25704 42.70706 L
179.25704 42.70706 L
179.16321 42.70706 L
179.06910 42.61294 L
178.97528 42.51883 L
178.97528 42.42501 L
178.97528 42.33090 L
178.97528 42.23707 L
179.06910 42.14324 L
179.16321 42.14324 L
179.25704 42.14324 L
179.35087 42.14324 L
@c
F
@rax %Note: Object
177.84822 42.14324 178.41175 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
178.22381 42.14324 m
178.22381 42.23707 L
178.31792 42.33090 L
178.41175 42.42501 L
178.41175 42.42501 L
178.31792 42.51883 L
178.22381 42.61294 L
178.12998 42.70706 L
178.12998 42.70706 L
178.03587 42.70706 L
177.94205 42.61294 L
177.84822 42.51883 L
177.84822 42.42501 L
177.84822 42.33090 L
177.84822 42.23707 L
177.94205 42.14324 L
178.03587 42.14324 L
178.12998 42.14324 L
178.22381 42.14324 L
@c
F
@rax %Note: Object
176.72088 42.14324 177.28441 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
177.09647 42.14324 m
177.09647 42.23707 L
177.19030 42.33090 L
177.28441 42.42501 L
177.28441 42.42501 L
177.19030 42.51883 L
177.09647 42.61294 L
177.00236 42.70706 L
177.00236 42.70706 L
176.90854 42.70706 L
176.81471 42.61294 L
176.72088 42.51883 L
176.72088 42.42501 L
176.72088 42.33090 L
176.72088 42.23707 L
176.81471 42.14324 L
176.90854 42.14324 L
177.00236 42.14324 L
177.09647 42.14324 L
@c
F
@rax %Note: Object
175.59354 42.14324 176.15707 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
175.96913 42.14324 m
175.96913 42.23707 L
176.06296 42.33090 L
176.15707 42.42501 L
176.15707 42.42501 L
176.06296 42.51883 L
175.96913 42.61294 L
175.87531 42.70706 L
175.87531 42.70706 L
175.78148 42.70706 L
175.68765 42.61294 L
175.59354 42.51883 L
175.59354 42.42501 L
175.59354 42.33090 L
175.59354 42.23707 L
175.68765 42.14324 L
175.78148 42.14324 L
175.87531 42.14324 L
175.96913 42.14324 L
@c
F
@rax %Note: Object
174.46620 42.14324 175.03002 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
174.84180 42.14324 m
174.84180 42.23707 L
174.93591 42.33090 L
175.03002 42.42501 L
175.03002 42.42501 L
174.93591 42.51883 L
174.84180 42.61294 L
174.74797 42.70706 L
174.74797 42.70706 L
174.65414 42.70706 L
174.56031 42.61294 L
174.46620 42.51883 L
174.46620 42.42501 L
174.46620 42.33090 L
174.46620 42.23707 L
174.56031 42.14324 L
174.65414 42.14324 L
174.74797 42.14324 L
174.84180 42.14324 L
@c
F
@rax %Note: Object
173.33858 42.14324 173.90239 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
173.71446 42.14324 m
173.71446 42.23707 L
173.80828 42.33090 L
173.90239 42.42501 L
173.90239 42.42501 L
173.80828 42.51883 L
173.71446 42.61294 L
173.62063 42.70706 L
173.62063 42.70706 L
173.52680 42.70706 L
173.43269 42.61294 L
173.33858 42.51883 L
173.33858 42.42501 L
173.33858 42.33090 L
173.33858 42.23707 L
173.43269 42.14324 L
173.52680 42.14324 L
173.62063 42.14324 L
173.71446 42.14324 L
@c
F
@rax %Note: Object
172.21153 42.14324 172.77506 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
172.58740 42.14324 m
172.58740 42.23707 L
172.68123 42.33090 L
172.77506 42.42501 L
172.77506 42.42501 L
172.68123 42.51883 L
172.58740 42.61294 L
172.49357 42.70706 L
172.49357 42.70706 L
172.39946 42.70706 L
172.30564 42.61294 L
172.21153 42.51883 L
172.21153 42.42501 L
172.21153 42.33090 L
172.21153 42.23707 L
172.30564 42.14324 L
172.39946 42.14324 L
172.49357 42.14324 L
172.58740 42.14324 L
@c
F
@rax %Note: Object
171.08419 42.14324 171.64772 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
171.46006 42.14324 m
171.46006 42.23707 L
171.55389 42.33090 L
171.64772 42.42501 L
171.64772 42.42501 L
171.55389 42.51883 L
171.46006 42.61294 L
171.36624 42.70706 L
171.36624 42.70706 L
171.27213 42.70706 L
171.17802 42.61294 L
171.08419 42.51883 L
171.08419 42.42501 L
171.08419 42.33090 L
171.08419 42.23707 L
171.17802 42.14324 L
171.27213 42.14324 L
171.36624 42.14324 L
171.46006 42.14324 L
@c
F
@rax %Note: Object
169.95685 42.14324 170.52038 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
170.33272 42.14324 m
170.33272 42.23707 L
170.42655 42.33090 L
170.52038 42.42501 L
170.52038 42.42501 L
170.42655 42.51883 L
170.33272 42.61294 L
170.23861 42.70706 L
170.23861 42.70706 L
170.14507 42.70706 L
170.05096 42.61294 L
169.95685 42.51883 L
169.95685 42.42501 L
169.95685 42.33090 L
169.95685 42.23707 L
170.05096 42.14324 L
170.14507 42.14324 L
170.23861 42.14324 L
170.33272 42.14324 L
@c
F
@rax %Note: Object
168.82951 42.14324 169.39332 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
169.20539 42.14324 m
169.20539 42.23707 L
169.29950 42.33090 L
169.39332 42.42501 L
169.39332 42.42501 L
169.29950 42.51883 L
169.20539 42.61294 L
169.11156 42.70706 L
169.11156 42.70706 L
169.01773 42.70706 L
168.92362 42.61294 L
168.82951 42.51883 L
168.82951 42.42501 L
168.82951 42.33090 L
168.82951 42.23707 L
168.92362 42.14324 L
169.01773 42.14324 L
169.11156 42.14324 L
169.20539 42.14324 L
@c
F
@rax %Note: Object
167.70217 42.14324 168.26598 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
168.07805 42.14324 m
168.07805 42.23707 L
168.17187 42.33090 L
168.26598 42.42501 L
168.26598 42.42501 L
168.17187 42.51883 L
168.07805 42.61294 L
167.98422 42.70706 L
167.98422 42.70706 L
167.89011 42.70706 L
167.79600 42.61294 L
167.70217 42.51883 L
167.70217 42.42501 L
167.70217 42.33090 L
167.70217 42.23707 L
167.79600 42.14324 L
167.89011 42.14324 L
167.98422 42.14324 L
168.07805 42.14324 L
@c
F
@rax %Note: Object
166.57512 42.14324 167.13865 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
166.95099 42.14324 m
166.95099 42.23707 L
167.04482 42.33090 L
167.13865 42.42501 L
167.13865 42.42501 L
167.04482 42.51883 L
166.95099 42.61294 L
166.85717 42.70706 L
166.85717 42.70706 L
166.76277 42.70706 L
166.66894 42.61294 L
166.57512 42.51883 L
166.57512 42.42501 L
166.57512 42.33090 L
166.57512 42.23707 L
166.66894 42.14324 L
166.76277 42.14324 L
166.85717 42.14324 L
166.95099 42.14324 L
@c
F
@rax %Note: Object
165.44778 42.14324 166.01131 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
165.82365 42.14324 m
165.82365 42.23707 L
165.91748 42.33090 L
166.01131 42.42501 L
166.01131 42.42501 L
165.91748 42.51883 L
165.82365 42.61294 L
165.72983 42.70706 L
165.72983 42.70706 L
165.63543 42.70706 L
165.54161 42.61294 L
165.44778 42.51883 L
165.44778 42.42501 L
165.44778 42.33090 L
165.44778 42.23707 L
165.54161 42.14324 L
165.63543 42.14324 L
165.72983 42.14324 L
165.82365 42.14324 L
@c
F
@rax %Note: Object
164.32044 42.14324 164.88397 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
164.69631 42.14324 m
164.69631 42.23707 L
164.79014 42.33090 L
164.88397 42.42501 L
164.88397 42.42501 L
164.79014 42.51883 L
164.69631 42.61294 L
164.60220 42.70706 L
164.60220 42.70706 L
164.50809 42.70706 L
164.41455 42.61294 L
164.32044 42.51883 L
164.32044 42.42501 L
164.32044 42.33090 L
164.32044 42.23707 L
164.41455 42.14324 L
164.50809 42.14324 L
164.60220 42.14324 L
164.69631 42.14324 L
@c
F
@rax %Note: Object
163.19310 42.14324 163.75691 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
163.56898 42.14324 m
163.56898 42.23707 L
163.66309 42.33090 L
163.75691 42.42501 L
163.75691 42.42501 L
163.66309 42.51883 L
163.56898 42.61294 L
163.47487 42.70706 L
163.47487 42.70706 L
163.38104 42.70706 L
163.28721 42.61294 L
163.19310 42.51883 L
163.19310 42.42501 L
163.19310 42.33090 L
163.19310 42.23707 L
163.28721 42.14324 L
163.38104 42.14324 L
163.47487 42.14324 L
163.56898 42.14324 L
@c
F
@rax %Note: Object
162.06576 42.14324 162.62957 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
162.44164 42.14324 m
162.44164 42.23707 L
162.53546 42.33090 L
162.62957 42.42501 L
162.62957 42.42501 L
162.53546 42.51883 L
162.44164 42.61294 L
162.34753 42.70706 L
162.34753 42.70706 L
162.25370 42.70706 L
162.15959 42.61294 L
162.06576 42.51883 L
162.06576 42.42501 L
162.06576 42.33090 L
162.06576 42.23707 L
162.15959 42.14324 L
162.25370 42.14324 L
162.34753 42.14324 L
162.44164 42.14324 L
@c
F
@rax %Note: Object
160.93871 42.14324 161.50224 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
161.31430 42.14324 m
161.31430 42.23707 L
161.40841 42.33090 L
161.50224 42.42501 L
161.50224 42.42501 L
161.40841 42.51883 L
161.31430 42.61294 L
161.22047 42.70706 L
161.22047 42.70706 L
161.12636 42.70706 L
161.03254 42.61294 L
160.93871 42.51883 L
160.93871 42.42501 L
160.93871 42.33090 L
160.93871 42.23707 L
161.03254 42.14324 L
161.12636 42.14324 L
161.22047 42.14324 L
161.31430 42.14324 L
@c
F
@rax %Note: Object
159.81137 42.14324 160.37490 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
160.18696 42.14324 m
160.18696 42.23707 L
160.28107 42.33090 L
160.37490 42.42501 L
160.37490 42.42501 L
160.28107 42.51883 L
160.18696 42.61294 L
160.09313 42.70706 L
160.09313 42.70706 L
159.99902 42.70706 L
159.90520 42.61294 L
159.81137 42.51883 L
159.81137 42.42501 L
159.81137 42.33090 L
159.81137 42.23707 L
159.90520 42.14324 L
159.99902 42.14324 L
160.09313 42.14324 L
160.18696 42.14324 L
@c
F
@rax %Note: Object
158.68403 42.14324 159.24756 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
159.05962 42.14324 m
159.05962 42.23707 L
159.15373 42.33090 L
159.24756 42.42501 L
159.24756 42.42501 L
159.15373 42.51883 L
159.05962 42.61294 L
158.96551 42.70706 L
158.96551 42.70706 L
158.87169 42.70706 L
158.77786 42.61294 L
158.68403 42.51883 L
158.68403 42.42501 L
158.68403 42.33090 L
158.68403 42.23707 L
158.77786 42.14324 L
158.87169 42.14324 L
158.96551 42.14324 L
159.05962 42.14324 L
@c
F
@rax %Note: Object
157.55669 42.14324 158.12050 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
157.93228 42.14324 m
157.93228 42.23707 L
158.02639 42.33090 L
158.12050 42.42501 L
158.12050 42.42501 L
158.02639 42.51883 L
157.93228 42.61294 L
157.83846 42.70706 L
157.83846 42.70706 L
157.74463 42.70706 L
157.65080 42.61294 L
157.55669 42.51883 L
157.55669 42.42501 L
157.55669 42.33090 L
157.55669 42.23707 L
157.65080 42.14324 L
157.74463 42.14324 L
157.83846 42.14324 L
157.93228 42.14324 L
@c
F
@rax %Note: Object
156.42935 42.14324 156.99317 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
156.80494 42.14324 m
156.80494 42.23707 L
156.89906 42.33090 L
156.99317 42.42501 L
156.99317 42.42501 L
156.89906 42.51883 L
156.80494 42.61294 L
156.71112 42.70706 L
156.71112 42.70706 L
156.61729 42.70706 L
156.52318 42.61294 L
156.42935 42.51883 L
156.42935 42.42501 L
156.42935 42.33090 L
156.42935 42.23707 L
156.52318 42.14324 L
156.61729 42.14324 L
156.71112 42.14324 L
156.80494 42.14324 L
@c
F
@rax %Note: Object
155.30202 42.14324 155.86583 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
155.67789 42.14324 m
155.67789 42.23707 L
155.77143 42.33090 L
155.86583 42.42501 L
155.86583 42.42501 L
155.77143 42.51883 L
155.67789 42.61294 L
155.58406 42.70706 L
155.58406 42.70706 L
155.48995 42.70706 L
155.39613 42.61294 L
155.30202 42.51883 L
155.30202 42.42501 L
155.30202 42.33090 L
155.30202 42.23707 L
155.39613 42.14324 L
155.48995 42.14324 L
155.58406 42.14324 L
155.67789 42.14324 L
@c
F
@rax %Note: Object
154.17468 42.14324 154.73820 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
154.55055 42.14324 m
154.55055 42.23707 L
154.64438 42.33090 L
154.73820 42.42501 L
154.73820 42.42501 L
154.64438 42.51883 L
154.55055 42.61294 L
154.45672 42.70706 L
154.45672 42.70706 L
154.36261 42.70706 L
154.26879 42.61294 L
154.17468 42.51883 L
154.17468 42.42501 L
154.17468 42.33090 L
154.17468 42.23707 L
154.26879 42.14324 L
154.36261 42.14324 L
154.45672 42.14324 L
154.55055 42.14324 L
@c
F
@rax %Note: Object
153.04734 42.14324 153.61087 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
153.42321 42.14324 m
153.42321 42.23707 L
153.51704 42.33090 L
153.61087 42.42501 L
153.61087 42.42501 L
153.51704 42.51883 L
153.42321 42.61294 L
153.32910 42.70706 L
153.32910 42.70706 L
153.23528 42.70706 L
153.14145 42.61294 L
153.04734 42.51883 L
153.04734 42.42501 L
153.04734 42.33090 L
153.04734 42.23707 L
153.14145 42.14324 L
153.23528 42.14324 L
153.32910 42.14324 L
153.42321 42.14324 L
@c
F
@rax %Note: Object
151.92000 42.14324 152.48381 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
152.29587 42.14324 m
152.29587 42.23707 L
152.38998 42.33090 L
152.48381 42.42501 L
152.48381 42.42501 L
152.38998 42.51883 L
152.29587 42.61294 L
152.20205 42.70706 L
152.20205 42.70706 L
152.10822 42.70706 L
152.01411 42.61294 L
151.92000 42.51883 L
151.92000 42.42501 L
151.92000 42.33090 L
151.92000 42.23707 L
152.01411 42.14324 L
152.10822 42.14324 L
152.20205 42.14324 L
152.29587 42.14324 L
@c
F
@rax %Note: Object
150.79266 42.14324 151.35647 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
151.16854 42.14324 m
151.16854 42.23707 L
151.26265 42.33090 L
151.35647 42.42501 L
151.35647 42.42501 L
151.26265 42.51883 L
151.16854 42.61294 L
151.07471 42.70706 L
151.07471 42.70706 L
150.98088 42.70706 L
150.88649 42.61294 L
150.79266 42.51883 L
150.79266 42.42501 L
150.79266 42.33090 L
150.79266 42.23707 L
150.88649 42.14324 L
150.98088 42.14324 L
151.07471 42.14324 L
151.16854 42.14324 L
@c
F
@rax %Note: Object
149.66561 42.14324 150.22913 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
150.04120 42.14324 m
150.04120 42.23707 L
150.13502 42.33090 L
150.22913 42.42501 L
150.22913 42.42501 L
150.13502 42.51883 L
150.04120 42.61294 L
149.94737 42.70706 L
149.94737 42.70706 L
149.85354 42.70706 L
149.75943 42.61294 L
149.66561 42.51883 L
149.66561 42.42501 L
149.66561 42.33090 L
149.66561 42.23707 L
149.75943 42.14324 L
149.85354 42.14324 L
149.94737 42.14324 L
150.04120 42.14324 L
@c
F
@rax %Note: Object
148.53827 42.14324 149.10180 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
148.91414 42.14324 m
148.91414 42.23707 L
149.00797 42.33090 L
149.10180 42.42501 L
149.10180 42.42501 L
149.00797 42.51883 L
148.91414 42.61294 L
148.82031 42.70706 L
148.82031 42.70706 L
148.72620 42.70706 L
148.63209 42.61294 L
148.53827 42.51883 L
148.53827 42.42501 L
148.53827 42.33090 L
148.53827 42.23707 L
148.63209 42.14324 L
148.72620 42.14324 L
148.82031 42.14324 L
148.91414 42.14324 L
@c
F
@rax %Note: Object
147.41093 42.14324 147.97446 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
147.78680 42.14324 m
147.78680 42.23707 L
147.88063 42.33090 L
147.97446 42.42501 L
147.97446 42.42501 L
147.88063 42.51883 L
147.78680 42.61294 L
147.69269 42.70706 L
147.69269 42.70706 L
147.59858 42.70706 L
147.50476 42.61294 L
147.41093 42.51883 L
147.41093 42.42501 L
147.41093 42.33090 L
147.41093 42.23707 L
147.50476 42.14324 L
147.59858 42.14324 L
147.69269 42.14324 L
147.78680 42.14324 L
@c
F
@rax %Note: Object
146.28359 42.14324 146.84740 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
146.65946 42.14324 m
146.65946 42.23707 L
146.75357 42.33090 L
146.84740 42.42501 L
146.84740 42.42501 L
146.75357 42.51883 L
146.65946 42.61294 L
146.56564 42.70706 L
146.56564 42.70706 L
146.47153 42.70706 L
146.37770 42.61294 L
146.28359 42.51883 L
146.28359 42.42501 L
146.28359 42.33090 L
146.28359 42.23707 L
146.37770 42.14324 L
146.47153 42.14324 L
146.56564 42.14324 L
146.65946 42.14324 L
@c
F
@rax %Note: Object
145.15625 42.14324 145.72006 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
145.53213 42.14324 m
145.53213 42.23707 L
145.62624 42.33090 L
145.72006 42.42501 L
145.72006 42.42501 L
145.62624 42.51883 L
145.53213 42.61294 L
145.43830 42.70706 L
145.43830 42.70706 L
145.34419 42.70706 L
145.25008 42.61294 L
145.15625 42.51883 L
145.15625 42.42501 L
145.15625 42.33090 L
145.15625 42.23707 L
145.25008 42.14324 L
145.34419 42.14324 L
145.43830 42.14324 L
145.53213 42.14324 L
@c
F
@rax %Note: Object
144.02920 42.14324 144.59272 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
144.40479 42.14324 m
144.40479 42.23707 L
144.49861 42.33090 L
144.59272 42.42501 L
144.59272 42.42501 L
144.49861 42.51883 L
144.40479 42.61294 L
144.31068 42.70706 L
144.31068 42.70706 L
144.21685 42.70706 L
144.12274 42.61294 L
144.02920 42.51883 L
144.02920 42.42501 L
144.02920 42.33090 L
144.02920 42.23707 L
144.12274 42.14324 L
144.21685 42.14324 L
144.31068 42.14324 L
144.40479 42.14324 L
@c
F
@rax %Note: Object
142.90186 42.14324 143.46539 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
143.27773 42.14324 m
143.27773 42.23707 L
143.37156 42.33090 L
143.46539 42.42501 L
143.46539 42.42501 L
143.37156 42.51883 L
143.27773 42.61294 L
143.18362 42.70706 L
143.18362 42.70706 L
143.08951 42.70706 L
142.99569 42.61294 L
142.90186 42.51883 L
142.90186 42.42501 L
142.90186 42.33090 L
142.90186 42.23707 L
142.99569 42.14324 L
143.08951 42.14324 L
143.18362 42.14324 L
143.27773 42.14324 L
@c
F
@rax %Note: Object
141.77452 42.14324 142.33805 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
142.15011 42.14324 m
142.15011 42.23707 L
142.24422 42.33090 L
142.33805 42.42501 L
142.33805 42.42501 L
142.24422 42.51883 L
142.15011 42.61294 L
142.05600 42.70706 L
142.05600 42.70706 L
141.96217 42.70706 L
141.86835 42.61294 L
141.77452 42.51883 L
141.77452 42.42501 L
141.77452 42.33090 L
141.77452 42.23707 L
141.86835 42.14324 L
141.96217 42.14324 L
142.05600 42.14324 L
142.15011 42.14324 L
@c
F
@rax %Note: Object
140.64718 42.14324 141.21071 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
141.02277 42.14324 m
141.02277 42.23707 L
141.11717 42.33090 L
141.21071 42.42501 L
141.21071 42.42501 L
141.11717 42.51883 L
141.02277 42.61294 L
140.92894 42.70706 L
140.92894 42.70706 L
140.83512 42.70706 L
140.74129 42.61294 L
140.64718 42.51883 L
140.64718 42.42501 L
140.64718 42.33090 L
140.64718 42.23707 L
140.74129 42.14324 L
140.83512 42.14324 L
140.92894 42.14324 L
141.02277 42.14324 L
@c
F
@rax %Note: Object
139.51984 42.14324 140.08365 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
139.89543 42.14324 m
139.89543 42.23707 L
139.98983 42.33090 L
140.08365 42.42501 L
140.08365 42.42501 L
139.98983 42.51883 L
139.89543 42.61294 L
139.80161 42.70706 L
139.80161 42.70706 L
139.70778 42.70706 L
139.61395 42.61294 L
139.51984 42.51883 L
139.51984 42.42501 L
139.51984 42.33090 L
139.51984 42.23707 L
139.61395 42.14324 L
139.70778 42.14324 L
139.80161 42.14324 L
139.89543 42.14324 L
@c
F
@rax %Note: Object
138.39250 42.14324 138.95631 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
138.76809 42.14324 m
138.76809 42.23707 L
138.86220 42.33090 L
138.95631 42.42501 L
138.95631 42.42501 L
138.86220 42.51883 L
138.76809 42.61294 L
138.67427 42.70706 L
138.67427 42.70706 L
138.58044 42.70706 L
138.48633 42.61294 L
138.39250 42.51883 L
138.39250 42.42501 L
138.39250 42.33090 L
138.39250 42.23707 L
138.48633 42.14324 L
138.58044 42.14324 L
138.67427 42.14324 L
138.76809 42.14324 L
@c
F
@rax %Note: Object
137.26545 42.14324 137.82898 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
137.64104 42.14324 m
137.64104 42.23707 L
137.73487 42.33090 L
137.82898 42.42501 L
137.82898 42.42501 L
137.73487 42.51883 L
137.64104 42.61294 L
137.54721 42.70706 L
137.54721 42.70706 L
137.45310 42.70706 L
137.35928 42.61294 L
137.26545 42.51883 L
137.26545 42.42501 L
137.26545 42.33090 L
137.26545 42.23707 L
137.35928 42.14324 L
137.45310 42.14324 L
137.54721 42.14324 L
137.64104 42.14324 L
@c
F
@rax %Note: Object
136.13811 42.14324 136.70164 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
136.51370 42.14324 m
136.51370 42.23707 L
136.60753 42.33090 L
136.70164 42.42501 L
136.70164 42.42501 L
136.60753 42.51883 L
136.51370 42.61294 L
136.41959 42.70706 L
136.41959 42.70706 L
136.32576 42.70706 L
136.23194 42.61294 L
136.13811 42.51883 L
136.13811 42.42501 L
136.13811 42.33090 L
136.13811 42.23707 L
136.23194 42.14324 L
136.32576 42.14324 L
136.41959 42.14324 L
136.51370 42.14324 L
@c
F
@rax %Note: Object
135.01049 42.14324 135.57430 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
135.38636 42.14324 m
135.38636 42.23707 L
135.48019 42.33090 L
135.57430 42.42501 L
135.57430 42.42501 L
135.48019 42.51883 L
135.38636 42.61294 L
135.29254 42.70706 L
135.29254 42.70706 L
135.19871 42.70706 L
135.10488 42.61294 L
135.01049 42.51883 L
135.01049 42.42501 L
135.01049 42.33090 L
135.01049 42.23707 L
135.10488 42.14324 L
135.19871 42.14324 L
135.29254 42.14324 L
135.38636 42.14324 L
@c
F
@rax %Note: Object
133.88315 42.14324 134.44696 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
134.25902 42.14324 m
134.25902 42.23707 L
134.35313 42.33090 L
134.44696 42.42501 L
134.44696 42.42501 L
134.35313 42.51883 L
134.25902 42.61294 L
134.16520 42.70706 L
134.16520 42.70706 L
134.07137 42.70706 L
133.97754 42.61294 L
133.88315 42.51883 L
133.88315 42.42501 L
133.88315 42.33090 L
133.88315 42.23707 L
133.97754 42.14324 L
134.07137 42.14324 L
134.16520 42.14324 L
134.25902 42.14324 L
@c
F
@rax %Note: Object
132.75581 42.14324 133.31962 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
133.13169 42.14324 m
133.13169 42.23707 L
133.22551 42.33090 L
133.31962 42.42501 L
133.31962 42.42501 L
133.22551 42.51883 L
133.13169 42.61294 L
133.03786 42.70706 L
133.03786 42.70706 L
132.94403 42.70706 L
132.84992 42.61294 L
132.75581 42.51883 L
132.75581 42.42501 L
132.75581 42.33090 L
132.75581 42.23707 L
132.84992 42.14324 L
132.94403 42.14324 L
133.03786 42.14324 L
133.13169 42.14324 L
@c
F
@rax %Note: Object
131.62876 42.14324 132.19228 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
132.00463 42.14324 m
132.00463 42.23707 L
132.09846 42.33090 L
132.19228 42.42501 L
132.19228 42.42501 L
132.09846 42.51883 L
132.00463 42.61294 L
131.91080 42.70706 L
131.91080 42.70706 L
131.81669 42.70706 L
131.72258 42.61294 L
131.62876 42.51883 L
131.62876 42.42501 L
131.62876 42.33090 L
131.62876 42.23707 L
131.72258 42.14324 L
131.81669 42.14324 L
131.91080 42.14324 L
132.00463 42.14324 L
@c
F
@rax %Note: Object
130.50142 42.14324 131.06494 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
130.87729 42.14324 m
130.87729 42.23707 L
130.97112 42.33090 L
131.06494 42.42501 L
131.06494 42.42501 L
130.97112 42.51883 L
130.87729 42.61294 L
130.78318 42.70706 L
130.78318 42.70706 L
130.68935 42.70706 L
130.59524 42.61294 L
130.50142 42.51883 L
130.50142 42.42501 L
130.50142 42.33090 L
130.50142 42.23707 L
130.59524 42.14324 L
130.68935 42.14324 L
130.78318 42.14324 L
130.87729 42.14324 L
@c
F
@rax %Note: Object
129.37408 42.14324 129.93761 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
129.74995 42.14324 m
129.74995 42.23707 L
129.84378 42.33090 L
129.93761 42.42501 L
129.93761 42.42501 L
129.84378 42.51883 L
129.74995 42.61294 L
129.65584 42.70706 L
129.65584 42.70706 L
129.56230 42.70706 L
129.46819 42.61294 L
129.37408 42.51883 L
129.37408 42.42501 L
129.37408 42.33090 L
129.37408 42.23707 L
129.46819 42.14324 L
129.56230 42.14324 L
129.65584 42.14324 L
129.74995 42.14324 L
@c
F
@rax %Note: Object
128.24674 42.14324 128.81055 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
128.62261 42.14324 m
128.62261 42.23707 L
128.71672 42.33090 L
128.81055 42.42501 L
128.81055 42.42501 L
128.71672 42.51883 L
128.62261 42.61294 L
128.52879 42.70706 L
128.52879 42.70706 L
128.43468 42.70706 L
128.34085 42.61294 L
128.24674 42.51883 L
128.24674 42.42501 L
128.24674 42.33090 L
128.24674 42.23707 L
128.34085 42.14324 L
128.43468 42.14324 L
128.52879 42.14324 L
128.62261 42.14324 L
@c
F
@rax %Note: Object
127.11940 42.14324 127.68321 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
127.49528 42.14324 m
127.49528 42.23707 L
127.58910 42.33090 L
127.68321 42.42501 L
127.68321 42.42501 L
127.58910 42.51883 L
127.49528 42.61294 L
127.40145 42.70706 L
127.40145 42.70706 L
127.30734 42.70706 L
127.21323 42.61294 L
127.11940 42.51883 L
127.11940 42.42501 L
127.11940 42.33090 L
127.11940 42.23707 L
127.21323 42.14324 L
127.30734 42.14324 L
127.40145 42.14324 L
127.49528 42.14324 L
@c
F
@rax %Note: Object
125.99235 42.14324 126.55587 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
126.36822 42.14324 m
126.36822 42.23707 L
126.46205 42.33090 L
126.55587 42.42501 L
126.55587 42.42501 L
126.46205 42.51883 L
126.36822 42.61294 L
126.27411 42.70706 L
126.27411 42.70706 L
126.18000 42.70706 L
126.08617 42.61294 L
125.99235 42.51883 L
125.99235 42.42501 L
125.99235 42.33090 L
125.99235 42.23707 L
126.08617 42.14324 L
126.18000 42.14324 L
126.27411 42.14324 L
126.36822 42.14324 L
@c
F
@rax %Note: Object
124.86501 42.14324 125.42854 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
125.24088 42.14324 m
125.24088 42.23707 L
125.33471 42.33090 L
125.42854 42.42501 L
125.42854 42.42501 L
125.33471 42.51883 L
125.24088 42.61294 L
125.14677 42.70706 L
125.14677 42.70706 L
125.05266 42.70706 L
124.95883 42.61294 L
124.86501 42.51883 L
124.86501 42.42501 L
124.86501 42.33090 L
124.86501 42.23707 L
124.95883 42.14324 L
125.05266 42.14324 L
125.14677 42.14324 L
125.24088 42.14324 L
@c
F
@rax %Note: Object
123.73767 42.14324 124.30120 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
124.11354 42.14324 m
124.11354 42.23707 L
124.20737 42.33090 L
124.30120 42.42501 L
124.30120 42.42501 L
124.20737 42.51883 L
124.11354 42.61294 L
124.01915 42.70706 L
124.01915 42.70706 L
123.92532 42.70706 L
123.83150 42.61294 L
123.73767 42.51883 L
123.73767 42.42501 L
123.73767 42.33090 L
123.73767 42.23707 L
123.83150 42.14324 L
123.92532 42.14324 L
124.01915 42.14324 L
124.11354 42.14324 L
@c
F
@rax %Note: Object
122.61033 42.14324 123.17414 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
122.98620 42.14324 m
122.98620 42.23707 L
123.08031 42.33090 L
123.17414 42.42501 L
123.17414 42.42501 L
123.08031 42.51883 L
122.98620 42.61294 L
122.89209 42.70706 L
122.89209 42.70706 L
122.79827 42.70706 L
122.70444 42.61294 L
122.61033 42.51883 L
122.61033 42.42501 L
122.61033 42.33090 L
122.61033 42.23707 L
122.70444 42.14324 L
122.79827 42.14324 L
122.89209 42.14324 L
122.98620 42.14324 L
@c
F
@rax %Note: Object
121.48299 42.14324 122.04680 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
121.85858 42.14324 m
121.85858 42.23707 L
121.95269 42.33090 L
122.04680 42.42501 L
122.04680 42.42501 L
121.95269 42.51883 L
121.85858 42.61294 L
121.76476 42.70706 L
121.76476 42.70706 L
121.67093 42.70706 L
121.57682 42.61294 L
121.48299 42.51883 L
121.48299 42.42501 L
121.48299 42.33090 L
121.48299 42.23707 L
121.57682 42.14324 L
121.67093 42.14324 L
121.76476 42.14324 L
121.85858 42.14324 L
@c
F
@rax %Note: Object
120.35594 42.14324 120.91946 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
120.73153 42.14324 m
120.73153 42.23707 L
120.82564 42.33090 L
120.91946 42.42501 L
120.91946 42.42501 L
120.82564 42.51883 L
120.73153 42.61294 L
120.63770 42.70706 L
120.63770 42.70706 L
120.54359 42.70706 L
120.44976 42.61294 L
120.35594 42.51883 L
120.35594 42.42501 L
120.35594 42.33090 L
120.35594 42.23707 L
120.44976 42.14324 L
120.54359 42.14324 L
120.63770 42.14324 L
120.73153 42.14324 L
@c
F
@rax %Note: Object
119.22860 42.14324 119.79213 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
119.60419 42.14324 m
119.60419 42.23707 L
119.69830 42.33090 L
119.79213 42.42501 L
119.79213 42.42501 L
119.69830 42.51883 L
119.60419 42.61294 L
119.51036 42.70706 L
119.51036 42.70706 L
119.41625 42.70706 L
119.32243 42.61294 L
119.22860 42.51883 L
119.22860 42.42501 L
119.22860 42.33090 L
119.22860 42.23707 L
119.32243 42.14324 L
119.41625 42.14324 L
119.51036 42.14324 L
119.60419 42.14324 L
@c
F
@rax %Note: Object
118.10126 42.14324 118.66479 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
118.47685 42.14324 m
118.47685 42.23707 L
118.57068 42.33090 L
118.66479 42.42501 L
118.66479 42.42501 L
118.57068 42.51883 L
118.47685 42.61294 L
118.38274 42.70706 L
118.38274 42.70706 L
118.28891 42.70706 L
118.19509 42.61294 L
118.10126 42.51883 L
118.10126 42.42501 L
118.10126 42.33090 L
118.10126 42.23707 L
118.19509 42.14324 L
118.28891 42.14324 L
118.38274 42.14324 L
118.47685 42.14324 L
@c
F
@rax %Note: Object
116.97392 42.14324 117.53773 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
117.34951 42.14324 m
117.34951 42.23707 L
117.44362 42.33090 L
117.53773 42.42501 L
117.53773 42.42501 L
117.44362 42.51883 L
117.34951 42.61294 L
117.25569 42.70706 L
117.25569 42.70706 L
117.16186 42.70706 L
117.06803 42.61294 L
116.97392 42.51883 L
116.97392 42.42501 L
116.97392 42.33090 L
116.97392 42.23707 L
117.06803 42.14324 L
117.16186 42.14324 L
117.25569 42.14324 L
117.34951 42.14324 L
@c
F
@rax %Note: Object
115.84658 42.14324 116.41039 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
116.22217 42.14324 m
116.22217 42.23707 L
116.31600 42.33090 L
116.41039 42.42501 L
116.41039 42.42501 L
116.31600 42.51883 L
116.22217 42.61294 L
116.12835 42.70706 L
116.12835 42.70706 L
116.03452 42.70706 L
115.94041 42.61294 L
115.84658 42.51883 L
115.84658 42.42501 L
115.84658 42.33090 L
115.84658 42.23707 L
115.94041 42.14324 L
116.03452 42.14324 L
116.12835 42.14324 L
116.22217 42.14324 L
@c
F
@rax %Note: Object
114.71924 42.14324 115.28277 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
115.09483 42.14324 m
115.09483 42.23707 L
115.18866 42.33090 L
115.28277 42.42501 L
115.28277 42.42501 L
115.18866 42.51883 L
115.09483 42.61294 L
115.00129 42.70706 L
115.00129 42.70706 L
114.90718 42.70706 L
114.81335 42.61294 L
114.71924 42.51883 L
114.71924 42.42501 L
114.71924 42.33090 L
114.71924 42.23707 L
114.81335 42.14324 L
114.90718 42.14324 L
115.00129 42.14324 L
115.09483 42.14324 L
@c
F
@rax %Note: Object
113.59191 42.14324 114.15543 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
113.96778 42.14324 m
113.96778 42.23707 L
114.06161 42.33090 L
114.15543 42.42501 L
114.15543 42.42501 L
114.06161 42.51883 L
113.96778 42.61294 L
113.87395 42.70706 L
113.87395 42.70706 L
113.77984 42.70706 L
113.68602 42.61294 L
113.59191 42.51883 L
113.59191 42.42501 L
113.59191 42.33090 L
113.59191 42.23707 L
113.68602 42.14324 L
113.77984 42.14324 L
113.87395 42.14324 L
113.96778 42.14324 L
@c
F
@rax %Note: Object
112.46457 42.14324 113.02809 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
112.84044 42.14324 m
112.84044 42.23707 L
112.93427 42.33090 L
113.02809 42.42501 L
113.02809 42.42501 L
112.93427 42.51883 L
112.84044 42.61294 L
112.74633 42.70706 L
112.74633 42.70706 L
112.65250 42.70706 L
112.55868 42.61294 L
112.46457 42.51883 L
112.46457 42.42501 L
112.46457 42.33090 L
112.46457 42.23707 L
112.55868 42.14324 L
112.65250 42.14324 L
112.74633 42.14324 L
112.84044 42.14324 L
@c
F
@rax %Note: Object
111.33723 42.14324 111.90104 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
111.71310 42.14324 m
111.71310 42.23707 L
111.80721 42.33090 L
111.90104 42.42501 L
111.90104 42.42501 L
111.80721 42.51883 L
111.71310 42.61294 L
111.61928 42.70706 L
111.61928 42.70706 L
111.52545 42.70706 L
111.43134 42.61294 L
111.33723 42.51883 L
111.33723 42.42501 L
111.33723 42.33090 L
111.33723 42.23707 L
111.43134 42.14324 L
111.52545 42.14324 L
111.61928 42.14324 L
111.71310 42.14324 L
@c
F
@rax %Note: Object
110.20989 42.14324 110.77370 42.70706 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.77370 42.33090 m
110.77370 42.42501 L
110.67987 42.51883 L
110.58576 42.61294 L
110.49194 42.70706 L
110.49194 42.70706 L
110.39811 42.61294 L
110.30372 42.51883 L
110.20989 42.42501 L
110.20989 42.42501 L
110.20989 42.42501 L
110.30372 42.33090 L
110.39811 42.23707 L
110.49194 42.14324 L
110.49194 42.14324 L
110.58576 42.23707 L
110.67987 42.33090 L
110.77370 42.33090 L
@c
F
@rax %Note: Object
110.20989 41.01591 110.77370 41.57943 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.77370 41.20356 m
110.77370 41.29767 L
110.67987 41.39150 L
110.58576 41.48561 L
110.49194 41.57943 L
110.49194 41.57943 L
110.39811 41.48561 L
110.30372 41.39150 L
110.20989 41.29767 L
110.20989 41.29767 L
110.20989 41.29767 L
110.30372 41.20356 L
110.39811 41.10973 L
110.49194 41.01591 L
110.49194 41.01591 L
110.58576 41.10973 L
110.67987 41.20356 L
110.77370 41.20356 L
@c
F
@rax %Note: Object
110.20989 39.88885 110.77370 40.45238 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.77370 40.07650 m
110.77370 40.17033 L
110.67987 40.26444 L
110.58576 40.35855 L
110.49194 40.45238 L
110.49194 40.45238 L
110.39811 40.35855 L
110.30372 40.26444 L
110.20989 40.17033 L
110.20989 40.17033 L
110.20989 40.17033 L
110.30372 40.07650 L
110.39811 39.98268 L
110.49194 39.88885 L
110.49194 39.88885 L
110.58576 39.98268 L
110.67987 40.07650 L
110.77370 40.07650 L
@c
F
@rax %Note: Object
110.20989 38.76123 110.77370 39.32504 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.77370 38.94917 m
110.77370 39.04299 L
110.67987 39.13682 L
110.58576 39.23093 L
110.49194 39.32504 L
110.49194 39.32504 L
110.39811 39.23093 L
110.30372 39.13682 L
110.20989 39.04299 L
110.20989 39.04299 L
110.20989 39.04299 L
110.30372 38.94917 L
110.39811 38.85534 L
110.49194 38.76123 L
110.49194 38.76123 L
110.58576 38.85534 L
110.67987 38.94917 L
110.77370 38.94917 L
@c
F
@rax %Note: Object
110.20989 37.63417 110.77370 38.19770 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.77370 37.82183 m
110.77370 37.91565 L
110.67987 38.00948 L
110.58576 38.10359 L
110.49194 38.19770 L
110.49194 38.19770 L
110.39811 38.10359 L
110.30372 38.00948 L
110.20989 37.91565 L
110.20989 37.91565 L
110.20989 37.91565 L
110.30372 37.82183 L
110.39811 37.72800 L
110.49194 37.63417 L
110.49194 37.63417 L
110.58576 37.72800 L
110.67987 37.82183 L
110.77370 37.82183 L
@c
F
@rax %Note: Object
110.20989 36.50683 110.77370 37.07065 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.77370 36.69449 m
110.77370 36.78860 L
110.67987 36.88243 L
110.58576 36.97625 L
110.49194 37.07065 L
110.49194 37.07065 L
110.39811 36.97625 L
110.30372 36.88243 L
110.20989 36.78860 L
110.20989 36.78860 L
110.20989 36.78860 L
110.30372 36.69449 L
110.39811 36.60066 L
110.49194 36.50683 L
110.49194 36.50683 L
110.58576 36.60066 L
110.67987 36.69449 L
110.77370 36.69449 L
@c
F
@rax %Note: Object
110.20989 35.37921 110.77370 35.94302 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.77370 35.56715 m
110.77370 35.66126 L
110.67987 35.75509 L
110.58576 35.84891 L
110.49194 35.94302 L
110.49194 35.94302 L
110.39811 35.84891 L
110.30372 35.75509 L
110.20989 35.66126 L
110.20989 35.66126 L
110.20989 35.66126 L
110.30372 35.56715 L
110.39811 35.47332 L
110.49194 35.37921 L
110.49194 35.37921 L
110.58576 35.47332 L
110.67987 35.56715 L
110.77370 35.56715 L
@c
F
@rax %Note: Object
110.20989 34.25216 110.77370 34.81540 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
110.77370 34.44009 m
110.77370 34.53392 L
110.67987 34.62803 L
110.58576 34.72186 L
110.49194 34.81540 L
110.49194 34.81540 L
110.39811 34.72186 L
110.30372 34.62803 L
110.20989 34.53392 L
110.20989 34.53392 L
110.20989 34.53392 L
110.30372 34.44009 L
110.39811 34.34627 L
110.49194 34.25216 L
110.49194 34.25216 L
110.58576 34.34627 L
110.67987 34.44009 L
110.77370 34.44009 L
@c
F
@rax %Note: Object
185.83313 39.41887 191.65748 45.33732 @E
0 O 0 @g
0.00 0.00 0.00 1.00 k
/$fm 0 def
185.83313 39.41887 m
191.65748 42.42501 L
185.83313 45.33732 L
185.83313 39.41887 L
@c
F
@rax %Note: Object
22.37443 34.81540 40.50539 49.00082 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
22.37443 34.81540 m
22.37443 49.00082 L
40.50539 49.00082 L
40.50539 34.81540 L
22.37443 34.81540 L
@c
S
@rax 28.10494 38.04973 31.48696 45.54057 @E
[0.00021304 0.00000000 0.00000000 0.00021304 28.10493405 39.51282670] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 31749.00000 z
0 0 (1) @t
T
@rax %Note: Object
24.91115 92.21414 43.04183 106.39928 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
24.91115 92.21414 m
24.91115 106.39928 L
43.04183 106.39928 L
43.04183 92.21414 L
24.91115 92.21414 L
@c
S
@rax 30.64167 95.44791 34.02340 102.93874 @E
[0.00021304 0.00000000 0.00000000 0.00021304 30.64154507 96.91113386] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 31749.00000 z
0 0 (2) @t
T
@rax %Note: Object
20.58973 168.58857 38.72069 182.77370 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
20.58973 168.58857 m
20.58973 182.77370 L
38.72069 182.77370 L
38.72069 168.58857 L
20.58973 168.58857 L
@c
S
@rax 26.31997 171.82261 29.70198 179.31345 @E
[0.00021304 0.00000000 0.00000000 0.00021304 26.32012452 173.28577116] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 31749.00000 z
0 0 (3) @t
T
@rax %Note: Object
19.18063 254.26346 37.31131 268.44860 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
19.18063 254.26346 m
19.18063 268.44860 L
37.31131 268.44860 L
37.31131 254.26346 L
19.18063 254.26346 L
@c
S
@rax 24.91115 257.49723 28.29317 264.98806 @E
[0.00021304 0.00000000 0.00000000 0.00021304 24.91110921 258.96046340] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 31749.00000 z
0 0 (4) @t
T
@rax %Note: Object
18.05329 344.44772 36.18397 358.63257 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
18.05329 344.44772 m
18.05329 358.63257 L
36.18397 358.63257 L
36.18397 344.44772 L
18.05329 344.44772 L
@c
S
@rax 23.78353 347.68148 27.16554 355.17203 @E
[0.00021304 0.00000000 0.00000000 0.00021304 23.78372654 349.14447329] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 31749.00000 z
0 0 (5) @t
T
@rax %Note: Object
20.58973 404.85203 38.72069 419.03717 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
20.58973 404.85203 m
20.58973 419.03717 L
38.72069 419.03717 L
38.72069 404.85203 L
20.58973 404.85203 L
@c
S
@rax 26.31997 408.08580 29.70198 415.57663 @E
[0.00021304 0.00000000 0.00000000 0.00021304 26.32012452 409.54892122] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 31749.00000 z
0 0 (6) @t
T
@rax %Note: Object
22.75030 511.38170 40.88126 525.56712 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
22.75030 511.38170 m
22.75030 525.56712 L
40.88126 525.56712 L
40.88126 511.38170 L
22.75030 511.38170 L
@c
S
@rax 28.48082 514.61575 31.86255 522.10658 @E
[0.00021304 0.00000000 0.00000000 0.00021304 28.48072828 516.07891472] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 31749.00000 z
0 0 (7) @t
T
@rax %Note: Object
56.28756 626.64831 74.41824 640.83373 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
56.28756 626.64831 m
56.28756 640.83373 L
74.41824 640.83373 L
74.41824 626.64831 L
56.28756 626.64831 L
@c
S
@rax 62.01808 629.88208 65.40009 637.37291 @E
[0.00021304 0.00000000 0.00000000 0.00021304 62.01801947 631.34527182] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 31749.00000 z
0 0 (8) @t
T
@rax %Note: Object
56.28756 746.14224 74.41824 760.32737 @E
0 J 0 j [] 0 d 0 R 0 @G
0.00 0.00 0.00 1.00 K
[0.75154114 0.00000000 0.00000000 0.75154114 -174028.05873745 738.38469803] 1 0.74976 0.74976 0.00000 @w
/$fm 0 def
56.28756 746.14224 m
56.28756 760.32737 L
74.41824 760.32737 L
74.41824 746.14224 L
56.28756 746.14224 L
@c
S
@rax 62.01808 749.37600 65.40009 756.86683 @E
[0.00021304 0.00000000 0.00000000 0.00021304 62.01801947 750.83910091] @tm
0 O 0 @g
0.00 0.00 0.00 1.00 k
e
/_R16-TimesNewRoman 31749.00000 z
0 0 (9) @t
T
%%PageTrailer
@rs
@rs
%%Trailer
@EndSysCorelDict
end
%%DocumentSuppliedResources: procset wCorel9Dict 9.0 0
%%+ font TimesNewRoman
%%+ font Verdana
%%+ font Verdana-Bold
%%+ font TimesNewRoman-Bold
%%+ font Symbol
%%EOF
%%EndDocument
@endspecial 4135 3236 a
currentpoint grestore moveto
4135 3236 a 2531 3406 a Fk(Figur)o(e)18
b(7:)24 b(Pr)o(opagation)18 b(example.)2115 3721 y Fm(At)c(the)g
(bottom)i(of)e(Figure)29 b(7,)15 b(update)h(\(1\))e(is)g(applied)i(to)e
(the)h(input)g(XML)2040 3808 y(document)21 b(bib)m(.xml,)f(changing)i
(the)e(publisher)g(element)g(in)g(the)g(speci\002ed)2040
3896 y(XP)o(ath)i(to)f(the)i(ne)n(w)f(publisher)h(element.)33
b(The)21 b(update)i(is)f(then)h(passed)f(to)2040 3983
y(the)16 b(Source)h(operator)g Ff(S)2687 3951 y Fd($)p
Fc(s)p Fd(1)2683 4001 y Fc(bib:xml)2892 3983 y Fm(,)f(which)h
(generates)g(update)h(\(2\))e(by)h(encap-)2040 4070 y(sulating)g(the)g
(input)g(XML)f(update)i(primiti)n(v)o(e)e Fj(up)i Fm(\(1\))e(into)h(a)f
(ChangeT)m(uple)2040 4157 y(update)22 b(with)e Fj(up)p
Fm(,)h Fa($)p Fj(s1)h Fm(and)f(1)g(as)g(its)f Fj(xup)p
Fm(,)h Fj(ucol)h Fm(and)f Fj(id)g Fm(ar)o(gument)g(respec-)2040
4244 y(ti)n(v)o(ely)-5 b(.)47 b(Update)28 b(\(2\))f(is)f(propagated)j
(to)d(the)h(parent)h(operator)g Ff(\036)3798 4213 y Fd($)p
Fc(a)3798 4265 y Fd($)p Fc(s)p Fd(1)p Fc(;book)2040 4332
y Fm(which)22 b(generates)f(a)g(ne)n(w)h(update)g(primiti)n(v)o(e)f
(\(3\).)29 b(Update)22 b(\(3\))f(has)g(a)g(ne)n(w)2040
4419 y Fj(col)15 b Fm(ar)o(gument)h Fa($)p Fj(a)f Fm(which)h(is)f(deri)
n(v)o(ed)g(from)g(the)h Fj(col')f Fm(ar)o(gument)g(in)g(the)g(na)o(v-)
2040 4506 y(igate)21 b(operator)i(itself,)e(and)h(a)g(ne)n(w)g
Fj(pos)g Fm(that)g(is)f(relati)n(v)o(e)h(to)f(the)h(e)o(xtracted)2040
4593 y(element)g(book)h(in)f(the)g(ne)n(w)g(column)h
Fa($)p Fj(a)f Fm(in)g(the)g(output)h(XA)-8 b(T)21 b(table.)31
b(The)2040 4680 y(ar)o(gument)c Fj(id)f Fm(no)n(w)h(has)g(the)g(id)f(v)
n(alue)h(of)f(1)h(that)f(will)g(identify)g(it)g(in)g(the)2040
4767 y(output)31 b(XA)-8 b(T)29 b(table.)56 b(The)30
b(detailed)h(construction)g(of)f(the)g(ne)n(w)g(update)2040
4855 y(primiti)n(v)o(e)19 b(can)g(be)g(found)h(in)f([5].)2115
4942 y(Ne)o(xt)h(the)h(node)h Ff(\036)2603 4910 y Fd($)p
Fc(col)p Fd(11)2603 4963 y($)p Fc(a)p Fd(1)p Fc(;title)2860
4942 y Fm(consumes)g(update)f(\(3\))g(and)g(generates)h(up-)2040
5029 y(date)h(\(4\).)32 b Fj(pos)23 b Fm(does)g(not)g(change)g(since)g
(the)f(ne)n(w)h(update)g(is)f(w)o(orking)h(on)2040 5116
y(the)j(same)f(column.)44 b(Also)25 b(the)h Fj(id)f Fm(in)g(update)i
(\(4\))e(is)g(no)n(w)h(re\003ecting)f(the)2040 5203 y(id)e(of)h(the)f
(tar)o(get)g(tuple)g(in)g(the)h(output)g(XA)-8 b(T)22
b(table.)36 b(Ne)o(xt,)24 b(update)h(\(4\))e(is)2040
5290 y(consumed)i(by)f(the)f(node)h Ff(\036)2792 5259
y Fd($)p Fc(col)p Fd(7)2792 5311 y($)p Fc(a)p Fd(1)p
Fc(;publisher)3196 5290 y Fm(to)f(generate)h(update)g(\(5\).)35
b(The)2040 5378 y(clean-up)28 b(process)g(here)f(remo)o(v)o(es)h
(column)f($a,)i(as)e(it)f(will)g(not)h(be)h(used)p eop
%%Page: 4 4
4 3 bop -152 -69 a Fm(later)21 b(on.)32 b(This)21 b(eliminates)g(the)h
(need)g(to)f(propagate)i(an)f(update)g(into)g(that)-152
19 y(column.)38 b(And)23 b(since)h(this)f(Na)o(vigate)g(operator)h(e)o
(xtracts)g(an)f(element)h(af-)-152 106 y(fected)i(by)g(the)f(update)i
(statement)e(\(publisher\),)j(a)d(ne)n(w)h(update)g(\(5\))g(will)-152
193 y(be)f(generated)h(for)e(that)h(element)g(with)f
Fj(ucol=)h Fa($)p Fj(col11)p Fm(.)42 b(Update)25 b(\(5\))f(has)-152
280 y Fj(pos)k(=)f(Null:publisher)g Fm(\(or)g(publisher)g(in)g(short\))
g(since)g(the)g(element)g(to)-152 367 y(be)i(updated)g(is)f(at)g(the)g
(root)g(in)g(the)g(update)h(column.)52 b(Ne)o(xt)28 b(Join)g(tak)o(es)
-152 454 y(update)c(\(5\))f(and)g(ree)n(v)n(aluates)h(the)f(Join)h
(condition)f(for)g(the)g(tuple)g(with)g(id)-152 542 y(=)29
b(1)g(af)n(fected)g(by)g(the)f(update.)53 b(As)29 b(result)f(of)h
(changing)h(the)f(publisher)-152 629 y(the)23 b(Join)f(condition)h(no)n
(w)g(became)g(true.)33 b(Thus)22 b(the)g(update)h(propagation)-152
716 y(generates)17 b(an)e(insertT)m(uple)g(update)i(\(6\))e(for)g(each)
h(joined)g(tuple.)22 b(In)15 b(this)h(e)o(x-)-152 803
y(ample)21 b(it)e(is)g(one)i(tuple)f(with)f(a)h(ne)n(w)g(id)g(=)f(2.)26
b(W)-6 b(e)20 b(also)g(need)g(to)g(determine)-152 890
y(the)26 b(position)g(of)g(insertion)f(into)h(the)g(output)g(XA)-8
b(T)24 b(table)i(which)g(will)e(be)-152 977 y(1)e(in)g(this)g(case.)33
b(Update)22 b(\(6\))g(is)g(ne)o(xt)g(passed)h(to)f(the)g(lo)n(wer)g(T)
-6 b(agger)23 b(node)-152 1065 y Ff(T)-96 1033 y Fd($)p
Fc(col)p Fd(13)-107 1086 y Fc()p Fd($)p Fc(col)p Fd(11$)p Fc(col)p
Fd(12)p Fc(<=B)r(ook)p 920 1086 V 21 w(Rev)r(iew)q(>)1222
1065 y Fm(which)28 b(generates)g(up-)-152 1152 y(date)21
b(\(7\))f(by)g(applying)i(the)e(tagging)h(pattern)g(to)f(the)g(tuple)g
(to)g(be)h(inserted.)-152 1239 y(The)c(Aggre)o(gate)g(node)g
Ff(Ag)s(g)606 1207 y Fd($)p Fc(col)p Fd(13)794 1239 y
Fm(then)g(tak)o(es)g(the)f(propagated)i(update)g(as)-152
1326 y(input)k(and)g(generates)h(update)f(\(8\).)31 b(This)21
b(is)g(done)h(by)g(taking)g(the)g(content)-152 1413 y(of)f(the)h(aggre)
o(gation)g(column)g Fa($)p Fj(col13)g Fm(for)f(the)g(tuple)g(with)g(id)
g(=)g(1)g(and)h(in-)-152 1500 y(cluding)f(it)e(into)h(an)g(AddEle)f
(update)i(specifying)g(the)e(right)h Fj(pos)p Fm(,)g(which)g(is)-152
1588 y(1)f(here)h(\(meaning)g(inserting)f(at)f(the)h(collection)h(root)
f(at)f(order)i(1\).)-77 1675 y(Finally)g(update)h(\(8\))f(is)f(passed)i
(to)f(the)g(second)i(T)-6 b(agger)20 b(node)h(that)f(gen-)-152
1762 y(erates)15 b(update)i(\(9\))e(by)g(applying)i(the)e(tagging)h
(pattern)f(to)h(the)f(ne)n(wly)g(added)-152 1849 y(element)k(and)g
(modifying)g Fj(pos)g Fm(to)g(be)f Fj(1:Result)p Fm(,)g(i.e.,)f
(referring)i(to)f(the)h(\002rst)-152 1936 y(XML)i(fragment)g(branches)h
(from)e(the)h(Result)f(element.)29 b(The)20 b(\002nal)h(ef)n(fect)-152
2023 y(on)i(the)f(materialized)h(vie)n(w)f(will)f(be)i(the)f(insertion)
h(of)f(a)g Ff(B)t(ook)p 1565 2023 23 4 v 30 w(R)q(ev)s(iew)-152
2111 y Fm(element)e(at)e(position)i(1.)-152 2319 y Fl(4.)100
b(EXPERIMENT)-9 b(AL)26 b(RESUL)-9 b(TS)-77 2427 y Fm(The)21
b(vie)n(w)f(maintainer)i(has)f(been)g(b)o(uilt)f(as)h(an)g(e)o
(xtension)g(of)g(the)g(Rain-)-152 2514 y(bo)n(w)i(query)h(engine)f
([11].)34 b(The)22 b(latter)g(generates)h(the)f(XA)-8
b(T)22 b(algebra)h(tree)-152 2601 y(for)i(a)f(gi)n(v)o(en)i(XQuery)f(e)
o(xpression)h(and)f(then)g(optimizes)g(it.)40 b(Thereafter)m(,)-152
2688 y(we)17 b(ha)o(v)o(e)h(e)o(xtended)g(the)f(e)o(x)o(ecution)h
(engine)g(to)f(initialize)g(all)f(intermediate)-152 2775
y(tables)22 b(and)g(auxiliary)g(information.)31 b(Ne)n(w)21
b(functionality)h(for)f(each)h(alge-)-152 2862 y(bra)d(node)h
(propagates)g(updates.)-152 2950 y(Our)h(e)o(xperiments)h(are)f(based)h
(on)g(XML)f(\002les)f(with)h(a)g(schema)h(as)f(in)g(Fig-)-152
3037 y(ures)j(1)f(and)g(2,)h(and)g(the)f(query)h(e)o(xpression)g(of)f
(our)h(running)g(e)o(xample)g(in)-152 3124 y(Figure)j(3.)49
b(The)27 b(test)g(system)g(w)o(as)h(a)f(Intel\(R\))g(Celeron\(TM\))g
(733MHz)-152 3211 y(processor)m(,)16 b(128M)g(memory)-5
b(,)16 b(running)g(W)m(indo)n(ws2000)g(and)f(Ja)o(v)n(a)g(1.3.0)p
1747 3211 V 27 w(01.)-77 3298 y(Figure)30 b(8)g(sho)n(ws)h(that)f(as)g
(the)g(size)g(of)g(the)h(data)f(\002le)f(increases,)34
b(the)-152 3386 y(cost)26 b(of)g(re-computation)h(increases)f(rapidly)g
(\(linear)f(in)h(the)f(size)h(of)g(the)-152 3473 y(input)f(\002le\),)g
(while)f(the)g(cost)h(of)f(incremental)h(maintenance)h(stays)f(f)o
(airly)-152 3560 y(constant)g(and)g(appears)g(lar)o(gely)f(independent)
j(from)d(the)g(input)h(\002le)e(size.)-152 3647 y(This)e(chart)g(w)o
(as)g(done)h(for)f(the)g(add-element)h(update)f(and)h(40\045)g(selecti)
n(v-)-152 3734 y(ity)15 b(case.)23 b(Other)15 b(e)o(xperiments)h(\(not)
f(sho)n(wn)i(here\))e(con\002rm)h(similar)e(trends)-152
3821 y(for)20 b(other)f(conditions)i(and)f(settings.)25
b(W)-6 b(e)19 b(thus)h(conclude)h(that)e(incremen-)-152
3909 y(tal)d(maintenance)h(is)f(a)f(v)n(aluable)i(technique)h(for)d
(XML)h(vie)n(w)g(maintenance)-152 3996 y(compared)21
b(to)d(re-computation.)95 4132 y
currentpoint currentpoint translate 0.27907 0.27907 scale neg exch
neg exch translate
95 4132 a 95 4132 a
gsave currentpoint currentpoint translate 270 neg rotate neg exch
neg exch translate
95 4132 a @beginspecial 82 @llx 67 @lly 519 @urx 712
@ury 4370 @rwi @clip @setspecial
%%BeginDocument: ./figures/size-exp.eps
%!PS-Adobe-3.0 EPSF-3.0
%%Title: experment2.xls
%%Creator: Windows NT 4.0
%%CreationDate: 17:1 7/2/2001
%%Pages: (atend)
%%BoundingBox: 82 67 519 712
%%LanguageLevel: 2
%%DocumentNeededFonts: (atend)
%%DocumentSuppliedFonts: (atend)
%%EndComments
%%BeginProlog
%%BeginResource: procset NTPSOct95
/NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load def}bd/ed{exch def}
bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill ld/tr/translate
ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n
/newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash ld/g
/setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im
/imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont setfont}bd/SM{cmtx
setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix currentmatrix
def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp eoclip}bd/EA{1
index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put cvn 3 -1
roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop
languagelevel 2 ge}{false}ifelse def end def
%%EndResource
%%EndProlog
%%BeginSetup
[{0
/languagelevel where{pop languagelevel 2 ge}{false}ifelse
{1 dict dup/JobTimeout 4 -1 roll put setuserparams}
{statusdict/setjobtimeout get exec}ifelse
}stopped cleartomark
[{240
/languagelevel where{pop languagelevel 2 ge}{false}ifelse
{1 dict dup/WaitTimeout 4 -1 roll put setuserparams}
{statusdict/waittimeout 3 -1 roll put}ifelse
}stopped cleartomark
/#copies 1 def
[{
%%BeginFeature: *Option1 False
%%EndFeature
} stopped cleartomark
[{
%%BeginFeature: *Option2 False
%%EndFeature
} stopped cleartomark
%%EndSetup
NTPSOct95 begin
%%Page: 1 1
NTPSOct95 /PageSV save put
90 rotate 0 -612 translate
13.059 598.762 translate 72 600 div dup neg scale
0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch itransform translate
n
5625 3826 375 523 B
1 g
f
1 sl
0 g
n
888 889 M
5813 889 L
5813 3505 L
888 3505 L
888 889 L
cp
[24 24 24 24 24 24 24 24 ]0 sd
1 g
gs
n
4925 1 888 2982 CB
n
888 2982 M
5813 2982 L
s
gr
0 g
gs
n
4925 1 888 2982 CB
n
888 2982 M
5813 2982 L
s
gr
1 g
gs
n
4925 1 888 2459 CB
n
888 2459 M
5813 2459 L
s
gr
0 g
gs
n
4925 1 888 2459 CB
n
888 2459 M
5813 2459 L
s
gr
1 g
gs
n
4925 1 888 1935 CB
n
888 1935 M
5813 1935 L
s
gr
0 g
gs
n
4925 1 888 1935 CB
n
888 1935 M
5813 1935 L
s
gr
1 g
gs
n
4925 1 888 1412 CB
n
888 1412 M
5813 1412 L
s
gr
0 g
gs
n
4925 1 888 1412 CB
n
888 1412 M
5813 1412 L
s
gr
1 g
gs
n
4925 1 888 889 CB
n
888 889 M
5813 889 L
s
gr
0 g
gs
n
4925 1 888 889 CB
n
888 889 M
5813 889 L
s
gr
1 setlinecap
8 sl
[]0 sd
0.5 g
n
4925 2616 888 889 B
cp
CM [1 0 0 1 342 490] concat
s
SM
1 sl
0 g
n
888 889 M
888 3505 L
s
n
888 3505 M
929 3505 L
s
n
888 2982 M
929 2982 L
s
n
888 2459 M
929 2459 L
s
n
888 1935 M
929 1935 L
s
n
888 1412 M
929 1412 L
s
n
888 889 M
929 889 L
s
n
888 3505 M
5813 3505 L
s
n
888 3505 M
888 3464 L
s
n
1381 3505 M
1381 3464 L
s
n
1873 3505 M
1873 3464 L
s
n
2366 3505 M
2366 3464 L
s
n
2858 3505 M
2858 3464 L
s
n
3351 3505 M
3351 3464 L
s
n
3843 3505 M
3843 3464 L
s
n
4336 3505 M
4336 3464 L
s
n
4828 3505 M
4828 3464 L
s
n
5321 3505 M
5321 3464 L
s
n
5813 3505 M
5813 3464 L
s
1 j
8 sl
n
1134 3364 M
1627 3260 L
CM [1 0 0 1 342 490] concat
s
SM
n
1627 3260 M
2119 3190 L
CM [1 0 0 1 342 490] concat
s
SM
n
2119 3190 M
2612 3003 L
CM [1 0 0 1 342 490] concat
s
SM
n
2612 3003 M
3104 2883 L
CM [1 0 0 1 342 490] concat
s
SM
n
3104 2883 M
3597 2637 L
CM [1 0 0 1 342 490] concat
s
SM
n
3597 2637 M
4089 2499 L
CM [1 0 0 1 342 490] concat
s
SM
n
4089 2499 M
4582 2078 L
CM [1 0 0 1 342 490] concat
s
SM
n
4582 2078 M
5074 1953 L
CM [1 0 0 1 342 490] concat
s
SM
n
5074 1953 M
5567 1380 L
CM [1 0 0 1 342 490] concat
s
SM
n
1134 3402 M
1627 3447 L
CM [1 0 0 1 342 490] concat
s
SM
n
1627 3447 M
2119 3439 L
CM [1 0 0 1 342 490] concat
s
SM
n
2119 3439 M
2612 3409 L
CM [1 0 0 1 342 490] concat
s
SM
n
2612 3409 M
3104 3422 L
CM [1 0 0 1 342 490] concat
s
SM
n
3104 3422 M
3597 3406 L
CM [1 0 0 1 342 490] concat
s
SM
n
3597 3406 M
4089 3417 L
CM [1 0 0 1 342 490] concat
s
SM
n
4089 3417 M
4582 3417 L
CM [1 0 0 1 342 490] concat
s
SM
n
4582 3417 M
5074 3408 L
CM [1 0 0 1 342 490] concat
s
SM
n
5074 3408 M
5567 3401 L
CM [1 0 0 1 342 490] concat
s
SM
0 j
n
41 41 1113 3343 B
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
n
41 41 1606 3239 B
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
n
41 41 2098 3169 B
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
n
41 41 2591 2982 B
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
n
41 41 3083 2862 B
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
n
41 41 3576 2616 B
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
n
41 41 4068 2478 B
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
n
41 41 4561 2057 B
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
n
41 41 5053 1932 B
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
n
41 41 5546 1359 B
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
1 j
n
1134 3381 M
1155 3402 L
1134 3423 L
1113 3402 L
1134 3381 L
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
n
1627 3426 M
1648 3447 L
1627 3468 L
1606 3447 L
1627 3426 L
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
n
2119 3418 M
2140 3439 L
2119 3460 L
2098 3439 L
2119 3418 L
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
n
2612 3388 M
2633 3409 L
2612 3430 L
2591 3409 L
2612 3388 L
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
n
3104 3401 M
3125 3422 L
3104 3443 L
3083 3422 L
3104 3401 L
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
n
3597 3385 M
3618 3406 L
3597 3427 L
3576 3406 L
3597 3385 L
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
n
4089 3396 M
4110 3417 L
4089 3438 L
4068 3417 L
4089 3396 L
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
n
4582 3396 M
4603 3417 L
4582 3438 L
4561 3417 L
4582 3396 L
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
n
5074 3387 M
5095 3408 L
5074 3429 L
5053 3408 L
5074 3387 L
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
n
5567 3380 M
5588 3401 L
5567 3422 L
5546 3401 L
5567 3380 L
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
%%IncludeFont: Times-Roman
[133 0 0 -133 0 0]/Times-Roman MF
(0)722 3548 MS
(4000)521 3025 MS
(8000)521 2502 MS
(12000)454 1978 MS
(16000)454 1455 MS
(20000)454 932 MS
(10)1067 3744 MS
(20)1560 3744 MS
(30)2052 3744 MS
(40)2545 3744 MS
(50)3037 3744 MS
(60)3530 3744 MS
(70)4022 3744 MS
(80)4515 3744 MS
(90)5007 3744 MS
(100)5467 3744 MS
(File size \(Elements/file\))2377 3982 MS
(Time \(ms\))578 680 MS
n
2041 175 2064 4043 B
1 g
f
0 g
n
2131 4136 M
2298 4136 L
CM [1 0 0 1 342 490] concat
s
SM
0 j
n
41 41 2193 4115 B
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
(re-compute)2329 4181 MS
1 j
n
3046 4136 M
3213 4136 L
CM [1 0 0 1 342 490] concat
s
SM
n
3129 4115 M
3150 4136 L
3129 4157 L
3108 4136 L
3129 4115 L
cp
gs
e
gr
CM [1 0 0 1 342 490] concat
s
SM
(up-propagation)3244 4181 MS
PageSV restore
showpage
%%Trailer
%%DocumentNeededFonts:
%%+ Times-Roman
%%DocumentSuppliedFonts:
end
%%Pages: 1
%%EOF
%%EndDocument
@endspecial 3736 4132 a
currentpoint grestore moveto
3736 4132 a 95 4132 a
currentpoint currentpoint translate 1 0.27907 div 1 0.27907 div scale
neg exch neg exch translate
95 4132
a 129 5291 a Fk(Figur)o(e)g(8:)24 b(P)o(erf)n(ormance)19
b(f)n(or)g(differ)o(ent)f(\002le)g(sizes.)2040 -69 y
Fl(5.)99 b(CONCLUSION)2115 39 y Fm(In)28 b(this)g(paper)g(we)g(propose)
h(an)g(algebraic)f(approach)i(for)e(incremen-)2040 126
y(tal)d(maintenance)h(of)f(XML)g(vie)n(ws)h(de\002ned)g(by)f(the)h
(XQuery)f(language.)2040 214 y(Since)k(the)h(internal)f(data)h(model)f
(of)h(the)f(XA)-8 b(T)29 b(XML)g(algebra)h(we)f(uti-)2040
301 y(lize)24 b(is)g(dif)n(ferent)g(from)g(the)h(XML)f(data)g(model,)i
(we)e(transform)g(updates)2040 388 y(to)c(the)g(XML)f(data)h(into)g
(update)h(primiti)n(v)o(es)e(applied)i(to)f(the)f(internal)h(data)2040
475 y(model.)j(Thereafter)16 b(we)h(designed)h(rules)e(for)h(each)g
(algebra)g(node)g(to)g(prop-)2040 562 y(agate)24 b(updates)h(through)g
(the)e(XA)-8 b(T)23 b(algebra)i(tree)e(up)h(to)g(the)g(result)f(vie)n
(w)-5 b(.)2040 649 y(The)17 b(preliminary)g(results)f(con\002rm)h(that)
f(incremental)h(vie)n(w)g(maintenance)2040 737 y(is)i(indeed)g(f)o
(aster)g(than)h(re-computation)g(in)f(most)g(cases.)2040
824 y Fk(Ackno)o(wledgements.)50 b Fm(W)-6 b(e)27 b(thank)i(Xin)f
(Zhang,)i(Brad)e(Pielech,)i(Brian)2040 911 y(Murphy)-5
b(,)26 b(and)e(all)f(Rainbo)n(w)h(team)g(members)g(at)g(WPI)e(for)h
(pro)o(viding)i(us)2040 998 y(with)19 b(the)g(core)g(Rainbo)n(w)h
(system.)2040 1137 y Fl(6.)99 b(REFERENCES)2077 1247
y Fm([1])38 b(S.)18 b(Abiteboul,)h(J.)g(McHugh,)g(M.)g(Rys,)g(V)-10
b(.)19 b(V)-8 b(assalos,)18 b(and)2202 1334 y(J.)g(W)m(iener)l(.)h
(Incremental)g(Maintenance)i(for)d(Materialized)i(V)l(ie)n(ws)2202
1421 y(o)o(v)o(er)f(Semistructured)g(Data.)g(In)g Fj(Int.)f(Confer)m
(ence)i(on)g(VLDB)p Fm(,)2202 1509 y(pages)g(38\22649,)g(August)f
(1998.)2077 1604 y([2])38 b(M.)19 b(J.)f(Care)o(y)-5
b(,)19 b(J.)f(Kiernan,)h(J.Shanmugasundaram,)i(E.)d(J.)h(Shekita,)2202
1691 y(and)h(S.)d(N.)i(Subramanian.)g(XPERANT)o(O:)e(Middle)n(w)o(are)j
(for)2202 1778 y(Publishing)f(Object-Relational)g(Data)g(as)g(XML)g
(Documents.)g(In)2202 1866 y Fj(The)g(VLDB)e(J)n(ournal)p
Fm(,)j(pages)g(646\226648,)h(2000.)2077 1961 y([3])38
b(L.)18 b(Chen)h(and)h(E.)e(A.)g(Rundensteiner)l(.)i(Aggre)o(gate)g(P)o
(ath)e(Inde)o(x)i(for)2202 2048 y(Incremental)f(W)-6
b(eb)19 b(V)l(ie)n(w)f(Maintenance.)j(In)e Fj(WECWIS)p
Fm(,)f(pages)2202 2135 y(231\226238,)j(June)e(2000.)2077
2231 y([4])38 b(L.)18 b(Chen)h(and)h(E.)e(A.)g(Rundensteiner)l(.)i(A)m
(CE-XQ:)e(A)g(CachE-a)o(w)o(are)2202 2318 y(XQuery)h(Answering)h
(System.)e(In)h Fj(W)-7 b(ebDB)p Fm(,)19 b(pages)h(31\22636,)g(June)
2202 2405 y(2002.)2077 2501 y([5])38 b(M.)19 b(EL-Sayed,)f(L.)g(W)-6
b(ang,)19 b(L.)f(Ding,)h(and)g(E.)f(A.)g(Rundensteiner)l(.)2202
2588 y(An)h(Algebraic)g(Approach)i(for)d(Incremental)i(Maintenance)g
(of)2202 2675 y(Materialized)f(XQuery.)g(T)-5 b(echnical)19
b(report,)g(Computer)h(Science)2202 2762 y(Department,)f(WPI,)e(2002.)j
(in)f(progress.)2077 2858 y([6])38 b(A.)18 b(Gupta)i(and)f(I.)f(S.)g
(Mumick.)i(Maintenance)g(of)f(Materialized)2202 2945
y(V)l(ie)n(ws:)j(Problems,)d(T)-5 b(echniques,)20 b(and)f
(Applications.)g(In)g Fj(IEEE)2202 3032 y(Bulletin)f(on)i(Data)f
(Engineering)o(,)h(18\(2\))p Fm(,)f(pages)h(3\22618,)g(June)f(1995.)
2077 3127 y([7])38 b(A.)18 b(Gupta,)h(I.)f(S.)g(Mumick,)i(and)g(V)-10
b(.)18 b(S.)g(Subrahmanian.)2202 3215 y(Maintaining)i(V)l(ie)n(ws)e
(Incrementally.)i(In)e Fj(SIGMOD)p Fm(,)h(pages)2202
3302 y(157\226166,)i(1993.)2077 3397 y([8])38 b(H.)18
b(A.)h(K)o(uno)g(and)h(E.)e(A.)g(Rundensteiner)l(.)i(Incremental)2202
3484 y(Maintenance)h(of)d(Materialized)i(Object-Oriented)f(V)l(ie)n(ws)
f(in)2202 3572 y(MultiV)l(ie)n(w:)k(Strate)o(gies)d(and)g(Performance)h
(Ev)n(aluation.)f Fj(IEEE)2202 3659 y(T)l(r)o(ansaction)h(on)f(Data)g
(and)h(Knowledg)o(e)g(Engineering)p Fm(,)2202 3746 y
(10\(5\):768\226792,)h(Sep./Oct.)d(1998.)2077 3841 y([9])38
b(M.)19 b(Fernandez)h(and)f(A.)f(Morishima)i(and)g(D.)e(Suciu)h(and)g
(W)-7 b(.)18 b(T)-6 b(an.)2202 3929 y(Publishing)19 b(Relational)g
(Data)g(in)g(XML:)f(the)h(SilkRoute)2202 4016 y(Approach.)h
Fj(IEEE)d(T)l(r)o(ans)i(on)h(Computer)o(s)p Fm(,)f(44\(4\):1\2269,)h
(2001.)2040 4111 y([10])38 b(I.)18 b(T)-6 b(atarino)o(v)h(,)19
b(Z.)f(G.)g(Iv)o(es,)h(A.)f(Y)-10 b(.)19 b(Hale)n(vy)-5
b(,)20 b(and)f(D.)f(S.)g(W)-6 b(eld.)2202 4198 y(Updating)20
b(XML.)e(In)h Fj(SIGMOD)p Fm(,)g(pages)h(413\226424,)g(May)g(2001.)2040
4294 y([11])38 b(X.)18 b(Zhang,)i(M.)e(Mulchandani,)j(S.)d(Christ,)g
(B.)g(Murphy)-5 b(,)20 b(and)g(E.)e(A.)2202 4381 y(Rundensteiner)l(.)i
(Rainbo)n(w:)k(Mapping-Dri)n(v)o(en)d(Xquery)2202 4468
y(Processing)e(System.)g(In)g Fj(Demo)g(Session)h(Pr)m(oceedings)f(of)
2202 4555 y(SIGMOD)p Fm(,)g(page)g(614,)h(2002.)2040
4651 y([12])38 b(X.)18 b(Zhang,)i(B.)e(Pielech,)g(,)g(and)i(E.)e
(Rundensteiner)l(.)i(Hone)o(y)-5 b(,)19 b(I)2202 4738
y(Shrunk)g(the)g(Xquery!-)h(An)f(XML)g(Algebra)g(Optimization)2202
4825 y(Approach.)h(In)f Fj(WIDM)p Fm(,)g(2002)h(to)e(appear)l(.)2040
4921 y([13])38 b(X.)18 b(Zhang)i(and)f(E.)f(Rundensteiner)l(.)i(XA)-8
b(T)l(:)18 b(XML)h(Algebra)g(for)2202 5008 y(Rainbo)n(w)h(System.)e(T)
-5 b(echnical)19 b(Report)g(WPI-CS-TR-02-24,)2202 5095
y(Computer)g(Science)h(Department,)f(WPI,)e(July)i(2002.)p
eop
%%Trailer
end
userdict /end-hook known{end-hook}if
%%EOF